mirror of
https://github.com/rxliuli/apps.apple.com.git
synced 2026-03-23 15:07:38 +01:00
init commit
This commit is contained in:
139
shared/logger/node_modules/@sentry/browser/esm/client.js
generated
vendored
Normal file
139
shared/logger/node_modules/@sentry/browser/esm/client.js
generated
vendored
Normal file
@@ -0,0 +1,139 @@
|
||||
import { BaseClient, SDK_VERSION } from '@sentry/core';
|
||||
import { getSDKSource, logger, createClientReportEnvelope, dsnToString } from '@sentry/utils';
|
||||
import { eventFromException, eventFromMessage } from './eventbuilder.js';
|
||||
import { WINDOW } from './helpers.js';
|
||||
import { BREADCRUMB_INTEGRATION_ID } from './integrations/breadcrumbs.js';
|
||||
import { createUserFeedbackEnvelope } from './userfeedback.js';
|
||||
|
||||
/**
|
||||
* Configuration options for the Sentry Browser SDK.
|
||||
* @see @sentry/types Options for more information.
|
||||
*/
|
||||
|
||||
/**
|
||||
* The Sentry Browser SDK Client.
|
||||
*
|
||||
* @see BrowserOptions for documentation on configuration options.
|
||||
* @see SentryClient for usage documentation.
|
||||
*/
|
||||
class BrowserClient extends BaseClient {
|
||||
/**
|
||||
* Creates a new Browser SDK instance.
|
||||
*
|
||||
* @param options Configuration options for this SDK.
|
||||
*/
|
||||
constructor(options) {
|
||||
const sdkSource = WINDOW.SENTRY_SDK_SOURCE || getSDKSource();
|
||||
|
||||
options._metadata = options._metadata || {};
|
||||
options._metadata.sdk = options._metadata.sdk || {
|
||||
name: 'sentry.javascript.browser',
|
||||
packages: [
|
||||
{
|
||||
name: `${sdkSource}:@sentry/browser`,
|
||||
version: SDK_VERSION,
|
||||
},
|
||||
],
|
||||
version: SDK_VERSION,
|
||||
};
|
||||
|
||||
super(options);
|
||||
|
||||
if (options.sendClientReports && WINDOW.document) {
|
||||
WINDOW.document.addEventListener('visibilitychange', () => {
|
||||
if (WINDOW.document.visibilityState === 'hidden') {
|
||||
this._flushOutcomes();
|
||||
}
|
||||
});
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
eventFromException(exception, hint) {
|
||||
return eventFromException(this._options.stackParser, exception, hint, this._options.attachStacktrace);
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
eventFromMessage(
|
||||
message,
|
||||
// eslint-disable-next-line deprecation/deprecation
|
||||
level = 'info',
|
||||
hint,
|
||||
) {
|
||||
return eventFromMessage(this._options.stackParser, message, level, hint, this._options.attachStacktrace);
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
sendEvent(event, hint) {
|
||||
// We only want to add the sentry event breadcrumb when the user has the breadcrumb integration installed and
|
||||
// activated its `sentry` option.
|
||||
// We also do not want to use the `Breadcrumbs` class here directly, because we do not want it to be included in
|
||||
// bundles, if it is not used by the SDK.
|
||||
// This all sadly is a bit ugly, but we currently don't have a "pre-send" hook on the integrations so we do it this
|
||||
// way for now.
|
||||
const breadcrumbIntegration = this.getIntegrationById(BREADCRUMB_INTEGRATION_ID) ;
|
||||
// We check for definedness of `addSentryBreadcrumb` in case users provided their own integration with id
|
||||
// "Breadcrumbs" that does not have this function.
|
||||
if (breadcrumbIntegration && breadcrumbIntegration.addSentryBreadcrumb) {
|
||||
breadcrumbIntegration.addSentryBreadcrumb(event);
|
||||
}
|
||||
|
||||
super.sendEvent(event, hint);
|
||||
}
|
||||
|
||||
/**
|
||||
* Sends user feedback to Sentry.
|
||||
*/
|
||||
captureUserFeedback(feedback) {
|
||||
if (!this._isEnabled()) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.warn('SDK not enabled, will not capture user feedback.');
|
||||
return;
|
||||
}
|
||||
|
||||
const envelope = createUserFeedbackEnvelope(feedback, {
|
||||
metadata: this.getSdkMetadata(),
|
||||
dsn: this.getDsn(),
|
||||
tunnel: this.getOptions().tunnel,
|
||||
});
|
||||
void this._sendEnvelope(envelope);
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
_prepareEvent(event, hint, scope) {
|
||||
event.platform = event.platform || 'javascript';
|
||||
return super._prepareEvent(event, hint, scope);
|
||||
}
|
||||
|
||||
/**
|
||||
* Sends client reports as an envelope.
|
||||
*/
|
||||
_flushOutcomes() {
|
||||
const outcomes = this._clearOutcomes();
|
||||
|
||||
if (outcomes.length === 0) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.log('No outcomes to send');
|
||||
return;
|
||||
}
|
||||
|
||||
if (!this._dsn) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.log('No dsn provided, will not send outcomes');
|
||||
return;
|
||||
}
|
||||
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.log('Sending outcomes:', outcomes);
|
||||
|
||||
const envelope = createClientReportEnvelope(outcomes, this._options.tunnel && dsnToString(this._dsn));
|
||||
void this._sendEnvelope(envelope);
|
||||
}
|
||||
}
|
||||
|
||||
export { BrowserClient };
|
||||
//# sourceMappingURL=client.js.map
|
||||
304
shared/logger/node_modules/@sentry/browser/esm/eventbuilder.js
generated
vendored
Normal file
304
shared/logger/node_modules/@sentry/browser/esm/eventbuilder.js
generated
vendored
Normal file
@@ -0,0 +1,304 @@
|
||||
import { getCurrentHub } from '@sentry/core';
|
||||
import { addExceptionMechanism, resolvedSyncPromise, isErrorEvent, isDOMError, isDOMException, addExceptionTypeValue, isError, isPlainObject, isEvent, normalizeToSize, extractExceptionKeysForMessage } from '@sentry/utils';
|
||||
|
||||
/**
|
||||
* This function creates an exception from a JavaScript Error
|
||||
*/
|
||||
function exceptionFromError(stackParser, ex) {
|
||||
// Get the frames first since Opera can lose the stack if we touch anything else first
|
||||
const frames = parseStackFrames(stackParser, ex);
|
||||
|
||||
const exception = {
|
||||
type: ex && ex.name,
|
||||
value: extractMessage(ex),
|
||||
};
|
||||
|
||||
if (frames.length) {
|
||||
exception.stacktrace = { frames };
|
||||
}
|
||||
|
||||
if (exception.type === undefined && exception.value === '') {
|
||||
exception.value = 'Unrecoverable error caught';
|
||||
}
|
||||
|
||||
return exception;
|
||||
}
|
||||
|
||||
/**
|
||||
* @hidden
|
||||
*/
|
||||
function eventFromPlainObject(
|
||||
stackParser,
|
||||
exception,
|
||||
syntheticException,
|
||||
isUnhandledRejection,
|
||||
) {
|
||||
const hub = getCurrentHub();
|
||||
const client = hub.getClient();
|
||||
const normalizeDepth = client && client.getOptions().normalizeDepth;
|
||||
|
||||
const event = {
|
||||
exception: {
|
||||
values: [
|
||||
{
|
||||
type: isEvent(exception) ? exception.constructor.name : isUnhandledRejection ? 'UnhandledRejection' : 'Error',
|
||||
value: getNonErrorObjectExceptionValue(exception, { isUnhandledRejection }),
|
||||
},
|
||||
],
|
||||
},
|
||||
extra: {
|
||||
__serialized__: normalizeToSize(exception, normalizeDepth),
|
||||
},
|
||||
};
|
||||
|
||||
if (syntheticException) {
|
||||
const frames = parseStackFrames(stackParser, syntheticException);
|
||||
if (frames.length) {
|
||||
// event.exception.values[0] has been set above
|
||||
(event.exception ).values[0].stacktrace = { frames };
|
||||
}
|
||||
}
|
||||
|
||||
return event;
|
||||
}
|
||||
|
||||
/**
|
||||
* @hidden
|
||||
*/
|
||||
function eventFromError(stackParser, ex) {
|
||||
return {
|
||||
exception: {
|
||||
values: [exceptionFromError(stackParser, ex)],
|
||||
},
|
||||
};
|
||||
}
|
||||
|
||||
/** Parses stack frames from an error */
|
||||
function parseStackFrames(
|
||||
stackParser,
|
||||
ex,
|
||||
) {
|
||||
// Access and store the stacktrace property before doing ANYTHING
|
||||
// else to it because Opera is not very good at providing it
|
||||
// reliably in other circumstances.
|
||||
const stacktrace = ex.stacktrace || ex.stack || '';
|
||||
|
||||
const popSize = getPopSize(ex);
|
||||
|
||||
try {
|
||||
return stackParser(stacktrace, popSize);
|
||||
} catch (e) {
|
||||
// no-empty
|
||||
}
|
||||
|
||||
return [];
|
||||
}
|
||||
|
||||
// Based on our own mapping pattern - https://github.com/getsentry/sentry/blob/9f08305e09866c8bd6d0c24f5b0aabdd7dd6c59c/src/sentry/lang/javascript/errormapping.py#L83-L108
|
||||
const reactMinifiedRegexp = /Minified React error #\d+;/i;
|
||||
|
||||
function getPopSize(ex) {
|
||||
if (ex) {
|
||||
if (typeof ex.framesToPop === 'number') {
|
||||
return ex.framesToPop;
|
||||
}
|
||||
|
||||
if (reactMinifiedRegexp.test(ex.message)) {
|
||||
return 1;
|
||||
}
|
||||
}
|
||||
|
||||
return 0;
|
||||
}
|
||||
|
||||
/**
|
||||
* There are cases where stacktrace.message is an Event object
|
||||
* https://github.com/getsentry/sentry-javascript/issues/1949
|
||||
* In this specific case we try to extract stacktrace.message.error.message
|
||||
*/
|
||||
function extractMessage(ex) {
|
||||
const message = ex && ex.message;
|
||||
if (!message) {
|
||||
return 'No error message';
|
||||
}
|
||||
if (message.error && typeof message.error.message === 'string') {
|
||||
return message.error.message;
|
||||
}
|
||||
return message;
|
||||
}
|
||||
|
||||
/**
|
||||
* Creates an {@link Event} from all inputs to `captureException` and non-primitive inputs to `captureMessage`.
|
||||
* @hidden
|
||||
*/
|
||||
function eventFromException(
|
||||
stackParser,
|
||||
exception,
|
||||
hint,
|
||||
attachStacktrace,
|
||||
) {
|
||||
const syntheticException = (hint && hint.syntheticException) || undefined;
|
||||
const event = eventFromUnknownInput(stackParser, exception, syntheticException, attachStacktrace);
|
||||
addExceptionMechanism(event); // defaults to { type: 'generic', handled: true }
|
||||
event.level = 'error';
|
||||
if (hint && hint.event_id) {
|
||||
event.event_id = hint.event_id;
|
||||
}
|
||||
return resolvedSyncPromise(event);
|
||||
}
|
||||
|
||||
/**
|
||||
* Builds and Event from a Message
|
||||
* @hidden
|
||||
*/
|
||||
function eventFromMessage(
|
||||
stackParser,
|
||||
message,
|
||||
// eslint-disable-next-line deprecation/deprecation
|
||||
level = 'info',
|
||||
hint,
|
||||
attachStacktrace,
|
||||
) {
|
||||
const syntheticException = (hint && hint.syntheticException) || undefined;
|
||||
const event = eventFromString(stackParser, message, syntheticException, attachStacktrace);
|
||||
event.level = level;
|
||||
if (hint && hint.event_id) {
|
||||
event.event_id = hint.event_id;
|
||||
}
|
||||
return resolvedSyncPromise(event);
|
||||
}
|
||||
|
||||
/**
|
||||
* @hidden
|
||||
*/
|
||||
function eventFromUnknownInput(
|
||||
stackParser,
|
||||
exception,
|
||||
syntheticException,
|
||||
attachStacktrace,
|
||||
isUnhandledRejection,
|
||||
) {
|
||||
let event;
|
||||
|
||||
if (isErrorEvent(exception ) && (exception ).error) {
|
||||
// If it is an ErrorEvent with `error` property, extract it to get actual Error
|
||||
const errorEvent = exception ;
|
||||
return eventFromError(stackParser, errorEvent.error );
|
||||
}
|
||||
|
||||
// If it is a `DOMError` (which is a legacy API, but still supported in some browsers) then we just extract the name
|
||||
// and message, as it doesn't provide anything else. According to the spec, all `DOMExceptions` should also be
|
||||
// `Error`s, but that's not the case in IE11, so in that case we treat it the same as we do a `DOMError`.
|
||||
//
|
||||
// https://developer.mozilla.org/en-US/docs/Web/API/DOMError
|
||||
// https://developer.mozilla.org/en-US/docs/Web/API/DOMException
|
||||
// https://webidl.spec.whatwg.org/#es-DOMException-specialness
|
||||
if (isDOMError(exception) || isDOMException(exception )) {
|
||||
const domException = exception ;
|
||||
|
||||
if ('stack' in (exception )) {
|
||||
event = eventFromError(stackParser, exception );
|
||||
} else {
|
||||
const name = domException.name || (isDOMError(domException) ? 'DOMError' : 'DOMException');
|
||||
const message = domException.message ? `${name}: ${domException.message}` : name;
|
||||
event = eventFromString(stackParser, message, syntheticException, attachStacktrace);
|
||||
addExceptionTypeValue(event, message);
|
||||
}
|
||||
if ('code' in domException) {
|
||||
// eslint-disable-next-line deprecation/deprecation
|
||||
event.tags = { ...event.tags, 'DOMException.code': `${domException.code}` };
|
||||
}
|
||||
|
||||
return event;
|
||||
}
|
||||
if (isError(exception)) {
|
||||
// we have a real Error object, do nothing
|
||||
return eventFromError(stackParser, exception);
|
||||
}
|
||||
if (isPlainObject(exception) || isEvent(exception)) {
|
||||
// If it's a plain object or an instance of `Event` (the built-in JS kind, not this SDK's `Event` type), serialize
|
||||
// it manually. This will allow us to group events based on top-level keys which is much better than creating a new
|
||||
// group on any key/value change.
|
||||
const objectException = exception ;
|
||||
event = eventFromPlainObject(stackParser, objectException, syntheticException, isUnhandledRejection);
|
||||
addExceptionMechanism(event, {
|
||||
synthetic: true,
|
||||
});
|
||||
return event;
|
||||
}
|
||||
|
||||
// If none of previous checks were valid, then it means that it's not:
|
||||
// - an instance of DOMError
|
||||
// - an instance of DOMException
|
||||
// - an instance of Event
|
||||
// - an instance of Error
|
||||
// - a valid ErrorEvent (one with an error property)
|
||||
// - a plain Object
|
||||
//
|
||||
// So bail out and capture it as a simple message:
|
||||
event = eventFromString(stackParser, exception , syntheticException, attachStacktrace);
|
||||
addExceptionTypeValue(event, `${exception}`, undefined);
|
||||
addExceptionMechanism(event, {
|
||||
synthetic: true,
|
||||
});
|
||||
|
||||
return event;
|
||||
}
|
||||
|
||||
/**
|
||||
* @hidden
|
||||
*/
|
||||
function eventFromString(
|
||||
stackParser,
|
||||
input,
|
||||
syntheticException,
|
||||
attachStacktrace,
|
||||
) {
|
||||
const event = {
|
||||
message: input,
|
||||
};
|
||||
|
||||
if (attachStacktrace && syntheticException) {
|
||||
const frames = parseStackFrames(stackParser, syntheticException);
|
||||
if (frames.length) {
|
||||
event.exception = {
|
||||
values: [{ value: input, stacktrace: { frames } }],
|
||||
};
|
||||
}
|
||||
}
|
||||
|
||||
return event;
|
||||
}
|
||||
|
||||
function getNonErrorObjectExceptionValue(
|
||||
exception,
|
||||
{ isUnhandledRejection },
|
||||
) {
|
||||
const keys = extractExceptionKeysForMessage(exception);
|
||||
const captureType = isUnhandledRejection ? 'promise rejection' : 'exception';
|
||||
|
||||
// Some ErrorEvent instances do not have an `error` property, which is why they are not handled before
|
||||
// We still want to try to get a decent message for these cases
|
||||
if (isErrorEvent(exception)) {
|
||||
return `Event \`ErrorEvent\` captured as ${captureType} with message \`${exception.message}\``;
|
||||
}
|
||||
|
||||
if (isEvent(exception)) {
|
||||
const className = getObjectClassName(exception);
|
||||
return `Event \`${className}\` (type=${exception.type}) captured as ${captureType}`;
|
||||
}
|
||||
|
||||
return `Object captured as ${captureType} with keys: ${keys}`;
|
||||
}
|
||||
|
||||
function getObjectClassName(obj) {
|
||||
try {
|
||||
const prototype = Object.getPrototypeOf(obj);
|
||||
return prototype ? prototype.constructor.name : undefined;
|
||||
} catch (e) {
|
||||
// ignore errors here
|
||||
}
|
||||
}
|
||||
|
||||
export { eventFromError, eventFromException, eventFromMessage, eventFromPlainObject, eventFromString, eventFromUnknownInput, exceptionFromError, parseStackFrames };
|
||||
//# sourceMappingURL=eventbuilder.js.map
|
||||
154
shared/logger/node_modules/@sentry/browser/esm/helpers.js
generated
vendored
Normal file
154
shared/logger/node_modules/@sentry/browser/esm/helpers.js
generated
vendored
Normal file
@@ -0,0 +1,154 @@
|
||||
import { withScope, captureException } from '@sentry/core';
|
||||
import { GLOBAL_OBJ, getOriginalFunction, markFunctionWrapped, addNonEnumerableProperty, addExceptionTypeValue, addExceptionMechanism } from '@sentry/utils';
|
||||
|
||||
const WINDOW = GLOBAL_OBJ ;
|
||||
|
||||
let ignoreOnError = 0;
|
||||
|
||||
/**
|
||||
* @hidden
|
||||
*/
|
||||
function shouldIgnoreOnError() {
|
||||
return ignoreOnError > 0;
|
||||
}
|
||||
|
||||
/**
|
||||
* @hidden
|
||||
*/
|
||||
function ignoreNextOnError() {
|
||||
// onerror should trigger before setTimeout
|
||||
ignoreOnError++;
|
||||
setTimeout(() => {
|
||||
ignoreOnError--;
|
||||
});
|
||||
}
|
||||
|
||||
/**
|
||||
* Instruments the given function and sends an event to Sentry every time the
|
||||
* function throws an exception.
|
||||
*
|
||||
* @param fn A function to wrap. It is generally safe to pass an unbound function, because the returned wrapper always
|
||||
* has a correct `this` context.
|
||||
* @returns The wrapped function.
|
||||
* @hidden
|
||||
*/
|
||||
function wrap(
|
||||
fn,
|
||||
options
|
||||
|
||||
= {},
|
||||
before,
|
||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any
|
||||
) {
|
||||
// for future readers what this does is wrap a function and then create
|
||||
// a bi-directional wrapping between them.
|
||||
//
|
||||
// example: wrapped = wrap(original);
|
||||
// original.__sentry_wrapped__ -> wrapped
|
||||
// wrapped.__sentry_original__ -> original
|
||||
|
||||
if (typeof fn !== 'function') {
|
||||
return fn;
|
||||
}
|
||||
|
||||
try {
|
||||
// if we're dealing with a function that was previously wrapped, return
|
||||
// the original wrapper.
|
||||
const wrapper = fn.__sentry_wrapped__;
|
||||
if (wrapper) {
|
||||
return wrapper;
|
||||
}
|
||||
|
||||
// We don't wanna wrap it twice
|
||||
if (getOriginalFunction(fn)) {
|
||||
return fn;
|
||||
}
|
||||
} catch (e) {
|
||||
// Just accessing custom props in some Selenium environments
|
||||
// can cause a "Permission denied" exception (see raven-js#495).
|
||||
// Bail on wrapping and return the function as-is (defers to window.onerror).
|
||||
return fn;
|
||||
}
|
||||
|
||||
/* eslint-disable prefer-rest-params */
|
||||
// It is important that `sentryWrapped` is not an arrow function to preserve the context of `this`
|
||||
const sentryWrapped = function () {
|
||||
const args = Array.prototype.slice.call(arguments);
|
||||
|
||||
try {
|
||||
if (before && typeof before === 'function') {
|
||||
before.apply(this, arguments);
|
||||
}
|
||||
|
||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any, @typescript-eslint/no-unsafe-member-access
|
||||
const wrappedArguments = args.map((arg) => wrap(arg, options));
|
||||
|
||||
// Attempt to invoke user-land function
|
||||
// NOTE: If you are a Sentry user, and you are seeing this stack frame, it
|
||||
// means the sentry.javascript SDK caught an error invoking your application code. This
|
||||
// is expected behavior and NOT indicative of a bug with sentry.javascript.
|
||||
return fn.apply(this, wrappedArguments);
|
||||
} catch (ex) {
|
||||
ignoreNextOnError();
|
||||
|
||||
withScope((scope) => {
|
||||
scope.addEventProcessor((event) => {
|
||||
if (options.mechanism) {
|
||||
addExceptionTypeValue(event, undefined, undefined);
|
||||
addExceptionMechanism(event, options.mechanism);
|
||||
}
|
||||
|
||||
event.extra = {
|
||||
...event.extra,
|
||||
arguments: args,
|
||||
};
|
||||
|
||||
return event;
|
||||
});
|
||||
|
||||
captureException(ex);
|
||||
});
|
||||
|
||||
throw ex;
|
||||
}
|
||||
};
|
||||
/* eslint-enable prefer-rest-params */
|
||||
|
||||
// Accessing some objects may throw
|
||||
// ref: https://github.com/getsentry/sentry-javascript/issues/1168
|
||||
try {
|
||||
for (const property in fn) {
|
||||
if (Object.prototype.hasOwnProperty.call(fn, property)) {
|
||||
sentryWrapped[property] = fn[property];
|
||||
}
|
||||
}
|
||||
} catch (_oO) {} // eslint-disable-line no-empty
|
||||
|
||||
// Signal that this function has been wrapped/filled already
|
||||
// for both debugging and to prevent it to being wrapped/filled twice
|
||||
markFunctionWrapped(sentryWrapped, fn);
|
||||
|
||||
addNonEnumerableProperty(fn, '__sentry_wrapped__', sentryWrapped);
|
||||
|
||||
// Restore original function name (not all browsers allow that)
|
||||
try {
|
||||
const descriptor = Object.getOwnPropertyDescriptor(sentryWrapped, 'name') ;
|
||||
if (descriptor.configurable) {
|
||||
Object.defineProperty(sentryWrapped, 'name', {
|
||||
get() {
|
||||
return fn.name;
|
||||
},
|
||||
});
|
||||
}
|
||||
// eslint-disable-next-line no-empty
|
||||
} catch (_oO) {}
|
||||
|
||||
return sentryWrapped;
|
||||
}
|
||||
|
||||
/**
|
||||
* All properties the report dialog supports
|
||||
*/
|
||||
|
||||
export { WINDOW, ignoreNextOnError, shouldIgnoreOnError, wrap };
|
||||
//# sourceMappingURL=helpers.js.map
|
||||
39
shared/logger/node_modules/@sentry/browser/esm/index.js
generated
vendored
Normal file
39
shared/logger/node_modules/@sentry/browser/esm/index.js
generated
vendored
Normal file
@@ -0,0 +1,39 @@
|
||||
import { Integrations } from '@sentry/core';
|
||||
export { FunctionToString, Hub, InboundFilters, SDK_VERSION, Scope, addBreadcrumb, addGlobalEventProcessor, addTracingExtensions, captureEvent, captureException, captureMessage, configureScope, createTransport, extractTraceparentData, getActiveTransaction, getCurrentHub, getHubFromCarrier, makeMain, makeMultiplexedTransport, setContext, setExtra, setExtras, setTag, setTags, setUser, spanStatusfromHttpCode, startTransaction, trace, withScope } from '@sentry/core';
|
||||
import { WINDOW } from './helpers.js';
|
||||
export { WINDOW } from './helpers.js';
|
||||
export { BrowserClient } from './client.js';
|
||||
export { makeFetchTransport } from './transports/fetch.js';
|
||||
export { makeXHRTransport } from './transports/xhr.js';
|
||||
export { chromeStackLineParser, defaultStackLineParsers, defaultStackParser, geckoStackLineParser, opera10StackLineParser, opera11StackLineParser, winjsStackLineParser } from './stack-parsers.js';
|
||||
export { eventFromException, eventFromMessage } from './eventbuilder.js';
|
||||
export { createUserFeedbackEnvelope } from './userfeedback.js';
|
||||
export { captureUserFeedback, close, defaultIntegrations, flush, forceLoad, init, lastEventId, onLoad, showReportDialog, wrap } from './sdk.js';
|
||||
import * as index from './integrations/index.js';
|
||||
export { Replay } from '@sentry/replay';
|
||||
export { BrowserTracing, defaultRequestInstrumentationOptions, instrumentOutgoingRequests } from '@sentry-internal/tracing';
|
||||
export { makeBrowserOfflineTransport } from './transports/offline.js';
|
||||
export { onProfilingStartRouteTransaction } from './profiling/hubextensions.js';
|
||||
export { BrowserProfilingIntegration } from './profiling/integration.js';
|
||||
export { GlobalHandlers } from './integrations/globalhandlers.js';
|
||||
export { TryCatch } from './integrations/trycatch.js';
|
||||
export { Breadcrumbs } from './integrations/breadcrumbs.js';
|
||||
export { LinkedErrors } from './integrations/linkederrors.js';
|
||||
export { HttpContext } from './integrations/httpcontext.js';
|
||||
export { Dedupe } from './integrations/dedupe.js';
|
||||
|
||||
let windowIntegrations = {};
|
||||
|
||||
// This block is needed to add compatibility with the integrations packages when used with a CDN
|
||||
if (WINDOW.Sentry && WINDOW.Sentry.Integrations) {
|
||||
windowIntegrations = WINDOW.Sentry.Integrations;
|
||||
}
|
||||
|
||||
const INTEGRATIONS = {
|
||||
...windowIntegrations,
|
||||
...Integrations,
|
||||
...index,
|
||||
};
|
||||
|
||||
export { INTEGRATIONS as Integrations };
|
||||
//# sourceMappingURL=index.js.map
|
||||
320
shared/logger/node_modules/@sentry/browser/esm/integrations/breadcrumbs.js
generated
vendored
Normal file
320
shared/logger/node_modules/@sentry/browser/esm/integrations/breadcrumbs.js
generated
vendored
Normal file
@@ -0,0 +1,320 @@
|
||||
import { getCurrentHub } from '@sentry/core';
|
||||
import { addInstrumentationHandler, getEventDescription, severityLevelFromString, safeJoin, SENTRY_XHR_DATA_KEY, parseUrl, logger, htmlTreeAsString } from '@sentry/utils';
|
||||
import { WINDOW } from '../helpers.js';
|
||||
|
||||
/* eslint-disable @typescript-eslint/no-unsafe-member-access */
|
||||
|
||||
/** maxStringLength gets capped to prevent 100 breadcrumbs exceeding 1MB event payload size */
|
||||
const MAX_ALLOWED_STRING_LENGTH = 1024;
|
||||
|
||||
const BREADCRUMB_INTEGRATION_ID = 'Breadcrumbs';
|
||||
|
||||
/**
|
||||
* Default Breadcrumbs instrumentations
|
||||
* TODO: Deprecated - with v6, this will be renamed to `Instrument`
|
||||
*/
|
||||
class Breadcrumbs {
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
static __initStatic() {this.id = BREADCRUMB_INTEGRATION_ID;}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
__init() {this.name = Breadcrumbs.id;}
|
||||
|
||||
/**
|
||||
* Options of the breadcrumbs integration.
|
||||
*/
|
||||
// This field is public, because we use it in the browser client to check if the `sentry` option is enabled.
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
constructor(options) {Breadcrumbs.prototype.__init.call(this);
|
||||
this.options = {
|
||||
console: true,
|
||||
dom: true,
|
||||
fetch: true,
|
||||
history: true,
|
||||
sentry: true,
|
||||
xhr: true,
|
||||
...options,
|
||||
};
|
||||
}
|
||||
|
||||
/**
|
||||
* Instrument browser built-ins w/ breadcrumb capturing
|
||||
* - Console API
|
||||
* - DOM API (click/typing)
|
||||
* - XMLHttpRequest API
|
||||
* - Fetch API
|
||||
* - History API
|
||||
*/
|
||||
setupOnce() {
|
||||
if (this.options.console) {
|
||||
addInstrumentationHandler('console', _consoleBreadcrumb);
|
||||
}
|
||||
if (this.options.dom) {
|
||||
addInstrumentationHandler('dom', _domBreadcrumb(this.options.dom));
|
||||
}
|
||||
if (this.options.xhr) {
|
||||
addInstrumentationHandler('xhr', _xhrBreadcrumb);
|
||||
}
|
||||
if (this.options.fetch) {
|
||||
addInstrumentationHandler('fetch', _fetchBreadcrumb);
|
||||
}
|
||||
if (this.options.history) {
|
||||
addInstrumentationHandler('history', _historyBreadcrumb);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Adds a breadcrumb for Sentry events or transactions if this option is enabled.
|
||||
*/
|
||||
addSentryBreadcrumb(event) {
|
||||
if (this.options.sentry) {
|
||||
getCurrentHub().addBreadcrumb(
|
||||
{
|
||||
category: `sentry.${event.type === 'transaction' ? 'transaction' : 'event'}`,
|
||||
event_id: event.event_id,
|
||||
level: event.level,
|
||||
message: getEventDescription(event),
|
||||
},
|
||||
{
|
||||
event,
|
||||
},
|
||||
);
|
||||
}
|
||||
}
|
||||
} Breadcrumbs.__initStatic();
|
||||
|
||||
/**
|
||||
* A HOC that creaes a function that creates breadcrumbs from DOM API calls.
|
||||
* This is a HOC so that we get access to dom options in the closure.
|
||||
*/
|
||||
function _domBreadcrumb(dom) {
|
||||
function _innerDomBreadcrumb(handlerData) {
|
||||
let target;
|
||||
let keyAttrs = typeof dom === 'object' ? dom.serializeAttribute : undefined;
|
||||
|
||||
let maxStringLength =
|
||||
typeof dom === 'object' && typeof dom.maxStringLength === 'number' ? dom.maxStringLength : undefined;
|
||||
if (maxStringLength && maxStringLength > MAX_ALLOWED_STRING_LENGTH) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) &&
|
||||
logger.warn(
|
||||
`\`dom.maxStringLength\` cannot exceed ${MAX_ALLOWED_STRING_LENGTH}, but a value of ${maxStringLength} was configured. Sentry will use ${MAX_ALLOWED_STRING_LENGTH} instead.`,
|
||||
);
|
||||
maxStringLength = MAX_ALLOWED_STRING_LENGTH;
|
||||
}
|
||||
|
||||
if (typeof keyAttrs === 'string') {
|
||||
keyAttrs = [keyAttrs];
|
||||
}
|
||||
|
||||
// Accessing event.target can throw (see getsentry/raven-js#838, #768)
|
||||
try {
|
||||
const event = handlerData.event ;
|
||||
target = _isEvent(event)
|
||||
? htmlTreeAsString(event.target, { keyAttrs, maxStringLength })
|
||||
: htmlTreeAsString(event, { keyAttrs, maxStringLength });
|
||||
} catch (e) {
|
||||
target = '<unknown>';
|
||||
}
|
||||
|
||||
if (target.length === 0) {
|
||||
return;
|
||||
}
|
||||
|
||||
getCurrentHub().addBreadcrumb(
|
||||
{
|
||||
category: `ui.${handlerData.name}`,
|
||||
message: target,
|
||||
},
|
||||
{
|
||||
event: handlerData.event,
|
||||
name: handlerData.name,
|
||||
global: handlerData.global,
|
||||
},
|
||||
);
|
||||
}
|
||||
|
||||
return _innerDomBreadcrumb;
|
||||
}
|
||||
|
||||
/**
|
||||
* Creates breadcrumbs from console API calls
|
||||
*/
|
||||
function _consoleBreadcrumb(handlerData) {
|
||||
// This is a hack to fix a Vue3-specific bug that causes an infinite loop of
|
||||
// console warnings. This happens when a Vue template is rendered with
|
||||
// an undeclared variable, which we try to stringify, ultimately causing
|
||||
// Vue to issue another warning which repeats indefinitely.
|
||||
// see: https://github.com/getsentry/sentry-javascript/pull/6010
|
||||
// see: https://github.com/getsentry/sentry-javascript/issues/5916
|
||||
for (let i = 0; i < handlerData.args.length; i++) {
|
||||
if (handlerData.args[i] === 'ref=Ref<') {
|
||||
handlerData.args[i + 1] = 'viewRef';
|
||||
break;
|
||||
}
|
||||
}
|
||||
const breadcrumb = {
|
||||
category: 'console',
|
||||
data: {
|
||||
arguments: handlerData.args,
|
||||
logger: 'console',
|
||||
},
|
||||
level: severityLevelFromString(handlerData.level),
|
||||
message: safeJoin(handlerData.args, ' '),
|
||||
};
|
||||
|
||||
if (handlerData.level === 'assert') {
|
||||
if (handlerData.args[0] === false) {
|
||||
breadcrumb.message = `Assertion failed: ${safeJoin(handlerData.args.slice(1), ' ') || 'console.assert'}`;
|
||||
breadcrumb.data.arguments = handlerData.args.slice(1);
|
||||
} else {
|
||||
// Don't capture a breadcrumb for passed assertions
|
||||
return;
|
||||
}
|
||||
}
|
||||
|
||||
getCurrentHub().addBreadcrumb(breadcrumb, {
|
||||
input: handlerData.args,
|
||||
level: handlerData.level,
|
||||
});
|
||||
}
|
||||
|
||||
/**
|
||||
* Creates breadcrumbs from XHR API calls
|
||||
*/
|
||||
function _xhrBreadcrumb(handlerData) {
|
||||
const { startTimestamp, endTimestamp } = handlerData;
|
||||
|
||||
const sentryXhrData = handlerData.xhr[SENTRY_XHR_DATA_KEY];
|
||||
|
||||
// We only capture complete, non-sentry requests
|
||||
if (!startTimestamp || !endTimestamp || !sentryXhrData) {
|
||||
return;
|
||||
}
|
||||
|
||||
const { method, url, status_code, body } = sentryXhrData;
|
||||
|
||||
const data = {
|
||||
method,
|
||||
url,
|
||||
status_code,
|
||||
};
|
||||
|
||||
const hint = {
|
||||
xhr: handlerData.xhr,
|
||||
input: body,
|
||||
startTimestamp,
|
||||
endTimestamp,
|
||||
};
|
||||
|
||||
getCurrentHub().addBreadcrumb(
|
||||
{
|
||||
category: 'xhr',
|
||||
data,
|
||||
type: 'http',
|
||||
},
|
||||
hint,
|
||||
);
|
||||
}
|
||||
|
||||
/**
|
||||
* Creates breadcrumbs from fetch API calls
|
||||
*/
|
||||
function _fetchBreadcrumb(handlerData) {
|
||||
const { startTimestamp, endTimestamp } = handlerData;
|
||||
|
||||
// We only capture complete fetch requests
|
||||
if (!endTimestamp) {
|
||||
return;
|
||||
}
|
||||
|
||||
if (handlerData.fetchData.url.match(/sentry_key/) && handlerData.fetchData.method === 'POST') {
|
||||
// We will not create breadcrumbs for fetch requests that contain `sentry_key` (internal sentry requests)
|
||||
return;
|
||||
}
|
||||
|
||||
if (handlerData.error) {
|
||||
const data = handlerData.fetchData;
|
||||
const hint = {
|
||||
data: handlerData.error,
|
||||
input: handlerData.args,
|
||||
startTimestamp,
|
||||
endTimestamp,
|
||||
};
|
||||
|
||||
getCurrentHub().addBreadcrumb(
|
||||
{
|
||||
category: 'fetch',
|
||||
data,
|
||||
level: 'error',
|
||||
type: 'http',
|
||||
},
|
||||
hint,
|
||||
);
|
||||
} else {
|
||||
const data = {
|
||||
...handlerData.fetchData,
|
||||
status_code: handlerData.response && handlerData.response.status,
|
||||
};
|
||||
const hint = {
|
||||
input: handlerData.args,
|
||||
response: handlerData.response,
|
||||
startTimestamp,
|
||||
endTimestamp,
|
||||
};
|
||||
getCurrentHub().addBreadcrumb(
|
||||
{
|
||||
category: 'fetch',
|
||||
data,
|
||||
type: 'http',
|
||||
},
|
||||
hint,
|
||||
);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Creates breadcrumbs from history API calls
|
||||
*/
|
||||
function _historyBreadcrumb(handlerData) {
|
||||
let from = handlerData.from;
|
||||
let to = handlerData.to;
|
||||
const parsedLoc = parseUrl(WINDOW.location.href);
|
||||
let parsedFrom = parseUrl(from);
|
||||
const parsedTo = parseUrl(to);
|
||||
|
||||
// Initial pushState doesn't provide `from` information
|
||||
if (!parsedFrom.path) {
|
||||
parsedFrom = parsedLoc;
|
||||
}
|
||||
|
||||
// Use only the path component of the URL if the URL matches the current
|
||||
// document (almost all the time when using pushState)
|
||||
if (parsedLoc.protocol === parsedTo.protocol && parsedLoc.host === parsedTo.host) {
|
||||
to = parsedTo.relative;
|
||||
}
|
||||
if (parsedLoc.protocol === parsedFrom.protocol && parsedLoc.host === parsedFrom.host) {
|
||||
from = parsedFrom.relative;
|
||||
}
|
||||
|
||||
getCurrentHub().addBreadcrumb({
|
||||
category: 'navigation',
|
||||
data: {
|
||||
from,
|
||||
to,
|
||||
},
|
||||
});
|
||||
}
|
||||
|
||||
function _isEvent(event) {
|
||||
return !!event && !!(event ).target;
|
||||
}
|
||||
|
||||
export { BREADCRUMB_INTEGRATION_ID, Breadcrumbs };
|
||||
//# sourceMappingURL=breadcrumbs.js.map
|
||||
211
shared/logger/node_modules/@sentry/browser/esm/integrations/dedupe.js
generated
vendored
Normal file
211
shared/logger/node_modules/@sentry/browser/esm/integrations/dedupe.js
generated
vendored
Normal file
@@ -0,0 +1,211 @@
|
||||
import { logger } from '@sentry/utils';
|
||||
|
||||
/** Deduplication filter */
|
||||
class Dedupe {constructor() { Dedupe.prototype.__init.call(this); }
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
static __initStatic() {this.id = 'Dedupe';}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
__init() {this.name = Dedupe.id;}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
setupOnce(addGlobalEventProcessor, getCurrentHub) {
|
||||
const eventProcessor = currentEvent => {
|
||||
// We want to ignore any non-error type events, e.g. transactions or replays
|
||||
// These should never be deduped, and also not be compared against as _previousEvent.
|
||||
if (currentEvent.type) {
|
||||
return currentEvent;
|
||||
}
|
||||
|
||||
const self = getCurrentHub().getIntegration(Dedupe);
|
||||
if (self) {
|
||||
// Juuust in case something goes wrong
|
||||
try {
|
||||
if (_shouldDropEvent(currentEvent, self._previousEvent)) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.warn('Event dropped due to being a duplicate of previously captured event.');
|
||||
return null;
|
||||
}
|
||||
} catch (_oO) {
|
||||
return (self._previousEvent = currentEvent);
|
||||
}
|
||||
|
||||
return (self._previousEvent = currentEvent);
|
||||
}
|
||||
return currentEvent;
|
||||
};
|
||||
|
||||
eventProcessor.id = this.name;
|
||||
addGlobalEventProcessor(eventProcessor);
|
||||
}
|
||||
} Dedupe.__initStatic();
|
||||
|
||||
/** JSDoc */
|
||||
function _shouldDropEvent(currentEvent, previousEvent) {
|
||||
if (!previousEvent) {
|
||||
return false;
|
||||
}
|
||||
|
||||
if (_isSameMessageEvent(currentEvent, previousEvent)) {
|
||||
return true;
|
||||
}
|
||||
|
||||
if (_isSameExceptionEvent(currentEvent, previousEvent)) {
|
||||
return true;
|
||||
}
|
||||
|
||||
return false;
|
||||
}
|
||||
|
||||
/** JSDoc */
|
||||
function _isSameMessageEvent(currentEvent, previousEvent) {
|
||||
const currentMessage = currentEvent.message;
|
||||
const previousMessage = previousEvent.message;
|
||||
|
||||
// If neither event has a message property, they were both exceptions, so bail out
|
||||
if (!currentMessage && !previousMessage) {
|
||||
return false;
|
||||
}
|
||||
|
||||
// If only one event has a stacktrace, but not the other one, they are not the same
|
||||
if ((currentMessage && !previousMessage) || (!currentMessage && previousMessage)) {
|
||||
return false;
|
||||
}
|
||||
|
||||
if (currentMessage !== previousMessage) {
|
||||
return false;
|
||||
}
|
||||
|
||||
if (!_isSameFingerprint(currentEvent, previousEvent)) {
|
||||
return false;
|
||||
}
|
||||
|
||||
if (!_isSameStacktrace(currentEvent, previousEvent)) {
|
||||
return false;
|
||||
}
|
||||
|
||||
return true;
|
||||
}
|
||||
|
||||
/** JSDoc */
|
||||
function _isSameExceptionEvent(currentEvent, previousEvent) {
|
||||
const previousException = _getExceptionFromEvent(previousEvent);
|
||||
const currentException = _getExceptionFromEvent(currentEvent);
|
||||
|
||||
if (!previousException || !currentException) {
|
||||
return false;
|
||||
}
|
||||
|
||||
if (previousException.type !== currentException.type || previousException.value !== currentException.value) {
|
||||
return false;
|
||||
}
|
||||
|
||||
if (!_isSameFingerprint(currentEvent, previousEvent)) {
|
||||
return false;
|
||||
}
|
||||
|
||||
if (!_isSameStacktrace(currentEvent, previousEvent)) {
|
||||
return false;
|
||||
}
|
||||
|
||||
return true;
|
||||
}
|
||||
|
||||
/** JSDoc */
|
||||
function _isSameStacktrace(currentEvent, previousEvent) {
|
||||
let currentFrames = _getFramesFromEvent(currentEvent);
|
||||
let previousFrames = _getFramesFromEvent(previousEvent);
|
||||
|
||||
// If neither event has a stacktrace, they are assumed to be the same
|
||||
if (!currentFrames && !previousFrames) {
|
||||
return true;
|
||||
}
|
||||
|
||||
// If only one event has a stacktrace, but not the other one, they are not the same
|
||||
if ((currentFrames && !previousFrames) || (!currentFrames && previousFrames)) {
|
||||
return false;
|
||||
}
|
||||
|
||||
currentFrames = currentFrames ;
|
||||
previousFrames = previousFrames ;
|
||||
|
||||
// If number of frames differ, they are not the same
|
||||
if (previousFrames.length !== currentFrames.length) {
|
||||
return false;
|
||||
}
|
||||
|
||||
// Otherwise, compare the two
|
||||
for (let i = 0; i < previousFrames.length; i++) {
|
||||
const frameA = previousFrames[i];
|
||||
const frameB = currentFrames[i];
|
||||
|
||||
if (
|
||||
frameA.filename !== frameB.filename ||
|
||||
frameA.lineno !== frameB.lineno ||
|
||||
frameA.colno !== frameB.colno ||
|
||||
frameA.function !== frameB.function
|
||||
) {
|
||||
return false;
|
||||
}
|
||||
}
|
||||
|
||||
return true;
|
||||
}
|
||||
|
||||
/** JSDoc */
|
||||
function _isSameFingerprint(currentEvent, previousEvent) {
|
||||
let currentFingerprint = currentEvent.fingerprint;
|
||||
let previousFingerprint = previousEvent.fingerprint;
|
||||
|
||||
// If neither event has a fingerprint, they are assumed to be the same
|
||||
if (!currentFingerprint && !previousFingerprint) {
|
||||
return true;
|
||||
}
|
||||
|
||||
// If only one event has a fingerprint, but not the other one, they are not the same
|
||||
if ((currentFingerprint && !previousFingerprint) || (!currentFingerprint && previousFingerprint)) {
|
||||
return false;
|
||||
}
|
||||
|
||||
currentFingerprint = currentFingerprint ;
|
||||
previousFingerprint = previousFingerprint ;
|
||||
|
||||
// Otherwise, compare the two
|
||||
try {
|
||||
return !!(currentFingerprint.join('') === previousFingerprint.join(''));
|
||||
} catch (_oO) {
|
||||
return false;
|
||||
}
|
||||
}
|
||||
|
||||
/** JSDoc */
|
||||
function _getExceptionFromEvent(event) {
|
||||
return event.exception && event.exception.values && event.exception.values[0];
|
||||
}
|
||||
|
||||
/** JSDoc */
|
||||
function _getFramesFromEvent(event) {
|
||||
const exception = event.exception;
|
||||
|
||||
if (exception) {
|
||||
try {
|
||||
// @ts-ignore Object could be undefined
|
||||
return exception.values[0].stacktrace.frames;
|
||||
} catch (_oO) {
|
||||
return undefined;
|
||||
}
|
||||
}
|
||||
return undefined;
|
||||
}
|
||||
|
||||
export { Dedupe };
|
||||
//# sourceMappingURL=dedupe.js.map
|
||||
248
shared/logger/node_modules/@sentry/browser/esm/integrations/globalhandlers.js
generated
vendored
Normal file
248
shared/logger/node_modules/@sentry/browser/esm/integrations/globalhandlers.js
generated
vendored
Normal file
@@ -0,0 +1,248 @@
|
||||
import { getCurrentHub } from '@sentry/core';
|
||||
import { addInstrumentationHandler, isString, isPrimitive, isErrorEvent, getLocationHref, logger, addExceptionMechanism } from '@sentry/utils';
|
||||
import { eventFromUnknownInput } from '../eventbuilder.js';
|
||||
import { shouldIgnoreOnError } from '../helpers.js';
|
||||
|
||||
/* eslint-disable @typescript-eslint/no-unsafe-member-access */
|
||||
|
||||
/** Global handlers */
|
||||
class GlobalHandlers {
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
static __initStatic() {this.id = 'GlobalHandlers';}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
__init() {this.name = GlobalHandlers.id;}
|
||||
|
||||
/** JSDoc */
|
||||
|
||||
/**
|
||||
* Stores references functions to installing handlers. Will set to undefined
|
||||
* after they have been run so that they are not used twice.
|
||||
*/
|
||||
__init2() {this._installFunc = {
|
||||
onerror: _installGlobalOnErrorHandler,
|
||||
onunhandledrejection: _installGlobalOnUnhandledRejectionHandler,
|
||||
};}
|
||||
|
||||
/** JSDoc */
|
||||
constructor(options) {GlobalHandlers.prototype.__init.call(this);GlobalHandlers.prototype.__init2.call(this);
|
||||
this._options = {
|
||||
onerror: true,
|
||||
onunhandledrejection: true,
|
||||
...options,
|
||||
};
|
||||
}
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
setupOnce() {
|
||||
Error.stackTraceLimit = 50;
|
||||
const options = this._options;
|
||||
|
||||
// We can disable guard-for-in as we construct the options object above + do checks against
|
||||
// `this._installFunc` for the property.
|
||||
// eslint-disable-next-line guard-for-in
|
||||
for (const key in options) {
|
||||
const installFunc = this._installFunc[key ];
|
||||
if (installFunc && options[key ]) {
|
||||
globalHandlerLog(key);
|
||||
installFunc();
|
||||
this._installFunc[key ] = undefined;
|
||||
}
|
||||
}
|
||||
}
|
||||
} GlobalHandlers.__initStatic();
|
||||
|
||||
/** JSDoc */
|
||||
function _installGlobalOnErrorHandler() {
|
||||
addInstrumentationHandler(
|
||||
'error',
|
||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any
|
||||
(data) => {
|
||||
const [hub, stackParser, attachStacktrace] = getHubAndOptions();
|
||||
if (!hub.getIntegration(GlobalHandlers)) {
|
||||
return;
|
||||
}
|
||||
const { msg, url, line, column, error } = data;
|
||||
if (shouldIgnoreOnError() || (error && error.__sentry_own_request__)) {
|
||||
return;
|
||||
}
|
||||
|
||||
const event =
|
||||
error === undefined && isString(msg)
|
||||
? _eventFromIncompleteOnError(msg, url, line, column)
|
||||
: _enhanceEventWithInitialFrame(
|
||||
eventFromUnknownInput(stackParser, error || msg, undefined, attachStacktrace, false),
|
||||
url,
|
||||
line,
|
||||
column,
|
||||
);
|
||||
|
||||
event.level = 'error';
|
||||
|
||||
addMechanismAndCapture(hub, error, event, 'onerror');
|
||||
},
|
||||
);
|
||||
}
|
||||
|
||||
/** JSDoc */
|
||||
function _installGlobalOnUnhandledRejectionHandler() {
|
||||
addInstrumentationHandler(
|
||||
'unhandledrejection',
|
||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any
|
||||
(e) => {
|
||||
const [hub, stackParser, attachStacktrace] = getHubAndOptions();
|
||||
if (!hub.getIntegration(GlobalHandlers)) {
|
||||
return;
|
||||
}
|
||||
let error = e;
|
||||
|
||||
// dig the object of the rejection out of known event types
|
||||
try {
|
||||
// PromiseRejectionEvents store the object of the rejection under 'reason'
|
||||
// see https://developer.mozilla.org/en-US/docs/Web/API/PromiseRejectionEvent
|
||||
if ('reason' in e) {
|
||||
error = e.reason;
|
||||
}
|
||||
// something, somewhere, (likely a browser extension) effectively casts PromiseRejectionEvents
|
||||
// to CustomEvents, moving the `promise` and `reason` attributes of the PRE into
|
||||
// the CustomEvent's `detail` attribute, since they're not part of CustomEvent's spec
|
||||
// see https://developer.mozilla.org/en-US/docs/Web/API/CustomEvent and
|
||||
// https://github.com/getsentry/sentry-javascript/issues/2380
|
||||
else if ('detail' in e && 'reason' in e.detail) {
|
||||
error = e.detail.reason;
|
||||
}
|
||||
} catch (_oO) {
|
||||
// no-empty
|
||||
}
|
||||
|
||||
if (shouldIgnoreOnError() || (error && error.__sentry_own_request__)) {
|
||||
return true;
|
||||
}
|
||||
|
||||
const event = isPrimitive(error)
|
||||
? _eventFromRejectionWithPrimitive(error)
|
||||
: eventFromUnknownInput(stackParser, error, undefined, attachStacktrace, true);
|
||||
|
||||
event.level = 'error';
|
||||
|
||||
addMechanismAndCapture(hub, error, event, 'onunhandledrejection');
|
||||
return;
|
||||
},
|
||||
);
|
||||
}
|
||||
|
||||
/**
|
||||
* Create an event from a promise rejection where the `reason` is a primitive.
|
||||
*
|
||||
* @param reason: The `reason` property of the promise rejection
|
||||
* @returns An Event object with an appropriate `exception` value
|
||||
*/
|
||||
function _eventFromRejectionWithPrimitive(reason) {
|
||||
return {
|
||||
exception: {
|
||||
values: [
|
||||
{
|
||||
type: 'UnhandledRejection',
|
||||
// String() is needed because the Primitive type includes symbols (which can't be automatically stringified)
|
||||
value: `Non-Error promise rejection captured with value: ${String(reason)}`,
|
||||
},
|
||||
],
|
||||
},
|
||||
};
|
||||
}
|
||||
|
||||
/**
|
||||
* This function creates a stack from an old, error-less onerror handler.
|
||||
*/
|
||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any
|
||||
function _eventFromIncompleteOnError(msg, url, line, column) {
|
||||
const ERROR_TYPES_RE =
|
||||
/^(?:[Uu]ncaught (?:exception: )?)?(?:((?:Eval|Internal|Range|Reference|Syntax|Type|URI|)Error): )?(.*)$/i;
|
||||
|
||||
// If 'message' is ErrorEvent, get real message from inside
|
||||
let message = isErrorEvent(msg) ? msg.message : msg;
|
||||
let name = 'Error';
|
||||
|
||||
const groups = message.match(ERROR_TYPES_RE);
|
||||
if (groups) {
|
||||
name = groups[1];
|
||||
message = groups[2];
|
||||
}
|
||||
|
||||
const event = {
|
||||
exception: {
|
||||
values: [
|
||||
{
|
||||
type: name,
|
||||
value: message,
|
||||
},
|
||||
],
|
||||
},
|
||||
};
|
||||
|
||||
return _enhanceEventWithInitialFrame(event, url, line, column);
|
||||
}
|
||||
|
||||
/** JSDoc */
|
||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any
|
||||
function _enhanceEventWithInitialFrame(event, url, line, column) {
|
||||
// event.exception
|
||||
const e = (event.exception = event.exception || {});
|
||||
// event.exception.values
|
||||
const ev = (e.values = e.values || []);
|
||||
// event.exception.values[0]
|
||||
const ev0 = (ev[0] = ev[0] || {});
|
||||
// event.exception.values[0].stacktrace
|
||||
const ev0s = (ev0.stacktrace = ev0.stacktrace || {});
|
||||
// event.exception.values[0].stacktrace.frames
|
||||
const ev0sf = (ev0s.frames = ev0s.frames || []);
|
||||
|
||||
const colno = isNaN(parseInt(column, 10)) ? undefined : column;
|
||||
const lineno = isNaN(parseInt(line, 10)) ? undefined : line;
|
||||
const filename = isString(url) && url.length > 0 ? url : getLocationHref();
|
||||
|
||||
// event.exception.values[0].stacktrace.frames
|
||||
if (ev0sf.length === 0) {
|
||||
ev0sf.push({
|
||||
colno,
|
||||
filename,
|
||||
function: '?',
|
||||
in_app: true,
|
||||
lineno,
|
||||
});
|
||||
}
|
||||
|
||||
return event;
|
||||
}
|
||||
|
||||
function globalHandlerLog(type) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.log(`Global Handler attached: ${type}`);
|
||||
}
|
||||
|
||||
function addMechanismAndCapture(hub, error, event, type) {
|
||||
addExceptionMechanism(event, {
|
||||
handled: false,
|
||||
type,
|
||||
});
|
||||
hub.captureEvent(event, {
|
||||
originalException: error,
|
||||
});
|
||||
}
|
||||
|
||||
function getHubAndOptions() {
|
||||
const hub = getCurrentHub();
|
||||
const client = hub.getClient();
|
||||
const options = (client && client.getOptions()) || {
|
||||
stackParser: () => [],
|
||||
attachStacktrace: false,
|
||||
};
|
||||
return [hub, options.stackParser, options.attachStacktrace];
|
||||
}
|
||||
|
||||
export { GlobalHandlers };
|
||||
//# sourceMappingURL=globalhandlers.js.map
|
||||
47
shared/logger/node_modules/@sentry/browser/esm/integrations/httpcontext.js
generated
vendored
Normal file
47
shared/logger/node_modules/@sentry/browser/esm/integrations/httpcontext.js
generated
vendored
Normal file
@@ -0,0 +1,47 @@
|
||||
import { addGlobalEventProcessor, getCurrentHub } from '@sentry/core';
|
||||
import { WINDOW } from '../helpers.js';
|
||||
|
||||
/** HttpContext integration collects information about HTTP request headers */
|
||||
class HttpContext {constructor() { HttpContext.prototype.__init.call(this); }
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
static __initStatic() {this.id = 'HttpContext';}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
__init() {this.name = HttpContext.id;}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
setupOnce() {
|
||||
addGlobalEventProcessor((event) => {
|
||||
if (getCurrentHub().getIntegration(HttpContext)) {
|
||||
// if none of the information we want exists, don't bother
|
||||
if (!WINDOW.navigator && !WINDOW.location && !WINDOW.document) {
|
||||
return event;
|
||||
}
|
||||
|
||||
// grab as much info as exists and add it to the event
|
||||
const url = (event.request && event.request.url) || (WINDOW.location && WINDOW.location.href);
|
||||
const { referrer } = WINDOW.document || {};
|
||||
const { userAgent } = WINDOW.navigator || {};
|
||||
|
||||
const headers = {
|
||||
...(event.request && event.request.headers),
|
||||
...(referrer && { Referer: referrer }),
|
||||
...(userAgent && { 'User-Agent': userAgent }),
|
||||
};
|
||||
const request = { ...event.request, ...(url && { url }), headers };
|
||||
|
||||
return { ...event, request };
|
||||
}
|
||||
return event;
|
||||
});
|
||||
}
|
||||
} HttpContext.__initStatic();
|
||||
|
||||
export { HttpContext };
|
||||
//# sourceMappingURL=httpcontext.js.map
|
||||
87
shared/logger/node_modules/@sentry/browser/esm/integrations/linkederrors.js
generated
vendored
Normal file
87
shared/logger/node_modules/@sentry/browser/esm/integrations/linkederrors.js
generated
vendored
Normal file
@@ -0,0 +1,87 @@
|
||||
import { getCurrentHub, addGlobalEventProcessor } from '@sentry/core';
|
||||
import { isInstanceOf } from '@sentry/utils';
|
||||
import { exceptionFromError } from '../eventbuilder.js';
|
||||
|
||||
const DEFAULT_KEY = 'cause';
|
||||
const DEFAULT_LIMIT = 5;
|
||||
|
||||
/** Adds SDK info to an event. */
|
||||
class LinkedErrors {
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
static __initStatic() {this.id = 'LinkedErrors';}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
__init() {this.name = LinkedErrors.id;}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
constructor(options = {}) {LinkedErrors.prototype.__init.call(this);
|
||||
this._key = options.key || DEFAULT_KEY;
|
||||
this._limit = options.limit || DEFAULT_LIMIT;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
setupOnce() {
|
||||
const client = getCurrentHub().getClient();
|
||||
if (!client) {
|
||||
return;
|
||||
}
|
||||
addGlobalEventProcessor((event, hint) => {
|
||||
const self = getCurrentHub().getIntegration(LinkedErrors);
|
||||
return self ? _handler(client.getOptions().stackParser, self._key, self._limit, event, hint) : event;
|
||||
});
|
||||
}
|
||||
} LinkedErrors.__initStatic();
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
function _handler(
|
||||
parser,
|
||||
key,
|
||||
limit,
|
||||
event,
|
||||
hint,
|
||||
) {
|
||||
if (!event.exception || !event.exception.values || !hint || !isInstanceOf(hint.originalException, Error)) {
|
||||
return event;
|
||||
}
|
||||
const linkedErrors = _walkErrorTree(parser, limit, hint.originalException , key);
|
||||
event.exception.values = [...linkedErrors, ...event.exception.values];
|
||||
return event;
|
||||
}
|
||||
|
||||
/**
|
||||
* JSDOC
|
||||
*/
|
||||
function _walkErrorTree(
|
||||
parser,
|
||||
limit,
|
||||
error,
|
||||
key,
|
||||
stack = [],
|
||||
) {
|
||||
if (!isInstanceOf(error[key], Error) || stack.length + 1 >= limit) {
|
||||
return stack;
|
||||
}
|
||||
const exception = exceptionFromError(parser, error[key]);
|
||||
return _walkErrorTree(parser, limit, error[key], key, [exception, ...stack]);
|
||||
}
|
||||
|
||||
export { LinkedErrors, _handler, _walkErrorTree };
|
||||
//# sourceMappingURL=linkederrors.js.map
|
||||
281
shared/logger/node_modules/@sentry/browser/esm/integrations/trycatch.js
generated
vendored
Normal file
281
shared/logger/node_modules/@sentry/browser/esm/integrations/trycatch.js
generated
vendored
Normal file
@@ -0,0 +1,281 @@
|
||||
import { fill, getFunctionName, getOriginalFunction } from '@sentry/utils';
|
||||
import { WINDOW, wrap } from '../helpers.js';
|
||||
|
||||
const DEFAULT_EVENT_TARGET = [
|
||||
'EventTarget',
|
||||
'Window',
|
||||
'Node',
|
||||
'ApplicationCache',
|
||||
'AudioTrackList',
|
||||
'ChannelMergerNode',
|
||||
'CryptoOperation',
|
||||
'EventSource',
|
||||
'FileReader',
|
||||
'HTMLUnknownElement',
|
||||
'IDBDatabase',
|
||||
'IDBRequest',
|
||||
'IDBTransaction',
|
||||
'KeyOperation',
|
||||
'MediaController',
|
||||
'MessagePort',
|
||||
'ModalWindow',
|
||||
'Notification',
|
||||
'SVGElementInstance',
|
||||
'Screen',
|
||||
'TextTrack',
|
||||
'TextTrackCue',
|
||||
'TextTrackList',
|
||||
'WebSocket',
|
||||
'WebSocketWorker',
|
||||
'Worker',
|
||||
'XMLHttpRequest',
|
||||
'XMLHttpRequestEventTarget',
|
||||
'XMLHttpRequestUpload',
|
||||
];
|
||||
|
||||
/** Wrap timer functions and event targets to catch errors and provide better meta data */
|
||||
class TryCatch {
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
static __initStatic() {this.id = 'TryCatch';}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
__init() {this.name = TryCatch.id;}
|
||||
|
||||
/** JSDoc */
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
constructor(options) {TryCatch.prototype.__init.call(this);
|
||||
this._options = {
|
||||
XMLHttpRequest: true,
|
||||
eventTarget: true,
|
||||
requestAnimationFrame: true,
|
||||
setInterval: true,
|
||||
setTimeout: true,
|
||||
...options,
|
||||
};
|
||||
}
|
||||
|
||||
/**
|
||||
* Wrap timer functions and event targets to catch errors
|
||||
* and provide better metadata.
|
||||
*/
|
||||
setupOnce() {
|
||||
if (this._options.setTimeout) {
|
||||
fill(WINDOW, 'setTimeout', _wrapTimeFunction);
|
||||
}
|
||||
|
||||
if (this._options.setInterval) {
|
||||
fill(WINDOW, 'setInterval', _wrapTimeFunction);
|
||||
}
|
||||
|
||||
if (this._options.requestAnimationFrame) {
|
||||
fill(WINDOW, 'requestAnimationFrame', _wrapRAF);
|
||||
}
|
||||
|
||||
if (this._options.XMLHttpRequest && 'XMLHttpRequest' in WINDOW) {
|
||||
fill(XMLHttpRequest.prototype, 'send', _wrapXHR);
|
||||
}
|
||||
|
||||
const eventTargetOption = this._options.eventTarget;
|
||||
if (eventTargetOption) {
|
||||
const eventTarget = Array.isArray(eventTargetOption) ? eventTargetOption : DEFAULT_EVENT_TARGET;
|
||||
eventTarget.forEach(_wrapEventTarget);
|
||||
}
|
||||
}
|
||||
} TryCatch.__initStatic();
|
||||
|
||||
/** JSDoc */
|
||||
function _wrapTimeFunction(original) {
|
||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any
|
||||
return function ( ...args) {
|
||||
const originalCallback = args[0];
|
||||
args[0] = wrap(originalCallback, {
|
||||
mechanism: {
|
||||
data: { function: getFunctionName(original) },
|
||||
handled: true,
|
||||
type: 'instrument',
|
||||
},
|
||||
});
|
||||
return original.apply(this, args);
|
||||
};
|
||||
}
|
||||
|
||||
/** JSDoc */
|
||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any
|
||||
function _wrapRAF(original) {
|
||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any
|
||||
return function ( callback) {
|
||||
// eslint-disable-next-line @typescript-eslint/no-unsafe-member-access
|
||||
return original.apply(this, [
|
||||
wrap(callback, {
|
||||
mechanism: {
|
||||
data: {
|
||||
function: 'requestAnimationFrame',
|
||||
handler: getFunctionName(original),
|
||||
},
|
||||
handled: true,
|
||||
type: 'instrument',
|
||||
},
|
||||
}),
|
||||
]);
|
||||
};
|
||||
}
|
||||
|
||||
/** JSDoc */
|
||||
function _wrapXHR(originalSend) {
|
||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any
|
||||
return function ( ...args) {
|
||||
// eslint-disable-next-line @typescript-eslint/no-this-alias
|
||||
const xhr = this;
|
||||
const xmlHttpRequestProps = ['onload', 'onerror', 'onprogress', 'onreadystatechange'];
|
||||
|
||||
xmlHttpRequestProps.forEach(prop => {
|
||||
if (prop in xhr && typeof xhr[prop] === 'function') {
|
||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any
|
||||
fill(xhr, prop, function (original) {
|
||||
const wrapOptions = {
|
||||
mechanism: {
|
||||
data: {
|
||||
function: prop,
|
||||
handler: getFunctionName(original),
|
||||
},
|
||||
handled: true,
|
||||
type: 'instrument',
|
||||
},
|
||||
};
|
||||
|
||||
// If Instrument integration has been called before TryCatch, get the name of original function
|
||||
const originalFunction = getOriginalFunction(original);
|
||||
if (originalFunction) {
|
||||
wrapOptions.mechanism.data.handler = getFunctionName(originalFunction);
|
||||
}
|
||||
|
||||
// Otherwise wrap directly
|
||||
return wrap(original, wrapOptions);
|
||||
});
|
||||
}
|
||||
});
|
||||
|
||||
return originalSend.apply(this, args);
|
||||
};
|
||||
}
|
||||
|
||||
/** JSDoc */
|
||||
function _wrapEventTarget(target) {
|
||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any
|
||||
const globalObject = WINDOW ;
|
||||
// eslint-disable-next-line @typescript-eslint/no-unsafe-member-access
|
||||
const proto = globalObject[target] && globalObject[target].prototype;
|
||||
|
||||
// eslint-disable-next-line @typescript-eslint/no-unsafe-member-access, no-prototype-builtins
|
||||
if (!proto || !proto.hasOwnProperty || !proto.hasOwnProperty('addEventListener')) {
|
||||
return;
|
||||
}
|
||||
|
||||
fill(proto, 'addEventListener', function (original)
|
||||
|
||||
{
|
||||
return function (
|
||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any
|
||||
|
||||
eventName,
|
||||
fn,
|
||||
options,
|
||||
) {
|
||||
try {
|
||||
if (typeof fn.handleEvent === 'function') {
|
||||
// ESlint disable explanation:
|
||||
// First, it is generally safe to call `wrap` with an unbound function. Furthermore, using `.bind()` would
|
||||
// introduce a bug here, because bind returns a new function that doesn't have our
|
||||
// flags(like __sentry_original__) attached. `wrap` checks for those flags to avoid unnecessary wrapping.
|
||||
// Without those flags, every call to addEventListener wraps the function again, causing a memory leak.
|
||||
// eslint-disable-next-line @typescript-eslint/unbound-method
|
||||
fn.handleEvent = wrap(fn.handleEvent, {
|
||||
mechanism: {
|
||||
data: {
|
||||
function: 'handleEvent',
|
||||
handler: getFunctionName(fn),
|
||||
target,
|
||||
},
|
||||
handled: true,
|
||||
type: 'instrument',
|
||||
},
|
||||
});
|
||||
}
|
||||
} catch (err) {
|
||||
// can sometimes get 'Permission denied to access property "handle Event'
|
||||
}
|
||||
|
||||
return original.apply(this, [
|
||||
eventName,
|
||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any
|
||||
wrap(fn , {
|
||||
mechanism: {
|
||||
data: {
|
||||
function: 'addEventListener',
|
||||
handler: getFunctionName(fn),
|
||||
target,
|
||||
},
|
||||
handled: true,
|
||||
type: 'instrument',
|
||||
},
|
||||
}),
|
||||
options,
|
||||
]);
|
||||
};
|
||||
});
|
||||
|
||||
fill(
|
||||
proto,
|
||||
'removeEventListener',
|
||||
function (
|
||||
originalRemoveEventListener,
|
||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any
|
||||
) {
|
||||
return function (
|
||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any
|
||||
|
||||
eventName,
|
||||
fn,
|
||||
options,
|
||||
) {
|
||||
/**
|
||||
* There are 2 possible scenarios here:
|
||||
*
|
||||
* 1. Someone passes a callback, which was attached prior to Sentry initialization, or by using unmodified
|
||||
* method, eg. `document.addEventListener.call(el, name, handler). In this case, we treat this function
|
||||
* as a pass-through, and call original `removeEventListener` with it.
|
||||
*
|
||||
* 2. Someone passes a callback, which was attached after Sentry was initialized, which means that it was using
|
||||
* our wrapped version of `addEventListener`, which internally calls `wrap` helper.
|
||||
* This helper "wraps" whole callback inside a try/catch statement, and attached appropriate metadata to it,
|
||||
* in order for us to make a distinction between wrapped/non-wrapped functions possible.
|
||||
* If a function was wrapped, it has additional property of `__sentry_wrapped__`, holding the handler.
|
||||
*
|
||||
* When someone adds a handler prior to initialization, and then do it again, but after,
|
||||
* then we have to detach both of them. Otherwise, if we'd detach only wrapped one, it'd be impossible
|
||||
* to get rid of the initial handler and it'd stick there forever.
|
||||
*/
|
||||
const wrappedEventHandler = fn ;
|
||||
try {
|
||||
const originalEventHandler = wrappedEventHandler && wrappedEventHandler.__sentry_wrapped__;
|
||||
if (originalEventHandler) {
|
||||
originalRemoveEventListener.call(this, eventName, originalEventHandler, options);
|
||||
}
|
||||
} catch (e) {
|
||||
// ignore, accessing __sentry_wrapped__ will throw in some Selenium environments
|
||||
}
|
||||
return originalRemoveEventListener.call(this, eventName, wrappedEventHandler, options);
|
||||
};
|
||||
},
|
||||
);
|
||||
}
|
||||
|
||||
export { TryCatch };
|
||||
//# sourceMappingURL=trycatch.js.map
|
||||
240
shared/logger/node_modules/@sentry/browser/esm/profiling/hubextensions.js
generated
vendored
Normal file
240
shared/logger/node_modules/@sentry/browser/esm/profiling/hubextensions.js
generated
vendored
Normal file
@@ -0,0 +1,240 @@
|
||||
import { getCurrentHub } from '@sentry/core';
|
||||
import { logger, uuid4 } from '@sentry/utils';
|
||||
import { WINDOW } from '../helpers.js';
|
||||
import { isValidSampleRate, addProfileToMap } from './utils.js';
|
||||
|
||||
/* eslint-disable complexity */
|
||||
|
||||
const MAX_PROFILE_DURATION_MS = 30000;
|
||||
// Keep a flag value to avoid re-initializing the profiler constructor. If it fails
|
||||
// once, it will always fail and this allows us to early return.
|
||||
let PROFILING_CONSTRUCTOR_FAILED = false;
|
||||
|
||||
/**
|
||||
* Check if profiler constructor is available.
|
||||
* @param maybeProfiler
|
||||
*/
|
||||
function isJSProfilerSupported(maybeProfiler) {
|
||||
return typeof maybeProfiler === 'function';
|
||||
}
|
||||
|
||||
/**
|
||||
* Safety wrapper for startTransaction for the unlikely case that transaction starts before tracing is imported -
|
||||
* if that happens we want to avoid throwing an error from profiling code.
|
||||
* see https://github.com/getsentry/sentry-javascript/issues/4731.
|
||||
*
|
||||
* @experimental
|
||||
*/
|
||||
function onProfilingStartRouteTransaction(transaction) {
|
||||
if (!transaction) {
|
||||
if ((typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__)) {
|
||||
logger.log('[Profiling] Transaction is undefined, skipping profiling');
|
||||
}
|
||||
return transaction;
|
||||
}
|
||||
|
||||
return wrapTransactionWithProfiling(transaction);
|
||||
}
|
||||
|
||||
/**
|
||||
* Wraps startTransaction and stopTransaction with profiling related logic.
|
||||
* startProfiling is called after the call to startTransaction in order to avoid our own code from
|
||||
* being profiled. Because of that same reason, stopProfiling is called before the call to stopTransaction.
|
||||
*/
|
||||
function wrapTransactionWithProfiling(transaction) {
|
||||
// Feature support check first
|
||||
const JSProfilerConstructor = WINDOW.Profiler;
|
||||
|
||||
if (!isJSProfilerSupported(JSProfilerConstructor)) {
|
||||
if ((typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__)) {
|
||||
logger.log(
|
||||
'[Profiling] Profiling is not supported by this browser, Profiler interface missing on window object.',
|
||||
);
|
||||
}
|
||||
return transaction;
|
||||
}
|
||||
|
||||
// If constructor failed once, it will always fail, so we can early return.
|
||||
if (PROFILING_CONSTRUCTOR_FAILED) {
|
||||
if ((typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__)) {
|
||||
logger.log('[Profiling] Profiling has been disabled for the duration of the current user session.');
|
||||
}
|
||||
return transaction;
|
||||
}
|
||||
|
||||
const client = getCurrentHub().getClient();
|
||||
const options = client && client.getOptions();
|
||||
if (!options) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.log('[Profiling] Profiling disabled, no options found.');
|
||||
return transaction;
|
||||
}
|
||||
|
||||
// @ts-ignore profilesSampleRate is not part of the browser options yet
|
||||
const profilesSampleRate = options.profilesSampleRate;
|
||||
|
||||
// Since this is coming from the user (or from a function provided by the user), who knows what we might get. (The
|
||||
// only valid values are booleans or numbers between 0 and 1.)
|
||||
if (!isValidSampleRate(profilesSampleRate)) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.warn('[Profiling] Discarding profile because of invalid sample rate.');
|
||||
return transaction;
|
||||
}
|
||||
|
||||
// if the function returned 0 (or false), or if `profileSampleRate` is 0, it's a sign the profile should be dropped
|
||||
if (!profilesSampleRate) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) &&
|
||||
logger.log(
|
||||
'[Profiling] Discarding profile because a negative sampling decision was inherited or profileSampleRate is set to 0',
|
||||
);
|
||||
return transaction;
|
||||
}
|
||||
|
||||
// Now we roll the dice. Math.random is inclusive of 0, but not of 1, so strict < is safe here. In case sampleRate is
|
||||
// a boolean, the < comparison will cause it to be automatically cast to 1 if it's true and 0 if it's false.
|
||||
const sampled = profilesSampleRate === true ? true : Math.random() < profilesSampleRate;
|
||||
// Check if we should sample this profile
|
||||
if (!sampled) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) &&
|
||||
logger.log(
|
||||
`[Profiling] Discarding profile because it's not included in the random sample (sampling rate = ${Number(
|
||||
profilesSampleRate,
|
||||
)})`,
|
||||
);
|
||||
return transaction;
|
||||
}
|
||||
|
||||
// From initial testing, it seems that the minimum value for sampleInterval is 10ms.
|
||||
const samplingIntervalMS = 10;
|
||||
// Start the profiler
|
||||
const maxSamples = Math.floor(MAX_PROFILE_DURATION_MS / samplingIntervalMS);
|
||||
let profiler;
|
||||
|
||||
// Attempt to initialize the profiler constructor, if it fails, we disable profiling for the current user session.
|
||||
// This is likely due to a missing 'Document-Policy': 'js-profiling' header. We do not want to throw an error if this happens
|
||||
// as we risk breaking the user's application, so just disable profiling and log an error.
|
||||
try {
|
||||
profiler = new JSProfilerConstructor({ sampleInterval: samplingIntervalMS, maxBufferSize: maxSamples });
|
||||
} catch (e) {
|
||||
if ((typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__)) {
|
||||
logger.log(
|
||||
"[Profiling] Failed to initialize the Profiling constructor, this is likely due to a missing 'Document-Policy': 'js-profiling' header.",
|
||||
);
|
||||
logger.log('[Profiling] Disabling profiling for current user session.');
|
||||
}
|
||||
PROFILING_CONSTRUCTOR_FAILED = true;
|
||||
}
|
||||
|
||||
// We failed to construct the profiler, fallback to original transaction - there is no need to log
|
||||
// anything as we already did that in the try/catch block.
|
||||
if (!profiler) {
|
||||
return transaction;
|
||||
}
|
||||
|
||||
if ((typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__)) {
|
||||
logger.log(`[Profiling] started profiling transaction: ${transaction.name || transaction.description}`);
|
||||
}
|
||||
|
||||
// We create "unique" transaction names to avoid concurrent transactions with same names
|
||||
// from being ignored by the profiler. From here on, only this transaction name should be used when
|
||||
// calling the profiler methods. Note: we log the original name to the user to avoid confusion.
|
||||
const profileId = uuid4();
|
||||
|
||||
/**
|
||||
* Idempotent handler for profile stop
|
||||
*/
|
||||
async function onProfileHandler() {
|
||||
// Check if the profile exists and return it the behavior has to be idempotent as users may call transaction.finish multiple times.
|
||||
if (!transaction) {
|
||||
return null;
|
||||
}
|
||||
// Satisfy the type checker, but profiler will always be defined here.
|
||||
if (!profiler) {
|
||||
return null;
|
||||
}
|
||||
|
||||
// This is temporary - we will use the collected span data to evaluate
|
||||
// if deferring txn.finish until profiler resolves is a viable approach.
|
||||
const stopProfilerSpan = transaction.startChild({ description: 'profiler.stop', op: 'profiler' });
|
||||
|
||||
return profiler
|
||||
.stop()
|
||||
.then((p) => {
|
||||
stopProfilerSpan.finish();
|
||||
|
||||
if (maxDurationTimeoutID) {
|
||||
WINDOW.clearTimeout(maxDurationTimeoutID);
|
||||
maxDurationTimeoutID = undefined;
|
||||
}
|
||||
|
||||
if ((typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__)) {
|
||||
logger.log(`[Profiling] stopped profiling of transaction: ${transaction.name || transaction.description}`);
|
||||
}
|
||||
|
||||
// In case of an overlapping transaction, stopProfiling may return null and silently ignore the overlapping profile.
|
||||
if (!p) {
|
||||
if ((typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__)) {
|
||||
logger.log(
|
||||
`[Profiling] profiler returned null profile for: ${transaction.name || transaction.description}`,
|
||||
'this may indicate an overlapping transaction or a call to stopProfiling with a profile title that was never started',
|
||||
);
|
||||
}
|
||||
return null;
|
||||
}
|
||||
|
||||
addProfileToMap(profileId, p);
|
||||
return null;
|
||||
})
|
||||
.catch(error => {
|
||||
stopProfilerSpan.finish();
|
||||
if ((typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__)) {
|
||||
logger.log('[Profiling] error while stopping profiler:', error);
|
||||
}
|
||||
return null;
|
||||
});
|
||||
}
|
||||
|
||||
// Enqueue a timeout to prevent profiles from running over max duration.
|
||||
let maxDurationTimeoutID = WINDOW.setTimeout(() => {
|
||||
if ((typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__)) {
|
||||
logger.log(
|
||||
'[Profiling] max profile duration elapsed, stopping profiling for:',
|
||||
transaction.name || transaction.description,
|
||||
);
|
||||
}
|
||||
// If the timeout exceeds, we want to stop profiling, but not finish the transaction
|
||||
void onProfileHandler();
|
||||
}, MAX_PROFILE_DURATION_MS);
|
||||
|
||||
// We need to reference the original finish call to avoid creating an infinite loop
|
||||
const originalFinish = transaction.finish.bind(transaction);
|
||||
|
||||
/**
|
||||
* Wraps startTransaction and stopTransaction with profiling related logic.
|
||||
* startProfiling is called after the call to startTransaction in order to avoid our own code from
|
||||
* being profiled. Because of that same reason, stopProfiling is called before the call to stopTransaction.
|
||||
*/
|
||||
function profilingWrappedTransactionFinish() {
|
||||
if (!transaction) {
|
||||
return originalFinish();
|
||||
}
|
||||
// onProfileHandler should always return the same profile even if this is called multiple times.
|
||||
// Always call onProfileHandler to ensure stopProfiling is called and the timeout is cleared.
|
||||
void onProfileHandler().then(
|
||||
() => {
|
||||
transaction.setContext('profile', { profile_id: profileId });
|
||||
originalFinish();
|
||||
},
|
||||
() => {
|
||||
// If onProfileHandler fails, we still want to call the original finish method.
|
||||
originalFinish();
|
||||
},
|
||||
);
|
||||
|
||||
return transaction;
|
||||
}
|
||||
|
||||
transaction.finish = profilingWrappedTransactionFinish;
|
||||
return transaction;
|
||||
}
|
||||
|
||||
export { MAX_PROFILE_DURATION_MS, onProfilingStartRouteTransaction, wrapTransactionWithProfiling };
|
||||
//# sourceMappingURL=hubextensions.js.map
|
||||
81
shared/logger/node_modules/@sentry/browser/esm/profiling/integration.js
generated
vendored
Normal file
81
shared/logger/node_modules/@sentry/browser/esm/profiling/integration.js
generated
vendored
Normal file
@@ -0,0 +1,81 @@
|
||||
import { logger } from '@sentry/utils';
|
||||
import { wrapTransactionWithProfiling } from './hubextensions.js';
|
||||
import { PROFILE_MAP, findProfiledTransactionsFromEnvelope, createProfilingEvent, addProfilesToEnvelope } from './utils.js';
|
||||
|
||||
/**
|
||||
* Browser profiling integration. Stores any event that has contexts["profile"]["profile_id"]
|
||||
* This exists because we do not want to await async profiler.stop calls as transaction.finish is called
|
||||
* in a synchronous context. Instead, we handle sending the profile async from the promise callback and
|
||||
* rely on being able to pull the event from the cache when we need to construct the envelope. This makes the
|
||||
* integration less reliable as we might be dropping profiles when the cache is full.
|
||||
*
|
||||
* @experimental
|
||||
*/
|
||||
class BrowserProfilingIntegration {constructor() { BrowserProfilingIntegration.prototype.__init.call(this);BrowserProfilingIntegration.prototype.__init2.call(this); }
|
||||
__init() {this.name = 'BrowserProfilingIntegration';}
|
||||
__init2() {this.getCurrentHub = undefined;}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
setupOnce(addGlobalEventProcessor, getCurrentHub) {
|
||||
this.getCurrentHub = getCurrentHub;
|
||||
const client = this.getCurrentHub().getClient() ;
|
||||
|
||||
if (client && typeof client.on === 'function') {
|
||||
client.on('startTransaction', (transaction) => {
|
||||
wrapTransactionWithProfiling(transaction);
|
||||
});
|
||||
|
||||
client.on('beforeEnvelope', (envelope) => {
|
||||
// if not profiles are in queue, there is nothing to add to the envelope.
|
||||
if (!PROFILE_MAP['size']) {
|
||||
return;
|
||||
}
|
||||
|
||||
const profiledTransactionEvents = findProfiledTransactionsFromEnvelope(envelope);
|
||||
if (!profiledTransactionEvents.length) {
|
||||
return;
|
||||
}
|
||||
|
||||
const profilesToAddToEnvelope = [];
|
||||
|
||||
for (const profiledTransaction of profiledTransactionEvents) {
|
||||
const context = profiledTransaction && profiledTransaction.contexts;
|
||||
const profile_id = context && context['profile'] && (context['profile']['profile_id'] );
|
||||
|
||||
if (!profile_id) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) &&
|
||||
logger.log('[Profiling] cannot find profile for a transaction without a profile context');
|
||||
continue;
|
||||
}
|
||||
|
||||
// Remove the profile from the transaction context before sending, relay will take care of the rest.
|
||||
if (context && context['profile']) {
|
||||
delete context.profile;
|
||||
}
|
||||
|
||||
const profile = PROFILE_MAP.get(profile_id);
|
||||
if (!profile) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.log(`[Profiling] Could not retrieve profile for transaction: ${profile_id}`);
|
||||
continue;
|
||||
}
|
||||
|
||||
PROFILE_MAP.delete(profile_id);
|
||||
const profileEvent = createProfilingEvent(profile_id, profile, profiledTransaction );
|
||||
|
||||
if (profileEvent) {
|
||||
profilesToAddToEnvelope.push(profileEvent);
|
||||
}
|
||||
}
|
||||
|
||||
addProfilesToEnvelope(envelope, profilesToAddToEnvelope);
|
||||
});
|
||||
} else {
|
||||
logger.warn('[Profiling] Client does not support hooks, profiling will be disabled');
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
export { BrowserProfilingIntegration };
|
||||
//# sourceMappingURL=integration.js.map
|
||||
438
shared/logger/node_modules/@sentry/browser/esm/profiling/utils.js
generated
vendored
Normal file
438
shared/logger/node_modules/@sentry/browser/esm/profiling/utils.js
generated
vendored
Normal file
@@ -0,0 +1,438 @@
|
||||
import { DEFAULT_ENVIRONMENT, getCurrentHub } from '@sentry/core';
|
||||
import { forEachEnvelopeItem, logger, uuid4, GLOBAL_OBJ } from '@sentry/utils';
|
||||
import { WINDOW } from '../helpers.js';
|
||||
|
||||
/* eslint-disable max-lines */
|
||||
|
||||
const MS_TO_NS = 1e6;
|
||||
// Use 0 as main thread id which is identical to threadId in node:worker_threads
|
||||
// where main logs 0 and workers seem to log in increments of 1
|
||||
const THREAD_ID_STRING = String(0);
|
||||
const THREAD_NAME = 'main';
|
||||
|
||||
// Machine properties (eval only once)
|
||||
let OS_PLATFORM = '';
|
||||
let OS_PLATFORM_VERSION = '';
|
||||
let OS_ARCH = '';
|
||||
let OS_BROWSER = (WINDOW.navigator && WINDOW.navigator.userAgent) || '';
|
||||
let OS_MODEL = '';
|
||||
const OS_LOCALE =
|
||||
(WINDOW.navigator && WINDOW.navigator.language) ||
|
||||
(WINDOW.navigator && WINDOW.navigator.languages && WINDOW.navigator.languages[0]) ||
|
||||
'';
|
||||
|
||||
function isUserAgentData(data) {
|
||||
return typeof data === 'object' && data !== null && 'getHighEntropyValues' in data;
|
||||
}
|
||||
|
||||
// @ts-ignore userAgentData is not part of the navigator interface yet
|
||||
const userAgentData = WINDOW.navigator && WINDOW.navigator.userAgentData;
|
||||
|
||||
if (isUserAgentData(userAgentData)) {
|
||||
userAgentData
|
||||
.getHighEntropyValues(['architecture', 'model', 'platform', 'platformVersion', 'fullVersionList'])
|
||||
.then((ua) => {
|
||||
OS_PLATFORM = ua.platform || '';
|
||||
OS_ARCH = ua.architecture || '';
|
||||
OS_MODEL = ua.model || '';
|
||||
OS_PLATFORM_VERSION = ua.platformVersion || '';
|
||||
|
||||
if (ua.fullVersionList && ua.fullVersionList.length > 0) {
|
||||
const firstUa = ua.fullVersionList[ua.fullVersionList.length - 1];
|
||||
OS_BROWSER = `${firstUa.brand} ${firstUa.version}`;
|
||||
}
|
||||
})
|
||||
.catch(e => void e);
|
||||
}
|
||||
|
||||
function isProcessedJSSelfProfile(profile) {
|
||||
return !('thread_metadata' in profile);
|
||||
}
|
||||
|
||||
// Enriches the profile with threadId of the current thread.
|
||||
// This is done in node as we seem to not be able to get the info from C native code.
|
||||
/**
|
||||
*
|
||||
*/
|
||||
function enrichWithThreadInformation(profile) {
|
||||
if (!isProcessedJSSelfProfile(profile)) {
|
||||
return profile;
|
||||
}
|
||||
|
||||
return convertJSSelfProfileToSampledFormat(profile);
|
||||
}
|
||||
|
||||
// Profile is marked as optional because it is deleted from the metadata
|
||||
// by the integration before the event is processed by other integrations.
|
||||
|
||||
function getTraceId(event) {
|
||||
const traceId = event && event.contexts && event.contexts['trace'] && event.contexts['trace']['trace_id'];
|
||||
// Log a warning if the profile has an invalid traceId (should be uuidv4).
|
||||
// All profiles and transactions are rejected if this is the case and we want to
|
||||
// warn users that this is happening if they enable debug flag
|
||||
if (typeof traceId === 'string' && traceId.length !== 32) {
|
||||
if ((typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__)) {
|
||||
logger.log(`[Profiling] Invalid traceId: ${traceId} on profiled event`);
|
||||
}
|
||||
}
|
||||
if (typeof traceId !== 'string') {
|
||||
return '';
|
||||
}
|
||||
|
||||
return traceId;
|
||||
}
|
||||
/**
|
||||
* Creates a profiling event envelope from a Sentry event. If profile does not pass
|
||||
* validation, returns null.
|
||||
* @param event
|
||||
* @param dsn
|
||||
* @param metadata
|
||||
* @param tunnel
|
||||
* @returns {EventEnvelope | null}
|
||||
*/
|
||||
|
||||
/**
|
||||
* Creates a profiling event envelope from a Sentry event.
|
||||
*/
|
||||
function createProfilePayload(
|
||||
event,
|
||||
processedProfile,
|
||||
profile_id,
|
||||
) {
|
||||
if (event.type !== 'transaction') {
|
||||
// createProfilingEventEnvelope should only be called for transactions,
|
||||
// we type guard this behavior with isProfiledTransactionEvent.
|
||||
throw new TypeError('Profiling events may only be attached to transactions, this should never occur.');
|
||||
}
|
||||
|
||||
if (processedProfile === undefined || processedProfile === null) {
|
||||
throw new TypeError(
|
||||
`Cannot construct profiling event envelope without a valid profile. Got ${processedProfile} instead.`,
|
||||
);
|
||||
}
|
||||
|
||||
const traceId = getTraceId(event);
|
||||
const enrichedThreadProfile = enrichWithThreadInformation(processedProfile);
|
||||
const transactionStartMs = typeof event.start_timestamp === 'number' ? event.start_timestamp * 1000 : Date.now();
|
||||
const transactionEndMs = typeof event.timestamp === 'number' ? event.timestamp * 1000 : Date.now();
|
||||
|
||||
const profile = {
|
||||
event_id: profile_id,
|
||||
timestamp: new Date(transactionStartMs).toISOString(),
|
||||
platform: 'javascript',
|
||||
version: '1',
|
||||
release: event.release || '',
|
||||
environment: event.environment || DEFAULT_ENVIRONMENT,
|
||||
runtime: {
|
||||
name: 'javascript',
|
||||
version: WINDOW.navigator.userAgent,
|
||||
},
|
||||
os: {
|
||||
name: OS_PLATFORM,
|
||||
version: OS_PLATFORM_VERSION,
|
||||
build_number: OS_BROWSER,
|
||||
},
|
||||
device: {
|
||||
locale: OS_LOCALE,
|
||||
model: OS_MODEL,
|
||||
manufacturer: OS_BROWSER,
|
||||
architecture: OS_ARCH,
|
||||
is_emulator: false,
|
||||
},
|
||||
debug_meta: {
|
||||
images: applyDebugMetadata(processedProfile.resources),
|
||||
},
|
||||
profile: enrichedThreadProfile,
|
||||
transactions: [
|
||||
{
|
||||
name: event.transaction || '',
|
||||
id: event.event_id || uuid4(),
|
||||
trace_id: traceId,
|
||||
active_thread_id: THREAD_ID_STRING,
|
||||
relative_start_ns: '0',
|
||||
relative_end_ns: ((transactionEndMs - transactionStartMs) * 1e6).toFixed(0),
|
||||
},
|
||||
],
|
||||
};
|
||||
|
||||
return profile;
|
||||
}
|
||||
|
||||
/**
|
||||
* Converts a JSSelfProfile to a our sampled format.
|
||||
* Does not currently perform stack indexing.
|
||||
*/
|
||||
function convertJSSelfProfileToSampledFormat(input) {
|
||||
let EMPTY_STACK_ID = undefined;
|
||||
let STACK_ID = 0;
|
||||
|
||||
// Initialize the profile that we will fill with data
|
||||
const profile = {
|
||||
samples: [],
|
||||
stacks: [],
|
||||
frames: [],
|
||||
thread_metadata: {
|
||||
[THREAD_ID_STRING]: { name: THREAD_NAME },
|
||||
},
|
||||
};
|
||||
|
||||
if (!input.samples.length) {
|
||||
return profile;
|
||||
}
|
||||
|
||||
// We assert samples.length > 0 above and timestamp should always be present
|
||||
const start = input.samples[0].timestamp;
|
||||
|
||||
for (let i = 0; i < input.samples.length; i++) {
|
||||
const jsSample = input.samples[i];
|
||||
|
||||
// If sample has no stack, add an empty sample
|
||||
if (jsSample.stackId === undefined) {
|
||||
if (EMPTY_STACK_ID === undefined) {
|
||||
EMPTY_STACK_ID = STACK_ID;
|
||||
profile.stacks[EMPTY_STACK_ID] = [];
|
||||
STACK_ID++;
|
||||
}
|
||||
|
||||
profile['samples'][i] = {
|
||||
// convert ms timestamp to ns
|
||||
elapsed_since_start_ns: ((jsSample.timestamp - start) * MS_TO_NS).toFixed(0),
|
||||
stack_id: EMPTY_STACK_ID,
|
||||
thread_id: THREAD_ID_STRING,
|
||||
};
|
||||
continue;
|
||||
}
|
||||
|
||||
let stackTop = input.stacks[jsSample.stackId];
|
||||
|
||||
// Functions in top->down order (root is last)
|
||||
// We follow the stackTop.parentId trail and collect each visited frameId
|
||||
const stack = [];
|
||||
|
||||
while (stackTop) {
|
||||
stack.push(stackTop.frameId);
|
||||
|
||||
const frame = input.frames[stackTop.frameId];
|
||||
|
||||
// If our frame has not been indexed yet, index it
|
||||
if (profile.frames[stackTop.frameId] === undefined) {
|
||||
profile.frames[stackTop.frameId] = {
|
||||
function: frame.name,
|
||||
file: frame.resourceId ? input.resources[frame.resourceId] : undefined,
|
||||
line: frame.line,
|
||||
column: frame.column,
|
||||
};
|
||||
}
|
||||
|
||||
stackTop = stackTop.parentId === undefined ? undefined : input.stacks[stackTop.parentId];
|
||||
}
|
||||
|
||||
const sample = {
|
||||
// convert ms timestamp to ns
|
||||
elapsed_since_start_ns: ((jsSample.timestamp - start) * MS_TO_NS).toFixed(0),
|
||||
stack_id: STACK_ID,
|
||||
thread_id: THREAD_ID_STRING,
|
||||
};
|
||||
|
||||
profile['stacks'][STACK_ID] = stack;
|
||||
profile['samples'][i] = sample;
|
||||
STACK_ID++;
|
||||
}
|
||||
|
||||
return profile;
|
||||
}
|
||||
|
||||
/**
|
||||
* Adds items to envelope if they are not already present - mutates the envelope.
|
||||
* @param envelope
|
||||
*/
|
||||
function addProfilesToEnvelope(envelope, profiles) {
|
||||
if (!profiles.length) {
|
||||
return envelope;
|
||||
}
|
||||
|
||||
for (const profile of profiles) {
|
||||
// @ts-ignore untyped envelope
|
||||
envelope[1].push([{ type: 'profile' }, profile]);
|
||||
}
|
||||
return envelope;
|
||||
}
|
||||
|
||||
/**
|
||||
* Finds transactions with profile_id context in the envelope
|
||||
* @param envelope
|
||||
* @returns
|
||||
*/
|
||||
function findProfiledTransactionsFromEnvelope(envelope) {
|
||||
const events = [];
|
||||
|
||||
forEachEnvelopeItem(envelope, (item, type) => {
|
||||
if (type !== 'transaction') {
|
||||
return;
|
||||
}
|
||||
|
||||
for (let j = 1; j < item.length; j++) {
|
||||
const event = item[j] ;
|
||||
|
||||
if (event && event.contexts && event.contexts['profile'] && event.contexts['profile']['profile_id']) {
|
||||
events.push(item[j] );
|
||||
}
|
||||
}
|
||||
});
|
||||
|
||||
return events;
|
||||
}
|
||||
|
||||
const debugIdStackParserCache = new WeakMap();
|
||||
/**
|
||||
* Applies debug meta data to an event from a list of paths to resources (sourcemaps)
|
||||
*/
|
||||
function applyDebugMetadata(resource_paths) {
|
||||
const debugIdMap = GLOBAL_OBJ._sentryDebugIds;
|
||||
|
||||
if (!debugIdMap) {
|
||||
return [];
|
||||
}
|
||||
|
||||
const hub = getCurrentHub();
|
||||
if (!hub) {
|
||||
return [];
|
||||
}
|
||||
const client = hub.getClient();
|
||||
if (!client) {
|
||||
return [];
|
||||
}
|
||||
const options = client.getOptions();
|
||||
if (!options) {
|
||||
return [];
|
||||
}
|
||||
const stackParser = options.stackParser;
|
||||
if (!stackParser) {
|
||||
return [];
|
||||
}
|
||||
|
||||
let debugIdStackFramesCache;
|
||||
const cachedDebugIdStackFrameCache = debugIdStackParserCache.get(stackParser);
|
||||
if (cachedDebugIdStackFrameCache) {
|
||||
debugIdStackFramesCache = cachedDebugIdStackFrameCache;
|
||||
} else {
|
||||
debugIdStackFramesCache = new Map();
|
||||
debugIdStackParserCache.set(stackParser, debugIdStackFramesCache);
|
||||
}
|
||||
|
||||
// Build a map of filename -> debug_id
|
||||
const filenameDebugIdMap = Object.keys(debugIdMap).reduce((acc, debugIdStackTrace) => {
|
||||
let parsedStack;
|
||||
|
||||
const cachedParsedStack = debugIdStackFramesCache.get(debugIdStackTrace);
|
||||
if (cachedParsedStack) {
|
||||
parsedStack = cachedParsedStack;
|
||||
} else {
|
||||
parsedStack = stackParser(debugIdStackTrace);
|
||||
debugIdStackFramesCache.set(debugIdStackTrace, parsedStack);
|
||||
}
|
||||
|
||||
for (let i = parsedStack.length - 1; i >= 0; i--) {
|
||||
const stackFrame = parsedStack[i];
|
||||
const file = stackFrame && stackFrame.filename;
|
||||
|
||||
if (stackFrame && file) {
|
||||
acc[file] = debugIdMap[debugIdStackTrace] ;
|
||||
break;
|
||||
}
|
||||
}
|
||||
return acc;
|
||||
}, {});
|
||||
|
||||
const images = [];
|
||||
for (const path of resource_paths) {
|
||||
if (path && filenameDebugIdMap[path]) {
|
||||
images.push({
|
||||
type: 'sourcemap',
|
||||
code_file: path,
|
||||
debug_id: filenameDebugIdMap[path] ,
|
||||
});
|
||||
}
|
||||
}
|
||||
|
||||
return images;
|
||||
}
|
||||
|
||||
/**
|
||||
* Checks the given sample rate to make sure it is valid type and value (a boolean, or a number between 0 and 1).
|
||||
*/
|
||||
function isValidSampleRate(rate) {
|
||||
// we need to check NaN explicitly because it's of type 'number' and therefore wouldn't get caught by this typecheck
|
||||
if ((typeof rate !== 'number' && typeof rate !== 'boolean') || (typeof rate === 'number' && isNaN(rate))) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) &&
|
||||
logger.warn(
|
||||
`[Profiling] Invalid sample rate. Sample rate must be a boolean or a number between 0 and 1. Got ${JSON.stringify(
|
||||
rate,
|
||||
)} of type ${JSON.stringify(typeof rate)}.`,
|
||||
);
|
||||
return false;
|
||||
}
|
||||
|
||||
// Boolean sample rates are always valid
|
||||
if (rate === true || rate === false) {
|
||||
return true;
|
||||
}
|
||||
|
||||
// in case sampleRate is a boolean, it will get automatically cast to 1 if it's true and 0 if it's false
|
||||
if (rate < 0 || rate > 1) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) &&
|
||||
logger.warn(`[Profiling] Invalid sample rate. Sample rate must be between 0 and 1. Got ${rate}.`);
|
||||
return false;
|
||||
}
|
||||
return true;
|
||||
}
|
||||
|
||||
function isValidProfile(profile) {
|
||||
if (profile.samples.length < 2) {
|
||||
if ((typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__)) {
|
||||
// Log a warning if the profile has less than 2 samples so users can know why
|
||||
// they are not seeing any profiling data and we cant avoid the back and forth
|
||||
// of asking them to provide us with a dump of the profile data.
|
||||
logger.log('[Profiling] Discarding profile because it contains less than 2 samples');
|
||||
}
|
||||
return false;
|
||||
}
|
||||
|
||||
if (!profile.frames.length) {
|
||||
if ((typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__)) {
|
||||
logger.log('[Profiling] Discarding profile because it contains no frames');
|
||||
}
|
||||
return false;
|
||||
}
|
||||
|
||||
return true;
|
||||
}
|
||||
|
||||
/**
|
||||
* Creates a profiling envelope item, if the profile does not pass validation, returns null.
|
||||
* @param event
|
||||
* @returns {Profile | null}
|
||||
*/
|
||||
function createProfilingEvent(profile_id, profile, event) {
|
||||
if (!isValidProfile(profile)) {
|
||||
return null;
|
||||
}
|
||||
|
||||
return createProfilePayload(event, profile, profile_id);
|
||||
}
|
||||
|
||||
const PROFILE_MAP = new Map();
|
||||
/**
|
||||
*
|
||||
*/
|
||||
function addProfileToMap(profile_id, profile) {
|
||||
PROFILE_MAP.set(profile_id, profile);
|
||||
|
||||
if (PROFILE_MAP.size > 30) {
|
||||
const last = PROFILE_MAP.keys().next().value;
|
||||
PROFILE_MAP.delete(last);
|
||||
}
|
||||
}
|
||||
|
||||
export { PROFILE_MAP, addProfileToMap, addProfilesToEnvelope, applyDebugMetadata, convertJSSelfProfileToSampledFormat, createProfilePayload, createProfilingEvent, enrichWithThreadInformation, findProfiledTransactionsFromEnvelope, isValidSampleRate };
|
||||
//# sourceMappingURL=utils.js.map
|
||||
293
shared/logger/node_modules/@sentry/browser/esm/sdk.js
generated
vendored
Normal file
293
shared/logger/node_modules/@sentry/browser/esm/sdk.js
generated
vendored
Normal file
@@ -0,0 +1,293 @@
|
||||
import { Integrations, getIntegrationsToSetup, initAndBind, getReportDialogEndpoint, getCurrentHub } from '@sentry/core';
|
||||
import { stackParserFromStackParserOptions, supportsFetch, logger, resolvedSyncPromise, addInstrumentationHandler } from '@sentry/utils';
|
||||
import { BrowserClient } from './client.js';
|
||||
import { WINDOW, wrap as wrap$1 } from './helpers.js';
|
||||
import { GlobalHandlers } from './integrations/globalhandlers.js';
|
||||
import { TryCatch } from './integrations/trycatch.js';
|
||||
import { Breadcrumbs } from './integrations/breadcrumbs.js';
|
||||
import { LinkedErrors } from './integrations/linkederrors.js';
|
||||
import { HttpContext } from './integrations/httpcontext.js';
|
||||
import { Dedupe } from './integrations/dedupe.js';
|
||||
import { defaultStackParser } from './stack-parsers.js';
|
||||
import { makeFetchTransport } from './transports/fetch.js';
|
||||
import { makeXHRTransport } from './transports/xhr.js';
|
||||
|
||||
const defaultIntegrations = [
|
||||
new Integrations.InboundFilters(),
|
||||
new Integrations.FunctionToString(),
|
||||
new TryCatch(),
|
||||
new Breadcrumbs(),
|
||||
new GlobalHandlers(),
|
||||
new LinkedErrors(),
|
||||
new Dedupe(),
|
||||
new HttpContext(),
|
||||
];
|
||||
|
||||
/**
|
||||
* A magic string that build tooling can leverage in order to inject a release value into the SDK.
|
||||
*/
|
||||
|
||||
/**
|
||||
* The Sentry Browser SDK Client.
|
||||
*
|
||||
* To use this SDK, call the {@link init} function as early as possible when
|
||||
* loading the web page. To set context information or send manual events, use
|
||||
* the provided methods.
|
||||
*
|
||||
* @example
|
||||
*
|
||||
* ```
|
||||
*
|
||||
* import { init } from '@sentry/browser';
|
||||
*
|
||||
* init({
|
||||
* dsn: '__DSN__',
|
||||
* // ...
|
||||
* });
|
||||
* ```
|
||||
*
|
||||
* @example
|
||||
* ```
|
||||
*
|
||||
* import { configureScope } from '@sentry/browser';
|
||||
* configureScope((scope: Scope) => {
|
||||
* scope.setExtra({ battery: 0.7 });
|
||||
* scope.setTag({ user_mode: 'admin' });
|
||||
* scope.setUser({ id: '4711' });
|
||||
* });
|
||||
* ```
|
||||
*
|
||||
* @example
|
||||
* ```
|
||||
*
|
||||
* import { addBreadcrumb } from '@sentry/browser';
|
||||
* addBreadcrumb({
|
||||
* message: 'My Breadcrumb',
|
||||
* // ...
|
||||
* });
|
||||
* ```
|
||||
*
|
||||
* @example
|
||||
*
|
||||
* ```
|
||||
*
|
||||
* import * as Sentry from '@sentry/browser';
|
||||
* Sentry.captureMessage('Hello, world!');
|
||||
* Sentry.captureException(new Error('Good bye'));
|
||||
* Sentry.captureEvent({
|
||||
* message: 'Manual',
|
||||
* stacktrace: [
|
||||
* // ...
|
||||
* ],
|
||||
* });
|
||||
* ```
|
||||
*
|
||||
* @see {@link BrowserOptions} for documentation on configuration options.
|
||||
*/
|
||||
function init(options = {}) {
|
||||
if (options.defaultIntegrations === undefined) {
|
||||
options.defaultIntegrations = defaultIntegrations;
|
||||
}
|
||||
if (options.release === undefined) {
|
||||
// This allows build tooling to find-and-replace __SENTRY_RELEASE__ to inject a release value
|
||||
if (typeof __SENTRY_RELEASE__ === 'string') {
|
||||
options.release = __SENTRY_RELEASE__;
|
||||
}
|
||||
|
||||
// This supports the variable that sentry-webpack-plugin injects
|
||||
if (WINDOW.SENTRY_RELEASE && WINDOW.SENTRY_RELEASE.id) {
|
||||
options.release = WINDOW.SENTRY_RELEASE.id;
|
||||
}
|
||||
}
|
||||
if (options.autoSessionTracking === undefined) {
|
||||
options.autoSessionTracking = true;
|
||||
}
|
||||
if (options.sendClientReports === undefined) {
|
||||
options.sendClientReports = true;
|
||||
}
|
||||
|
||||
const clientOptions = {
|
||||
...options,
|
||||
stackParser: stackParserFromStackParserOptions(options.stackParser || defaultStackParser),
|
||||
integrations: getIntegrationsToSetup(options),
|
||||
transport: options.transport || (supportsFetch() ? makeFetchTransport : makeXHRTransport),
|
||||
};
|
||||
|
||||
initAndBind(BrowserClient, clientOptions);
|
||||
|
||||
if (options.autoSessionTracking) {
|
||||
startSessionTracking();
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Present the user with a report dialog.
|
||||
*
|
||||
* @param options Everything is optional, we try to fetch all info need from the global scope.
|
||||
*/
|
||||
function showReportDialog(options = {}, hub = getCurrentHub()) {
|
||||
// doesn't work without a document (React Native)
|
||||
if (!WINDOW.document) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.error('Global document not defined in showReportDialog call');
|
||||
return;
|
||||
}
|
||||
|
||||
const { client, scope } = hub.getStackTop();
|
||||
const dsn = options.dsn || (client && client.getDsn());
|
||||
if (!dsn) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.error('DSN not configured for showReportDialog call');
|
||||
return;
|
||||
}
|
||||
|
||||
if (scope) {
|
||||
options.user = {
|
||||
...scope.getUser(),
|
||||
...options.user,
|
||||
};
|
||||
}
|
||||
|
||||
if (!options.eventId) {
|
||||
options.eventId = hub.lastEventId();
|
||||
}
|
||||
|
||||
const script = WINDOW.document.createElement('script');
|
||||
script.async = true;
|
||||
script.src = getReportDialogEndpoint(dsn, options);
|
||||
|
||||
if (options.onLoad) {
|
||||
script.onload = options.onLoad;
|
||||
}
|
||||
|
||||
const injectionPoint = WINDOW.document.head || WINDOW.document.body;
|
||||
if (injectionPoint) {
|
||||
injectionPoint.appendChild(script);
|
||||
} else {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.error('Not injecting report dialog. No injection point found in HTML');
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* This is the getter for lastEventId.
|
||||
*
|
||||
* @returns The last event id of a captured event.
|
||||
*/
|
||||
function lastEventId() {
|
||||
return getCurrentHub().lastEventId();
|
||||
}
|
||||
|
||||
/**
|
||||
* This function is here to be API compatible with the loader.
|
||||
* @hidden
|
||||
*/
|
||||
function forceLoad() {
|
||||
// Noop
|
||||
}
|
||||
|
||||
/**
|
||||
* This function is here to be API compatible with the loader.
|
||||
* @hidden
|
||||
*/
|
||||
function onLoad(callback) {
|
||||
callback();
|
||||
}
|
||||
|
||||
/**
|
||||
* Call `flush()` on the current client, if there is one. See {@link Client.flush}.
|
||||
*
|
||||
* @param timeout Maximum time in ms the client should wait to flush its event queue. Omitting this parameter will cause
|
||||
* the client to wait until all events are sent before resolving the promise.
|
||||
* @returns A promise which resolves to `true` if the queue successfully drains before the timeout, or `false` if it
|
||||
* doesn't (or if there's no client defined).
|
||||
*/
|
||||
function flush(timeout) {
|
||||
const client = getCurrentHub().getClient();
|
||||
if (client) {
|
||||
return client.flush(timeout);
|
||||
}
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.warn('Cannot flush events. No client defined.');
|
||||
return resolvedSyncPromise(false);
|
||||
}
|
||||
|
||||
/**
|
||||
* Call `close()` on the current client, if there is one. See {@link Client.close}.
|
||||
*
|
||||
* @param timeout Maximum time in ms the client should wait to flush its event queue before shutting down. Omitting this
|
||||
* parameter will cause the client to wait until all events are sent before disabling itself.
|
||||
* @returns A promise which resolves to `true` if the queue successfully drains before the timeout, or `false` if it
|
||||
* doesn't (or if there's no client defined).
|
||||
*/
|
||||
function close(timeout) {
|
||||
const client = getCurrentHub().getClient();
|
||||
if (client) {
|
||||
return client.close(timeout);
|
||||
}
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.warn('Cannot flush events and disable SDK. No client defined.');
|
||||
return resolvedSyncPromise(false);
|
||||
}
|
||||
|
||||
/**
|
||||
* Wrap code within a try/catch block so the SDK is able to capture errors.
|
||||
*
|
||||
* @param fn A function to wrap.
|
||||
*
|
||||
* @returns The result of wrapped function call.
|
||||
*/
|
||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any
|
||||
function wrap(fn) {
|
||||
return wrap$1(fn)();
|
||||
}
|
||||
|
||||
function startSessionOnHub(hub) {
|
||||
hub.startSession({ ignoreDuration: true });
|
||||
hub.captureSession();
|
||||
}
|
||||
|
||||
/**
|
||||
* Enable automatic Session Tracking for the initial page load.
|
||||
*/
|
||||
function startSessionTracking() {
|
||||
if (typeof WINDOW.document === 'undefined') {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) &&
|
||||
logger.warn('Session tracking in non-browser environment with @sentry/browser is not supported.');
|
||||
return;
|
||||
}
|
||||
|
||||
const hub = getCurrentHub();
|
||||
|
||||
// The only way for this to be false is for there to be a version mismatch between @sentry/browser (>= 6.0.0) and
|
||||
// @sentry/hub (< 5.27.0). In the simple case, there won't ever be such a mismatch, because the two packages are
|
||||
// pinned at the same version in package.json, but there are edge cases where it's possible. See
|
||||
// https://github.com/getsentry/sentry-javascript/issues/3207 and
|
||||
// https://github.com/getsentry/sentry-javascript/issues/3234 and
|
||||
// https://github.com/getsentry/sentry-javascript/issues/3278.
|
||||
if (!hub.captureSession) {
|
||||
return;
|
||||
}
|
||||
|
||||
// The session duration for browser sessions does not track a meaningful
|
||||
// concept that can be used as a metric.
|
||||
// Automatically captured sessions are akin to page views, and thus we
|
||||
// discard their duration.
|
||||
startSessionOnHub(hub);
|
||||
|
||||
// We want to create a session for every navigation as well
|
||||
addInstrumentationHandler('history', ({ from, to }) => {
|
||||
// Don't create an additional session for the initial route or if the location did not change
|
||||
if (!(from === undefined || from === to)) {
|
||||
startSessionOnHub(getCurrentHub());
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
/**
|
||||
* Captures user feedback and sends it to Sentry.
|
||||
*/
|
||||
function captureUserFeedback(feedback) {
|
||||
const client = getCurrentHub().getClient();
|
||||
if (client) {
|
||||
client.captureUserFeedback(feedback);
|
||||
}
|
||||
}
|
||||
|
||||
export { captureUserFeedback, close, defaultIntegrations, flush, forceLoad, init, lastEventId, onLoad, showReportDialog, wrap };
|
||||
//# sourceMappingURL=sdk.js.map
|
||||
168
shared/logger/node_modules/@sentry/browser/esm/stack-parsers.js
generated
vendored
Normal file
168
shared/logger/node_modules/@sentry/browser/esm/stack-parsers.js
generated
vendored
Normal file
@@ -0,0 +1,168 @@
|
||||
import { createStackParser } from '@sentry/utils';
|
||||
|
||||
// global reference to slice
|
||||
const UNKNOWN_FUNCTION = '?';
|
||||
|
||||
const OPERA10_PRIORITY = 10;
|
||||
const OPERA11_PRIORITY = 20;
|
||||
const CHROME_PRIORITY = 30;
|
||||
const WINJS_PRIORITY = 40;
|
||||
const GECKO_PRIORITY = 50;
|
||||
|
||||
function createFrame(filename, func, lineno, colno) {
|
||||
const frame = {
|
||||
filename,
|
||||
function: func,
|
||||
in_app: true, // All browser frames are considered in_app
|
||||
};
|
||||
|
||||
if (lineno !== undefined) {
|
||||
frame.lineno = lineno;
|
||||
}
|
||||
|
||||
if (colno !== undefined) {
|
||||
frame.colno = colno;
|
||||
}
|
||||
|
||||
return frame;
|
||||
}
|
||||
|
||||
// Chromium based browsers: Chrome, Brave, new Opera, new Edge
|
||||
const chromeRegex =
|
||||
/^\s*at (?:(.+?\)(?: \[.+\])?|.*?) ?\((?:address at )?)?(?:async )?((?:<anonymous>|[-a-z]+:|.*bundle|\/)?.*?)(?::(\d+))?(?::(\d+))?\)?\s*$/i;
|
||||
const chromeEvalRegex = /\((\S*)(?::(\d+))(?::(\d+))\)/;
|
||||
|
||||
const chrome = line => {
|
||||
const parts = chromeRegex.exec(line);
|
||||
|
||||
if (parts) {
|
||||
const isEval = parts[2] && parts[2].indexOf('eval') === 0; // start of line
|
||||
|
||||
if (isEval) {
|
||||
const subMatch = chromeEvalRegex.exec(parts[2]);
|
||||
|
||||
if (subMatch) {
|
||||
// throw out eval line/column and use top-most line/column number
|
||||
parts[2] = subMatch[1]; // url
|
||||
parts[3] = subMatch[2]; // line
|
||||
parts[4] = subMatch[3]; // column
|
||||
}
|
||||
}
|
||||
|
||||
// Kamil: One more hack won't hurt us right? Understanding and adding more rules on top of these regexps right now
|
||||
// would be way too time consuming. (TODO: Rewrite whole RegExp to be more readable)
|
||||
const [func, filename] = extractSafariExtensionDetails(parts[1] || UNKNOWN_FUNCTION, parts[2]);
|
||||
|
||||
return createFrame(filename, func, parts[3] ? +parts[3] : undefined, parts[4] ? +parts[4] : undefined);
|
||||
}
|
||||
|
||||
return;
|
||||
};
|
||||
|
||||
const chromeStackLineParser = [CHROME_PRIORITY, chrome];
|
||||
|
||||
// gecko regex: `(?:bundle|\d+\.js)`: `bundle` is for react native, `\d+\.js` also but specifically for ram bundles because it
|
||||
// generates filenames without a prefix like `file://` the filenames in the stacktrace are just 42.js
|
||||
// We need this specific case for now because we want no other regex to match.
|
||||
const geckoREgex =
|
||||
/^\s*(.*?)(?:\((.*?)\))?(?:^|@)?((?:[-a-z]+)?:\/.*?|\[native code\]|[^@]*(?:bundle|\d+\.js)|\/[\w\-. /=]+)(?::(\d+))?(?::(\d+))?\s*$/i;
|
||||
const geckoEvalRegex = /(\S+) line (\d+)(?: > eval line \d+)* > eval/i;
|
||||
|
||||
const gecko = line => {
|
||||
const parts = geckoREgex.exec(line);
|
||||
|
||||
if (parts) {
|
||||
const isEval = parts[3] && parts[3].indexOf(' > eval') > -1;
|
||||
if (isEval) {
|
||||
const subMatch = geckoEvalRegex.exec(parts[3]);
|
||||
|
||||
if (subMatch) {
|
||||
// throw out eval line/column and use top-most line number
|
||||
parts[1] = parts[1] || 'eval';
|
||||
parts[3] = subMatch[1];
|
||||
parts[4] = subMatch[2];
|
||||
parts[5] = ''; // no column when eval
|
||||
}
|
||||
}
|
||||
|
||||
let filename = parts[3];
|
||||
let func = parts[1] || UNKNOWN_FUNCTION;
|
||||
[func, filename] = extractSafariExtensionDetails(func, filename);
|
||||
|
||||
return createFrame(filename, func, parts[4] ? +parts[4] : undefined, parts[5] ? +parts[5] : undefined);
|
||||
}
|
||||
|
||||
return;
|
||||
};
|
||||
|
||||
const geckoStackLineParser = [GECKO_PRIORITY, gecko];
|
||||
|
||||
const winjsRegex = /^\s*at (?:((?:\[object object\])?.+) )?\(?((?:[-a-z]+):.*?):(\d+)(?::(\d+))?\)?\s*$/i;
|
||||
|
||||
const winjs = line => {
|
||||
const parts = winjsRegex.exec(line);
|
||||
|
||||
return parts
|
||||
? createFrame(parts[2], parts[1] || UNKNOWN_FUNCTION, +parts[3], parts[4] ? +parts[4] : undefined)
|
||||
: undefined;
|
||||
};
|
||||
|
||||
const winjsStackLineParser = [WINJS_PRIORITY, winjs];
|
||||
|
||||
const opera10Regex = / line (\d+).*script (?:in )?(\S+)(?:: in function (\S+))?$/i;
|
||||
|
||||
const opera10 = line => {
|
||||
const parts = opera10Regex.exec(line);
|
||||
return parts ? createFrame(parts[2], parts[3] || UNKNOWN_FUNCTION, +parts[1]) : undefined;
|
||||
};
|
||||
|
||||
const opera10StackLineParser = [OPERA10_PRIORITY, opera10];
|
||||
|
||||
const opera11Regex =
|
||||
/ line (\d+), column (\d+)\s*(?:in (?:<anonymous function: ([^>]+)>|([^)]+))\(.*\))? in (.*):\s*$/i;
|
||||
|
||||
const opera11 = line => {
|
||||
const parts = opera11Regex.exec(line);
|
||||
return parts ? createFrame(parts[5], parts[3] || parts[4] || UNKNOWN_FUNCTION, +parts[1], +parts[2]) : undefined;
|
||||
};
|
||||
|
||||
const opera11StackLineParser = [OPERA11_PRIORITY, opera11];
|
||||
|
||||
const defaultStackLineParsers = [chromeStackLineParser, geckoStackLineParser, winjsStackLineParser];
|
||||
|
||||
const defaultStackParser = createStackParser(...defaultStackLineParsers);
|
||||
|
||||
/**
|
||||
* Safari web extensions, starting version unknown, can produce "frames-only" stacktraces.
|
||||
* What it means, is that instead of format like:
|
||||
*
|
||||
* Error: wat
|
||||
* at function@url:row:col
|
||||
* at function@url:row:col
|
||||
* at function@url:row:col
|
||||
*
|
||||
* it produces something like:
|
||||
*
|
||||
* function@url:row:col
|
||||
* function@url:row:col
|
||||
* function@url:row:col
|
||||
*
|
||||
* Because of that, it won't be captured by `chrome` RegExp and will fall into `Gecko` branch.
|
||||
* This function is extracted so that we can use it in both places without duplicating the logic.
|
||||
* Unfortunately "just" changing RegExp is too complicated now and making it pass all tests
|
||||
* and fix this case seems like an impossible, or at least way too time-consuming task.
|
||||
*/
|
||||
const extractSafariExtensionDetails = (func, filename) => {
|
||||
const isSafariExtension = func.indexOf('safari-extension') !== -1;
|
||||
const isSafariWebExtension = func.indexOf('safari-web-extension') !== -1;
|
||||
|
||||
return isSafariExtension || isSafariWebExtension
|
||||
? [
|
||||
func.indexOf('@') !== -1 ? func.split('@')[0] : UNKNOWN_FUNCTION,
|
||||
isSafariExtension ? `safari-extension:${filename}` : `safari-web-extension:${filename}`,
|
||||
]
|
||||
: [func, filename];
|
||||
};
|
||||
|
||||
export { chromeStackLineParser, defaultStackLineParsers, defaultStackParser, geckoStackLineParser, opera10StackLineParser, opera11StackLineParser, winjsStackLineParser };
|
||||
//# sourceMappingURL=stack-parsers.js.map
|
||||
64
shared/logger/node_modules/@sentry/browser/esm/transports/fetch.js
generated
vendored
Normal file
64
shared/logger/node_modules/@sentry/browser/esm/transports/fetch.js
generated
vendored
Normal file
@@ -0,0 +1,64 @@
|
||||
import { createTransport } from '@sentry/core';
|
||||
import { rejectedSyncPromise } from '@sentry/utils';
|
||||
import { getNativeFetchImplementation, clearCachedFetchImplementation } from './utils.js';
|
||||
|
||||
/**
|
||||
* Creates a Transport that uses the Fetch API to send events to Sentry.
|
||||
*/
|
||||
function makeFetchTransport(
|
||||
options,
|
||||
nativeFetch = getNativeFetchImplementation(),
|
||||
) {
|
||||
let pendingBodySize = 0;
|
||||
let pendingCount = 0;
|
||||
|
||||
function makeRequest(request) {
|
||||
const requestSize = request.body.length;
|
||||
pendingBodySize += requestSize;
|
||||
pendingCount++;
|
||||
|
||||
const requestOptions = {
|
||||
body: request.body,
|
||||
method: 'POST',
|
||||
referrerPolicy: 'origin',
|
||||
headers: options.headers,
|
||||
// Outgoing requests are usually cancelled when navigating to a different page, causing a "TypeError: Failed to
|
||||
// fetch" error and sending a "network_error" client-outcome - in Chrome, the request status shows "(cancelled)".
|
||||
// The `keepalive` flag keeps outgoing requests alive, even when switching pages. We want this since we're
|
||||
// frequently sending events right before the user is switching pages (eg. whenfinishing navigation transactions).
|
||||
// Gotchas:
|
||||
// - `keepalive` isn't supported by Firefox
|
||||
// - As per spec (https://fetch.spec.whatwg.org/#http-network-or-cache-fetch):
|
||||
// If the sum of contentLength and inflightKeepaliveBytes is greater than 64 kibibytes, then return a network error.
|
||||
// We will therefore only activate the flag when we're below that limit.
|
||||
// There is also a limit of requests that can be open at the same time, so we also limit this to 15
|
||||
// See https://github.com/getsentry/sentry-javascript/pull/7553 for details
|
||||
keepalive: pendingBodySize <= 60000 && pendingCount < 15,
|
||||
...options.fetchOptions,
|
||||
};
|
||||
|
||||
try {
|
||||
return nativeFetch(options.url, requestOptions).then(response => {
|
||||
pendingBodySize -= requestSize;
|
||||
pendingCount--;
|
||||
return {
|
||||
statusCode: response.status,
|
||||
headers: {
|
||||
'x-sentry-rate-limits': response.headers.get('X-Sentry-Rate-Limits'),
|
||||
'retry-after': response.headers.get('Retry-After'),
|
||||
},
|
||||
};
|
||||
});
|
||||
} catch (e) {
|
||||
clearCachedFetchImplementation();
|
||||
pendingBodySize -= requestSize;
|
||||
pendingCount--;
|
||||
return rejectedSyncPromise(e);
|
||||
}
|
||||
}
|
||||
|
||||
return createTransport(options, makeRequest);
|
||||
}
|
||||
|
||||
export { makeFetchTransport };
|
||||
//# sourceMappingURL=fetch.js.map
|
||||
133
shared/logger/node_modules/@sentry/browser/esm/transports/offline.js
generated
vendored
Normal file
133
shared/logger/node_modules/@sentry/browser/esm/transports/offline.js
generated
vendored
Normal file
@@ -0,0 +1,133 @@
|
||||
import { makeOfflineTransport } from '@sentry/core';
|
||||
import { serializeEnvelope, parseEnvelope } from '@sentry/utils';
|
||||
|
||||
// 'Store', 'promisifyRequest' and 'createStore' were originally copied from the 'idb-keyval' package before being
|
||||
// modified and simplified: https://github.com/jakearchibald/idb-keyval
|
||||
//
|
||||
// At commit: 0420a704fd6cbb4225429c536b1f61112d012fca
|
||||
// Original licence:
|
||||
|
||||
// Copyright 2016, Jake Archibald
|
||||
//
|
||||
// Licensed under the Apache License, Version 2.0 (the "License");
|
||||
// you may not use this file except in compliance with the License.
|
||||
// You may obtain a copy of the License at
|
||||
//
|
||||
// http://www.apache.org/licenses/LICENSE-2.0
|
||||
//
|
||||
// Unless required by applicable law or agreed to in writing, software
|
||||
// distributed under the License is distributed on an "AS IS" BASIS,
|
||||
// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||
// See the License for the specific language governing permissions and
|
||||
// limitations under the License.
|
||||
|
||||
function promisifyRequest(request) {
|
||||
return new Promise((resolve, reject) => {
|
||||
// @ts-ignore - file size hacks
|
||||
request.oncomplete = request.onsuccess = () => resolve(request.result);
|
||||
// @ts-ignore - file size hacks
|
||||
request.onabort = request.onerror = () => reject(request.error);
|
||||
});
|
||||
}
|
||||
|
||||
/** Create or open an IndexedDb store */
|
||||
function createStore(dbName, storeName) {
|
||||
const request = indexedDB.open(dbName);
|
||||
request.onupgradeneeded = () => request.result.createObjectStore(storeName);
|
||||
const dbp = promisifyRequest(request);
|
||||
|
||||
return callback => dbp.then(db => callback(db.transaction(storeName, 'readwrite').objectStore(storeName)));
|
||||
}
|
||||
|
||||
function keys(store) {
|
||||
return promisifyRequest(store.getAllKeys() );
|
||||
}
|
||||
|
||||
/** Insert into the store */
|
||||
function insert(store, value, maxQueueSize) {
|
||||
return store(store => {
|
||||
return keys(store).then(keys => {
|
||||
if (keys.length >= maxQueueSize) {
|
||||
return;
|
||||
}
|
||||
|
||||
// We insert with an incremented key so that the entries are popped in order
|
||||
store.put(value, Math.max(...keys, 0) + 1);
|
||||
return promisifyRequest(store.transaction);
|
||||
});
|
||||
});
|
||||
}
|
||||
|
||||
/** Pop the oldest value from the store */
|
||||
function pop(store) {
|
||||
return store(store => {
|
||||
return keys(store).then(keys => {
|
||||
if (keys.length === 0) {
|
||||
return undefined;
|
||||
}
|
||||
|
||||
return promisifyRequest(store.get(keys[0])).then(value => {
|
||||
store.delete(keys[0]);
|
||||
return promisifyRequest(store.transaction).then(() => value);
|
||||
});
|
||||
});
|
||||
});
|
||||
}
|
||||
|
||||
function createIndexedDbStore(options) {
|
||||
let store;
|
||||
|
||||
// Lazily create the store only when it's needed
|
||||
function getStore() {
|
||||
if (store == undefined) {
|
||||
store = createStore(options.dbName || 'sentry-offline', options.storeName || 'queue');
|
||||
}
|
||||
|
||||
return store;
|
||||
}
|
||||
|
||||
return {
|
||||
insert: async (env) => {
|
||||
try {
|
||||
const serialized = await serializeEnvelope(env, options.textEncoder);
|
||||
await insert(getStore(), serialized, options.maxQueueSize || 30);
|
||||
} catch (_) {
|
||||
//
|
||||
}
|
||||
},
|
||||
pop: async () => {
|
||||
try {
|
||||
const deserialized = await pop(getStore());
|
||||
if (deserialized) {
|
||||
return parseEnvelope(
|
||||
deserialized,
|
||||
options.textEncoder || new TextEncoder(),
|
||||
options.textDecoder || new TextDecoder(),
|
||||
);
|
||||
}
|
||||
} catch (_) {
|
||||
//
|
||||
}
|
||||
|
||||
return undefined;
|
||||
},
|
||||
};
|
||||
}
|
||||
|
||||
function makeIndexedDbOfflineTransport(
|
||||
createTransport,
|
||||
) {
|
||||
return options => createTransport({ ...options, createStore: createIndexedDbStore });
|
||||
}
|
||||
|
||||
/**
|
||||
* Creates a transport that uses IndexedDb to store events when offline.
|
||||
*/
|
||||
function makeBrowserOfflineTransport(
|
||||
createTransport,
|
||||
) {
|
||||
return makeIndexedDbOfflineTransport(makeOfflineTransport(createTransport));
|
||||
}
|
||||
|
||||
export { createStore, insert, makeBrowserOfflineTransport, pop };
|
||||
//# sourceMappingURL=offline.js.map
|
||||
85
shared/logger/node_modules/@sentry/browser/esm/transports/utils.js
generated
vendored
Normal file
85
shared/logger/node_modules/@sentry/browser/esm/transports/utils.js
generated
vendored
Normal file
@@ -0,0 +1,85 @@
|
||||
import { isNativeFetch, logger } from '@sentry/utils';
|
||||
import { WINDOW } from '../helpers.js';
|
||||
|
||||
let cachedFetchImpl = undefined;
|
||||
|
||||
/**
|
||||
* A special usecase for incorrectly wrapped Fetch APIs in conjunction with ad-blockers.
|
||||
* Whenever someone wraps the Fetch API and returns the wrong promise chain,
|
||||
* this chain becomes orphaned and there is no possible way to capture it's rejections
|
||||
* other than allowing it bubble up to this very handler. eg.
|
||||
*
|
||||
* const f = window.fetch;
|
||||
* window.fetch = function () {
|
||||
* const p = f.apply(this, arguments);
|
||||
*
|
||||
* p.then(function() {
|
||||
* console.log('hi.');
|
||||
* });
|
||||
*
|
||||
* return p;
|
||||
* }
|
||||
*
|
||||
* `p.then(function () { ... })` is producing a completely separate promise chain,
|
||||
* however, what's returned is `p` - the result of original `fetch` call.
|
||||
*
|
||||
* This mean, that whenever we use the Fetch API to send our own requests, _and_
|
||||
* some ad-blocker blocks it, this orphaned chain will _always_ reject,
|
||||
* effectively causing another event to be captured.
|
||||
* This makes a whole process become an infinite loop, which we need to somehow
|
||||
* deal with, and break it in one way or another.
|
||||
*
|
||||
* To deal with this issue, we are making sure that we _always_ use the real
|
||||
* browser Fetch API, instead of relying on what `window.fetch` exposes.
|
||||
* The only downside to this would be missing our own requests as breadcrumbs,
|
||||
* but because we are already not doing this, it should be just fine.
|
||||
*
|
||||
* Possible failed fetch error messages per-browser:
|
||||
*
|
||||
* Chrome: Failed to fetch
|
||||
* Edge: Failed to Fetch
|
||||
* Firefox: NetworkError when attempting to fetch resource
|
||||
* Safari: resource blocked by content blocker
|
||||
*/
|
||||
function getNativeFetchImplementation() {
|
||||
if (cachedFetchImpl) {
|
||||
return cachedFetchImpl;
|
||||
}
|
||||
|
||||
/* eslint-disable @typescript-eslint/unbound-method */
|
||||
|
||||
// Fast path to avoid DOM I/O
|
||||
if (isNativeFetch(WINDOW.fetch)) {
|
||||
return (cachedFetchImpl = WINDOW.fetch.bind(WINDOW));
|
||||
}
|
||||
|
||||
const document = WINDOW.document;
|
||||
let fetchImpl = WINDOW.fetch;
|
||||
// eslint-disable-next-line deprecation/deprecation
|
||||
if (document && typeof document.createElement === 'function') {
|
||||
try {
|
||||
const sandbox = document.createElement('iframe');
|
||||
sandbox.hidden = true;
|
||||
document.head.appendChild(sandbox);
|
||||
const contentWindow = sandbox.contentWindow;
|
||||
if (contentWindow && contentWindow.fetch) {
|
||||
fetchImpl = contentWindow.fetch;
|
||||
}
|
||||
document.head.removeChild(sandbox);
|
||||
} catch (e) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) &&
|
||||
logger.warn('Could not create sandbox iframe for pure fetch check, bailing to window.fetch: ', e);
|
||||
}
|
||||
}
|
||||
|
||||
return (cachedFetchImpl = fetchImpl.bind(WINDOW));
|
||||
/* eslint-enable @typescript-eslint/unbound-method */
|
||||
}
|
||||
|
||||
/** Clears cached fetch impl */
|
||||
function clearCachedFetchImplementation() {
|
||||
cachedFetchImpl = undefined;
|
||||
}
|
||||
|
||||
export { clearCachedFetchImplementation, getNativeFetchImplementation };
|
||||
//# sourceMappingURL=utils.js.map
|
||||
52
shared/logger/node_modules/@sentry/browser/esm/transports/xhr.js
generated
vendored
Normal file
52
shared/logger/node_modules/@sentry/browser/esm/transports/xhr.js
generated
vendored
Normal file
@@ -0,0 +1,52 @@
|
||||
import { createTransport } from '@sentry/core';
|
||||
import { SyncPromise } from '@sentry/utils';
|
||||
|
||||
/**
|
||||
* The DONE ready state for XmlHttpRequest
|
||||
*
|
||||
* Defining it here as a constant b/c XMLHttpRequest.DONE is not always defined
|
||||
* (e.g. during testing, it is `undefined`)
|
||||
*
|
||||
* @see {@link https://developer.mozilla.org/en-US/docs/Web/API/XMLHttpRequest/readyState}
|
||||
*/
|
||||
const XHR_READYSTATE_DONE = 4;
|
||||
|
||||
/**
|
||||
* Creates a Transport that uses the XMLHttpRequest API to send events to Sentry.
|
||||
*/
|
||||
function makeXHRTransport(options) {
|
||||
function makeRequest(request) {
|
||||
return new SyncPromise((resolve, reject) => {
|
||||
const xhr = new XMLHttpRequest();
|
||||
|
||||
xhr.onerror = reject;
|
||||
|
||||
xhr.onreadystatechange = () => {
|
||||
if (xhr.readyState === XHR_READYSTATE_DONE) {
|
||||
resolve({
|
||||
statusCode: xhr.status,
|
||||
headers: {
|
||||
'x-sentry-rate-limits': xhr.getResponseHeader('X-Sentry-Rate-Limits'),
|
||||
'retry-after': xhr.getResponseHeader('Retry-After'),
|
||||
},
|
||||
});
|
||||
}
|
||||
};
|
||||
|
||||
xhr.open('POST', options.url);
|
||||
|
||||
for (const header in options.headers) {
|
||||
if (Object.prototype.hasOwnProperty.call(options.headers, header)) {
|
||||
xhr.setRequestHeader(header, options.headers[header]);
|
||||
}
|
||||
}
|
||||
|
||||
xhr.send(request.body);
|
||||
});
|
||||
}
|
||||
|
||||
return createTransport(options, makeRequest);
|
||||
}
|
||||
|
||||
export { makeXHRTransport };
|
||||
//# sourceMappingURL=xhr.js.map
|
||||
41
shared/logger/node_modules/@sentry/browser/esm/userfeedback.js
generated
vendored
Normal file
41
shared/logger/node_modules/@sentry/browser/esm/userfeedback.js
generated
vendored
Normal file
@@ -0,0 +1,41 @@
|
||||
import { dsnToString, createEnvelope } from '@sentry/utils';
|
||||
|
||||
/**
|
||||
* Creates an envelope from a user feedback.
|
||||
*/
|
||||
function createUserFeedbackEnvelope(
|
||||
feedback,
|
||||
{
|
||||
metadata,
|
||||
tunnel,
|
||||
dsn,
|
||||
}
|
||||
|
||||
,
|
||||
) {
|
||||
const headers = {
|
||||
event_id: feedback.event_id,
|
||||
sent_at: new Date().toISOString(),
|
||||
...(metadata &&
|
||||
metadata.sdk && {
|
||||
sdk: {
|
||||
name: metadata.sdk.name,
|
||||
version: metadata.sdk.version,
|
||||
},
|
||||
}),
|
||||
...(!!tunnel && !!dsn && { dsn: dsnToString(dsn) }),
|
||||
};
|
||||
const item = createUserFeedbackEnvelopeItem(feedback);
|
||||
|
||||
return createEnvelope(headers, [item]);
|
||||
}
|
||||
|
||||
function createUserFeedbackEnvelopeItem(feedback) {
|
||||
const feedbackHeaders = {
|
||||
type: 'user_report',
|
||||
};
|
||||
return [feedbackHeaders, feedback];
|
||||
}
|
||||
|
||||
export { createUserFeedbackEnvelope };
|
||||
//# sourceMappingURL=userfeedback.js.map
|
||||
90
shared/logger/node_modules/@sentry/core/esm/api.js
generated
vendored
Normal file
90
shared/logger/node_modules/@sentry/core/esm/api.js
generated
vendored
Normal file
@@ -0,0 +1,90 @@
|
||||
import { makeDsn, dsnToString, urlEncode } from '@sentry/utils';
|
||||
|
||||
const SENTRY_API_VERSION = '7';
|
||||
|
||||
/** Returns the prefix to construct Sentry ingestion API endpoints. */
|
||||
function getBaseApiEndpoint(dsn) {
|
||||
const protocol = dsn.protocol ? `${dsn.protocol}:` : '';
|
||||
const port = dsn.port ? `:${dsn.port}` : '';
|
||||
return `${protocol}//${dsn.host}${port}${dsn.path ? `/${dsn.path}` : ''}/api/`;
|
||||
}
|
||||
|
||||
/** Returns the ingest API endpoint for target. */
|
||||
function _getIngestEndpoint(dsn) {
|
||||
return `${getBaseApiEndpoint(dsn)}${dsn.projectId}/envelope/`;
|
||||
}
|
||||
|
||||
/** Returns a URL-encoded string with auth config suitable for a query string. */
|
||||
function _encodedAuth(dsn, sdkInfo) {
|
||||
return urlEncode({
|
||||
// We send only the minimum set of required information. See
|
||||
// https://github.com/getsentry/sentry-javascript/issues/2572.
|
||||
sentry_key: dsn.publicKey,
|
||||
sentry_version: SENTRY_API_VERSION,
|
||||
...(sdkInfo && { sentry_client: `${sdkInfo.name}/${sdkInfo.version}` }),
|
||||
});
|
||||
}
|
||||
|
||||
/**
|
||||
* Returns the envelope endpoint URL with auth in the query string.
|
||||
*
|
||||
* Sending auth as part of the query string and not as custom HTTP headers avoids CORS preflight requests.
|
||||
*/
|
||||
function getEnvelopeEndpointWithUrlEncodedAuth(
|
||||
dsn,
|
||||
// TODO (v8): Remove `tunnelOrOptions` in favor of `options`, and use the substitute code below
|
||||
// options: ClientOptions = {} as ClientOptions,
|
||||
tunnelOrOptions = {} ,
|
||||
) {
|
||||
// TODO (v8): Use this code instead
|
||||
// const { tunnel, _metadata = {} } = options;
|
||||
// return tunnel ? tunnel : `${_getIngestEndpoint(dsn)}?${_encodedAuth(dsn, _metadata.sdk)}`;
|
||||
|
||||
const tunnel = typeof tunnelOrOptions === 'string' ? tunnelOrOptions : tunnelOrOptions.tunnel;
|
||||
const sdkInfo =
|
||||
typeof tunnelOrOptions === 'string' || !tunnelOrOptions._metadata ? undefined : tunnelOrOptions._metadata.sdk;
|
||||
|
||||
return tunnel ? tunnel : `${_getIngestEndpoint(dsn)}?${_encodedAuth(dsn, sdkInfo)}`;
|
||||
}
|
||||
|
||||
/** Returns the url to the report dialog endpoint. */
|
||||
function getReportDialogEndpoint(
|
||||
dsnLike,
|
||||
dialogOptions
|
||||
|
||||
,
|
||||
) {
|
||||
const dsn = makeDsn(dsnLike);
|
||||
if (!dsn) {
|
||||
return '';
|
||||
}
|
||||
|
||||
const endpoint = `${getBaseApiEndpoint(dsn)}embed/error-page/`;
|
||||
|
||||
let encodedOptions = `dsn=${dsnToString(dsn)}`;
|
||||
for (const key in dialogOptions) {
|
||||
if (key === 'dsn') {
|
||||
continue;
|
||||
}
|
||||
|
||||
if (key === 'user') {
|
||||
const user = dialogOptions.user;
|
||||
if (!user) {
|
||||
continue;
|
||||
}
|
||||
if (user.name) {
|
||||
encodedOptions += `&name=${encodeURIComponent(user.name)}`;
|
||||
}
|
||||
if (user.email) {
|
||||
encodedOptions += `&email=${encodeURIComponent(user.email)}`;
|
||||
}
|
||||
} else {
|
||||
encodedOptions += `&${encodeURIComponent(key)}=${encodeURIComponent(dialogOptions[key] )}`;
|
||||
}
|
||||
}
|
||||
|
||||
return `${endpoint}?${encodedOptions}`;
|
||||
}
|
||||
|
||||
export { getEnvelopeEndpointWithUrlEncodedAuth, getReportDialogEndpoint };
|
||||
//# sourceMappingURL=api.js.map
|
||||
674
shared/logger/node_modules/@sentry/core/esm/baseclient.js
generated
vendored
Normal file
674
shared/logger/node_modules/@sentry/core/esm/baseclient.js
generated
vendored
Normal file
@@ -0,0 +1,674 @@
|
||||
import { makeDsn, logger, checkOrSetAlreadyCaught, isPrimitive, resolvedSyncPromise, addItemToEnvelope, createAttachmentEnvelopeItem, SyncPromise, rejectedSyncPromise, SentryError, isThenable, isPlainObject } from '@sentry/utils';
|
||||
import { getEnvelopeEndpointWithUrlEncodedAuth } from './api.js';
|
||||
import { createEventEnvelope, createSessionEnvelope } from './envelope.js';
|
||||
import { setupIntegrations, setupIntegration } from './integration.js';
|
||||
import { updateSession } from './session.js';
|
||||
import { prepareEvent } from './utils/prepareEvent.js';
|
||||
|
||||
const ALREADY_SEEN_ERROR = "Not capturing exception because it's already been captured.";
|
||||
|
||||
/**
|
||||
* Base implementation for all JavaScript SDK clients.
|
||||
*
|
||||
* Call the constructor with the corresponding options
|
||||
* specific to the client subclass. To access these options later, use
|
||||
* {@link Client.getOptions}.
|
||||
*
|
||||
* If a Dsn is specified in the options, it will be parsed and stored. Use
|
||||
* {@link Client.getDsn} to retrieve the Dsn at any moment. In case the Dsn is
|
||||
* invalid, the constructor will throw a {@link SentryException}. Note that
|
||||
* without a valid Dsn, the SDK will not send any events to Sentry.
|
||||
*
|
||||
* Before sending an event, it is passed through
|
||||
* {@link BaseClient._prepareEvent} to add SDK information and scope data
|
||||
* (breadcrumbs and context). To add more custom information, override this
|
||||
* method and extend the resulting prepared event.
|
||||
*
|
||||
* To issue automatically created events (e.g. via instrumentation), use
|
||||
* {@link Client.captureEvent}. It will prepare the event and pass it through
|
||||
* the callback lifecycle. To issue auto-breadcrumbs, use
|
||||
* {@link Client.addBreadcrumb}.
|
||||
*
|
||||
* @example
|
||||
* class NodeClient extends BaseClient<NodeOptions> {
|
||||
* public constructor(options: NodeOptions) {
|
||||
* super(options);
|
||||
* }
|
||||
*
|
||||
* // ...
|
||||
* }
|
||||
*/
|
||||
class BaseClient {
|
||||
/** Options passed to the SDK. */
|
||||
|
||||
/** The client Dsn, if specified in options. Without this Dsn, the SDK will be disabled. */
|
||||
|
||||
/** Array of set up integrations. */
|
||||
__init() {this._integrations = {};}
|
||||
|
||||
/** Indicates whether this client's integrations have been set up. */
|
||||
__init2() {this._integrationsInitialized = false;}
|
||||
|
||||
/** Number of calls being processed */
|
||||
__init3() {this._numProcessing = 0;}
|
||||
|
||||
/** Holds flushable */
|
||||
__init4() {this._outcomes = {};}
|
||||
|
||||
// eslint-disable-next-line @typescript-eslint/ban-types
|
||||
__init5() {this._hooks = {};}
|
||||
|
||||
/**
|
||||
* Initializes this client instance.
|
||||
*
|
||||
* @param options Options for the client.
|
||||
*/
|
||||
constructor(options) {BaseClient.prototype.__init.call(this);BaseClient.prototype.__init2.call(this);BaseClient.prototype.__init3.call(this);BaseClient.prototype.__init4.call(this);BaseClient.prototype.__init5.call(this);
|
||||
this._options = options;
|
||||
|
||||
if (options.dsn) {
|
||||
this._dsn = makeDsn(options.dsn);
|
||||
} else {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.warn('No DSN provided, client will not do anything.');
|
||||
}
|
||||
|
||||
if (this._dsn) {
|
||||
const url = getEnvelopeEndpointWithUrlEncodedAuth(this._dsn, options);
|
||||
this._transport = options.transport({
|
||||
recordDroppedEvent: this.recordDroppedEvent.bind(this),
|
||||
...options.transportOptions,
|
||||
url,
|
||||
});
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any, @typescript-eslint/explicit-module-boundary-types
|
||||
captureException(exception, hint, scope) {
|
||||
// ensure we haven't captured this very object before
|
||||
if (checkOrSetAlreadyCaught(exception)) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.log(ALREADY_SEEN_ERROR);
|
||||
return;
|
||||
}
|
||||
|
||||
let eventId = hint && hint.event_id;
|
||||
|
||||
this._process(
|
||||
this.eventFromException(exception, hint)
|
||||
.then(event => this._captureEvent(event, hint, scope))
|
||||
.then(result => {
|
||||
eventId = result;
|
||||
}),
|
||||
);
|
||||
|
||||
return eventId;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
captureMessage(
|
||||
message,
|
||||
// eslint-disable-next-line deprecation/deprecation
|
||||
level,
|
||||
hint,
|
||||
scope,
|
||||
) {
|
||||
let eventId = hint && hint.event_id;
|
||||
|
||||
const promisedEvent = isPrimitive(message)
|
||||
? this.eventFromMessage(String(message), level, hint)
|
||||
: this.eventFromException(message, hint);
|
||||
|
||||
this._process(
|
||||
promisedEvent
|
||||
.then(event => this._captureEvent(event, hint, scope))
|
||||
.then(result => {
|
||||
eventId = result;
|
||||
}),
|
||||
);
|
||||
|
||||
return eventId;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
captureEvent(event, hint, scope) {
|
||||
// ensure we haven't captured this very object before
|
||||
if (hint && hint.originalException && checkOrSetAlreadyCaught(hint.originalException)) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.log(ALREADY_SEEN_ERROR);
|
||||
return;
|
||||
}
|
||||
|
||||
let eventId = hint && hint.event_id;
|
||||
|
||||
this._process(
|
||||
this._captureEvent(event, hint, scope).then(result => {
|
||||
eventId = result;
|
||||
}),
|
||||
);
|
||||
|
||||
return eventId;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
captureSession(session) {
|
||||
if (!this._isEnabled()) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.warn('SDK not enabled, will not capture session.');
|
||||
return;
|
||||
}
|
||||
|
||||
if (!(typeof session.release === 'string')) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.warn('Discarded session because of missing or non-string release');
|
||||
} else {
|
||||
this.sendSession(session);
|
||||
// After sending, we set init false to indicate it's not the first occurrence
|
||||
updateSession(session, { init: false });
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
getDsn() {
|
||||
return this._dsn;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
getOptions() {
|
||||
return this._options;
|
||||
}
|
||||
|
||||
/**
|
||||
* @see SdkMetadata in @sentry/types
|
||||
*
|
||||
* @return The metadata of the SDK
|
||||
*/
|
||||
getSdkMetadata() {
|
||||
return this._options._metadata;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
getTransport() {
|
||||
return this._transport;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
flush(timeout) {
|
||||
const transport = this._transport;
|
||||
if (transport) {
|
||||
return this._isClientDoneProcessing(timeout).then(clientFinished => {
|
||||
return transport.flush(timeout).then(transportFlushed => clientFinished && transportFlushed);
|
||||
});
|
||||
} else {
|
||||
return resolvedSyncPromise(true);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
close(timeout) {
|
||||
return this.flush(timeout).then(result => {
|
||||
this.getOptions().enabled = false;
|
||||
return result;
|
||||
});
|
||||
}
|
||||
|
||||
/**
|
||||
* Sets up the integrations
|
||||
*/
|
||||
setupIntegrations() {
|
||||
if (this._isEnabled() && !this._integrationsInitialized) {
|
||||
this._integrations = setupIntegrations(this._options.integrations);
|
||||
this._integrationsInitialized = true;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets an installed integration by its `id`.
|
||||
*
|
||||
* @returns The installed integration or `undefined` if no integration with that `id` was installed.
|
||||
*/
|
||||
getIntegrationById(integrationId) {
|
||||
return this._integrations[integrationId];
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
getIntegration(integration) {
|
||||
try {
|
||||
return (this._integrations[integration.id] ) || null;
|
||||
} catch (_oO) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.warn(`Cannot retrieve integration ${integration.id} from the current Client`);
|
||||
return null;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
addIntegration(integration) {
|
||||
setupIntegration(integration, this._integrations);
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
sendEvent(event, hint = {}) {
|
||||
if (this._dsn) {
|
||||
let env = createEventEnvelope(event, this._dsn, this._options._metadata, this._options.tunnel);
|
||||
|
||||
for (const attachment of hint.attachments || []) {
|
||||
env = addItemToEnvelope(
|
||||
env,
|
||||
createAttachmentEnvelopeItem(
|
||||
attachment,
|
||||
this._options.transportOptions && this._options.transportOptions.textEncoder,
|
||||
),
|
||||
);
|
||||
}
|
||||
|
||||
const promise = this._sendEnvelope(env);
|
||||
if (promise) {
|
||||
promise.then(sendResponse => this.emit('afterSendEvent', event, sendResponse), null);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
sendSession(session) {
|
||||
if (this._dsn) {
|
||||
const env = createSessionEnvelope(session, this._dsn, this._options._metadata, this._options.tunnel);
|
||||
void this._sendEnvelope(env);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
recordDroppedEvent(reason, category, _event) {
|
||||
// Note: we use `event` in replay, where we overwrite this hook.
|
||||
|
||||
if (this._options.sendClientReports) {
|
||||
// We want to track each category (error, transaction, session, replay_event) separately
|
||||
// but still keep the distinction between different type of outcomes.
|
||||
// We could use nested maps, but it's much easier to read and type this way.
|
||||
// A correct type for map-based implementation if we want to go that route
|
||||
// would be `Partial<Record<SentryRequestType, Partial<Record<Outcome, number>>>>`
|
||||
// With typescript 4.1 we could even use template literal types
|
||||
const key = `${reason}:${category}`;
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.log(`Adding outcome: "${key}"`);
|
||||
|
||||
// The following works because undefined + 1 === NaN and NaN is falsy
|
||||
this._outcomes[key] = this._outcomes[key] + 1 || 1;
|
||||
}
|
||||
}
|
||||
|
||||
// Keep on() & emit() signatures in sync with types' client.ts interface
|
||||
|
||||
/** @inheritdoc */
|
||||
|
||||
/** @inheritdoc */
|
||||
on(hook, callback) {
|
||||
if (!this._hooks[hook]) {
|
||||
this._hooks[hook] = [];
|
||||
}
|
||||
|
||||
// @ts-ignore We assue the types are correct
|
||||
this._hooks[hook].push(callback);
|
||||
}
|
||||
|
||||
/** @inheritdoc */
|
||||
|
||||
/** @inheritdoc */
|
||||
emit(hook, ...rest) {
|
||||
if (this._hooks[hook]) {
|
||||
// @ts-ignore we cannot enforce the callback to match the hook
|
||||
this._hooks[hook].forEach(callback => callback(...rest));
|
||||
}
|
||||
}
|
||||
|
||||
/** Updates existing session based on the provided event */
|
||||
_updateSessionFromEvent(session, event) {
|
||||
let crashed = false;
|
||||
let errored = false;
|
||||
const exceptions = event.exception && event.exception.values;
|
||||
|
||||
if (exceptions) {
|
||||
errored = true;
|
||||
|
||||
for (const ex of exceptions) {
|
||||
const mechanism = ex.mechanism;
|
||||
if (mechanism && mechanism.handled === false) {
|
||||
crashed = true;
|
||||
break;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
// A session is updated and that session update is sent in only one of the two following scenarios:
|
||||
// 1. Session with non terminal status and 0 errors + an error occurred -> Will set error count to 1 and send update
|
||||
// 2. Session with non terminal status and 1 error + a crash occurred -> Will set status crashed and send update
|
||||
const sessionNonTerminal = session.status === 'ok';
|
||||
const shouldUpdateAndSend = (sessionNonTerminal && session.errors === 0) || (sessionNonTerminal && crashed);
|
||||
|
||||
if (shouldUpdateAndSend) {
|
||||
updateSession(session, {
|
||||
...(crashed && { status: 'crashed' }),
|
||||
errors: session.errors || Number(errored || crashed),
|
||||
});
|
||||
this.captureSession(session);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Determine if the client is finished processing. Returns a promise because it will wait `timeout` ms before saying
|
||||
* "no" (resolving to `false`) in order to give the client a chance to potentially finish first.
|
||||
*
|
||||
* @param timeout The time, in ms, after which to resolve to `false` if the client is still busy. Passing `0` (or not
|
||||
* passing anything) will make the promise wait as long as it takes for processing to finish before resolving to
|
||||
* `true`.
|
||||
* @returns A promise which will resolve to `true` if processing is already done or finishes before the timeout, and
|
||||
* `false` otherwise
|
||||
*/
|
||||
_isClientDoneProcessing(timeout) {
|
||||
return new SyncPromise(resolve => {
|
||||
let ticked = 0;
|
||||
const tick = 1;
|
||||
|
||||
const interval = setInterval(() => {
|
||||
if (this._numProcessing == 0) {
|
||||
clearInterval(interval);
|
||||
resolve(true);
|
||||
} else {
|
||||
ticked += tick;
|
||||
if (timeout && ticked >= timeout) {
|
||||
clearInterval(interval);
|
||||
resolve(false);
|
||||
}
|
||||
}
|
||||
}, tick);
|
||||
});
|
||||
}
|
||||
|
||||
/** Determines whether this SDK is enabled and a valid Dsn is present. */
|
||||
_isEnabled() {
|
||||
return this.getOptions().enabled !== false && this._dsn !== undefined;
|
||||
}
|
||||
|
||||
/**
|
||||
* Adds common information to events.
|
||||
*
|
||||
* The information includes release and environment from `options`,
|
||||
* breadcrumbs and context (extra, tags and user) from the scope.
|
||||
*
|
||||
* Information that is already present in the event is never overwritten. For
|
||||
* nested objects, such as the context, keys are merged.
|
||||
*
|
||||
* @param event The original event.
|
||||
* @param hint May contain additional information about the original exception.
|
||||
* @param scope A scope containing event metadata.
|
||||
* @returns A new event with more information.
|
||||
*/
|
||||
_prepareEvent(event, hint, scope) {
|
||||
const options = this.getOptions();
|
||||
const integrations = Object.keys(this._integrations);
|
||||
if (!hint.integrations && integrations.length > 0) {
|
||||
hint.integrations = integrations;
|
||||
}
|
||||
return prepareEvent(options, event, hint, scope);
|
||||
}
|
||||
|
||||
/**
|
||||
* Processes the event and logs an error in case of rejection
|
||||
* @param event
|
||||
* @param hint
|
||||
* @param scope
|
||||
*/
|
||||
_captureEvent(event, hint = {}, scope) {
|
||||
return this._processEvent(event, hint, scope).then(
|
||||
finalEvent => {
|
||||
return finalEvent.event_id;
|
||||
},
|
||||
reason => {
|
||||
if ((typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__)) {
|
||||
// If something's gone wrong, log the error as a warning. If it's just us having used a `SentryError` for
|
||||
// control flow, log just the message (no stack) as a log-level log.
|
||||
const sentryError = reason ;
|
||||
if (sentryError.logLevel === 'log') {
|
||||
logger.log(sentryError.message);
|
||||
} else {
|
||||
logger.warn(sentryError);
|
||||
}
|
||||
}
|
||||
return undefined;
|
||||
},
|
||||
);
|
||||
}
|
||||
|
||||
/**
|
||||
* Processes an event (either error or message) and sends it to Sentry.
|
||||
*
|
||||
* This also adds breadcrumbs and context information to the event. However,
|
||||
* platform specific meta data (such as the User's IP address) must be added
|
||||
* by the SDK implementor.
|
||||
*
|
||||
*
|
||||
* @param event The event to send to Sentry.
|
||||
* @param hint May contain additional information about the original exception.
|
||||
* @param scope A scope containing event metadata.
|
||||
* @returns A SyncPromise that resolves with the event or rejects in case event was/will not be send.
|
||||
*/
|
||||
_processEvent(event, hint, scope) {
|
||||
const options = this.getOptions();
|
||||
const { sampleRate } = options;
|
||||
|
||||
if (!this._isEnabled()) {
|
||||
return rejectedSyncPromise(new SentryError('SDK not enabled, will not capture event.', 'log'));
|
||||
}
|
||||
|
||||
const isTransaction = isTransactionEvent(event);
|
||||
const isError = isErrorEvent(event);
|
||||
const eventType = event.type || 'error';
|
||||
const beforeSendLabel = `before send for type \`${eventType}\``;
|
||||
|
||||
// 1.0 === 100% events are sent
|
||||
// 0.0 === 0% events are sent
|
||||
// Sampling for transaction happens somewhere else
|
||||
if (isError && typeof sampleRate === 'number' && Math.random() > sampleRate) {
|
||||
this.recordDroppedEvent('sample_rate', 'error', event);
|
||||
return rejectedSyncPromise(
|
||||
new SentryError(
|
||||
`Discarding event because it's not included in the random sample (sampling rate = ${sampleRate})`,
|
||||
'log',
|
||||
),
|
||||
);
|
||||
}
|
||||
|
||||
const dataCategory = eventType === 'replay_event' ? 'replay' : eventType;
|
||||
|
||||
return this._prepareEvent(event, hint, scope)
|
||||
.then(prepared => {
|
||||
if (prepared === null) {
|
||||
this.recordDroppedEvent('event_processor', dataCategory, event);
|
||||
throw new SentryError('An event processor returned `null`, will not send event.', 'log');
|
||||
}
|
||||
|
||||
const isInternalException = hint.data && (hint.data ).__sentry__ === true;
|
||||
if (isInternalException) {
|
||||
return prepared;
|
||||
}
|
||||
|
||||
const result = processBeforeSend(options, prepared, hint);
|
||||
return _validateBeforeSendResult(result, beforeSendLabel);
|
||||
})
|
||||
.then(processedEvent => {
|
||||
if (processedEvent === null) {
|
||||
this.recordDroppedEvent('before_send', dataCategory, event);
|
||||
throw new SentryError(`${beforeSendLabel} returned \`null\`, will not send event.`, 'log');
|
||||
}
|
||||
|
||||
const session = scope && scope.getSession();
|
||||
if (!isTransaction && session) {
|
||||
this._updateSessionFromEvent(session, processedEvent);
|
||||
}
|
||||
|
||||
// None of the Sentry built event processor will update transaction name,
|
||||
// so if the transaction name has been changed by an event processor, we know
|
||||
// it has to come from custom event processor added by a user
|
||||
const transactionInfo = processedEvent.transaction_info;
|
||||
if (isTransaction && transactionInfo && processedEvent.transaction !== event.transaction) {
|
||||
const source = 'custom';
|
||||
processedEvent.transaction_info = {
|
||||
...transactionInfo,
|
||||
source,
|
||||
};
|
||||
}
|
||||
|
||||
this.sendEvent(processedEvent, hint);
|
||||
return processedEvent;
|
||||
})
|
||||
.then(null, reason => {
|
||||
if (reason instanceof SentryError) {
|
||||
throw reason;
|
||||
}
|
||||
|
||||
this.captureException(reason, {
|
||||
data: {
|
||||
__sentry__: true,
|
||||
},
|
||||
originalException: reason,
|
||||
});
|
||||
throw new SentryError(
|
||||
`Event processing pipeline threw an error, original event will not be sent. Details have been sent as a new event.\nReason: ${reason}`,
|
||||
);
|
||||
});
|
||||
}
|
||||
|
||||
/**
|
||||
* Occupies the client with processing and event
|
||||
*/
|
||||
_process(promise) {
|
||||
this._numProcessing++;
|
||||
void promise.then(
|
||||
value => {
|
||||
this._numProcessing--;
|
||||
return value;
|
||||
},
|
||||
reason => {
|
||||
this._numProcessing--;
|
||||
return reason;
|
||||
},
|
||||
);
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritdoc
|
||||
*/
|
||||
_sendEnvelope(envelope) {
|
||||
if (this._transport && this._dsn) {
|
||||
this.emit('beforeEnvelope', envelope);
|
||||
|
||||
return this._transport.send(envelope).then(null, reason => {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.error('Error while sending event:', reason);
|
||||
});
|
||||
} else {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.error('Transport disabled');
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Clears outcomes on this client and returns them.
|
||||
*/
|
||||
_clearOutcomes() {
|
||||
const outcomes = this._outcomes;
|
||||
this._outcomes = {};
|
||||
return Object.keys(outcomes).map(key => {
|
||||
const [reason, category] = key.split(':') ;
|
||||
return {
|
||||
reason,
|
||||
category,
|
||||
quantity: outcomes[key],
|
||||
};
|
||||
});
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any, @typescript-eslint/explicit-module-boundary-types
|
||||
|
||||
}
|
||||
|
||||
/**
|
||||
* Verifies that return value of configured `beforeSend` or `beforeSendTransaction` is of expected type, and returns the value if so.
|
||||
*/
|
||||
function _validateBeforeSendResult(
|
||||
beforeSendResult,
|
||||
beforeSendLabel,
|
||||
) {
|
||||
const invalidValueError = `${beforeSendLabel} must return \`null\` or a valid event.`;
|
||||
if (isThenable(beforeSendResult)) {
|
||||
return beforeSendResult.then(
|
||||
event => {
|
||||
if (!isPlainObject(event) && event !== null) {
|
||||
throw new SentryError(invalidValueError);
|
||||
}
|
||||
return event;
|
||||
},
|
||||
e => {
|
||||
throw new SentryError(`${beforeSendLabel} rejected with ${e}`);
|
||||
},
|
||||
);
|
||||
} else if (!isPlainObject(beforeSendResult) && beforeSendResult !== null) {
|
||||
throw new SentryError(invalidValueError);
|
||||
}
|
||||
return beforeSendResult;
|
||||
}
|
||||
|
||||
/**
|
||||
* Process the matching `beforeSendXXX` callback.
|
||||
*/
|
||||
function processBeforeSend(
|
||||
options,
|
||||
event,
|
||||
hint,
|
||||
) {
|
||||
const { beforeSend, beforeSendTransaction } = options;
|
||||
|
||||
if (isErrorEvent(event) && beforeSend) {
|
||||
return beforeSend(event, hint);
|
||||
}
|
||||
|
||||
if (isTransactionEvent(event) && beforeSendTransaction) {
|
||||
return beforeSendTransaction(event, hint);
|
||||
}
|
||||
|
||||
return event;
|
||||
}
|
||||
|
||||
function isErrorEvent(event) {
|
||||
return event.type === undefined;
|
||||
}
|
||||
|
||||
function isTransactionEvent(event) {
|
||||
return event.type === 'transaction';
|
||||
}
|
||||
|
||||
export { BaseClient };
|
||||
//# sourceMappingURL=baseclient.js.map
|
||||
4
shared/logger/node_modules/@sentry/core/esm/constants.js
generated
vendored
Normal file
4
shared/logger/node_modules/@sentry/core/esm/constants.js
generated
vendored
Normal file
@@ -0,0 +1,4 @@
|
||||
const DEFAULT_ENVIRONMENT = 'production';
|
||||
|
||||
export { DEFAULT_ENVIRONMENT };
|
||||
//# sourceMappingURL=constants.js.map
|
||||
74
shared/logger/node_modules/@sentry/core/esm/envelope.js
generated
vendored
Normal file
74
shared/logger/node_modules/@sentry/core/esm/envelope.js
generated
vendored
Normal file
@@ -0,0 +1,74 @@
|
||||
import { getSdkMetadataForEnvelopeHeader, dsnToString, createEnvelope, createEventEnvelopeHeaders } from '@sentry/utils';
|
||||
|
||||
/**
|
||||
* Apply SdkInfo (name, version, packages, integrations) to the corresponding event key.
|
||||
* Merge with existing data if any.
|
||||
**/
|
||||
function enhanceEventWithSdkInfo(event, sdkInfo) {
|
||||
if (!sdkInfo) {
|
||||
return event;
|
||||
}
|
||||
event.sdk = event.sdk || {};
|
||||
event.sdk.name = event.sdk.name || sdkInfo.name;
|
||||
event.sdk.version = event.sdk.version || sdkInfo.version;
|
||||
event.sdk.integrations = [...(event.sdk.integrations || []), ...(sdkInfo.integrations || [])];
|
||||
event.sdk.packages = [...(event.sdk.packages || []), ...(sdkInfo.packages || [])];
|
||||
return event;
|
||||
}
|
||||
|
||||
/** Creates an envelope from a Session */
|
||||
function createSessionEnvelope(
|
||||
session,
|
||||
dsn,
|
||||
metadata,
|
||||
tunnel,
|
||||
) {
|
||||
const sdkInfo = getSdkMetadataForEnvelopeHeader(metadata);
|
||||
const envelopeHeaders = {
|
||||
sent_at: new Date().toISOString(),
|
||||
...(sdkInfo && { sdk: sdkInfo }),
|
||||
...(!!tunnel && { dsn: dsnToString(dsn) }),
|
||||
};
|
||||
|
||||
const envelopeItem =
|
||||
'aggregates' in session ? [{ type: 'sessions' }, session] : [{ type: 'session' }, session.toJSON()];
|
||||
|
||||
return createEnvelope(envelopeHeaders, [envelopeItem]);
|
||||
}
|
||||
|
||||
/**
|
||||
* Create an Envelope from an event.
|
||||
*/
|
||||
function createEventEnvelope(
|
||||
event,
|
||||
dsn,
|
||||
metadata,
|
||||
tunnel,
|
||||
) {
|
||||
const sdkInfo = getSdkMetadataForEnvelopeHeader(metadata);
|
||||
|
||||
/*
|
||||
Note: Due to TS, event.type may be `replay_event`, theoretically.
|
||||
In practice, we never call `createEventEnvelope` with `replay_event` type,
|
||||
and we'd have to adjut a looot of types to make this work properly.
|
||||
We want to avoid casting this around, as that could lead to bugs (e.g. when we add another type)
|
||||
So the safe choice is to really guard against the replay_event type here.
|
||||
*/
|
||||
const eventType = event.type && event.type !== 'replay_event' ? event.type : 'event';
|
||||
|
||||
enhanceEventWithSdkInfo(event, metadata && metadata.sdk);
|
||||
|
||||
const envelopeHeaders = createEventEnvelopeHeaders(event, sdkInfo, tunnel, dsn);
|
||||
|
||||
// Prevent this data (which, if it exists, was used in earlier steps in the processing pipeline) from being sent to
|
||||
// sentry. (Note: Our use of this property comes and goes with whatever we might be debugging, whatever hacks we may
|
||||
// have temporarily added, etc. Even if we don't happen to be using it at some point in the future, let's not get rid
|
||||
// of this `delete`, lest we miss putting it back in the next time the property is in use.)
|
||||
delete event.sdkProcessingMetadata;
|
||||
|
||||
const eventItem = [{ type: eventType }, event];
|
||||
return createEnvelope(envelopeHeaders, [eventItem]);
|
||||
}
|
||||
|
||||
export { createEventEnvelope, createSessionEnvelope };
|
||||
//# sourceMappingURL=envelope.js.map
|
||||
193
shared/logger/node_modules/@sentry/core/esm/exports.js
generated
vendored
Normal file
193
shared/logger/node_modules/@sentry/core/esm/exports.js
generated
vendored
Normal file
@@ -0,0 +1,193 @@
|
||||
import { logger, uuid4 } from '@sentry/utils';
|
||||
import { getCurrentHub } from './hub.js';
|
||||
|
||||
// Note: All functions in this file are typed with a return value of `ReturnType<Hub[HUB_FUNCTION]>`,
|
||||
// where HUB_FUNCTION is some method on the Hub class.
|
||||
//
|
||||
// This is done to make sure the top level SDK methods stay in sync with the hub methods.
|
||||
// Although every method here has an explicit return type, some of them (that map to void returns) do not
|
||||
// contain `return` keywords. This is done to save on bundle size, as `return` is not minifiable.
|
||||
|
||||
/**
|
||||
* Captures an exception event and sends it to Sentry.
|
||||
*
|
||||
* @param exception An exception-like object.
|
||||
* @param captureContext Additional scope data to apply to exception event.
|
||||
* @returns The generated eventId.
|
||||
*/
|
||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any, @typescript-eslint/explicit-module-boundary-types
|
||||
function captureException(exception, captureContext) {
|
||||
return getCurrentHub().captureException(exception, { captureContext });
|
||||
}
|
||||
|
||||
/**
|
||||
* Captures a message event and sends it to Sentry.
|
||||
*
|
||||
* @param message The message to send to Sentry.
|
||||
* @param Severity Define the level of the message.
|
||||
* @returns The generated eventId.
|
||||
*/
|
||||
function captureMessage(
|
||||
message,
|
||||
// eslint-disable-next-line deprecation/deprecation
|
||||
captureContext,
|
||||
) {
|
||||
// This is necessary to provide explicit scopes upgrade, without changing the original
|
||||
// arity of the `captureMessage(message, level)` method.
|
||||
const level = typeof captureContext === 'string' ? captureContext : undefined;
|
||||
const context = typeof captureContext !== 'string' ? { captureContext } : undefined;
|
||||
return getCurrentHub().captureMessage(message, level, context);
|
||||
}
|
||||
|
||||
/**
|
||||
* Captures a manually created event and sends it to Sentry.
|
||||
*
|
||||
* @param event The event to send to Sentry.
|
||||
* @returns The generated eventId.
|
||||
*/
|
||||
function captureEvent(event, hint) {
|
||||
return getCurrentHub().captureEvent(event, hint);
|
||||
}
|
||||
|
||||
/**
|
||||
* Callback to set context information onto the scope.
|
||||
* @param callback Callback function that receives Scope.
|
||||
*/
|
||||
function configureScope(callback) {
|
||||
getCurrentHub().configureScope(callback);
|
||||
}
|
||||
|
||||
/**
|
||||
* Records a new breadcrumb which will be attached to future events.
|
||||
*
|
||||
* Breadcrumbs will be added to subsequent events to provide more context on
|
||||
* user's actions prior to an error or crash.
|
||||
*
|
||||
* @param breadcrumb The breadcrumb to record.
|
||||
*/
|
||||
function addBreadcrumb(breadcrumb) {
|
||||
getCurrentHub().addBreadcrumb(breadcrumb);
|
||||
}
|
||||
|
||||
/**
|
||||
* Sets context data with the given name.
|
||||
* @param name of the context
|
||||
* @param context Any kind of data. This data will be normalized.
|
||||
*/
|
||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any
|
||||
function setContext(name, context) {
|
||||
getCurrentHub().setContext(name, context);
|
||||
}
|
||||
|
||||
/**
|
||||
* Set an object that will be merged sent as extra data with the event.
|
||||
* @param extras Extras object to merge into current context.
|
||||
*/
|
||||
function setExtras(extras) {
|
||||
getCurrentHub().setExtras(extras);
|
||||
}
|
||||
|
||||
/**
|
||||
* Set key:value that will be sent as extra data with the event.
|
||||
* @param key String of extra
|
||||
* @param extra Any kind of data. This data will be normalized.
|
||||
*/
|
||||
function setExtra(key, extra) {
|
||||
getCurrentHub().setExtra(key, extra);
|
||||
}
|
||||
|
||||
/**
|
||||
* Set an object that will be merged sent as tags data with the event.
|
||||
* @param tags Tags context object to merge into current context.
|
||||
*/
|
||||
function setTags(tags) {
|
||||
getCurrentHub().setTags(tags);
|
||||
}
|
||||
|
||||
/**
|
||||
* Set key:value that will be sent as tags data with the event.
|
||||
*
|
||||
* Can also be used to unset a tag, by passing `undefined`.
|
||||
*
|
||||
* @param key String key of tag
|
||||
* @param value Value of tag
|
||||
*/
|
||||
function setTag(key, value) {
|
||||
getCurrentHub().setTag(key, value);
|
||||
}
|
||||
|
||||
/**
|
||||
* Updates user context information for future events.
|
||||
*
|
||||
* @param user User context object to be set in the current context. Pass `null` to unset the user.
|
||||
*/
|
||||
function setUser(user) {
|
||||
getCurrentHub().setUser(user);
|
||||
}
|
||||
|
||||
/**
|
||||
* Creates a new scope with and executes the given operation within.
|
||||
* The scope is automatically removed once the operation
|
||||
* finishes or throws.
|
||||
*
|
||||
* This is essentially a convenience function for:
|
||||
*
|
||||
* pushScope();
|
||||
* callback();
|
||||
* popScope();
|
||||
*
|
||||
* @param callback that will be enclosed into push/popScope.
|
||||
*/
|
||||
function withScope(callback) {
|
||||
getCurrentHub().withScope(callback);
|
||||
}
|
||||
|
||||
/**
|
||||
* Starts a new `Transaction` and returns it. This is the entry point to manual tracing instrumentation.
|
||||
*
|
||||
* A tree structure can be built by adding child spans to the transaction, and child spans to other spans. To start a
|
||||
* new child span within the transaction or any span, call the respective `.startChild()` method.
|
||||
*
|
||||
* Every child span must be finished before the transaction is finished, otherwise the unfinished spans are discarded.
|
||||
*
|
||||
* The transaction must be finished with a call to its `.finish()` method, at which point the transaction with all its
|
||||
* finished child spans will be sent to Sentry.
|
||||
*
|
||||
* NOTE: This function should only be used for *manual* instrumentation. Auto-instrumentation should call
|
||||
* `startTransaction` directly on the hub.
|
||||
*
|
||||
* @param context Properties of the new `Transaction`.
|
||||
* @param customSamplingContext Information given to the transaction sampling function (along with context-dependent
|
||||
* default values). See {@link Options.tracesSampler}.
|
||||
*
|
||||
* @returns The transaction which was just started
|
||||
*/
|
||||
function startTransaction(
|
||||
context,
|
||||
customSamplingContext,
|
||||
) {
|
||||
return getCurrentHub().startTransaction({ ...context }, customSamplingContext);
|
||||
}
|
||||
|
||||
/**
|
||||
* Create a cron monitor check in and send it to Sentry.
|
||||
*
|
||||
* @param checkIn An object that describes a check in.
|
||||
* @param upsertMonitorConfig An optional object that describes a monitor config. Use this if you want
|
||||
* to create a monitor automatically when sending a check in.
|
||||
*/
|
||||
function captureCheckIn(checkIn, upsertMonitorConfig) {
|
||||
const client = getCurrentHub().getClient();
|
||||
if (!client) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.warn('Cannot capture check-in. No client defined.');
|
||||
} else if (!client.captureCheckIn) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.warn('Cannot capture check-in. Client does not support sending check-ins.');
|
||||
} else {
|
||||
return client.captureCheckIn(checkIn, upsertMonitorConfig);
|
||||
}
|
||||
|
||||
return uuid4();
|
||||
}
|
||||
|
||||
export { addBreadcrumb, captureCheckIn, captureEvent, captureException, captureMessage, configureScope, setContext, setExtra, setExtras, setTag, setTags, setUser, startTransaction, withScope };
|
||||
//# sourceMappingURL=exports.js.map
|
||||
564
shared/logger/node_modules/@sentry/core/esm/hub.js
generated
vendored
Normal file
564
shared/logger/node_modules/@sentry/core/esm/hub.js
generated
vendored
Normal file
@@ -0,0 +1,564 @@
|
||||
import { uuid4, dateTimestampInSeconds, consoleSandbox, logger, GLOBAL_OBJ, getGlobalSingleton } from '@sentry/utils';
|
||||
import { DEFAULT_ENVIRONMENT } from './constants.js';
|
||||
import { Scope } from './scope.js';
|
||||
import { closeSession, makeSession, updateSession } from './session.js';
|
||||
|
||||
/**
|
||||
* API compatibility version of this hub.
|
||||
*
|
||||
* WARNING: This number should only be increased when the global interface
|
||||
* changes and new methods are introduced.
|
||||
*
|
||||
* @hidden
|
||||
*/
|
||||
const API_VERSION = 4;
|
||||
|
||||
/**
|
||||
* Default maximum number of breadcrumbs added to an event. Can be overwritten
|
||||
* with {@link Options.maxBreadcrumbs}.
|
||||
*/
|
||||
const DEFAULT_BREADCRUMBS = 100;
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
class Hub {
|
||||
/** Is a {@link Layer}[] containing the client and scope */
|
||||
|
||||
/** Contains the last event id of a captured event. */
|
||||
|
||||
/**
|
||||
* Creates a new instance of the hub, will push one {@link Layer} into the
|
||||
* internal stack on creation.
|
||||
*
|
||||
* @param client bound to the hub.
|
||||
* @param scope bound to the hub.
|
||||
* @param version number, higher number means higher priority.
|
||||
*/
|
||||
constructor(client, scope = new Scope(), _version = API_VERSION) {this._version = _version;
|
||||
this._stack = [{ scope }];
|
||||
if (client) {
|
||||
this.bindClient(client);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
isOlderThan(version) {
|
||||
return this._version < version;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
bindClient(client) {
|
||||
const top = this.getStackTop();
|
||||
top.client = client;
|
||||
if (client && client.setupIntegrations) {
|
||||
client.setupIntegrations();
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
pushScope() {
|
||||
// We want to clone the content of prev scope
|
||||
const scope = Scope.clone(this.getScope());
|
||||
this.getStack().push({
|
||||
client: this.getClient(),
|
||||
scope,
|
||||
});
|
||||
return scope;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
popScope() {
|
||||
if (this.getStack().length <= 1) return false;
|
||||
return !!this.getStack().pop();
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
withScope(callback) {
|
||||
const scope = this.pushScope();
|
||||
try {
|
||||
callback(scope);
|
||||
} finally {
|
||||
this.popScope();
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
getClient() {
|
||||
return this.getStackTop().client ;
|
||||
}
|
||||
|
||||
/** Returns the scope of the top stack. */
|
||||
getScope() {
|
||||
return this.getStackTop().scope;
|
||||
}
|
||||
|
||||
/** Returns the scope stack for domains or the process. */
|
||||
getStack() {
|
||||
return this._stack;
|
||||
}
|
||||
|
||||
/** Returns the topmost scope layer in the order domain > local > process. */
|
||||
getStackTop() {
|
||||
return this._stack[this._stack.length - 1];
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
captureException(exception, hint) {
|
||||
const eventId = (this._lastEventId = hint && hint.event_id ? hint.event_id : uuid4());
|
||||
const syntheticException = new Error('Sentry syntheticException');
|
||||
this._withClient((client, scope) => {
|
||||
client.captureException(
|
||||
exception,
|
||||
{
|
||||
originalException: exception,
|
||||
syntheticException,
|
||||
...hint,
|
||||
event_id: eventId,
|
||||
},
|
||||
scope,
|
||||
);
|
||||
});
|
||||
return eventId;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
captureMessage(
|
||||
message,
|
||||
// eslint-disable-next-line deprecation/deprecation
|
||||
level,
|
||||
hint,
|
||||
) {
|
||||
const eventId = (this._lastEventId = hint && hint.event_id ? hint.event_id : uuid4());
|
||||
const syntheticException = new Error(message);
|
||||
this._withClient((client, scope) => {
|
||||
client.captureMessage(
|
||||
message,
|
||||
level,
|
||||
{
|
||||
originalException: message,
|
||||
syntheticException,
|
||||
...hint,
|
||||
event_id: eventId,
|
||||
},
|
||||
scope,
|
||||
);
|
||||
});
|
||||
return eventId;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
captureEvent(event, hint) {
|
||||
const eventId = hint && hint.event_id ? hint.event_id : uuid4();
|
||||
if (!event.type) {
|
||||
this._lastEventId = eventId;
|
||||
}
|
||||
|
||||
this._withClient((client, scope) => {
|
||||
client.captureEvent(event, { ...hint, event_id: eventId }, scope);
|
||||
});
|
||||
return eventId;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
lastEventId() {
|
||||
return this._lastEventId;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
addBreadcrumb(breadcrumb, hint) {
|
||||
const { scope, client } = this.getStackTop();
|
||||
|
||||
if (!client) return;
|
||||
|
||||
const { beforeBreadcrumb = null, maxBreadcrumbs = DEFAULT_BREADCRUMBS } =
|
||||
(client.getOptions && client.getOptions()) || {};
|
||||
|
||||
if (maxBreadcrumbs <= 0) return;
|
||||
|
||||
const timestamp = dateTimestampInSeconds();
|
||||
const mergedBreadcrumb = { timestamp, ...breadcrumb };
|
||||
const finalBreadcrumb = beforeBreadcrumb
|
||||
? (consoleSandbox(() => beforeBreadcrumb(mergedBreadcrumb, hint)) )
|
||||
: mergedBreadcrumb;
|
||||
|
||||
if (finalBreadcrumb === null) return;
|
||||
|
||||
if (client.emit) {
|
||||
client.emit('beforeAddBreadcrumb', finalBreadcrumb, hint);
|
||||
}
|
||||
|
||||
scope.addBreadcrumb(finalBreadcrumb, maxBreadcrumbs);
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
setUser(user) {
|
||||
this.getScope().setUser(user);
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
setTags(tags) {
|
||||
this.getScope().setTags(tags);
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
setExtras(extras) {
|
||||
this.getScope().setExtras(extras);
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
setTag(key, value) {
|
||||
this.getScope().setTag(key, value);
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
setExtra(key, extra) {
|
||||
this.getScope().setExtra(key, extra);
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any
|
||||
setContext(name, context) {
|
||||
this.getScope().setContext(name, context);
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
configureScope(callback) {
|
||||
const { scope, client } = this.getStackTop();
|
||||
if (client) {
|
||||
callback(scope);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
run(callback) {
|
||||
const oldHub = makeMain(this);
|
||||
try {
|
||||
callback(this);
|
||||
} finally {
|
||||
makeMain(oldHub);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
getIntegration(integration) {
|
||||
const client = this.getClient();
|
||||
if (!client) return null;
|
||||
try {
|
||||
return client.getIntegration(integration);
|
||||
} catch (_oO) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.warn(`Cannot retrieve integration ${integration.id} from the current Hub`);
|
||||
return null;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
startTransaction(context, customSamplingContext) {
|
||||
const result = this._callExtensionMethod('startTransaction', context, customSamplingContext);
|
||||
|
||||
if ((typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && !result) {
|
||||
// eslint-disable-next-line no-console
|
||||
console.warn(`Tracing extension 'startTransaction' has not been added. Call 'addTracingExtensions' before calling 'init':
|
||||
Sentry.addTracingExtensions();
|
||||
Sentry.init({...});
|
||||
`);
|
||||
}
|
||||
|
||||
return result;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
traceHeaders() {
|
||||
return this._callExtensionMethod('traceHeaders');
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
captureSession(endSession = false) {
|
||||
// both send the update and pull the session from the scope
|
||||
if (endSession) {
|
||||
return this.endSession();
|
||||
}
|
||||
|
||||
// only send the update
|
||||
this._sendSessionUpdate();
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
endSession() {
|
||||
const layer = this.getStackTop();
|
||||
const scope = layer.scope;
|
||||
const session = scope.getSession();
|
||||
if (session) {
|
||||
closeSession(session);
|
||||
}
|
||||
this._sendSessionUpdate();
|
||||
|
||||
// the session is over; take it off of the scope
|
||||
scope.setSession();
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
startSession(context) {
|
||||
const { scope, client } = this.getStackTop();
|
||||
const { release, environment = DEFAULT_ENVIRONMENT } = (client && client.getOptions()) || {};
|
||||
|
||||
// Will fetch userAgent if called from browser sdk
|
||||
const { userAgent } = GLOBAL_OBJ.navigator || {};
|
||||
|
||||
const session = makeSession({
|
||||
release,
|
||||
environment,
|
||||
user: scope.getUser(),
|
||||
...(userAgent && { userAgent }),
|
||||
...context,
|
||||
});
|
||||
|
||||
// End existing session if there's one
|
||||
const currentSession = scope.getSession && scope.getSession();
|
||||
if (currentSession && currentSession.status === 'ok') {
|
||||
updateSession(currentSession, { status: 'exited' });
|
||||
}
|
||||
this.endSession();
|
||||
|
||||
// Afterwards we set the new session on the scope
|
||||
scope.setSession(session);
|
||||
|
||||
return session;
|
||||
}
|
||||
|
||||
/**
|
||||
* Returns if default PII should be sent to Sentry and propagated in ourgoing requests
|
||||
* when Tracing is used.
|
||||
*/
|
||||
shouldSendDefaultPii() {
|
||||
const client = this.getClient();
|
||||
const options = client && client.getOptions();
|
||||
return Boolean(options && options.sendDefaultPii);
|
||||
}
|
||||
|
||||
/**
|
||||
* Sends the current Session on the scope
|
||||
*/
|
||||
_sendSessionUpdate() {
|
||||
const { scope, client } = this.getStackTop();
|
||||
|
||||
const session = scope.getSession();
|
||||
if (session && client && client.captureSession) {
|
||||
client.captureSession(session);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Internal helper function to call a method on the top client if it exists.
|
||||
*
|
||||
* @param method The method to call on the client.
|
||||
* @param args Arguments to pass to the client function.
|
||||
*/
|
||||
_withClient(callback) {
|
||||
const { scope, client } = this.getStackTop();
|
||||
if (client) {
|
||||
callback(client, scope);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Calls global extension method and binding current instance to the function call
|
||||
*/
|
||||
// @ts-ignore Function lacks ending return statement and return type does not include 'undefined'. ts(2366)
|
||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any
|
||||
_callExtensionMethod(method, ...args) {
|
||||
const carrier = getMainCarrier();
|
||||
const sentry = carrier.__SENTRY__;
|
||||
if (sentry && sentry.extensions && typeof sentry.extensions[method] === 'function') {
|
||||
return sentry.extensions[method].apply(this, args);
|
||||
}
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.warn(`Extension method ${method} couldn't be found, doing nothing.`);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Returns the global shim registry.
|
||||
*
|
||||
* FIXME: This function is problematic, because despite always returning a valid Carrier,
|
||||
* it has an optional `__SENTRY__` property, which then in turn requires us to always perform an unnecessary check
|
||||
* at the call-site. We always access the carrier through this function, so we can guarantee that `__SENTRY__` is there.
|
||||
**/
|
||||
function getMainCarrier() {
|
||||
GLOBAL_OBJ.__SENTRY__ = GLOBAL_OBJ.__SENTRY__ || {
|
||||
extensions: {},
|
||||
hub: undefined,
|
||||
};
|
||||
return GLOBAL_OBJ;
|
||||
}
|
||||
|
||||
/**
|
||||
* Replaces the current main hub with the passed one on the global object
|
||||
*
|
||||
* @returns The old replaced hub
|
||||
*/
|
||||
function makeMain(hub) {
|
||||
const registry = getMainCarrier();
|
||||
const oldHub = getHubFromCarrier(registry);
|
||||
setHubOnCarrier(registry, hub);
|
||||
return oldHub;
|
||||
}
|
||||
|
||||
/**
|
||||
* Returns the default hub instance.
|
||||
*
|
||||
* If a hub is already registered in the global carrier but this module
|
||||
* contains a more recent version, it replaces the registered version.
|
||||
* Otherwise, the currently registered hub will be returned.
|
||||
*/
|
||||
function getCurrentHub() {
|
||||
// Get main carrier (global for every environment)
|
||||
const registry = getMainCarrier();
|
||||
|
||||
if (registry.__SENTRY__ && registry.__SENTRY__.acs) {
|
||||
const hub = registry.__SENTRY__.acs.getCurrentHub();
|
||||
|
||||
if (hub) {
|
||||
return hub;
|
||||
}
|
||||
}
|
||||
|
||||
// Return hub that lives on a global object
|
||||
return getGlobalHub(registry);
|
||||
}
|
||||
|
||||
function getGlobalHub(registry = getMainCarrier()) {
|
||||
// If there's no hub, or its an old API, assign a new one
|
||||
if (!hasHubOnCarrier(registry) || getHubFromCarrier(registry).isOlderThan(API_VERSION)) {
|
||||
setHubOnCarrier(registry, new Hub());
|
||||
}
|
||||
|
||||
// Return hub that lives on a global object
|
||||
return getHubFromCarrier(registry);
|
||||
}
|
||||
|
||||
/**
|
||||
* @private Private API with no semver guarantees!
|
||||
*
|
||||
* If the carrier does not contain a hub, a new hub is created with the global hub client and scope.
|
||||
*/
|
||||
function ensureHubOnCarrier(carrier, parent = getGlobalHub()) {
|
||||
// If there's no hub on current domain, or it's an old API, assign a new one
|
||||
if (!hasHubOnCarrier(carrier) || getHubFromCarrier(carrier).isOlderThan(API_VERSION)) {
|
||||
const globalHubTopStack = parent.getStackTop();
|
||||
setHubOnCarrier(carrier, new Hub(globalHubTopStack.client, Scope.clone(globalHubTopStack.scope)));
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* @private Private API with no semver guarantees!
|
||||
*
|
||||
* Sets the global async context strategy
|
||||
*/
|
||||
function setAsyncContextStrategy(strategy) {
|
||||
// Get main carrier (global for every environment)
|
||||
const registry = getMainCarrier();
|
||||
registry.__SENTRY__ = registry.__SENTRY__ || {};
|
||||
registry.__SENTRY__.acs = strategy;
|
||||
}
|
||||
|
||||
/**
|
||||
* Runs the supplied callback in its own async context. Async Context strategies are defined per SDK.
|
||||
*
|
||||
* @param callback The callback to run in its own async context
|
||||
* @param options Options to pass to the async context strategy
|
||||
* @returns The result of the callback
|
||||
*/
|
||||
function runWithAsyncContext(callback, options = {}) {
|
||||
const registry = getMainCarrier();
|
||||
|
||||
if (registry.__SENTRY__ && registry.__SENTRY__.acs) {
|
||||
return registry.__SENTRY__.acs.runWithAsyncContext(callback, options);
|
||||
}
|
||||
|
||||
// if there was no strategy, fallback to just calling the callback
|
||||
return callback();
|
||||
}
|
||||
|
||||
/**
|
||||
* This will tell whether a carrier has a hub on it or not
|
||||
* @param carrier object
|
||||
*/
|
||||
function hasHubOnCarrier(carrier) {
|
||||
return !!(carrier && carrier.__SENTRY__ && carrier.__SENTRY__.hub);
|
||||
}
|
||||
|
||||
/**
|
||||
* This will create a new {@link Hub} and add to the passed object on
|
||||
* __SENTRY__.hub.
|
||||
* @param carrier object
|
||||
* @hidden
|
||||
*/
|
||||
function getHubFromCarrier(carrier) {
|
||||
return getGlobalSingleton('hub', () => new Hub(), carrier);
|
||||
}
|
||||
|
||||
/**
|
||||
* This will set passed {@link Hub} on the passed object's __SENTRY__.hub attribute
|
||||
* @param carrier object
|
||||
* @param hub Hub
|
||||
* @returns A boolean indicating success or failure
|
||||
*/
|
||||
function setHubOnCarrier(carrier, hub) {
|
||||
if (!carrier) return false;
|
||||
const __SENTRY__ = (carrier.__SENTRY__ = carrier.__SENTRY__ || {});
|
||||
__SENTRY__.hub = hub;
|
||||
return true;
|
||||
}
|
||||
|
||||
export { API_VERSION, Hub, ensureHubOnCarrier, getCurrentHub, getHubFromCarrier, getMainCarrier, makeMain, runWithAsyncContext, setAsyncContextStrategy, setHubOnCarrier };
|
||||
//# sourceMappingURL=hub.js.map
|
||||
112
shared/logger/node_modules/@sentry/core/esm/integration.js
generated
vendored
Normal file
112
shared/logger/node_modules/@sentry/core/esm/integration.js
generated
vendored
Normal file
@@ -0,0 +1,112 @@
|
||||
import { arrayify, logger } from '@sentry/utils';
|
||||
import { getCurrentHub } from './hub.js';
|
||||
import { addGlobalEventProcessor } from './scope.js';
|
||||
|
||||
const installedIntegrations = [];
|
||||
|
||||
/** Map of integrations assigned to a client */
|
||||
|
||||
/**
|
||||
* Remove duplicates from the given array, preferring the last instance of any duplicate. Not guaranteed to
|
||||
* preseve the order of integrations in the array.
|
||||
*
|
||||
* @private
|
||||
*/
|
||||
function filterDuplicates(integrations) {
|
||||
const integrationsByName = {};
|
||||
|
||||
integrations.forEach(currentInstance => {
|
||||
const { name } = currentInstance;
|
||||
|
||||
const existingInstance = integrationsByName[name];
|
||||
|
||||
// We want integrations later in the array to overwrite earlier ones of the same type, except that we never want a
|
||||
// default instance to overwrite an existing user instance
|
||||
if (existingInstance && !existingInstance.isDefaultInstance && currentInstance.isDefaultInstance) {
|
||||
return;
|
||||
}
|
||||
|
||||
integrationsByName[name] = currentInstance;
|
||||
});
|
||||
|
||||
return Object.keys(integrationsByName).map(k => integrationsByName[k]);
|
||||
}
|
||||
|
||||
/** Gets integrations to install */
|
||||
function getIntegrationsToSetup(options) {
|
||||
const defaultIntegrations = options.defaultIntegrations || [];
|
||||
const userIntegrations = options.integrations;
|
||||
|
||||
// We flag default instances, so that later we can tell them apart from any user-created instances of the same class
|
||||
defaultIntegrations.forEach(integration => {
|
||||
integration.isDefaultInstance = true;
|
||||
});
|
||||
|
||||
let integrations;
|
||||
|
||||
if (Array.isArray(userIntegrations)) {
|
||||
integrations = [...defaultIntegrations, ...userIntegrations];
|
||||
} else if (typeof userIntegrations === 'function') {
|
||||
integrations = arrayify(userIntegrations(defaultIntegrations));
|
||||
} else {
|
||||
integrations = defaultIntegrations;
|
||||
}
|
||||
|
||||
const finalIntegrations = filterDuplicates(integrations);
|
||||
|
||||
// The `Debug` integration prints copies of the `event` and `hint` which will be passed to `beforeSend` or
|
||||
// `beforeSendTransaction`. It therefore has to run after all other integrations, so that the changes of all event
|
||||
// processors will be reflected in the printed values. For lack of a more elegant way to guarantee that, we therefore
|
||||
// locate it and, assuming it exists, pop it out of its current spot and shove it onto the end of the array.
|
||||
const debugIndex = findIndex(finalIntegrations, integration => integration.name === 'Debug');
|
||||
if (debugIndex !== -1) {
|
||||
const [debugInstance] = finalIntegrations.splice(debugIndex, 1);
|
||||
finalIntegrations.push(debugInstance);
|
||||
}
|
||||
|
||||
return finalIntegrations;
|
||||
}
|
||||
|
||||
/**
|
||||
* Given a list of integration instances this installs them all. When `withDefaults` is set to `true` then all default
|
||||
* integrations are added unless they were already provided before.
|
||||
* @param integrations array of integration instances
|
||||
* @param withDefault should enable default integrations
|
||||
*/
|
||||
function setupIntegrations(integrations) {
|
||||
const integrationIndex = {};
|
||||
|
||||
integrations.forEach(integration => {
|
||||
// guard against empty provided integrations
|
||||
if (integration) {
|
||||
setupIntegration(integration, integrationIndex);
|
||||
}
|
||||
});
|
||||
|
||||
return integrationIndex;
|
||||
}
|
||||
|
||||
/** Setup a single integration. */
|
||||
function setupIntegration(integration, integrationIndex) {
|
||||
integrationIndex[integration.name] = integration;
|
||||
|
||||
if (installedIntegrations.indexOf(integration.name) === -1) {
|
||||
integration.setupOnce(addGlobalEventProcessor, getCurrentHub);
|
||||
installedIntegrations.push(integration.name);
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.log(`Integration installed: ${integration.name}`);
|
||||
}
|
||||
}
|
||||
|
||||
// Polyfill for Array.findIndex(), which is not supported in ES5
|
||||
function findIndex(arr, callback) {
|
||||
for (let i = 0; i < arr.length; i++) {
|
||||
if (callback(arr[i]) === true) {
|
||||
return i;
|
||||
}
|
||||
}
|
||||
|
||||
return -1;
|
||||
}
|
||||
|
||||
export { getIntegrationsToSetup, installedIntegrations, setupIntegration, setupIntegrations };
|
||||
//# sourceMappingURL=integration.js.map
|
||||
39
shared/logger/node_modules/@sentry/core/esm/integrations/functiontostring.js
generated
vendored
Normal file
39
shared/logger/node_modules/@sentry/core/esm/integrations/functiontostring.js
generated
vendored
Normal file
@@ -0,0 +1,39 @@
|
||||
import { getOriginalFunction } from '@sentry/utils';
|
||||
|
||||
let originalFunctionToString;
|
||||
|
||||
/** Patch toString calls to return proper name for wrapped functions */
|
||||
class FunctionToString {constructor() { FunctionToString.prototype.__init.call(this); }
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
static __initStatic() {this.id = 'FunctionToString';}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
__init() {this.name = FunctionToString.id;}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
setupOnce() {
|
||||
// eslint-disable-next-line @typescript-eslint/unbound-method
|
||||
originalFunctionToString = Function.prototype.toString;
|
||||
|
||||
// intrinsics (like Function.prototype) might be immutable in some environments
|
||||
// e.g. Node with --frozen-intrinsics, XS (an embedded JavaScript engine) or SES (a JavaScript proposal)
|
||||
try {
|
||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any
|
||||
Function.prototype.toString = function ( ...args) {
|
||||
const context = getOriginalFunction(this) || this;
|
||||
return originalFunctionToString.apply(context, args);
|
||||
};
|
||||
} catch (e) {
|
||||
// ignore errors here, just don't patch this
|
||||
}
|
||||
}
|
||||
} FunctionToString.__initStatic();
|
||||
|
||||
export { FunctionToString };
|
||||
//# sourceMappingURL=functiontostring.js.map
|
||||
213
shared/logger/node_modules/@sentry/core/esm/integrations/inboundfilters.js
generated
vendored
Normal file
213
shared/logger/node_modules/@sentry/core/esm/integrations/inboundfilters.js
generated
vendored
Normal file
@@ -0,0 +1,213 @@
|
||||
import { logger, getEventDescription, stringMatchesSomePattern } from '@sentry/utils';
|
||||
|
||||
// "Script error." is hard coded into browsers for errors that it can't read.
|
||||
// this is the result of a script being pulled in from an external domain and CORS.
|
||||
const DEFAULT_IGNORE_ERRORS = [/^Script error\.?$/, /^Javascript error: Script error\.? on line 0$/];
|
||||
|
||||
const DEFAULT_IGNORE_TRANSACTIONS = [
|
||||
/^.*healthcheck.*$/,
|
||||
/^.*healthy.*$/,
|
||||
/^.*live.*$/,
|
||||
/^.*ready.*$/,
|
||||
/^.*heartbeat.*$/,
|
||||
/^.*\/health$/,
|
||||
/^.*\/healthz$/,
|
||||
];
|
||||
|
||||
/** Options for the InboundFilters integration */
|
||||
|
||||
/** Inbound filters configurable by the user */
|
||||
class InboundFilters {
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
static __initStatic() {this.id = 'InboundFilters';}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
__init() {this.name = InboundFilters.id;}
|
||||
|
||||
constructor( _options = {}) {this._options = _options;InboundFilters.prototype.__init.call(this);}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
setupOnce(addGlobalEventProcessor, getCurrentHub) {
|
||||
const eventProcess = (event) => {
|
||||
const hub = getCurrentHub();
|
||||
if (hub) {
|
||||
const self = hub.getIntegration(InboundFilters);
|
||||
if (self) {
|
||||
const client = hub.getClient();
|
||||
const clientOptions = client ? client.getOptions() : {};
|
||||
const options = _mergeOptions(self._options, clientOptions);
|
||||
return _shouldDropEvent(event, options) ? null : event;
|
||||
}
|
||||
}
|
||||
return event;
|
||||
};
|
||||
|
||||
eventProcess.id = this.name;
|
||||
addGlobalEventProcessor(eventProcess);
|
||||
}
|
||||
} InboundFilters.__initStatic();
|
||||
|
||||
/** JSDoc */
|
||||
function _mergeOptions(
|
||||
internalOptions = {},
|
||||
clientOptions = {},
|
||||
) {
|
||||
return {
|
||||
allowUrls: [...(internalOptions.allowUrls || []), ...(clientOptions.allowUrls || [])],
|
||||
denyUrls: [...(internalOptions.denyUrls || []), ...(clientOptions.denyUrls || [])],
|
||||
ignoreErrors: [
|
||||
...(internalOptions.ignoreErrors || []),
|
||||
...(clientOptions.ignoreErrors || []),
|
||||
...(internalOptions.disableErrorDefaults ? [] : DEFAULT_IGNORE_ERRORS),
|
||||
],
|
||||
ignoreTransactions: [
|
||||
...(internalOptions.ignoreTransactions || []),
|
||||
...(clientOptions.ignoreTransactions || []),
|
||||
...(internalOptions.disableTransactionDefaults ? [] : DEFAULT_IGNORE_TRANSACTIONS),
|
||||
],
|
||||
ignoreInternal: internalOptions.ignoreInternal !== undefined ? internalOptions.ignoreInternal : true,
|
||||
};
|
||||
}
|
||||
|
||||
/** JSDoc */
|
||||
function _shouldDropEvent(event, options) {
|
||||
if (options.ignoreInternal && _isSentryError(event)) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) &&
|
||||
logger.warn(`Event dropped due to being internal Sentry Error.\nEvent: ${getEventDescription(event)}`);
|
||||
return true;
|
||||
}
|
||||
if (_isIgnoredError(event, options.ignoreErrors)) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) &&
|
||||
logger.warn(
|
||||
`Event dropped due to being matched by \`ignoreErrors\` option.\nEvent: ${getEventDescription(event)}`,
|
||||
);
|
||||
return true;
|
||||
}
|
||||
if (_isIgnoredTransaction(event, options.ignoreTransactions)) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) &&
|
||||
logger.warn(
|
||||
`Event dropped due to being matched by \`ignoreTransactions\` option.\nEvent: ${getEventDescription(event)}`,
|
||||
);
|
||||
return true;
|
||||
}
|
||||
if (_isDeniedUrl(event, options.denyUrls)) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) &&
|
||||
logger.warn(
|
||||
`Event dropped due to being matched by \`denyUrls\` option.\nEvent: ${getEventDescription(
|
||||
event,
|
||||
)}.\nUrl: ${_getEventFilterUrl(event)}`,
|
||||
);
|
||||
return true;
|
||||
}
|
||||
if (!_isAllowedUrl(event, options.allowUrls)) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) &&
|
||||
logger.warn(
|
||||
`Event dropped due to not being matched by \`allowUrls\` option.\nEvent: ${getEventDescription(
|
||||
event,
|
||||
)}.\nUrl: ${_getEventFilterUrl(event)}`,
|
||||
);
|
||||
return true;
|
||||
}
|
||||
return false;
|
||||
}
|
||||
|
||||
function _isIgnoredError(event, ignoreErrors) {
|
||||
// If event.type, this is not an error
|
||||
if (event.type || !ignoreErrors || !ignoreErrors.length) {
|
||||
return false;
|
||||
}
|
||||
|
||||
return _getPossibleEventMessages(event).some(message => stringMatchesSomePattern(message, ignoreErrors));
|
||||
}
|
||||
|
||||
function _isIgnoredTransaction(event, ignoreTransactions) {
|
||||
if (event.type !== 'transaction' || !ignoreTransactions || !ignoreTransactions.length) {
|
||||
return false;
|
||||
}
|
||||
|
||||
const name = event.transaction;
|
||||
return name ? stringMatchesSomePattern(name, ignoreTransactions) : false;
|
||||
}
|
||||
|
||||
function _isDeniedUrl(event, denyUrls) {
|
||||
// TODO: Use Glob instead?
|
||||
if (!denyUrls || !denyUrls.length) {
|
||||
return false;
|
||||
}
|
||||
const url = _getEventFilterUrl(event);
|
||||
return !url ? false : stringMatchesSomePattern(url, denyUrls);
|
||||
}
|
||||
|
||||
function _isAllowedUrl(event, allowUrls) {
|
||||
// TODO: Use Glob instead?
|
||||
if (!allowUrls || !allowUrls.length) {
|
||||
return true;
|
||||
}
|
||||
const url = _getEventFilterUrl(event);
|
||||
return !url ? true : stringMatchesSomePattern(url, allowUrls);
|
||||
}
|
||||
|
||||
function _getPossibleEventMessages(event) {
|
||||
if (event.message) {
|
||||
return [event.message];
|
||||
}
|
||||
if (event.exception) {
|
||||
const { values } = event.exception;
|
||||
try {
|
||||
const { type = '', value = '' } = (values && values[values.length - 1]) || {};
|
||||
return [`${value}`, `${type}: ${value}`];
|
||||
} catch (oO) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.error(`Cannot extract message for event ${getEventDescription(event)}`);
|
||||
return [];
|
||||
}
|
||||
}
|
||||
return [];
|
||||
}
|
||||
|
||||
function _isSentryError(event) {
|
||||
try {
|
||||
// @ts-ignore can't be a sentry error if undefined
|
||||
// eslint-disable-next-line @typescript-eslint/no-unsafe-member-access
|
||||
return event.exception.values[0].type === 'SentryError';
|
||||
} catch (e) {
|
||||
// ignore
|
||||
}
|
||||
return false;
|
||||
}
|
||||
|
||||
function _getLastValidUrl(frames = []) {
|
||||
for (let i = frames.length - 1; i >= 0; i--) {
|
||||
const frame = frames[i];
|
||||
|
||||
if (frame && frame.filename !== '<anonymous>' && frame.filename !== '[native code]') {
|
||||
return frame.filename || null;
|
||||
}
|
||||
}
|
||||
|
||||
return null;
|
||||
}
|
||||
|
||||
function _getEventFilterUrl(event) {
|
||||
try {
|
||||
let frames;
|
||||
try {
|
||||
// @ts-ignore we only care about frames if the whole thing here is defined
|
||||
frames = event.exception.values[0].stacktrace.frames;
|
||||
} catch (e) {
|
||||
// ignore
|
||||
}
|
||||
return frames ? _getLastValidUrl(frames) : null;
|
||||
} catch (oO) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.error(`Cannot extract url for event ${getEventDescription(event)}`);
|
||||
return null;
|
||||
}
|
||||
}
|
||||
|
||||
export { InboundFilters, _mergeOptions, _shouldDropEvent };
|
||||
//# sourceMappingURL=inboundfilters.js.map
|
||||
555
shared/logger/node_modules/@sentry/core/esm/scope.js
generated
vendored
Normal file
555
shared/logger/node_modules/@sentry/core/esm/scope.js
generated
vendored
Normal file
@@ -0,0 +1,555 @@
|
||||
import { isPlainObject, dateTimestampInSeconds, SyncPromise, logger, isThenable, arrayify, getGlobalSingleton } from '@sentry/utils';
|
||||
import { updateSession } from './session.js';
|
||||
|
||||
/**
|
||||
* Default value for maximum number of breadcrumbs added to an event.
|
||||
*/
|
||||
const DEFAULT_MAX_BREADCRUMBS = 100;
|
||||
|
||||
/**
|
||||
* Holds additional event information. {@link Scope.applyToEvent} will be
|
||||
* called by the client before an event will be sent.
|
||||
*/
|
||||
class Scope {
|
||||
/** Flag if notifying is happening. */
|
||||
|
||||
/** Callback for client to receive scope changes. */
|
||||
|
||||
/** Callback list that will be called after {@link applyToEvent}. */
|
||||
|
||||
/** Array of breadcrumbs. */
|
||||
|
||||
/** User */
|
||||
|
||||
/** Tags */
|
||||
|
||||
/** Extra */
|
||||
|
||||
/** Contexts */
|
||||
|
||||
/** Attachments */
|
||||
|
||||
/**
|
||||
* A place to stash data which is needed at some point in the SDK's event processing pipeline but which shouldn't get
|
||||
* sent to Sentry
|
||||
*/
|
||||
|
||||
/** Fingerprint */
|
||||
|
||||
/** Severity */
|
||||
// eslint-disable-next-line deprecation/deprecation
|
||||
|
||||
/** Transaction Name */
|
||||
|
||||
/** Span */
|
||||
|
||||
/** Session */
|
||||
|
||||
/** Request Mode Session Status */
|
||||
|
||||
// NOTE: Any field which gets added here should get added not only to the constructor but also to the `clone` method.
|
||||
|
||||
constructor() {
|
||||
this._notifyingListeners = false;
|
||||
this._scopeListeners = [];
|
||||
this._eventProcessors = [];
|
||||
this._breadcrumbs = [];
|
||||
this._attachments = [];
|
||||
this._user = {};
|
||||
this._tags = {};
|
||||
this._extra = {};
|
||||
this._contexts = {};
|
||||
this._sdkProcessingMetadata = {};
|
||||
}
|
||||
|
||||
/**
|
||||
* Inherit values from the parent scope.
|
||||
* @param scope to clone.
|
||||
*/
|
||||
static clone(scope) {
|
||||
const newScope = new Scope();
|
||||
if (scope) {
|
||||
newScope._breadcrumbs = [...scope._breadcrumbs];
|
||||
newScope._tags = { ...scope._tags };
|
||||
newScope._extra = { ...scope._extra };
|
||||
newScope._contexts = { ...scope._contexts };
|
||||
newScope._user = scope._user;
|
||||
newScope._level = scope._level;
|
||||
newScope._span = scope._span;
|
||||
newScope._session = scope._session;
|
||||
newScope._transactionName = scope._transactionName;
|
||||
newScope._fingerprint = scope._fingerprint;
|
||||
newScope._eventProcessors = [...scope._eventProcessors];
|
||||
newScope._requestSession = scope._requestSession;
|
||||
newScope._attachments = [...scope._attachments];
|
||||
newScope._sdkProcessingMetadata = { ...scope._sdkProcessingMetadata };
|
||||
}
|
||||
return newScope;
|
||||
}
|
||||
|
||||
/**
|
||||
* Add internal on change listener. Used for sub SDKs that need to store the scope.
|
||||
* @hidden
|
||||
*/
|
||||
addScopeListener(callback) {
|
||||
this._scopeListeners.push(callback);
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
addEventProcessor(callback) {
|
||||
this._eventProcessors.push(callback);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
setUser(user) {
|
||||
this._user = user || {};
|
||||
if (this._session) {
|
||||
updateSession(this._session, { user });
|
||||
}
|
||||
this._notifyScopeListeners();
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
getUser() {
|
||||
return this._user;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
getRequestSession() {
|
||||
return this._requestSession;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
setRequestSession(requestSession) {
|
||||
this._requestSession = requestSession;
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
setTags(tags) {
|
||||
this._tags = {
|
||||
...this._tags,
|
||||
...tags,
|
||||
};
|
||||
this._notifyScopeListeners();
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
setTag(key, value) {
|
||||
this._tags = { ...this._tags, [key]: value };
|
||||
this._notifyScopeListeners();
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
setExtras(extras) {
|
||||
this._extra = {
|
||||
...this._extra,
|
||||
...extras,
|
||||
};
|
||||
this._notifyScopeListeners();
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
setExtra(key, extra) {
|
||||
this._extra = { ...this._extra, [key]: extra };
|
||||
this._notifyScopeListeners();
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
setFingerprint(fingerprint) {
|
||||
this._fingerprint = fingerprint;
|
||||
this._notifyScopeListeners();
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
setLevel(
|
||||
// eslint-disable-next-line deprecation/deprecation
|
||||
level,
|
||||
) {
|
||||
this._level = level;
|
||||
this._notifyScopeListeners();
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
setTransactionName(name) {
|
||||
this._transactionName = name;
|
||||
this._notifyScopeListeners();
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
setContext(key, context) {
|
||||
if (context === null) {
|
||||
// eslint-disable-next-line @typescript-eslint/no-dynamic-delete
|
||||
delete this._contexts[key];
|
||||
} else {
|
||||
this._contexts[key] = context;
|
||||
}
|
||||
|
||||
this._notifyScopeListeners();
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
setSpan(span) {
|
||||
this._span = span;
|
||||
this._notifyScopeListeners();
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
getSpan() {
|
||||
return this._span;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
getTransaction() {
|
||||
// Often, this span (if it exists at all) will be a transaction, but it's not guaranteed to be. Regardless, it will
|
||||
// have a pointer to the currently-active transaction.
|
||||
const span = this.getSpan();
|
||||
return span && span.transaction;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
setSession(session) {
|
||||
if (!session) {
|
||||
delete this._session;
|
||||
} else {
|
||||
this._session = session;
|
||||
}
|
||||
this._notifyScopeListeners();
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
getSession() {
|
||||
return this._session;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
update(captureContext) {
|
||||
if (!captureContext) {
|
||||
return this;
|
||||
}
|
||||
|
||||
if (typeof captureContext === 'function') {
|
||||
const updatedScope = (captureContext )(this);
|
||||
return updatedScope instanceof Scope ? updatedScope : this;
|
||||
}
|
||||
|
||||
if (captureContext instanceof Scope) {
|
||||
this._tags = { ...this._tags, ...captureContext._tags };
|
||||
this._extra = { ...this._extra, ...captureContext._extra };
|
||||
this._contexts = { ...this._contexts, ...captureContext._contexts };
|
||||
if (captureContext._user && Object.keys(captureContext._user).length) {
|
||||
this._user = captureContext._user;
|
||||
}
|
||||
if (captureContext._level) {
|
||||
this._level = captureContext._level;
|
||||
}
|
||||
if (captureContext._fingerprint) {
|
||||
this._fingerprint = captureContext._fingerprint;
|
||||
}
|
||||
if (captureContext._requestSession) {
|
||||
this._requestSession = captureContext._requestSession;
|
||||
}
|
||||
} else if (isPlainObject(captureContext)) {
|
||||
// eslint-disable-next-line no-param-reassign
|
||||
captureContext = captureContext ;
|
||||
this._tags = { ...this._tags, ...captureContext.tags };
|
||||
this._extra = { ...this._extra, ...captureContext.extra };
|
||||
this._contexts = { ...this._contexts, ...captureContext.contexts };
|
||||
if (captureContext.user) {
|
||||
this._user = captureContext.user;
|
||||
}
|
||||
if (captureContext.level) {
|
||||
this._level = captureContext.level;
|
||||
}
|
||||
if (captureContext.fingerprint) {
|
||||
this._fingerprint = captureContext.fingerprint;
|
||||
}
|
||||
if (captureContext.requestSession) {
|
||||
this._requestSession = captureContext.requestSession;
|
||||
}
|
||||
}
|
||||
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
clear() {
|
||||
this._breadcrumbs = [];
|
||||
this._tags = {};
|
||||
this._extra = {};
|
||||
this._user = {};
|
||||
this._contexts = {};
|
||||
this._level = undefined;
|
||||
this._transactionName = undefined;
|
||||
this._fingerprint = undefined;
|
||||
this._requestSession = undefined;
|
||||
this._span = undefined;
|
||||
this._session = undefined;
|
||||
this._notifyScopeListeners();
|
||||
this._attachments = [];
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
addBreadcrumb(breadcrumb, maxBreadcrumbs) {
|
||||
const maxCrumbs = typeof maxBreadcrumbs === 'number' ? maxBreadcrumbs : DEFAULT_MAX_BREADCRUMBS;
|
||||
|
||||
// No data has been changed, so don't notify scope listeners
|
||||
if (maxCrumbs <= 0) {
|
||||
return this;
|
||||
}
|
||||
|
||||
const mergedBreadcrumb = {
|
||||
timestamp: dateTimestampInSeconds(),
|
||||
...breadcrumb,
|
||||
};
|
||||
this._breadcrumbs = [...this._breadcrumbs, mergedBreadcrumb].slice(-maxCrumbs);
|
||||
this._notifyScopeListeners();
|
||||
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
getLastBreadcrumb() {
|
||||
return this._breadcrumbs[this._breadcrumbs.length - 1];
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
clearBreadcrumbs() {
|
||||
this._breadcrumbs = [];
|
||||
this._notifyScopeListeners();
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
addAttachment(attachment) {
|
||||
this._attachments.push(attachment);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
getAttachments() {
|
||||
return this._attachments;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
clearAttachments() {
|
||||
this._attachments = [];
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Applies data from the scope to the event and runs all event processors on it.
|
||||
*
|
||||
* @param event Event
|
||||
* @param hint Object containing additional information about the original exception, for use by the event processors.
|
||||
* @hidden
|
||||
*/
|
||||
applyToEvent(event, hint = {}) {
|
||||
if (this._extra && Object.keys(this._extra).length) {
|
||||
event.extra = { ...this._extra, ...event.extra };
|
||||
}
|
||||
if (this._tags && Object.keys(this._tags).length) {
|
||||
event.tags = { ...this._tags, ...event.tags };
|
||||
}
|
||||
if (this._user && Object.keys(this._user).length) {
|
||||
event.user = { ...this._user, ...event.user };
|
||||
}
|
||||
if (this._contexts && Object.keys(this._contexts).length) {
|
||||
event.contexts = { ...this._contexts, ...event.contexts };
|
||||
}
|
||||
if (this._level) {
|
||||
event.level = this._level;
|
||||
}
|
||||
if (this._transactionName) {
|
||||
event.transaction = this._transactionName;
|
||||
}
|
||||
|
||||
// We want to set the trace context for normal events only if there isn't already
|
||||
// a trace context on the event. There is a product feature in place where we link
|
||||
// errors with transaction and it relies on that.
|
||||
if (this._span) {
|
||||
event.contexts = { trace: this._span.getTraceContext(), ...event.contexts };
|
||||
const transaction = this._span.transaction;
|
||||
if (transaction) {
|
||||
event.sdkProcessingMetadata = {
|
||||
dynamicSamplingContext: transaction.getDynamicSamplingContext(),
|
||||
...event.sdkProcessingMetadata,
|
||||
};
|
||||
const transactionName = transaction.name;
|
||||
if (transactionName) {
|
||||
event.tags = { transaction: transactionName, ...event.tags };
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
this._applyFingerprint(event);
|
||||
|
||||
event.breadcrumbs = [...(event.breadcrumbs || []), ...this._breadcrumbs];
|
||||
event.breadcrumbs = event.breadcrumbs.length > 0 ? event.breadcrumbs : undefined;
|
||||
|
||||
event.sdkProcessingMetadata = { ...event.sdkProcessingMetadata, ...this._sdkProcessingMetadata };
|
||||
|
||||
return this._notifyEventProcessors([...getGlobalEventProcessors(), ...this._eventProcessors], event, hint);
|
||||
}
|
||||
|
||||
/**
|
||||
* Add data which will be accessible during event processing but won't get sent to Sentry
|
||||
*/
|
||||
setSDKProcessingMetadata(newData) {
|
||||
this._sdkProcessingMetadata = { ...this._sdkProcessingMetadata, ...newData };
|
||||
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* This will be called after {@link applyToEvent} is finished.
|
||||
*/
|
||||
_notifyEventProcessors(
|
||||
processors,
|
||||
event,
|
||||
hint,
|
||||
index = 0,
|
||||
) {
|
||||
return new SyncPromise((resolve, reject) => {
|
||||
const processor = processors[index];
|
||||
if (event === null || typeof processor !== 'function') {
|
||||
resolve(event);
|
||||
} else {
|
||||
const result = processor({ ...event }, hint) ;
|
||||
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) &&
|
||||
processor.id &&
|
||||
result === null &&
|
||||
logger.log(`Event processor "${processor.id}" dropped event`);
|
||||
|
||||
if (isThenable(result)) {
|
||||
void result
|
||||
.then(final => this._notifyEventProcessors(processors, final, hint, index + 1).then(resolve))
|
||||
.then(null, reject);
|
||||
} else {
|
||||
void this._notifyEventProcessors(processors, result, hint, index + 1)
|
||||
.then(resolve)
|
||||
.then(null, reject);
|
||||
}
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
/**
|
||||
* This will be called on every set call.
|
||||
*/
|
||||
_notifyScopeListeners() {
|
||||
// We need this check for this._notifyingListeners to be able to work on scope during updates
|
||||
// If this check is not here we'll produce endless recursion when something is done with the scope
|
||||
// during the callback.
|
||||
if (!this._notifyingListeners) {
|
||||
this._notifyingListeners = true;
|
||||
this._scopeListeners.forEach(callback => {
|
||||
callback(this);
|
||||
});
|
||||
this._notifyingListeners = false;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Applies fingerprint from the scope to the event if there's one,
|
||||
* uses message if there's one instead or get rid of empty fingerprint
|
||||
*/
|
||||
_applyFingerprint(event) {
|
||||
// Make sure it's an array first and we actually have something in place
|
||||
event.fingerprint = event.fingerprint ? arrayify(event.fingerprint) : [];
|
||||
|
||||
// If we have something on the scope, then merge it with event
|
||||
if (this._fingerprint) {
|
||||
event.fingerprint = event.fingerprint.concat(this._fingerprint);
|
||||
}
|
||||
|
||||
// If we have no data at all, remove empty array default
|
||||
if (event.fingerprint && !event.fingerprint.length) {
|
||||
delete event.fingerprint;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Returns the global event processors.
|
||||
*/
|
||||
function getGlobalEventProcessors() {
|
||||
return getGlobalSingleton('globalEventProcessors', () => []);
|
||||
}
|
||||
|
||||
/**
|
||||
* Add a EventProcessor to be kept globally.
|
||||
* @param callback EventProcessor to add
|
||||
*/
|
||||
function addGlobalEventProcessor(callback) {
|
||||
getGlobalEventProcessors().push(callback);
|
||||
}
|
||||
|
||||
export { Scope, addGlobalEventProcessor };
|
||||
//# sourceMappingURL=scope.js.map
|
||||
35
shared/logger/node_modules/@sentry/core/esm/sdk.js
generated
vendored
Normal file
35
shared/logger/node_modules/@sentry/core/esm/sdk.js
generated
vendored
Normal file
@@ -0,0 +1,35 @@
|
||||
import { logger } from '@sentry/utils';
|
||||
import { getCurrentHub } from './hub.js';
|
||||
|
||||
/** A class object that can instantiate Client objects. */
|
||||
|
||||
/**
|
||||
* Internal function to create a new SDK client instance. The client is
|
||||
* installed and then bound to the current scope.
|
||||
*
|
||||
* @param clientClass The client class to instantiate.
|
||||
* @param options Options to pass to the client.
|
||||
*/
|
||||
function initAndBind(
|
||||
clientClass,
|
||||
options,
|
||||
) {
|
||||
if (options.debug === true) {
|
||||
if ((typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__)) {
|
||||
logger.enable();
|
||||
} else {
|
||||
// use `console.warn` rather than `logger.warn` since by non-debug bundles have all `logger.x` statements stripped
|
||||
// eslint-disable-next-line no-console
|
||||
console.warn('[Sentry] Cannot initialize SDK with `debug` option using a non-debug bundle.');
|
||||
}
|
||||
}
|
||||
const hub = getCurrentHub();
|
||||
const scope = hub.getScope();
|
||||
scope.update(options.initialScope);
|
||||
|
||||
const client = new clientClass(options);
|
||||
hub.bindClient(client);
|
||||
}
|
||||
|
||||
export { initAndBind };
|
||||
//# sourceMappingURL=sdk.js.map
|
||||
155
shared/logger/node_modules/@sentry/core/esm/session.js
generated
vendored
Normal file
155
shared/logger/node_modules/@sentry/core/esm/session.js
generated
vendored
Normal file
@@ -0,0 +1,155 @@
|
||||
import { timestampInSeconds, uuid4, dropUndefinedKeys } from '@sentry/utils';
|
||||
|
||||
/**
|
||||
* Creates a new `Session` object by setting certain default parameters. If optional @param context
|
||||
* is passed, the passed properties are applied to the session object.
|
||||
*
|
||||
* @param context (optional) additional properties to be applied to the returned session object
|
||||
*
|
||||
* @returns a new `Session` object
|
||||
*/
|
||||
function makeSession(context) {
|
||||
// Both timestamp and started are in seconds since the UNIX epoch.
|
||||
const startingTime = timestampInSeconds();
|
||||
|
||||
const session = {
|
||||
sid: uuid4(),
|
||||
init: true,
|
||||
timestamp: startingTime,
|
||||
started: startingTime,
|
||||
duration: 0,
|
||||
status: 'ok',
|
||||
errors: 0,
|
||||
ignoreDuration: false,
|
||||
toJSON: () => sessionToJSON(session),
|
||||
};
|
||||
|
||||
if (context) {
|
||||
updateSession(session, context);
|
||||
}
|
||||
|
||||
return session;
|
||||
}
|
||||
|
||||
/**
|
||||
* Updates a session object with the properties passed in the context.
|
||||
*
|
||||
* Note that this function mutates the passed object and returns void.
|
||||
* (Had to do this instead of returning a new and updated session because closing and sending a session
|
||||
* makes an update to the session after it was passed to the sending logic.
|
||||
* @see BaseClient.captureSession )
|
||||
*
|
||||
* @param session the `Session` to update
|
||||
* @param context the `SessionContext` holding the properties that should be updated in @param session
|
||||
*/
|
||||
// eslint-disable-next-line complexity
|
||||
function updateSession(session, context = {}) {
|
||||
if (context.user) {
|
||||
if (!session.ipAddress && context.user.ip_address) {
|
||||
session.ipAddress = context.user.ip_address;
|
||||
}
|
||||
|
||||
if (!session.did && !context.did) {
|
||||
session.did = context.user.id || context.user.email || context.user.username;
|
||||
}
|
||||
}
|
||||
|
||||
session.timestamp = context.timestamp || timestampInSeconds();
|
||||
|
||||
if (context.ignoreDuration) {
|
||||
session.ignoreDuration = context.ignoreDuration;
|
||||
}
|
||||
if (context.sid) {
|
||||
// Good enough uuid validation. — Kamil
|
||||
session.sid = context.sid.length === 32 ? context.sid : uuid4();
|
||||
}
|
||||
if (context.init !== undefined) {
|
||||
session.init = context.init;
|
||||
}
|
||||
if (!session.did && context.did) {
|
||||
session.did = `${context.did}`;
|
||||
}
|
||||
if (typeof context.started === 'number') {
|
||||
session.started = context.started;
|
||||
}
|
||||
if (session.ignoreDuration) {
|
||||
session.duration = undefined;
|
||||
} else if (typeof context.duration === 'number') {
|
||||
session.duration = context.duration;
|
||||
} else {
|
||||
const duration = session.timestamp - session.started;
|
||||
session.duration = duration >= 0 ? duration : 0;
|
||||
}
|
||||
if (context.release) {
|
||||
session.release = context.release;
|
||||
}
|
||||
if (context.environment) {
|
||||
session.environment = context.environment;
|
||||
}
|
||||
if (!session.ipAddress && context.ipAddress) {
|
||||
session.ipAddress = context.ipAddress;
|
||||
}
|
||||
if (!session.userAgent && context.userAgent) {
|
||||
session.userAgent = context.userAgent;
|
||||
}
|
||||
if (typeof context.errors === 'number') {
|
||||
session.errors = context.errors;
|
||||
}
|
||||
if (context.status) {
|
||||
session.status = context.status;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Closes a session by setting its status and updating the session object with it.
|
||||
* Internally calls `updateSession` to update the passed session object.
|
||||
*
|
||||
* Note that this function mutates the passed session (@see updateSession for explanation).
|
||||
*
|
||||
* @param session the `Session` object to be closed
|
||||
* @param status the `SessionStatus` with which the session was closed. If you don't pass a status,
|
||||
* this function will keep the previously set status, unless it was `'ok'` in which case
|
||||
* it is changed to `'exited'`.
|
||||
*/
|
||||
function closeSession(session, status) {
|
||||
let context = {};
|
||||
if (status) {
|
||||
context = { status };
|
||||
} else if (session.status === 'ok') {
|
||||
context = { status: 'exited' };
|
||||
}
|
||||
|
||||
updateSession(session, context);
|
||||
}
|
||||
|
||||
/**
|
||||
* Serializes a passed session object to a JSON object with a slightly different structure.
|
||||
* This is necessary because the Sentry backend requires a slightly different schema of a session
|
||||
* than the one the JS SDKs use internally.
|
||||
*
|
||||
* @param session the session to be converted
|
||||
*
|
||||
* @returns a JSON object of the passed session
|
||||
*/
|
||||
function sessionToJSON(session) {
|
||||
return dropUndefinedKeys({
|
||||
sid: `${session.sid}`,
|
||||
init: session.init,
|
||||
// Make sure that sec is converted to ms for date constructor
|
||||
started: new Date(session.started * 1000).toISOString(),
|
||||
timestamp: new Date(session.timestamp * 1000).toISOString(),
|
||||
status: session.status,
|
||||
errors: session.errors,
|
||||
did: typeof session.did === 'number' || typeof session.did === 'string' ? `${session.did}` : undefined,
|
||||
duration: session.duration,
|
||||
attrs: {
|
||||
release: session.release,
|
||||
environment: session.environment,
|
||||
ip_address: session.ipAddress,
|
||||
user_agent: session.userAgent,
|
||||
},
|
||||
});
|
||||
}
|
||||
|
||||
export { closeSession, makeSession, updateSession };
|
||||
//# sourceMappingURL=session.js.map
|
||||
36
shared/logger/node_modules/@sentry/core/esm/tracing/errors.js
generated
vendored
Normal file
36
shared/logger/node_modules/@sentry/core/esm/tracing/errors.js
generated
vendored
Normal file
@@ -0,0 +1,36 @@
|
||||
import { addInstrumentationHandler, logger } from '@sentry/utils';
|
||||
import { getActiveTransaction } from './utils.js';
|
||||
|
||||
let errorsInstrumented = false;
|
||||
|
||||
/**
|
||||
* Configures global error listeners
|
||||
*/
|
||||
function registerErrorInstrumentation() {
|
||||
if (errorsInstrumented) {
|
||||
return;
|
||||
}
|
||||
|
||||
errorsInstrumented = true;
|
||||
addInstrumentationHandler('error', errorCallback);
|
||||
addInstrumentationHandler('unhandledrejection', errorCallback);
|
||||
}
|
||||
|
||||
/**
|
||||
* If an error or unhandled promise occurs, we mark the active transaction as failed
|
||||
*/
|
||||
function errorCallback() {
|
||||
const activeTransaction = getActiveTransaction();
|
||||
if (activeTransaction) {
|
||||
const status = 'internal_error';
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.log(`[Tracing] Transaction: ${status} -> Global error occured`);
|
||||
activeTransaction.setStatus(status);
|
||||
}
|
||||
}
|
||||
|
||||
// The function name will be lost when bundling but we need to be able to identify this listener later to maintain the
|
||||
// node.js default exit behaviour
|
||||
errorCallback.tag = 'sentry_tracingErrorCallback';
|
||||
|
||||
export { registerErrorInstrumentation };
|
||||
//# sourceMappingURL=errors.js.map
|
||||
241
shared/logger/node_modules/@sentry/core/esm/tracing/hubextensions.js
generated
vendored
Normal file
241
shared/logger/node_modules/@sentry/core/esm/tracing/hubextensions.js
generated
vendored
Normal file
@@ -0,0 +1,241 @@
|
||||
import { logger, isNaN } from '@sentry/utils';
|
||||
import { getMainCarrier } from '../hub.js';
|
||||
import { hasTracingEnabled } from '../utils/hasTracingEnabled.js';
|
||||
import { registerErrorInstrumentation } from './errors.js';
|
||||
import { IdleTransaction } from './idletransaction.js';
|
||||
import { Transaction } from './transaction.js';
|
||||
|
||||
/** Returns all trace headers that are currently on the top scope. */
|
||||
function traceHeaders() {
|
||||
const scope = this.getScope();
|
||||
const span = scope.getSpan();
|
||||
|
||||
return span
|
||||
? {
|
||||
'sentry-trace': span.toTraceparent(),
|
||||
}
|
||||
: {};
|
||||
}
|
||||
|
||||
/**
|
||||
* Makes a sampling decision for the given transaction and stores it on the transaction.
|
||||
*
|
||||
* Called every time a transaction is created. Only transactions which emerge with a `sampled` value of `true` will be
|
||||
* sent to Sentry.
|
||||
*
|
||||
* @param transaction: The transaction needing a sampling decision
|
||||
* @param options: The current client's options, so we can access `tracesSampleRate` and/or `tracesSampler`
|
||||
* @param samplingContext: Default and user-provided data which may be used to help make the decision
|
||||
*
|
||||
* @returns The given transaction with its `sampled` value set
|
||||
*/
|
||||
function sample(
|
||||
transaction,
|
||||
options,
|
||||
samplingContext,
|
||||
) {
|
||||
// nothing to do if tracing is not enabled
|
||||
if (!hasTracingEnabled(options)) {
|
||||
transaction.sampled = false;
|
||||
return transaction;
|
||||
}
|
||||
|
||||
// if the user has forced a sampling decision by passing a `sampled` value in their transaction context, go with that
|
||||
if (transaction.sampled !== undefined) {
|
||||
transaction.setMetadata({
|
||||
sampleRate: Number(transaction.sampled),
|
||||
});
|
||||
return transaction;
|
||||
}
|
||||
|
||||
// we would have bailed already if neither `tracesSampler` nor `tracesSampleRate` nor `enableTracing` were defined, so one of these should
|
||||
// work; prefer the hook if so
|
||||
let sampleRate;
|
||||
if (typeof options.tracesSampler === 'function') {
|
||||
sampleRate = options.tracesSampler(samplingContext);
|
||||
transaction.setMetadata({
|
||||
sampleRate: Number(sampleRate),
|
||||
});
|
||||
} else if (samplingContext.parentSampled !== undefined) {
|
||||
sampleRate = samplingContext.parentSampled;
|
||||
} else if (typeof options.tracesSampleRate !== 'undefined') {
|
||||
sampleRate = options.tracesSampleRate;
|
||||
transaction.setMetadata({
|
||||
sampleRate: Number(sampleRate),
|
||||
});
|
||||
} else {
|
||||
// When `enableTracing === true`, we use a sample rate of 100%
|
||||
sampleRate = 1;
|
||||
transaction.setMetadata({
|
||||
sampleRate,
|
||||
});
|
||||
}
|
||||
|
||||
// Since this is coming from the user (or from a function provided by the user), who knows what we might get. (The
|
||||
// only valid values are booleans or numbers between 0 and 1.)
|
||||
if (!isValidSampleRate(sampleRate)) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.warn('[Tracing] Discarding transaction because of invalid sample rate.');
|
||||
transaction.sampled = false;
|
||||
return transaction;
|
||||
}
|
||||
|
||||
// if the function returned 0 (or false), or if `tracesSampleRate` is 0, it's a sign the transaction should be dropped
|
||||
if (!sampleRate) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) &&
|
||||
logger.log(
|
||||
`[Tracing] Discarding transaction because ${
|
||||
typeof options.tracesSampler === 'function'
|
||||
? 'tracesSampler returned 0 or false'
|
||||
: 'a negative sampling decision was inherited or tracesSampleRate is set to 0'
|
||||
}`,
|
||||
);
|
||||
transaction.sampled = false;
|
||||
return transaction;
|
||||
}
|
||||
|
||||
// Now we roll the dice. Math.random is inclusive of 0, but not of 1, so strict < is safe here. In case sampleRate is
|
||||
// a boolean, the < comparison will cause it to be automatically cast to 1 if it's true and 0 if it's false.
|
||||
transaction.sampled = Math.random() < (sampleRate );
|
||||
|
||||
// if we're not going to keep it, we're done
|
||||
if (!transaction.sampled) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) &&
|
||||
logger.log(
|
||||
`[Tracing] Discarding transaction because it's not included in the random sample (sampling rate = ${Number(
|
||||
sampleRate,
|
||||
)})`,
|
||||
);
|
||||
return transaction;
|
||||
}
|
||||
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.log(`[Tracing] starting ${transaction.op} transaction - ${transaction.name}`);
|
||||
return transaction;
|
||||
}
|
||||
|
||||
/**
|
||||
* Checks the given sample rate to make sure it is valid type and value (a boolean, or a number between 0 and 1).
|
||||
*/
|
||||
function isValidSampleRate(rate) {
|
||||
// we need to check NaN explicitly because it's of type 'number' and therefore wouldn't get caught by this typecheck
|
||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any
|
||||
if (isNaN(rate) || !(typeof rate === 'number' || typeof rate === 'boolean')) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) &&
|
||||
logger.warn(
|
||||
`[Tracing] Given sample rate is invalid. Sample rate must be a boolean or a number between 0 and 1. Got ${JSON.stringify(
|
||||
rate,
|
||||
)} of type ${JSON.stringify(typeof rate)}.`,
|
||||
);
|
||||
return false;
|
||||
}
|
||||
|
||||
// in case sampleRate is a boolean, it will get automatically cast to 1 if it's true and 0 if it's false
|
||||
if (rate < 0 || rate > 1) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) &&
|
||||
logger.warn(`[Tracing] Given sample rate is invalid. Sample rate must be between 0 and 1. Got ${rate}.`);
|
||||
return false;
|
||||
}
|
||||
return true;
|
||||
}
|
||||
|
||||
/**
|
||||
* Creates a new transaction and adds a sampling decision if it doesn't yet have one.
|
||||
*
|
||||
* The Hub.startTransaction method delegates to this method to do its work, passing the Hub instance in as `this`, as if
|
||||
* it had been called on the hub directly. Exists as a separate function so that it can be injected into the class as an
|
||||
* "extension method."
|
||||
*
|
||||
* @param this: The Hub starting the transaction
|
||||
* @param transactionContext: Data used to configure the transaction
|
||||
* @param CustomSamplingContext: Optional data to be provided to the `tracesSampler` function (if any)
|
||||
*
|
||||
* @returns The new transaction
|
||||
*
|
||||
* @see {@link Hub.startTransaction}
|
||||
*/
|
||||
function _startTransaction(
|
||||
|
||||
transactionContext,
|
||||
customSamplingContext,
|
||||
) {
|
||||
const client = this.getClient();
|
||||
const options = (client && client.getOptions()) || {};
|
||||
|
||||
const configInstrumenter = options.instrumenter || 'sentry';
|
||||
const transactionInstrumenter = transactionContext.instrumenter || 'sentry';
|
||||
|
||||
if (configInstrumenter !== transactionInstrumenter) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) &&
|
||||
logger.error(
|
||||
`A transaction was started with instrumenter=\`${transactionInstrumenter}\`, but the SDK is configured with the \`${configInstrumenter}\` instrumenter.
|
||||
The transaction will not be sampled. Please use the ${configInstrumenter} instrumentation to start transactions.`,
|
||||
);
|
||||
|
||||
transactionContext.sampled = false;
|
||||
}
|
||||
|
||||
let transaction = new Transaction(transactionContext, this);
|
||||
transaction = sample(transaction, options, {
|
||||
parentSampled: transactionContext.parentSampled,
|
||||
transactionContext,
|
||||
...customSamplingContext,
|
||||
});
|
||||
if (transaction.sampled) {
|
||||
transaction.initSpanRecorder(options._experiments && (options._experiments.maxSpans ));
|
||||
}
|
||||
if (client && client.emit) {
|
||||
client.emit('startTransaction', transaction);
|
||||
}
|
||||
return transaction;
|
||||
}
|
||||
|
||||
/**
|
||||
* Create new idle transaction.
|
||||
*/
|
||||
function startIdleTransaction(
|
||||
hub,
|
||||
transactionContext,
|
||||
idleTimeout,
|
||||
finalTimeout,
|
||||
onScope,
|
||||
customSamplingContext,
|
||||
heartbeatInterval,
|
||||
) {
|
||||
const client = hub.getClient();
|
||||
const options = (client && client.getOptions()) || {};
|
||||
|
||||
let transaction = new IdleTransaction(transactionContext, hub, idleTimeout, finalTimeout, heartbeatInterval, onScope);
|
||||
transaction = sample(transaction, options, {
|
||||
parentSampled: transactionContext.parentSampled,
|
||||
transactionContext,
|
||||
...customSamplingContext,
|
||||
});
|
||||
if (transaction.sampled) {
|
||||
transaction.initSpanRecorder(options._experiments && (options._experiments.maxSpans ));
|
||||
}
|
||||
if (client && client.emit) {
|
||||
client.emit('startTransaction', transaction);
|
||||
}
|
||||
return transaction;
|
||||
}
|
||||
|
||||
/**
|
||||
* Adds tracing extensions to the global hub.
|
||||
*/
|
||||
function addTracingExtensions() {
|
||||
const carrier = getMainCarrier();
|
||||
if (!carrier.__SENTRY__) {
|
||||
return;
|
||||
}
|
||||
carrier.__SENTRY__.extensions = carrier.__SENTRY__.extensions || {};
|
||||
if (!carrier.__SENTRY__.extensions.startTransaction) {
|
||||
carrier.__SENTRY__.extensions.startTransaction = _startTransaction;
|
||||
}
|
||||
if (!carrier.__SENTRY__.extensions.traceHeaders) {
|
||||
carrier.__SENTRY__.extensions.traceHeaders = traceHeaders;
|
||||
}
|
||||
|
||||
registerErrorInstrumentation();
|
||||
}
|
||||
|
||||
export { addTracingExtensions, startIdleTransaction };
|
||||
//# sourceMappingURL=hubextensions.js.map
|
||||
347
shared/logger/node_modules/@sentry/core/esm/tracing/idletransaction.js
generated
vendored
Normal file
347
shared/logger/node_modules/@sentry/core/esm/tracing/idletransaction.js
generated
vendored
Normal file
@@ -0,0 +1,347 @@
|
||||
import { logger, timestampInSeconds } from '@sentry/utils';
|
||||
import { SpanRecorder } from './span.js';
|
||||
import { Transaction } from './transaction.js';
|
||||
|
||||
const TRACING_DEFAULTS = {
|
||||
idleTimeout: 1000,
|
||||
finalTimeout: 30000,
|
||||
heartbeatInterval: 5000,
|
||||
};
|
||||
|
||||
const FINISH_REASON_TAG = 'finishReason';
|
||||
|
||||
const IDLE_TRANSACTION_FINISH_REASONS = [
|
||||
'heartbeatFailed',
|
||||
'idleTimeout',
|
||||
'documentHidden',
|
||||
'finalTimeout',
|
||||
'externalFinish',
|
||||
'cancelled',
|
||||
];
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
class IdleTransactionSpanRecorder extends SpanRecorder {
|
||||
constructor(
|
||||
_pushActivity,
|
||||
_popActivity,
|
||||
transactionSpanId,
|
||||
maxlen,
|
||||
) {
|
||||
super(maxlen);this._pushActivity = _pushActivity;this._popActivity = _popActivity;this.transactionSpanId = transactionSpanId; }
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
add(span) {
|
||||
// We should make sure we do not push and pop activities for
|
||||
// the transaction that this span recorder belongs to.
|
||||
if (span.spanId !== this.transactionSpanId) {
|
||||
// We patch span.finish() to pop an activity after setting an endTimestamp.
|
||||
span.finish = (endTimestamp) => {
|
||||
span.endTimestamp = typeof endTimestamp === 'number' ? endTimestamp : timestampInSeconds();
|
||||
this._popActivity(span.spanId);
|
||||
};
|
||||
|
||||
// We should only push new activities if the span does not have an end timestamp.
|
||||
if (span.endTimestamp === undefined) {
|
||||
this._pushActivity(span.spanId);
|
||||
}
|
||||
}
|
||||
|
||||
super.add(span);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* An IdleTransaction is a transaction that automatically finishes. It does this by tracking child spans as activities.
|
||||
* You can have multiple IdleTransactions active, but if the `onScope` option is specified, the idle transaction will
|
||||
* put itself on the scope on creation.
|
||||
*/
|
||||
class IdleTransaction extends Transaction {
|
||||
// Activities store a list of active spans
|
||||
__init() {this.activities = {};}
|
||||
|
||||
// Track state of activities in previous heartbeat
|
||||
|
||||
// Amount of times heartbeat has counted. Will cause transaction to finish after 3 beats.
|
||||
__init2() {this._heartbeatCounter = 0;}
|
||||
|
||||
// We should not use heartbeat if we finished a transaction
|
||||
__init3() {this._finished = false;}
|
||||
|
||||
// Idle timeout was canceled and we should finish the transaction with the last span end.
|
||||
__init4() {this._idleTimeoutCanceledPermanently = false;}
|
||||
|
||||
__init5() {this._beforeFinishCallbacks = [];}
|
||||
|
||||
/**
|
||||
* Timer that tracks Transaction idleTimeout
|
||||
*/
|
||||
|
||||
__init6() {this._finishReason = IDLE_TRANSACTION_FINISH_REASONS[4];}
|
||||
|
||||
constructor(
|
||||
transactionContext,
|
||||
_idleHub,
|
||||
/**
|
||||
* The time to wait in ms until the idle transaction will be finished. This timer is started each time
|
||||
* there are no active spans on this transaction.
|
||||
*/
|
||||
_idleTimeout = TRACING_DEFAULTS.idleTimeout,
|
||||
/**
|
||||
* The final value in ms that a transaction cannot exceed
|
||||
*/
|
||||
_finalTimeout = TRACING_DEFAULTS.finalTimeout,
|
||||
_heartbeatInterval = TRACING_DEFAULTS.heartbeatInterval,
|
||||
// Whether or not the transaction should put itself on the scope when it starts and pop itself off when it ends
|
||||
_onScope = false,
|
||||
) {
|
||||
super(transactionContext, _idleHub);this._idleHub = _idleHub;this._idleTimeout = _idleTimeout;this._finalTimeout = _finalTimeout;this._heartbeatInterval = _heartbeatInterval;this._onScope = _onScope;IdleTransaction.prototype.__init.call(this);IdleTransaction.prototype.__init2.call(this);IdleTransaction.prototype.__init3.call(this);IdleTransaction.prototype.__init4.call(this);IdleTransaction.prototype.__init5.call(this);IdleTransaction.prototype.__init6.call(this);
|
||||
if (_onScope) {
|
||||
// We set the transaction here on the scope so error events pick up the trace
|
||||
// context and attach it to the error.
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.log(`Setting idle transaction on scope. Span ID: ${this.spanId}`);
|
||||
_idleHub.configureScope(scope => scope.setSpan(this));
|
||||
}
|
||||
|
||||
this._restartIdleTimeout();
|
||||
setTimeout(() => {
|
||||
if (!this._finished) {
|
||||
this.setStatus('deadline_exceeded');
|
||||
this._finishReason = IDLE_TRANSACTION_FINISH_REASONS[3];
|
||||
this.finish();
|
||||
}
|
||||
}, this._finalTimeout);
|
||||
}
|
||||
|
||||
/** {@inheritDoc} */
|
||||
finish(endTimestamp = timestampInSeconds()) {
|
||||
this._finished = true;
|
||||
this.activities = {};
|
||||
|
||||
if (this.op === 'ui.action.click') {
|
||||
this.setTag(FINISH_REASON_TAG, this._finishReason);
|
||||
}
|
||||
|
||||
if (this.spanRecorder) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) &&
|
||||
logger.log('[Tracing] finishing IdleTransaction', new Date(endTimestamp * 1000).toISOString(), this.op);
|
||||
|
||||
for (const callback of this._beforeFinishCallbacks) {
|
||||
callback(this, endTimestamp);
|
||||
}
|
||||
|
||||
this.spanRecorder.spans = this.spanRecorder.spans.filter((span) => {
|
||||
// If we are dealing with the transaction itself, we just return it
|
||||
if (span.spanId === this.spanId) {
|
||||
return true;
|
||||
}
|
||||
|
||||
// We cancel all pending spans with status "cancelled" to indicate the idle transaction was finished early
|
||||
if (!span.endTimestamp) {
|
||||
span.endTimestamp = endTimestamp;
|
||||
span.setStatus('cancelled');
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) &&
|
||||
logger.log('[Tracing] cancelling span since transaction ended early', JSON.stringify(span, undefined, 2));
|
||||
}
|
||||
|
||||
const keepSpan = span.startTimestamp < endTimestamp;
|
||||
if (!keepSpan) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) &&
|
||||
logger.log(
|
||||
'[Tracing] discarding Span since it happened after Transaction was finished',
|
||||
JSON.stringify(span, undefined, 2),
|
||||
);
|
||||
}
|
||||
return keepSpan;
|
||||
});
|
||||
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.log('[Tracing] flushing IdleTransaction');
|
||||
} else {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.log('[Tracing] No active IdleTransaction');
|
||||
}
|
||||
|
||||
// if `this._onScope` is `true`, the transaction put itself on the scope when it started
|
||||
if (this._onScope) {
|
||||
const scope = this._idleHub.getScope();
|
||||
if (scope.getTransaction() === this) {
|
||||
scope.setSpan(undefined);
|
||||
}
|
||||
}
|
||||
|
||||
return super.finish(endTimestamp);
|
||||
}
|
||||
|
||||
/**
|
||||
* Register a callback function that gets excecuted before the transaction finishes.
|
||||
* Useful for cleanup or if you want to add any additional spans based on current context.
|
||||
*
|
||||
* This is exposed because users have no other way of running something before an idle transaction
|
||||
* finishes.
|
||||
*/
|
||||
registerBeforeFinishCallback(callback) {
|
||||
this._beforeFinishCallbacks.push(callback);
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
initSpanRecorder(maxlen) {
|
||||
if (!this.spanRecorder) {
|
||||
const pushActivity = (id) => {
|
||||
if (this._finished) {
|
||||
return;
|
||||
}
|
||||
this._pushActivity(id);
|
||||
};
|
||||
const popActivity = (id) => {
|
||||
if (this._finished) {
|
||||
return;
|
||||
}
|
||||
this._popActivity(id);
|
||||
};
|
||||
|
||||
this.spanRecorder = new IdleTransactionSpanRecorder(pushActivity, popActivity, this.spanId, maxlen);
|
||||
|
||||
// Start heartbeat so that transactions do not run forever.
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.log('Starting heartbeat');
|
||||
this._pingHeartbeat();
|
||||
}
|
||||
this.spanRecorder.add(this);
|
||||
}
|
||||
|
||||
/**
|
||||
* Cancels the existing idle timeout, if there is one.
|
||||
* @param restartOnChildSpanChange Default is `true`.
|
||||
* If set to false the transaction will end
|
||||
* with the last child span.
|
||||
*/
|
||||
cancelIdleTimeout(
|
||||
endTimestamp,
|
||||
{
|
||||
restartOnChildSpanChange,
|
||||
}
|
||||
|
||||
= {
|
||||
restartOnChildSpanChange: true,
|
||||
},
|
||||
) {
|
||||
this._idleTimeoutCanceledPermanently = restartOnChildSpanChange === false;
|
||||
if (this._idleTimeoutID) {
|
||||
clearTimeout(this._idleTimeoutID);
|
||||
this._idleTimeoutID = undefined;
|
||||
|
||||
if (Object.keys(this.activities).length === 0 && this._idleTimeoutCanceledPermanently) {
|
||||
this._finishReason = IDLE_TRANSACTION_FINISH_REASONS[5];
|
||||
this.finish(endTimestamp);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Temporary method used to externally set the transaction's `finishReason`
|
||||
*
|
||||
* ** WARNING**
|
||||
* This is for the purpose of experimentation only and will be removed in the near future, do not use!
|
||||
*
|
||||
* @internal
|
||||
*
|
||||
*/
|
||||
setFinishReason(reason) {
|
||||
this._finishReason = reason;
|
||||
}
|
||||
|
||||
/**
|
||||
* Restarts idle timeout, if there is no running idle timeout it will start one.
|
||||
*/
|
||||
_restartIdleTimeout(endTimestamp) {
|
||||
this.cancelIdleTimeout();
|
||||
this._idleTimeoutID = setTimeout(() => {
|
||||
if (!this._finished && Object.keys(this.activities).length === 0) {
|
||||
this._finishReason = IDLE_TRANSACTION_FINISH_REASONS[1];
|
||||
this.finish(endTimestamp);
|
||||
}
|
||||
}, this._idleTimeout);
|
||||
}
|
||||
|
||||
/**
|
||||
* Start tracking a specific activity.
|
||||
* @param spanId The span id that represents the activity
|
||||
*/
|
||||
_pushActivity(spanId) {
|
||||
this.cancelIdleTimeout(undefined, { restartOnChildSpanChange: !this._idleTimeoutCanceledPermanently });
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.log(`[Tracing] pushActivity: ${spanId}`);
|
||||
this.activities[spanId] = true;
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.log('[Tracing] new activities count', Object.keys(this.activities).length);
|
||||
}
|
||||
|
||||
/**
|
||||
* Remove an activity from usage
|
||||
* @param spanId The span id that represents the activity
|
||||
*/
|
||||
_popActivity(spanId) {
|
||||
if (this.activities[spanId]) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.log(`[Tracing] popActivity ${spanId}`);
|
||||
// eslint-disable-next-line @typescript-eslint/no-dynamic-delete
|
||||
delete this.activities[spanId];
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.log('[Tracing] new activities count', Object.keys(this.activities).length);
|
||||
}
|
||||
|
||||
if (Object.keys(this.activities).length === 0) {
|
||||
const endTimestamp = timestampInSeconds();
|
||||
if (this._idleTimeoutCanceledPermanently) {
|
||||
this._finishReason = IDLE_TRANSACTION_FINISH_REASONS[5];
|
||||
this.finish(endTimestamp);
|
||||
} else {
|
||||
// We need to add the timeout here to have the real endtimestamp of the transaction
|
||||
// Remember timestampInSeconds is in seconds, timeout is in ms
|
||||
this._restartIdleTimeout(endTimestamp + this._idleTimeout / 1000);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Checks when entries of this.activities are not changing for 3 beats.
|
||||
* If this occurs we finish the transaction.
|
||||
*/
|
||||
_beat() {
|
||||
// We should not be running heartbeat if the idle transaction is finished.
|
||||
if (this._finished) {
|
||||
return;
|
||||
}
|
||||
|
||||
const heartbeatString = Object.keys(this.activities).join('');
|
||||
|
||||
if (heartbeatString === this._prevHeartbeatString) {
|
||||
this._heartbeatCounter++;
|
||||
} else {
|
||||
this._heartbeatCounter = 1;
|
||||
}
|
||||
|
||||
this._prevHeartbeatString = heartbeatString;
|
||||
|
||||
if (this._heartbeatCounter >= 3) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.log('[Tracing] Transaction finished because of no change for 3 heart beats');
|
||||
this.setStatus('deadline_exceeded');
|
||||
this._finishReason = IDLE_TRANSACTION_FINISH_REASONS[0];
|
||||
this.finish();
|
||||
} else {
|
||||
this._pingHeartbeat();
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Pings the heartbeat
|
||||
*/
|
||||
_pingHeartbeat() {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.log(`pinging Heartbeat -> current counter: ${this._heartbeatCounter}`);
|
||||
setTimeout(() => {
|
||||
this._beat();
|
||||
}, this._heartbeatInterval);
|
||||
}
|
||||
}
|
||||
|
||||
export { IdleTransaction, IdleTransactionSpanRecorder, TRACING_DEFAULTS };
|
||||
//# sourceMappingURL=idletransaction.js.map
|
||||
378
shared/logger/node_modules/@sentry/core/esm/tracing/span.js
generated
vendored
Normal file
378
shared/logger/node_modules/@sentry/core/esm/tracing/span.js
generated
vendored
Normal file
@@ -0,0 +1,378 @@
|
||||
import { uuid4, timestampInSeconds, logger, dropUndefinedKeys } from '@sentry/utils';
|
||||
|
||||
/**
|
||||
* Keeps track of finished spans for a given transaction
|
||||
* @internal
|
||||
* @hideconstructor
|
||||
* @hidden
|
||||
*/
|
||||
class SpanRecorder {
|
||||
__init() {this.spans = [];}
|
||||
|
||||
constructor(maxlen = 1000) {SpanRecorder.prototype.__init.call(this);
|
||||
this._maxlen = maxlen;
|
||||
}
|
||||
|
||||
/**
|
||||
* This is just so that we don't run out of memory while recording a lot
|
||||
* of spans. At some point we just stop and flush out the start of the
|
||||
* trace tree (i.e.the first n spans with the smallest
|
||||
* start_timestamp).
|
||||
*/
|
||||
add(span) {
|
||||
if (this.spans.length > this._maxlen) {
|
||||
span.spanRecorder = undefined;
|
||||
} else {
|
||||
this.spans.push(span);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Span contains all data about a span
|
||||
*/
|
||||
class Span {
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
__init2() {this.traceId = uuid4();}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
__init3() {this.spanId = uuid4().substring(16);}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
|
||||
/**
|
||||
* Internal keeper of the status
|
||||
*/
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
|
||||
/**
|
||||
* Timestamp in seconds when the span was created.
|
||||
*/
|
||||
__init4() {this.startTimestamp = timestampInSeconds();}
|
||||
|
||||
/**
|
||||
* Timestamp in seconds when the span ended.
|
||||
*/
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
__init5() {this.tags = {};}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any
|
||||
__init6() {this.data = {};}
|
||||
|
||||
/**
|
||||
* List of spans that were finalized
|
||||
*/
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
|
||||
/**
|
||||
* The instrumenter that created this span.
|
||||
*/
|
||||
__init7() {this.instrumenter = 'sentry';}
|
||||
|
||||
/**
|
||||
* You should never call the constructor manually, always use `Sentry.startTransaction()`
|
||||
* or call `startChild()` on an existing span.
|
||||
* @internal
|
||||
* @hideconstructor
|
||||
* @hidden
|
||||
*/
|
||||
constructor(spanContext) {Span.prototype.__init2.call(this);Span.prototype.__init3.call(this);Span.prototype.__init4.call(this);Span.prototype.__init5.call(this);Span.prototype.__init6.call(this);Span.prototype.__init7.call(this);
|
||||
if (!spanContext) {
|
||||
return this;
|
||||
}
|
||||
if (spanContext.traceId) {
|
||||
this.traceId = spanContext.traceId;
|
||||
}
|
||||
if (spanContext.spanId) {
|
||||
this.spanId = spanContext.spanId;
|
||||
}
|
||||
if (spanContext.parentSpanId) {
|
||||
this.parentSpanId = spanContext.parentSpanId;
|
||||
}
|
||||
// We want to include booleans as well here
|
||||
if ('sampled' in spanContext) {
|
||||
this.sampled = spanContext.sampled;
|
||||
}
|
||||
if (spanContext.op) {
|
||||
this.op = spanContext.op;
|
||||
}
|
||||
if (spanContext.description) {
|
||||
this.description = spanContext.description;
|
||||
}
|
||||
if (spanContext.data) {
|
||||
this.data = spanContext.data;
|
||||
}
|
||||
if (spanContext.tags) {
|
||||
this.tags = spanContext.tags;
|
||||
}
|
||||
if (spanContext.status) {
|
||||
this.status = spanContext.status;
|
||||
}
|
||||
if (spanContext.startTimestamp) {
|
||||
this.startTimestamp = spanContext.startTimestamp;
|
||||
}
|
||||
if (spanContext.endTimestamp) {
|
||||
this.endTimestamp = spanContext.endTimestamp;
|
||||
}
|
||||
if (spanContext.instrumenter) {
|
||||
this.instrumenter = spanContext.instrumenter;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
startChild(
|
||||
spanContext,
|
||||
) {
|
||||
const childSpan = new Span({
|
||||
...spanContext,
|
||||
parentSpanId: this.spanId,
|
||||
sampled: this.sampled,
|
||||
traceId: this.traceId,
|
||||
});
|
||||
|
||||
childSpan.spanRecorder = this.spanRecorder;
|
||||
if (childSpan.spanRecorder) {
|
||||
childSpan.spanRecorder.add(childSpan);
|
||||
}
|
||||
|
||||
childSpan.transaction = this.transaction;
|
||||
|
||||
if ((typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && childSpan.transaction) {
|
||||
const opStr = (spanContext && spanContext.op) || '< unknown op >';
|
||||
const nameStr = childSpan.transaction.name || '< unknown name >';
|
||||
const idStr = childSpan.transaction.spanId;
|
||||
|
||||
const logMessage = `[Tracing] Starting '${opStr}' span on transaction '${nameStr}' (${idStr}).`;
|
||||
childSpan.transaction.metadata.spanMetadata[childSpan.spanId] = { logMessage };
|
||||
logger.log(logMessage);
|
||||
}
|
||||
|
||||
return childSpan;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
setTag(key, value) {
|
||||
this.tags = { ...this.tags, [key]: value };
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any, @typescript-eslint/explicit-module-boundary-types
|
||||
setData(key, value) {
|
||||
this.data = { ...this.data, [key]: value };
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
setStatus(value) {
|
||||
this.status = value;
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
setHttpStatus(httpStatus) {
|
||||
this.setTag('http.status_code', String(httpStatus));
|
||||
this.setData('http.response.status_code', httpStatus);
|
||||
const spanStatus = spanStatusfromHttpCode(httpStatus);
|
||||
if (spanStatus !== 'unknown_error') {
|
||||
this.setStatus(spanStatus);
|
||||
}
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
isSuccess() {
|
||||
return this.status === 'ok';
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
finish(endTimestamp) {
|
||||
if (
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) &&
|
||||
// Don't call this for transactions
|
||||
this.transaction &&
|
||||
this.transaction.spanId !== this.spanId
|
||||
) {
|
||||
const { logMessage } = this.transaction.metadata.spanMetadata[this.spanId];
|
||||
if (logMessage) {
|
||||
logger.log((logMessage ).replace('Starting', 'Finishing'));
|
||||
}
|
||||
}
|
||||
|
||||
this.endTimestamp = typeof endTimestamp === 'number' ? endTimestamp : timestampInSeconds();
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
toTraceparent() {
|
||||
let sampledString = '';
|
||||
if (this.sampled !== undefined) {
|
||||
sampledString = this.sampled ? '-1' : '-0';
|
||||
}
|
||||
return `${this.traceId}-${this.spanId}${sampledString}`;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
toContext() {
|
||||
return dropUndefinedKeys({
|
||||
data: this.data,
|
||||
description: this.description,
|
||||
endTimestamp: this.endTimestamp,
|
||||
op: this.op,
|
||||
parentSpanId: this.parentSpanId,
|
||||
sampled: this.sampled,
|
||||
spanId: this.spanId,
|
||||
startTimestamp: this.startTimestamp,
|
||||
status: this.status,
|
||||
tags: this.tags,
|
||||
traceId: this.traceId,
|
||||
});
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
updateWithContext(spanContext) {
|
||||
this.data = spanContext.data || {};
|
||||
this.description = spanContext.description;
|
||||
this.endTimestamp = spanContext.endTimestamp;
|
||||
this.op = spanContext.op;
|
||||
this.parentSpanId = spanContext.parentSpanId;
|
||||
this.sampled = spanContext.sampled;
|
||||
this.spanId = spanContext.spanId || this.spanId;
|
||||
this.startTimestamp = spanContext.startTimestamp || this.startTimestamp;
|
||||
this.status = spanContext.status;
|
||||
this.tags = spanContext.tags || {};
|
||||
this.traceId = spanContext.traceId || this.traceId;
|
||||
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
getTraceContext() {
|
||||
return dropUndefinedKeys({
|
||||
data: Object.keys(this.data).length > 0 ? this.data : undefined,
|
||||
description: this.description,
|
||||
op: this.op,
|
||||
parent_span_id: this.parentSpanId,
|
||||
span_id: this.spanId,
|
||||
status: this.status,
|
||||
tags: Object.keys(this.tags).length > 0 ? this.tags : undefined,
|
||||
trace_id: this.traceId,
|
||||
});
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
toJSON()
|
||||
|
||||
{
|
||||
return dropUndefinedKeys({
|
||||
data: Object.keys(this.data).length > 0 ? this.data : undefined,
|
||||
description: this.description,
|
||||
op: this.op,
|
||||
parent_span_id: this.parentSpanId,
|
||||
span_id: this.spanId,
|
||||
start_timestamp: this.startTimestamp,
|
||||
status: this.status,
|
||||
tags: Object.keys(this.tags).length > 0 ? this.tags : undefined,
|
||||
timestamp: this.endTimestamp,
|
||||
trace_id: this.traceId,
|
||||
});
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Converts a HTTP status code into a {@link SpanStatusType}.
|
||||
*
|
||||
* @param httpStatus The HTTP response status code.
|
||||
* @returns The span status or unknown_error.
|
||||
*/
|
||||
function spanStatusfromHttpCode(httpStatus) {
|
||||
if (httpStatus < 400 && httpStatus >= 100) {
|
||||
return 'ok';
|
||||
}
|
||||
|
||||
if (httpStatus >= 400 && httpStatus < 500) {
|
||||
switch (httpStatus) {
|
||||
case 401:
|
||||
return 'unauthenticated';
|
||||
case 403:
|
||||
return 'permission_denied';
|
||||
case 404:
|
||||
return 'not_found';
|
||||
case 409:
|
||||
return 'already_exists';
|
||||
case 413:
|
||||
return 'failed_precondition';
|
||||
case 429:
|
||||
return 'resource_exhausted';
|
||||
default:
|
||||
return 'invalid_argument';
|
||||
}
|
||||
}
|
||||
|
||||
if (httpStatus >= 500 && httpStatus < 600) {
|
||||
switch (httpStatus) {
|
||||
case 501:
|
||||
return 'unimplemented';
|
||||
case 503:
|
||||
return 'unavailable';
|
||||
case 504:
|
||||
return 'deadline_exceeded';
|
||||
default:
|
||||
return 'internal_error';
|
||||
}
|
||||
}
|
||||
|
||||
return 'unknown_error';
|
||||
}
|
||||
|
||||
export { Span, SpanRecorder, spanStatusfromHttpCode };
|
||||
//# sourceMappingURL=span.js.map
|
||||
78
shared/logger/node_modules/@sentry/core/esm/tracing/trace.js
generated
vendored
Normal file
78
shared/logger/node_modules/@sentry/core/esm/tracing/trace.js
generated
vendored
Normal file
@@ -0,0 +1,78 @@
|
||||
import { isThenable } from '@sentry/utils';
|
||||
import { getCurrentHub } from '../hub.js';
|
||||
import { hasTracingEnabled } from '../utils/hasTracingEnabled.js';
|
||||
|
||||
/**
|
||||
* Wraps a function with a transaction/span and finishes the span after the function is done.
|
||||
*
|
||||
* Note that if you have not enabled tracing extensions via `addTracingExtensions`
|
||||
* or you didn't set `tracesSampleRate`, this function will not generate spans
|
||||
* and the `span` returned from the callback will be undefined.
|
||||
*
|
||||
* This function is meant to be used internally and may break at any time. Use at your own risk.
|
||||
*
|
||||
* @internal
|
||||
* @private
|
||||
*/
|
||||
function trace(
|
||||
context,
|
||||
callback,
|
||||
// eslint-disable-next-line @typescript-eslint/no-empty-function
|
||||
onError = () => {},
|
||||
) {
|
||||
const ctx = { ...context };
|
||||
// If a name is set and a description is not, set the description to the name.
|
||||
if (ctx.name !== undefined && ctx.description === undefined) {
|
||||
ctx.description = ctx.name;
|
||||
}
|
||||
|
||||
const hub = getCurrentHub();
|
||||
const scope = hub.getScope();
|
||||
|
||||
const parentSpan = scope.getSpan();
|
||||
|
||||
function getActiveSpan() {
|
||||
if (!hasTracingEnabled()) {
|
||||
return undefined;
|
||||
}
|
||||
return parentSpan ? parentSpan.startChild(ctx) : hub.startTransaction(ctx);
|
||||
}
|
||||
|
||||
const activeSpan = getActiveSpan();
|
||||
scope.setSpan(activeSpan);
|
||||
|
||||
function finishAndSetSpan() {
|
||||
activeSpan && activeSpan.finish();
|
||||
hub.getScope().setSpan(parentSpan);
|
||||
}
|
||||
|
||||
let maybePromiseResult;
|
||||
try {
|
||||
maybePromiseResult = callback(activeSpan);
|
||||
} catch (e) {
|
||||
activeSpan && activeSpan.setStatus('internal_error');
|
||||
onError(e);
|
||||
finishAndSetSpan();
|
||||
throw e;
|
||||
}
|
||||
|
||||
if (isThenable(maybePromiseResult)) {
|
||||
Promise.resolve(maybePromiseResult).then(
|
||||
() => {
|
||||
finishAndSetSpan();
|
||||
},
|
||||
e => {
|
||||
activeSpan && activeSpan.setStatus('internal_error');
|
||||
onError(e);
|
||||
finishAndSetSpan();
|
||||
},
|
||||
);
|
||||
} else {
|
||||
finishAndSetSpan();
|
||||
}
|
||||
|
||||
return maybePromiseResult;
|
||||
}
|
||||
|
||||
export { trace };
|
||||
//# sourceMappingURL=trace.js.map
|
||||
276
shared/logger/node_modules/@sentry/core/esm/tracing/transaction.js
generated
vendored
Normal file
276
shared/logger/node_modules/@sentry/core/esm/tracing/transaction.js
generated
vendored
Normal file
@@ -0,0 +1,276 @@
|
||||
import { logger, dropUndefinedKeys } from '@sentry/utils';
|
||||
import { DEFAULT_ENVIRONMENT } from '../constants.js';
|
||||
import { getCurrentHub } from '../hub.js';
|
||||
import { Span, SpanRecorder } from './span.js';
|
||||
|
||||
/** JSDoc */
|
||||
class Transaction extends Span {
|
||||
|
||||
/**
|
||||
* The reference to the current hub.
|
||||
*/
|
||||
|
||||
__init() {this._measurements = {};}
|
||||
|
||||
__init2() {this._contexts = {};}
|
||||
|
||||
__init3() {this._frozenDynamicSamplingContext = undefined;}
|
||||
|
||||
/**
|
||||
* This constructor should never be called manually. Those instrumenting tracing should use
|
||||
* `Sentry.startTransaction()`, and internal methods should use `hub.startTransaction()`.
|
||||
* @internal
|
||||
* @hideconstructor
|
||||
* @hidden
|
||||
*/
|
||||
constructor(transactionContext, hub) {
|
||||
super(transactionContext);Transaction.prototype.__init.call(this);Transaction.prototype.__init2.call(this);Transaction.prototype.__init3.call(this);
|
||||
this._hub = hub || getCurrentHub();
|
||||
|
||||
this._name = transactionContext.name || '';
|
||||
|
||||
this.metadata = {
|
||||
source: 'custom',
|
||||
...transactionContext.metadata,
|
||||
spanMetadata: {},
|
||||
};
|
||||
|
||||
this._trimEnd = transactionContext.trimEnd;
|
||||
|
||||
// this is because transactions are also spans, and spans have a transaction pointer
|
||||
this.transaction = this;
|
||||
|
||||
// If Dynamic Sampling Context is provided during the creation of the transaction, we freeze it as it usually means
|
||||
// there is incoming Dynamic Sampling Context. (Either through an incoming request, a baggage meta-tag, or other means)
|
||||
const incomingDynamicSamplingContext = this.metadata.dynamicSamplingContext;
|
||||
if (incomingDynamicSamplingContext) {
|
||||
// We shallow copy this in case anything writes to the original reference of the passed in `dynamicSamplingContext`
|
||||
this._frozenDynamicSamplingContext = { ...incomingDynamicSamplingContext };
|
||||
}
|
||||
}
|
||||
|
||||
/** Getter for `name` property */
|
||||
get name() {
|
||||
return this._name;
|
||||
}
|
||||
|
||||
/** Setter for `name` property, which also sets `source` as custom */
|
||||
set name(newName) {
|
||||
this.setName(newName);
|
||||
}
|
||||
|
||||
/**
|
||||
* JSDoc
|
||||
*/
|
||||
setName(name, source = 'custom') {
|
||||
this._name = name;
|
||||
this.metadata.source = source;
|
||||
}
|
||||
|
||||
/**
|
||||
* Attaches SpanRecorder to the span itself
|
||||
* @param maxlen maximum number of spans that can be recorded
|
||||
*/
|
||||
initSpanRecorder(maxlen = 1000) {
|
||||
if (!this.spanRecorder) {
|
||||
this.spanRecorder = new SpanRecorder(maxlen);
|
||||
}
|
||||
this.spanRecorder.add(this);
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
setContext(key, context) {
|
||||
if (context === null) {
|
||||
// eslint-disable-next-line @typescript-eslint/no-dynamic-delete
|
||||
delete this._contexts[key];
|
||||
} else {
|
||||
this._contexts[key] = context;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
setMeasurement(name, value, unit = '') {
|
||||
this._measurements[name] = { value, unit };
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
setMetadata(newMetadata) {
|
||||
this.metadata = { ...this.metadata, ...newMetadata };
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
finish(endTimestamp) {
|
||||
// This transaction is already finished, so we should not flush it again.
|
||||
if (this.endTimestamp !== undefined) {
|
||||
return undefined;
|
||||
}
|
||||
|
||||
if (!this.name) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.warn('Transaction has no name, falling back to `<unlabeled transaction>`.');
|
||||
this.name = '<unlabeled transaction>';
|
||||
}
|
||||
|
||||
// just sets the end timestamp
|
||||
super.finish(endTimestamp);
|
||||
|
||||
const client = this._hub.getClient();
|
||||
if (client && client.emit) {
|
||||
client.emit('finishTransaction', this);
|
||||
}
|
||||
|
||||
if (this.sampled !== true) {
|
||||
// At this point if `sampled !== true` we want to discard the transaction.
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.log('[Tracing] Discarding transaction because its trace was not chosen to be sampled.');
|
||||
|
||||
if (client) {
|
||||
client.recordDroppedEvent('sample_rate', 'transaction');
|
||||
}
|
||||
|
||||
return undefined;
|
||||
}
|
||||
|
||||
const finishedSpans = this.spanRecorder ? this.spanRecorder.spans.filter(s => s !== this && s.endTimestamp) : [];
|
||||
|
||||
if (this._trimEnd && finishedSpans.length > 0) {
|
||||
this.endTimestamp = finishedSpans.reduce((prev, current) => {
|
||||
if (prev.endTimestamp && current.endTimestamp) {
|
||||
return prev.endTimestamp > current.endTimestamp ? prev : current;
|
||||
}
|
||||
return prev;
|
||||
}).endTimestamp;
|
||||
}
|
||||
|
||||
const metadata = this.metadata;
|
||||
|
||||
const transaction = {
|
||||
contexts: {
|
||||
...this._contexts,
|
||||
// We don't want to override trace context
|
||||
trace: this.getTraceContext(),
|
||||
},
|
||||
spans: finishedSpans,
|
||||
start_timestamp: this.startTimestamp,
|
||||
tags: this.tags,
|
||||
timestamp: this.endTimestamp,
|
||||
transaction: this.name,
|
||||
type: 'transaction',
|
||||
sdkProcessingMetadata: {
|
||||
...metadata,
|
||||
dynamicSamplingContext: this.getDynamicSamplingContext(),
|
||||
},
|
||||
...(metadata.source && {
|
||||
transaction_info: {
|
||||
source: metadata.source,
|
||||
},
|
||||
}),
|
||||
};
|
||||
|
||||
const hasMeasurements = Object.keys(this._measurements).length > 0;
|
||||
|
||||
if (hasMeasurements) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) &&
|
||||
logger.log(
|
||||
'[Measurements] Adding measurements to transaction',
|
||||
JSON.stringify(this._measurements, undefined, 2),
|
||||
);
|
||||
transaction.measurements = this._measurements;
|
||||
}
|
||||
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.log(`[Tracing] Finishing ${this.op} transaction: ${this.name}.`);
|
||||
|
||||
return this._hub.captureEvent(transaction);
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
toContext() {
|
||||
const spanContext = super.toContext();
|
||||
|
||||
return dropUndefinedKeys({
|
||||
...spanContext,
|
||||
name: this.name,
|
||||
trimEnd: this._trimEnd,
|
||||
});
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritDoc
|
||||
*/
|
||||
updateWithContext(transactionContext) {
|
||||
super.updateWithContext(transactionContext);
|
||||
|
||||
this.name = transactionContext.name || '';
|
||||
|
||||
this._trimEnd = transactionContext.trimEnd;
|
||||
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* @inheritdoc
|
||||
*
|
||||
* @experimental
|
||||
*/
|
||||
getDynamicSamplingContext() {
|
||||
if (this._frozenDynamicSamplingContext) {
|
||||
return this._frozenDynamicSamplingContext;
|
||||
}
|
||||
|
||||
const hub = this._hub || getCurrentHub();
|
||||
const client = hub && hub.getClient();
|
||||
|
||||
if (!client) return {};
|
||||
|
||||
const { environment, release } = client.getOptions() || {};
|
||||
const { publicKey: public_key } = client.getDsn() || {};
|
||||
|
||||
const maybeSampleRate = this.metadata.sampleRate;
|
||||
const sample_rate = maybeSampleRate !== undefined ? maybeSampleRate.toString() : undefined;
|
||||
|
||||
const { segment: user_segment } = hub.getScope().getUser() || {};
|
||||
|
||||
const source = this.metadata.source;
|
||||
|
||||
// We don't want to have a transaction name in the DSC if the source is "url" because URLs might contain PII
|
||||
const transaction = source && source !== 'url' ? this.name : undefined;
|
||||
|
||||
const dsc = dropUndefinedKeys({
|
||||
environment: environment || DEFAULT_ENVIRONMENT,
|
||||
release,
|
||||
transaction,
|
||||
user_segment,
|
||||
public_key,
|
||||
trace_id: this.traceId,
|
||||
sample_rate,
|
||||
});
|
||||
|
||||
// Uncomment if we want to make DSC immutable
|
||||
// this._frozenDynamicSamplingContext = dsc;
|
||||
|
||||
client.emit && client.emit('createDsc', dsc);
|
||||
|
||||
return dsc;
|
||||
}
|
||||
|
||||
/**
|
||||
* Override the current hub with a new one.
|
||||
* Used if you want another hub to finish the transaction.
|
||||
*
|
||||
* @internal
|
||||
*/
|
||||
setHub(hub) {
|
||||
this._hub = hub;
|
||||
}
|
||||
}
|
||||
|
||||
export { Transaction };
|
||||
//# sourceMappingURL=transaction.js.map
|
||||
12
shared/logger/node_modules/@sentry/core/esm/tracing/utils.js
generated
vendored
Normal file
12
shared/logger/node_modules/@sentry/core/esm/tracing/utils.js
generated
vendored
Normal file
@@ -0,0 +1,12 @@
|
||||
import { getCurrentHub } from '../hub.js';
|
||||
export { TRACEPARENT_REGEXP, extractTraceparentData, stripUrlQueryAndFragment } from '@sentry/utils';
|
||||
|
||||
/** Grabs active transaction off scope, if any */
|
||||
function getActiveTransaction(maybeHub) {
|
||||
const hub = maybeHub || getCurrentHub();
|
||||
const scope = hub.getScope();
|
||||
return scope.getTransaction() ;
|
||||
}
|
||||
|
||||
export { getActiveTransaction };
|
||||
//# sourceMappingURL=utils.js.map
|
||||
101
shared/logger/node_modules/@sentry/core/esm/transports/base.js
generated
vendored
Normal file
101
shared/logger/node_modules/@sentry/core/esm/transports/base.js
generated
vendored
Normal file
@@ -0,0 +1,101 @@
|
||||
import { makePromiseBuffer, forEachEnvelopeItem, envelopeItemTypeToDataCategory, isRateLimited, resolvedSyncPromise, createEnvelope, SentryError, logger, serializeEnvelope, updateRateLimits } from '@sentry/utils';
|
||||
|
||||
const DEFAULT_TRANSPORT_BUFFER_SIZE = 30;
|
||||
|
||||
/**
|
||||
* Creates an instance of a Sentry `Transport`
|
||||
*
|
||||
* @param options
|
||||
* @param makeRequest
|
||||
*/
|
||||
function createTransport(
|
||||
options,
|
||||
makeRequest,
|
||||
buffer = makePromiseBuffer(
|
||||
options.bufferSize || DEFAULT_TRANSPORT_BUFFER_SIZE,
|
||||
),
|
||||
) {
|
||||
let rateLimits = {};
|
||||
const flush = (timeout) => buffer.drain(timeout);
|
||||
|
||||
function send(envelope) {
|
||||
const filteredEnvelopeItems = [];
|
||||
|
||||
// Drop rate limited items from envelope
|
||||
forEachEnvelopeItem(envelope, (item, type) => {
|
||||
const envelopeItemDataCategory = envelopeItemTypeToDataCategory(type);
|
||||
if (isRateLimited(rateLimits, envelopeItemDataCategory)) {
|
||||
const event = getEventForEnvelopeItem(item, type);
|
||||
options.recordDroppedEvent('ratelimit_backoff', envelopeItemDataCategory, event);
|
||||
} else {
|
||||
filteredEnvelopeItems.push(item);
|
||||
}
|
||||
});
|
||||
|
||||
// Skip sending if envelope is empty after filtering out rate limited events
|
||||
if (filteredEnvelopeItems.length === 0) {
|
||||
return resolvedSyncPromise();
|
||||
}
|
||||
|
||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any
|
||||
const filteredEnvelope = createEnvelope(envelope[0], filteredEnvelopeItems );
|
||||
|
||||
// Creates client report for each item in an envelope
|
||||
const recordEnvelopeLoss = (reason) => {
|
||||
forEachEnvelopeItem(filteredEnvelope, (item, type) => {
|
||||
const event = getEventForEnvelopeItem(item, type);
|
||||
options.recordDroppedEvent(reason, envelopeItemTypeToDataCategory(type), event);
|
||||
});
|
||||
};
|
||||
|
||||
const requestTask = () =>
|
||||
makeRequest({ body: serializeEnvelope(filteredEnvelope, options.textEncoder) }).then(
|
||||
response => {
|
||||
// We don't want to throw on NOK responses, but we want to at least log them
|
||||
if (response.statusCode !== undefined && (response.statusCode < 200 || response.statusCode >= 300)) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.warn(`Sentry responded with status code ${response.statusCode} to sent event.`);
|
||||
}
|
||||
|
||||
rateLimits = updateRateLimits(rateLimits, response);
|
||||
return response;
|
||||
},
|
||||
error => {
|
||||
recordEnvelopeLoss('network_error');
|
||||
throw error;
|
||||
},
|
||||
);
|
||||
|
||||
return buffer.add(requestTask).then(
|
||||
result => result,
|
||||
error => {
|
||||
if (error instanceof SentryError) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.error('Skipped sending event because buffer is full.');
|
||||
recordEnvelopeLoss('queue_overflow');
|
||||
return resolvedSyncPromise();
|
||||
} else {
|
||||
throw error;
|
||||
}
|
||||
},
|
||||
);
|
||||
}
|
||||
|
||||
// We use this to identifify if the transport is the base transport
|
||||
// TODO (v8): Remove this again as we'll no longer need it
|
||||
send.__sentry__baseTransport__ = true;
|
||||
|
||||
return {
|
||||
send,
|
||||
flush,
|
||||
};
|
||||
}
|
||||
|
||||
function getEventForEnvelopeItem(item, type) {
|
||||
if (type !== 'event' && type !== 'transaction') {
|
||||
return undefined;
|
||||
}
|
||||
|
||||
return Array.isArray(item) ? (item )[1] : undefined;
|
||||
}
|
||||
|
||||
export { DEFAULT_TRANSPORT_BUFFER_SIZE, createTransport };
|
||||
//# sourceMappingURL=base.js.map
|
||||
76
shared/logger/node_modules/@sentry/core/esm/transports/multiplexed.js
generated
vendored
Normal file
76
shared/logger/node_modules/@sentry/core/esm/transports/multiplexed.js
generated
vendored
Normal file
@@ -0,0 +1,76 @@
|
||||
import { dsnFromString, forEachEnvelopeItem } from '@sentry/utils';
|
||||
import { getEnvelopeEndpointWithUrlEncodedAuth } from '../api.js';
|
||||
|
||||
function eventFromEnvelope(env, types) {
|
||||
let event;
|
||||
|
||||
forEachEnvelopeItem(env, (item, type) => {
|
||||
if (types.includes(type)) {
|
||||
event = Array.isArray(item) ? (item )[1] : undefined;
|
||||
}
|
||||
// bail out if we found an event
|
||||
return !!event;
|
||||
});
|
||||
|
||||
return event;
|
||||
}
|
||||
|
||||
/**
|
||||
* Creates a transport that can send events to different DSNs depending on the envelope contents.
|
||||
*/
|
||||
function makeMultiplexedTransport(
|
||||
createTransport,
|
||||
matcher,
|
||||
) {
|
||||
return options => {
|
||||
const fallbackTransport = createTransport(options);
|
||||
const otherTransports = {};
|
||||
|
||||
function getTransport(dsn) {
|
||||
if (!otherTransports[dsn]) {
|
||||
const validatedDsn = dsnFromString(dsn);
|
||||
if (!validatedDsn) {
|
||||
return undefined;
|
||||
}
|
||||
const url = getEnvelopeEndpointWithUrlEncodedAuth(validatedDsn);
|
||||
otherTransports[dsn] = createTransport({ ...options, url });
|
||||
}
|
||||
|
||||
return otherTransports[dsn];
|
||||
}
|
||||
|
||||
async function send(envelope) {
|
||||
function getEvent(types) {
|
||||
const eventTypes = types && types.length ? types : ['event'];
|
||||
return eventFromEnvelope(envelope, eventTypes);
|
||||
}
|
||||
|
||||
const transports = matcher({ envelope, getEvent })
|
||||
.map(dsn => getTransport(dsn))
|
||||
.filter((t) => !!t);
|
||||
|
||||
// If we have no transports to send to, use the fallback transport
|
||||
if (transports.length === 0) {
|
||||
transports.push(fallbackTransport);
|
||||
}
|
||||
|
||||
const results = await Promise.all(transports.map(transport => transport.send(envelope)));
|
||||
|
||||
return results[0];
|
||||
}
|
||||
|
||||
async function flush(timeout) {
|
||||
const allTransports = [...Object.keys(otherTransports).map(dsn => otherTransports[dsn]), fallbackTransport];
|
||||
const results = await Promise.all(allTransports.map(transport => transport.flush(timeout)));
|
||||
return results.every(r => r);
|
||||
}
|
||||
|
||||
return {
|
||||
send,
|
||||
flush,
|
||||
};
|
||||
};
|
||||
}
|
||||
|
||||
export { makeMultiplexedTransport };
|
||||
//# sourceMappingURL=multiplexed.js.map
|
||||
122
shared/logger/node_modules/@sentry/core/esm/transports/offline.js
generated
vendored
Normal file
122
shared/logger/node_modules/@sentry/core/esm/transports/offline.js
generated
vendored
Normal file
@@ -0,0 +1,122 @@
|
||||
import { parseRetryAfterHeader, logger, envelopeContainsItemType } from '@sentry/utils';
|
||||
|
||||
const MIN_DELAY = 100; // 100 ms
|
||||
const START_DELAY = 5000; // 5 seconds
|
||||
const MAX_DELAY = 3.6e6; // 1 hour
|
||||
|
||||
function log(msg, error) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.info(`[Offline]: ${msg}`, error);
|
||||
}
|
||||
|
||||
/**
|
||||
* Wraps a transport and stores and retries events when they fail to send.
|
||||
*
|
||||
* @param createTransport The transport to wrap.
|
||||
*/
|
||||
function makeOfflineTransport(
|
||||
createTransport,
|
||||
) {
|
||||
return options => {
|
||||
const transport = createTransport(options);
|
||||
const store = options.createStore ? options.createStore(options) : undefined;
|
||||
|
||||
let retryDelay = START_DELAY;
|
||||
let flushTimer;
|
||||
|
||||
function shouldQueue(env, error, retryDelay) {
|
||||
// We don't queue Session Replay envelopes because they are:
|
||||
// - Ordered and Replay relies on the response status to know when they're successfully sent.
|
||||
// - Likely to fill the queue quickly and block other events from being sent.
|
||||
// We also want to drop client reports because they can be generated when we retry sending events while offline.
|
||||
if (envelopeContainsItemType(env, ['replay_event', 'replay_recording', 'client_report'])) {
|
||||
return false;
|
||||
}
|
||||
|
||||
if (options.shouldStore) {
|
||||
return options.shouldStore(env, error, retryDelay);
|
||||
}
|
||||
|
||||
return true;
|
||||
}
|
||||
|
||||
function flushIn(delay) {
|
||||
if (!store) {
|
||||
return;
|
||||
}
|
||||
|
||||
if (flushTimer) {
|
||||
clearTimeout(flushTimer );
|
||||
}
|
||||
|
||||
flushTimer = setTimeout(async () => {
|
||||
flushTimer = undefined;
|
||||
|
||||
const found = await store.pop();
|
||||
if (found) {
|
||||
log('Attempting to send previously queued event');
|
||||
void send(found).catch(e => {
|
||||
log('Failed to retry sending', e);
|
||||
});
|
||||
}
|
||||
}, delay) ;
|
||||
|
||||
// We need to unref the timer in node.js, otherwise the node process never exit.
|
||||
if (typeof flushTimer !== 'number' && flushTimer.unref) {
|
||||
flushTimer.unref();
|
||||
}
|
||||
}
|
||||
|
||||
function flushWithBackOff() {
|
||||
if (flushTimer) {
|
||||
return;
|
||||
}
|
||||
|
||||
flushIn(retryDelay);
|
||||
|
||||
retryDelay = Math.min(retryDelay * 2, MAX_DELAY);
|
||||
}
|
||||
|
||||
async function send(envelope) {
|
||||
try {
|
||||
const result = await transport.send(envelope);
|
||||
|
||||
let delay = MIN_DELAY;
|
||||
|
||||
if (result) {
|
||||
// If there's a retry-after header, use that as the next delay.
|
||||
if (result.headers && result.headers['retry-after']) {
|
||||
delay = parseRetryAfterHeader(result.headers['retry-after']);
|
||||
} // If we have a server error, return now so we don't flush the queue.
|
||||
else if ((result.statusCode || 0) >= 400) {
|
||||
return result;
|
||||
}
|
||||
}
|
||||
|
||||
flushIn(delay);
|
||||
retryDelay = START_DELAY;
|
||||
return result;
|
||||
} catch (e) {
|
||||
if (store && (await shouldQueue(envelope, e , retryDelay))) {
|
||||
await store.insert(envelope);
|
||||
flushWithBackOff();
|
||||
log('Error sending. Event queued', e );
|
||||
return {};
|
||||
} else {
|
||||
throw e;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
if (options.flushAtStartup) {
|
||||
flushWithBackOff();
|
||||
}
|
||||
|
||||
return {
|
||||
send,
|
||||
flush: t => transport.flush(t),
|
||||
};
|
||||
};
|
||||
}
|
||||
|
||||
export { MIN_DELAY, START_DELAY, makeOfflineTransport };
|
||||
//# sourceMappingURL=offline.js.map
|
||||
23
shared/logger/node_modules/@sentry/core/esm/utils/hasTracingEnabled.js
generated
vendored
Normal file
23
shared/logger/node_modules/@sentry/core/esm/utils/hasTracingEnabled.js
generated
vendored
Normal file
@@ -0,0 +1,23 @@
|
||||
import { getCurrentHub } from '../hub.js';
|
||||
|
||||
// Treeshakable guard to remove all code related to tracing
|
||||
|
||||
/**
|
||||
* Determines if tracing is currently enabled.
|
||||
*
|
||||
* Tracing is enabled when at least one of `tracesSampleRate` and `tracesSampler` is defined in the SDK config.
|
||||
*/
|
||||
function hasTracingEnabled(
|
||||
maybeOptions,
|
||||
) {
|
||||
if (typeof __SENTRY_TRACING__ === 'boolean' && !__SENTRY_TRACING__) {
|
||||
return false;
|
||||
}
|
||||
|
||||
const client = getCurrentHub().getClient();
|
||||
const options = maybeOptions || (client && client.getOptions());
|
||||
return !!options && (options.enableTracing || 'tracesSampleRate' in options || 'tracesSampler' in options);
|
||||
}
|
||||
|
||||
export { hasTracingEnabled };
|
||||
//# sourceMappingURL=hasTracingEnabled.js.map
|
||||
304
shared/logger/node_modules/@sentry/core/esm/utils/prepareEvent.js
generated
vendored
Normal file
304
shared/logger/node_modules/@sentry/core/esm/utils/prepareEvent.js
generated
vendored
Normal file
@@ -0,0 +1,304 @@
|
||||
import { uuid4, dateTimestampInSeconds, resolvedSyncPromise, truncate, GLOBAL_OBJ, normalize } from '@sentry/utils';
|
||||
import { DEFAULT_ENVIRONMENT } from '../constants.js';
|
||||
import { Scope } from '../scope.js';
|
||||
|
||||
/**
|
||||
* Adds common information to events.
|
||||
*
|
||||
* The information includes release and environment from `options`,
|
||||
* breadcrumbs and context (extra, tags and user) from the scope.
|
||||
*
|
||||
* Information that is already present in the event is never overwritten. For
|
||||
* nested objects, such as the context, keys are merged.
|
||||
*
|
||||
* Note: This also triggers callbacks for `addGlobalEventProcessor`, but not `beforeSend`.
|
||||
*
|
||||
* @param event The original event.
|
||||
* @param hint May contain additional information about the original exception.
|
||||
* @param scope A scope containing event metadata.
|
||||
* @returns A new event with more information.
|
||||
* @hidden
|
||||
*/
|
||||
function prepareEvent(
|
||||
options,
|
||||
event,
|
||||
hint,
|
||||
scope,
|
||||
) {
|
||||
const { normalizeDepth = 3, normalizeMaxBreadth = 1000 } = options;
|
||||
const prepared = {
|
||||
...event,
|
||||
event_id: event.event_id || hint.event_id || uuid4(),
|
||||
timestamp: event.timestamp || dateTimestampInSeconds(),
|
||||
};
|
||||
const integrations = hint.integrations || options.integrations.map(i => i.name);
|
||||
|
||||
applyClientOptions(prepared, options);
|
||||
applyIntegrationsMetadata(prepared, integrations);
|
||||
|
||||
// Only put debug IDs onto frames for error events.
|
||||
if (event.type === undefined) {
|
||||
applyDebugIds(prepared, options.stackParser);
|
||||
}
|
||||
|
||||
// If we have scope given to us, use it as the base for further modifications.
|
||||
// This allows us to prevent unnecessary copying of data if `captureContext` is not provided.
|
||||
let finalScope = scope;
|
||||
if (hint.captureContext) {
|
||||
finalScope = Scope.clone(finalScope).update(hint.captureContext);
|
||||
}
|
||||
|
||||
// We prepare the result here with a resolved Event.
|
||||
let result = resolvedSyncPromise(prepared);
|
||||
|
||||
// This should be the last thing called, since we want that
|
||||
// {@link Hub.addEventProcessor} gets the finished prepared event.
|
||||
//
|
||||
// We need to check for the existence of `finalScope.getAttachments`
|
||||
// because `getAttachments` can be undefined if users are using an older version
|
||||
// of `@sentry/core` that does not have the `getAttachments` method.
|
||||
// See: https://github.com/getsentry/sentry-javascript/issues/5229
|
||||
if (finalScope) {
|
||||
// Collect attachments from the hint and scope
|
||||
if (finalScope.getAttachments) {
|
||||
const attachments = [...(hint.attachments || []), ...finalScope.getAttachments()];
|
||||
|
||||
if (attachments.length) {
|
||||
hint.attachments = attachments;
|
||||
}
|
||||
}
|
||||
|
||||
// In case we have a hub we reassign it.
|
||||
result = finalScope.applyToEvent(prepared, hint);
|
||||
}
|
||||
|
||||
return result.then(evt => {
|
||||
if (evt) {
|
||||
// We apply the debug_meta field only after all event processors have ran, so that if any event processors modified
|
||||
// file names (e.g.the RewriteFrames integration) the filename -> debug ID relationship isn't destroyed.
|
||||
// This should not cause any PII issues, since we're only moving data that is already on the event and not adding
|
||||
// any new data
|
||||
applyDebugMeta(evt);
|
||||
}
|
||||
|
||||
if (typeof normalizeDepth === 'number' && normalizeDepth > 0) {
|
||||
return normalizeEvent(evt, normalizeDepth, normalizeMaxBreadth);
|
||||
}
|
||||
return evt;
|
||||
});
|
||||
}
|
||||
|
||||
/**
|
||||
* Enhances event using the client configuration.
|
||||
* It takes care of all "static" values like environment, release and `dist`,
|
||||
* as well as truncating overly long values.
|
||||
* @param event event instance to be enhanced
|
||||
*/
|
||||
function applyClientOptions(event, options) {
|
||||
const { environment, release, dist, maxValueLength = 250 } = options;
|
||||
|
||||
if (!('environment' in event)) {
|
||||
event.environment = 'environment' in options ? environment : DEFAULT_ENVIRONMENT;
|
||||
}
|
||||
|
||||
if (event.release === undefined && release !== undefined) {
|
||||
event.release = release;
|
||||
}
|
||||
|
||||
if (event.dist === undefined && dist !== undefined) {
|
||||
event.dist = dist;
|
||||
}
|
||||
|
||||
if (event.message) {
|
||||
event.message = truncate(event.message, maxValueLength);
|
||||
}
|
||||
|
||||
const exception = event.exception && event.exception.values && event.exception.values[0];
|
||||
if (exception && exception.value) {
|
||||
exception.value = truncate(exception.value, maxValueLength);
|
||||
}
|
||||
|
||||
const request = event.request;
|
||||
if (request && request.url) {
|
||||
request.url = truncate(request.url, maxValueLength);
|
||||
}
|
||||
}
|
||||
|
||||
const debugIdStackParserCache = new WeakMap();
|
||||
|
||||
/**
|
||||
* Puts debug IDs into the stack frames of an error event.
|
||||
*/
|
||||
function applyDebugIds(event, stackParser) {
|
||||
const debugIdMap = GLOBAL_OBJ._sentryDebugIds;
|
||||
|
||||
if (!debugIdMap) {
|
||||
return;
|
||||
}
|
||||
|
||||
let debugIdStackFramesCache;
|
||||
const cachedDebugIdStackFrameCache = debugIdStackParserCache.get(stackParser);
|
||||
if (cachedDebugIdStackFrameCache) {
|
||||
debugIdStackFramesCache = cachedDebugIdStackFrameCache;
|
||||
} else {
|
||||
debugIdStackFramesCache = new Map();
|
||||
debugIdStackParserCache.set(stackParser, debugIdStackFramesCache);
|
||||
}
|
||||
|
||||
// Build a map of filename -> debug_id
|
||||
const filenameDebugIdMap = Object.keys(debugIdMap).reduce((acc, debugIdStackTrace) => {
|
||||
let parsedStack;
|
||||
const cachedParsedStack = debugIdStackFramesCache.get(debugIdStackTrace);
|
||||
if (cachedParsedStack) {
|
||||
parsedStack = cachedParsedStack;
|
||||
} else {
|
||||
parsedStack = stackParser(debugIdStackTrace);
|
||||
debugIdStackFramesCache.set(debugIdStackTrace, parsedStack);
|
||||
}
|
||||
|
||||
for (let i = parsedStack.length - 1; i >= 0; i--) {
|
||||
const stackFrame = parsedStack[i];
|
||||
if (stackFrame.filename) {
|
||||
acc[stackFrame.filename] = debugIdMap[debugIdStackTrace];
|
||||
break;
|
||||
}
|
||||
}
|
||||
return acc;
|
||||
}, {});
|
||||
|
||||
try {
|
||||
// eslint-disable-next-line @typescript-eslint/no-non-null-assertion
|
||||
event.exception.values.forEach(exception => {
|
||||
// eslint-disable-next-line @typescript-eslint/no-non-null-assertion
|
||||
exception.stacktrace.frames.forEach(frame => {
|
||||
if (frame.filename) {
|
||||
frame.debug_id = filenameDebugIdMap[frame.filename];
|
||||
}
|
||||
});
|
||||
});
|
||||
} catch (e) {
|
||||
// To save bundle size we're just try catching here instead of checking for the existence of all the different objects.
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Moves debug IDs from the stack frames of an error event into the debug_meta field.
|
||||
*/
|
||||
function applyDebugMeta(event) {
|
||||
// Extract debug IDs and filenames from the stack frames on the event.
|
||||
const filenameDebugIdMap = {};
|
||||
try {
|
||||
// eslint-disable-next-line @typescript-eslint/no-non-null-assertion
|
||||
event.exception.values.forEach(exception => {
|
||||
// eslint-disable-next-line @typescript-eslint/no-non-null-assertion
|
||||
exception.stacktrace.frames.forEach(frame => {
|
||||
if (frame.debug_id) {
|
||||
if (frame.abs_path) {
|
||||
filenameDebugIdMap[frame.abs_path] = frame.debug_id;
|
||||
} else if (frame.filename) {
|
||||
filenameDebugIdMap[frame.filename] = frame.debug_id;
|
||||
}
|
||||
delete frame.debug_id;
|
||||
}
|
||||
});
|
||||
});
|
||||
} catch (e) {
|
||||
// To save bundle size we're just try catching here instead of checking for the existence of all the different objects.
|
||||
}
|
||||
|
||||
if (Object.keys(filenameDebugIdMap).length === 0) {
|
||||
return;
|
||||
}
|
||||
|
||||
// Fill debug_meta information
|
||||
event.debug_meta = event.debug_meta || {};
|
||||
event.debug_meta.images = event.debug_meta.images || [];
|
||||
const images = event.debug_meta.images;
|
||||
Object.keys(filenameDebugIdMap).forEach(filename => {
|
||||
images.push({
|
||||
type: 'sourcemap',
|
||||
code_file: filename,
|
||||
debug_id: filenameDebugIdMap[filename],
|
||||
});
|
||||
});
|
||||
}
|
||||
|
||||
/**
|
||||
* This function adds all used integrations to the SDK info in the event.
|
||||
* @param event The event that will be filled with all integrations.
|
||||
*/
|
||||
function applyIntegrationsMetadata(event, integrationNames) {
|
||||
if (integrationNames.length > 0) {
|
||||
event.sdk = event.sdk || {};
|
||||
event.sdk.integrations = [...(event.sdk.integrations || []), ...integrationNames];
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Applies `normalize` function on necessary `Event` attributes to make them safe for serialization.
|
||||
* Normalized keys:
|
||||
* - `breadcrumbs.data`
|
||||
* - `user`
|
||||
* - `contexts`
|
||||
* - `extra`
|
||||
* @param event Event
|
||||
* @returns Normalized event
|
||||
*/
|
||||
function normalizeEvent(event, depth, maxBreadth) {
|
||||
if (!event) {
|
||||
return null;
|
||||
}
|
||||
|
||||
const normalized = {
|
||||
...event,
|
||||
...(event.breadcrumbs && {
|
||||
breadcrumbs: event.breadcrumbs.map(b => ({
|
||||
...b,
|
||||
...(b.data && {
|
||||
data: normalize(b.data, depth, maxBreadth),
|
||||
}),
|
||||
})),
|
||||
}),
|
||||
...(event.user && {
|
||||
user: normalize(event.user, depth, maxBreadth),
|
||||
}),
|
||||
...(event.contexts && {
|
||||
contexts: normalize(event.contexts, depth, maxBreadth),
|
||||
}),
|
||||
...(event.extra && {
|
||||
extra: normalize(event.extra, depth, maxBreadth),
|
||||
}),
|
||||
};
|
||||
|
||||
// event.contexts.trace stores information about a Transaction. Similarly,
|
||||
// event.spans[] stores information about child Spans. Given that a
|
||||
// Transaction is conceptually a Span, normalization should apply to both
|
||||
// Transactions and Spans consistently.
|
||||
// For now the decision is to skip normalization of Transactions and Spans,
|
||||
// so this block overwrites the normalized event to add back the original
|
||||
// Transaction information prior to normalization.
|
||||
if (event.contexts && event.contexts.trace && normalized.contexts) {
|
||||
normalized.contexts.trace = event.contexts.trace;
|
||||
|
||||
// event.contexts.trace.data may contain circular/dangerous data so we need to normalize it
|
||||
if (event.contexts.trace.data) {
|
||||
normalized.contexts.trace.data = normalize(event.contexts.trace.data, depth, maxBreadth);
|
||||
}
|
||||
}
|
||||
|
||||
// event.spans[].data may contain circular/dangerous data so we need to normalize it
|
||||
if (event.spans) {
|
||||
normalized.spans = event.spans.map(span => {
|
||||
// We cannot use the spread operator here because `toJSON` on `span` is non-enumerable
|
||||
if (span.data) {
|
||||
span.data = normalize(span.data, depth, maxBreadth);
|
||||
}
|
||||
return span;
|
||||
});
|
||||
}
|
||||
|
||||
return normalized;
|
||||
}
|
||||
|
||||
export { applyDebugIds, applyDebugMeta, prepareEvent };
|
||||
//# sourceMappingURL=prepareEvent.js.map
|
||||
4
shared/logger/node_modules/@sentry/core/esm/version.js
generated
vendored
Normal file
4
shared/logger/node_modules/@sentry/core/esm/version.js
generated
vendored
Normal file
@@ -0,0 +1,4 @@
|
||||
const SDK_VERSION = '7.57.0';
|
||||
|
||||
export { SDK_VERSION };
|
||||
//# sourceMappingURL=version.js.map
|
||||
8542
shared/logger/node_modules/@sentry/replay/esm/index.js
generated
vendored
Normal file
8542
shared/logger/node_modules/@sentry/replay/esm/index.js
generated
vendored
Normal file
File diff suppressed because one or more lines are too long
24
shared/logger/node_modules/@sentry/types/esm/severity.js
generated
vendored
Normal file
24
shared/logger/node_modules/@sentry/types/esm/severity.js
generated
vendored
Normal file
@@ -0,0 +1,24 @@
|
||||
/**
|
||||
* TODO(v7): Remove this enum and replace with SeverityLevel
|
||||
*/
|
||||
export var Severity;
|
||||
(function (Severity) {
|
||||
/** JSDoc */
|
||||
Severity["Fatal"] = "fatal";
|
||||
/** JSDoc */
|
||||
Severity["Error"] = "error";
|
||||
/** JSDoc */
|
||||
Severity["Warning"] = "warning";
|
||||
/** JSDoc */
|
||||
Severity["Log"] = "log";
|
||||
/** JSDoc */
|
||||
Severity["Info"] = "info";
|
||||
/** JSDoc */
|
||||
Severity["Debug"] = "debug";
|
||||
/** JSDoc */
|
||||
Severity["Critical"] = "critical";
|
||||
})(Severity || (Severity = {}));
|
||||
// TODO: in v7, these can disappear, because they now also exist in `@sentry/utils`. (Having them there rather than here
|
||||
// is nice because then it enforces the idea that only types are exported from `@sentry/types`.)
|
||||
export var SeverityLevels = ['fatal', 'error', 'warning', 'log', 'info', 'debug', 'critical'];
|
||||
//# sourceMappingURL=severity.js.map
|
||||
145
shared/logger/node_modules/@sentry/utils/esm/baggage.js
generated
vendored
Normal file
145
shared/logger/node_modules/@sentry/utils/esm/baggage.js
generated
vendored
Normal file
@@ -0,0 +1,145 @@
|
||||
import { isString } from './is.js';
|
||||
import { logger } from './logger.js';
|
||||
|
||||
const BAGGAGE_HEADER_NAME = 'baggage';
|
||||
|
||||
const SENTRY_BAGGAGE_KEY_PREFIX = 'sentry-';
|
||||
|
||||
const SENTRY_BAGGAGE_KEY_PREFIX_REGEX = /^sentry-/;
|
||||
|
||||
/**
|
||||
* Max length of a serialized baggage string
|
||||
*
|
||||
* https://www.w3.org/TR/baggage/#limits
|
||||
*/
|
||||
const MAX_BAGGAGE_STRING_LENGTH = 8192;
|
||||
|
||||
/**
|
||||
* Takes a baggage header and turns it into Dynamic Sampling Context, by extracting all the "sentry-" prefixed values
|
||||
* from it.
|
||||
*
|
||||
* @param baggageHeader A very bread definition of a baggage header as it might appear in various frameworks.
|
||||
* @returns The Dynamic Sampling Context that was found on `baggageHeader`, if there was any, `undefined` otherwise.
|
||||
*/
|
||||
function baggageHeaderToDynamicSamplingContext(
|
||||
// Very liberal definition of what any incoming header might look like
|
||||
baggageHeader,
|
||||
) {
|
||||
if (!isString(baggageHeader) && !Array.isArray(baggageHeader)) {
|
||||
return undefined;
|
||||
}
|
||||
|
||||
// Intermediary object to store baggage key value pairs of incoming baggage headers on.
|
||||
// It is later used to read Sentry-DSC-values from.
|
||||
let baggageObject = {};
|
||||
|
||||
if (Array.isArray(baggageHeader)) {
|
||||
// Combine all baggage headers into one object containing the baggage values so we can later read the Sentry-DSC-values from it
|
||||
baggageObject = baggageHeader.reduce((acc, curr) => {
|
||||
const currBaggageObject = baggageHeaderToObject(curr);
|
||||
return {
|
||||
...acc,
|
||||
...currBaggageObject,
|
||||
};
|
||||
}, {});
|
||||
} else {
|
||||
// Return undefined if baggage header is an empty string (technically an empty baggage header is not spec conform but
|
||||
// this is how we choose to handle it)
|
||||
if (!baggageHeader) {
|
||||
return undefined;
|
||||
}
|
||||
|
||||
baggageObject = baggageHeaderToObject(baggageHeader);
|
||||
}
|
||||
|
||||
// Read all "sentry-" prefixed values out of the baggage object and put it onto a dynamic sampling context object.
|
||||
const dynamicSamplingContext = Object.entries(baggageObject).reduce((acc, [key, value]) => {
|
||||
if (key.match(SENTRY_BAGGAGE_KEY_PREFIX_REGEX)) {
|
||||
const nonPrefixedKey = key.slice(SENTRY_BAGGAGE_KEY_PREFIX.length);
|
||||
acc[nonPrefixedKey] = value;
|
||||
}
|
||||
return acc;
|
||||
}, {});
|
||||
|
||||
// Only return a dynamic sampling context object if there are keys in it.
|
||||
// A keyless object means there were no sentry values on the header, which means that there is no DSC.
|
||||
if (Object.keys(dynamicSamplingContext).length > 0) {
|
||||
return dynamicSamplingContext ;
|
||||
} else {
|
||||
return undefined;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Turns a Dynamic Sampling Object into a baggage header by prefixing all the keys on the object with "sentry-".
|
||||
*
|
||||
* @param dynamicSamplingContext The Dynamic Sampling Context to turn into a header. For convenience and compatibility
|
||||
* with the `getDynamicSamplingContext` method on the Transaction class ,this argument can also be `undefined`. If it is
|
||||
* `undefined` the function will return `undefined`.
|
||||
* @returns a baggage header, created from `dynamicSamplingContext`, or `undefined` either if `dynamicSamplingContext`
|
||||
* was `undefined`, or if `dynamicSamplingContext` didn't contain any values.
|
||||
*/
|
||||
function dynamicSamplingContextToSentryBaggageHeader(
|
||||
// this also takes undefined for convenience and bundle size in other places
|
||||
dynamicSamplingContext,
|
||||
) {
|
||||
// Prefix all DSC keys with "sentry-" and put them into a new object
|
||||
const sentryPrefixedDSC = Object.entries(dynamicSamplingContext).reduce(
|
||||
(acc, [dscKey, dscValue]) => {
|
||||
if (dscValue) {
|
||||
acc[`${SENTRY_BAGGAGE_KEY_PREFIX}${dscKey}`] = dscValue;
|
||||
}
|
||||
return acc;
|
||||
},
|
||||
{},
|
||||
);
|
||||
|
||||
return objectToBaggageHeader(sentryPrefixedDSC);
|
||||
}
|
||||
|
||||
/**
|
||||
* Will parse a baggage header, which is a simple key-value map, into a flat object.
|
||||
*
|
||||
* @param baggageHeader The baggage header to parse.
|
||||
* @returns a flat object containing all the key-value pairs from `baggageHeader`.
|
||||
*/
|
||||
function baggageHeaderToObject(baggageHeader) {
|
||||
return baggageHeader
|
||||
.split(',')
|
||||
.map(baggageEntry => baggageEntry.split('=').map(keyOrValue => decodeURIComponent(keyOrValue.trim())))
|
||||
.reduce((acc, [key, value]) => {
|
||||
acc[key] = value;
|
||||
return acc;
|
||||
}, {});
|
||||
}
|
||||
|
||||
/**
|
||||
* Turns a flat object (key-value pairs) into a baggage header, which is also just key-value pairs.
|
||||
*
|
||||
* @param object The object to turn into a baggage header.
|
||||
* @returns a baggage header string, or `undefined` if the object didn't have any values, since an empty baggage header
|
||||
* is not spec compliant.
|
||||
*/
|
||||
function objectToBaggageHeader(object) {
|
||||
if (Object.keys(object).length === 0) {
|
||||
// An empty baggage header is not spec compliant: We return undefined.
|
||||
return undefined;
|
||||
}
|
||||
|
||||
return Object.entries(object).reduce((baggageHeader, [objectKey, objectValue], currentIndex) => {
|
||||
const baggageEntry = `${encodeURIComponent(objectKey)}=${encodeURIComponent(objectValue)}`;
|
||||
const newBaggageHeader = currentIndex === 0 ? baggageEntry : `${baggageHeader},${baggageEntry}`;
|
||||
if (newBaggageHeader.length > MAX_BAGGAGE_STRING_LENGTH) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) &&
|
||||
logger.warn(
|
||||
`Not adding key: ${objectKey} with val: ${objectValue} to baggage header due to exceeding baggage size limits.`,
|
||||
);
|
||||
return baggageHeader;
|
||||
} else {
|
||||
return newBaggageHeader;
|
||||
}
|
||||
}, '');
|
||||
}
|
||||
|
||||
export { BAGGAGE_HEADER_NAME, MAX_BAGGAGE_STRING_LENGTH, SENTRY_BAGGAGE_KEY_PREFIX, SENTRY_BAGGAGE_KEY_PREFIX_REGEX, baggageHeaderToDynamicSamplingContext, dynamicSamplingContextToSentryBaggageHeader };
|
||||
//# sourceMappingURL=baggage.js.map
|
||||
152
shared/logger/node_modules/@sentry/utils/esm/browser.js
generated
vendored
Normal file
152
shared/logger/node_modules/@sentry/utils/esm/browser.js
generated
vendored
Normal file
@@ -0,0 +1,152 @@
|
||||
import { isString } from './is.js';
|
||||
import { getGlobalObject } from './worldwide.js';
|
||||
|
||||
// eslint-disable-next-line deprecation/deprecation
|
||||
const WINDOW = getGlobalObject();
|
||||
|
||||
const DEFAULT_MAX_STRING_LENGTH = 80;
|
||||
|
||||
/**
|
||||
* Given a child DOM element, returns a query-selector statement describing that
|
||||
* and its ancestors
|
||||
* e.g. [HTMLElement] => body > div > input#foo.btn[name=baz]
|
||||
* @returns generated DOM path
|
||||
*/
|
||||
function htmlTreeAsString(
|
||||
elem,
|
||||
options = {},
|
||||
) {
|
||||
|
||||
// try/catch both:
|
||||
// - accessing event.target (see getsentry/raven-js#838, #768)
|
||||
// - `htmlTreeAsString` because it's complex, and just accessing the DOM incorrectly
|
||||
// - can throw an exception in some circumstances.
|
||||
try {
|
||||
let currentElem = elem ;
|
||||
const MAX_TRAVERSE_HEIGHT = 5;
|
||||
const out = [];
|
||||
let height = 0;
|
||||
let len = 0;
|
||||
const separator = ' > ';
|
||||
const sepLength = separator.length;
|
||||
let nextStr;
|
||||
const keyAttrs = Array.isArray(options) ? options : options.keyAttrs;
|
||||
const maxStringLength = (!Array.isArray(options) && options.maxStringLength) || DEFAULT_MAX_STRING_LENGTH;
|
||||
|
||||
while (currentElem && height++ < MAX_TRAVERSE_HEIGHT) {
|
||||
nextStr = _htmlElementAsString(currentElem, keyAttrs);
|
||||
// bail out if
|
||||
// - nextStr is the 'html' element
|
||||
// - the length of the string that would be created exceeds maxStringLength
|
||||
// (ignore this limit if we are on the first iteration)
|
||||
if (nextStr === 'html' || (height > 1 && len + out.length * sepLength + nextStr.length >= maxStringLength)) {
|
||||
break;
|
||||
}
|
||||
|
||||
out.push(nextStr);
|
||||
|
||||
len += nextStr.length;
|
||||
currentElem = currentElem.parentNode;
|
||||
}
|
||||
|
||||
return out.reverse().join(separator);
|
||||
} catch (_oO) {
|
||||
return '<unknown>';
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Returns a simple, query-selector representation of a DOM element
|
||||
* e.g. [HTMLElement] => input#foo.btn[name=baz]
|
||||
* @returns generated DOM path
|
||||
*/
|
||||
function _htmlElementAsString(el, keyAttrs) {
|
||||
const elem = el
|
||||
|
||||
;
|
||||
|
||||
const out = [];
|
||||
let className;
|
||||
let classes;
|
||||
let key;
|
||||
let attr;
|
||||
let i;
|
||||
|
||||
if (!elem || !elem.tagName) {
|
||||
return '';
|
||||
}
|
||||
|
||||
out.push(elem.tagName.toLowerCase());
|
||||
|
||||
// Pairs of attribute keys defined in `serializeAttribute` and their values on element.
|
||||
const keyAttrPairs =
|
||||
keyAttrs && keyAttrs.length
|
||||
? keyAttrs.filter(keyAttr => elem.getAttribute(keyAttr)).map(keyAttr => [keyAttr, elem.getAttribute(keyAttr)])
|
||||
: null;
|
||||
|
||||
if (keyAttrPairs && keyAttrPairs.length) {
|
||||
keyAttrPairs.forEach(keyAttrPair => {
|
||||
out.push(`[${keyAttrPair[0]}="${keyAttrPair[1]}"]`);
|
||||
});
|
||||
} else {
|
||||
if (elem.id) {
|
||||
out.push(`#${elem.id}`);
|
||||
}
|
||||
|
||||
// eslint-disable-next-line prefer-const
|
||||
className = elem.className;
|
||||
if (className && isString(className)) {
|
||||
classes = className.split(/\s+/);
|
||||
for (i = 0; i < classes.length; i++) {
|
||||
out.push(`.${classes[i]}`);
|
||||
}
|
||||
}
|
||||
}
|
||||
const allowedAttrs = ['aria-label', 'type', 'name', 'title', 'alt'];
|
||||
for (i = 0; i < allowedAttrs.length; i++) {
|
||||
key = allowedAttrs[i];
|
||||
attr = elem.getAttribute(key);
|
||||
if (attr) {
|
||||
out.push(`[${key}="${attr}"]`);
|
||||
}
|
||||
}
|
||||
return out.join('');
|
||||
}
|
||||
|
||||
/**
|
||||
* A safe form of location.href
|
||||
*/
|
||||
function getLocationHref() {
|
||||
try {
|
||||
return WINDOW.document.location.href;
|
||||
} catch (oO) {
|
||||
return '';
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets a DOM element by using document.querySelector.
|
||||
*
|
||||
* This wrapper will first check for the existance of the function before
|
||||
* actually calling it so that we don't have to take care of this check,
|
||||
* every time we want to access the DOM.
|
||||
*
|
||||
* Reason: DOM/querySelector is not available in all environments.
|
||||
*
|
||||
* We have to cast to any because utils can be consumed by a variety of environments,
|
||||
* and we don't want to break TS users. If you know what element will be selected by
|
||||
* `document.querySelector`, specify it as part of the generic call. For example,
|
||||
* `const element = getDomElement<Element>('selector');`
|
||||
*
|
||||
* @param selector the selector string passed on to document.querySelector
|
||||
*/
|
||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any
|
||||
function getDomElement(selector) {
|
||||
if (WINDOW.document && WINDOW.document.querySelector) {
|
||||
return WINDOW.document.querySelector(selector) ;
|
||||
}
|
||||
return null;
|
||||
}
|
||||
|
||||
export { getDomElement, getLocationHref, htmlTreeAsString };
|
||||
//# sourceMappingURL=browser.js.map
|
||||
59
shared/logger/node_modules/@sentry/utils/esm/buildPolyfills/_optionalChain.js
generated
vendored
Normal file
59
shared/logger/node_modules/@sentry/utils/esm/buildPolyfills/_optionalChain.js
generated
vendored
Normal file
@@ -0,0 +1,59 @@
|
||||
/**
|
||||
* Polyfill for the optional chain operator, `?.`, given previous conversion of the expression into an array of values,
|
||||
* descriptors, and functions.
|
||||
*
|
||||
* Adapted from Sucrase (https://github.com/alangpierce/sucrase)
|
||||
* See https://github.com/alangpierce/sucrase/blob/265887868966917f3b924ce38dfad01fbab1329f/src/transformers/OptionalChainingNullishTransformer.ts#L15
|
||||
*
|
||||
* @param ops Array result of expression conversion
|
||||
* @returns The value of the expression
|
||||
*/
|
||||
function _optionalChain(ops) {
|
||||
let lastAccessLHS = undefined;
|
||||
let value = ops[0];
|
||||
let i = 1;
|
||||
while (i < ops.length) {
|
||||
const op = ops[i] ;
|
||||
const fn = ops[i + 1] ;
|
||||
i += 2;
|
||||
// by checking for loose equality to `null`, we catch both `null` and `undefined`
|
||||
if ((op === 'optionalAccess' || op === 'optionalCall') && value == null) {
|
||||
// really we're meaning to return `undefined` as an actual value here, but it saves bytes not to write it
|
||||
return;
|
||||
}
|
||||
if (op === 'access' || op === 'optionalAccess') {
|
||||
lastAccessLHS = value;
|
||||
value = fn(value);
|
||||
} else if (op === 'call' || op === 'optionalCall') {
|
||||
value = fn((...args) => (value ).call(lastAccessLHS, ...args));
|
||||
lastAccessLHS = undefined;
|
||||
}
|
||||
}
|
||||
return value;
|
||||
}
|
||||
|
||||
// Sucrase version
|
||||
// function _optionalChain(ops) {
|
||||
// let lastAccessLHS = undefined;
|
||||
// let value = ops[0];
|
||||
// let i = 1;
|
||||
// while (i < ops.length) {
|
||||
// const op = ops[i];
|
||||
// const fn = ops[i + 1];
|
||||
// i += 2;
|
||||
// if ((op === 'optionalAccess' || op === 'optionalCall') && value == null) {
|
||||
// return undefined;
|
||||
// }
|
||||
// if (op === 'access' || op === 'optionalAccess') {
|
||||
// lastAccessLHS = value;
|
||||
// value = fn(value);
|
||||
// } else if (op === 'call' || op === 'optionalCall') {
|
||||
// value = fn((...args) => value.call(lastAccessLHS, ...args));
|
||||
// lastAccessLHS = undefined;
|
||||
// }
|
||||
// }
|
||||
// return value;
|
||||
// }
|
||||
|
||||
export { _optionalChain };
|
||||
//# sourceMappingURL=_optionalChain.js.map
|
||||
25
shared/logger/node_modules/@sentry/utils/esm/clientreport.js
generated
vendored
Normal file
25
shared/logger/node_modules/@sentry/utils/esm/clientreport.js
generated
vendored
Normal file
@@ -0,0 +1,25 @@
|
||||
import { createEnvelope } from './envelope.js';
|
||||
import { dateTimestampInSeconds } from './time.js';
|
||||
|
||||
/**
|
||||
* Creates client report envelope
|
||||
* @param discarded_events An array of discard events
|
||||
* @param dsn A DSN that can be set on the header. Optional.
|
||||
*/
|
||||
function createClientReportEnvelope(
|
||||
discarded_events,
|
||||
dsn,
|
||||
timestamp,
|
||||
) {
|
||||
const clientReportItem = [
|
||||
{ type: 'client_report' },
|
||||
{
|
||||
timestamp: timestamp || dateTimestampInSeconds(),
|
||||
discarded_events,
|
||||
},
|
||||
];
|
||||
return createEnvelope(dsn ? { dsn } : {}, [clientReportItem]);
|
||||
}
|
||||
|
||||
export { createClientReportEnvelope };
|
||||
//# sourceMappingURL=clientreport.js.map
|
||||
126
shared/logger/node_modules/@sentry/utils/esm/dsn.js
generated
vendored
Normal file
126
shared/logger/node_modules/@sentry/utils/esm/dsn.js
generated
vendored
Normal file
@@ -0,0 +1,126 @@
|
||||
import { logger } from './logger.js';
|
||||
|
||||
/** Regular expression used to parse a Dsn. */
|
||||
const DSN_REGEX = /^(?:(\w+):)\/\/(?:(\w+)(?::(\w+)?)?@)([\w.-]+)(?::(\d+))?\/(.+)/;
|
||||
|
||||
function isValidProtocol(protocol) {
|
||||
return protocol === 'http' || protocol === 'https';
|
||||
}
|
||||
|
||||
/**
|
||||
* Renders the string representation of this Dsn.
|
||||
*
|
||||
* By default, this will render the public representation without the password
|
||||
* component. To get the deprecated private representation, set `withPassword`
|
||||
* to true.
|
||||
*
|
||||
* @param withPassword When set to true, the password will be included.
|
||||
*/
|
||||
function dsnToString(dsn, withPassword = false) {
|
||||
const { host, path, pass, port, projectId, protocol, publicKey } = dsn;
|
||||
return (
|
||||
`${protocol}://${publicKey}${withPassword && pass ? `:${pass}` : ''}` +
|
||||
`@${host}${port ? `:${port}` : ''}/${path ? `${path}/` : path}${projectId}`
|
||||
);
|
||||
}
|
||||
|
||||
/**
|
||||
* Parses a Dsn from a given string.
|
||||
*
|
||||
* @param str A Dsn as string
|
||||
* @returns Dsn as DsnComponents or undefined if @param str is not a valid DSN string
|
||||
*/
|
||||
function dsnFromString(str) {
|
||||
const match = DSN_REGEX.exec(str);
|
||||
|
||||
if (!match) {
|
||||
// This should be logged to the console
|
||||
// eslint-disable-next-line no-console
|
||||
console.error(`Invalid Sentry Dsn: ${str}`);
|
||||
return undefined;
|
||||
}
|
||||
|
||||
const [protocol, publicKey, pass = '', host, port = '', lastPath] = match.slice(1);
|
||||
let path = '';
|
||||
let projectId = lastPath;
|
||||
|
||||
const split = projectId.split('/');
|
||||
if (split.length > 1) {
|
||||
path = split.slice(0, -1).join('/');
|
||||
projectId = split.pop() ;
|
||||
}
|
||||
|
||||
if (projectId) {
|
||||
const projectMatch = projectId.match(/^\d+/);
|
||||
if (projectMatch) {
|
||||
projectId = projectMatch[0];
|
||||
}
|
||||
}
|
||||
|
||||
return dsnFromComponents({ host, pass, path, projectId, port, protocol: protocol , publicKey });
|
||||
}
|
||||
|
||||
function dsnFromComponents(components) {
|
||||
return {
|
||||
protocol: components.protocol,
|
||||
publicKey: components.publicKey || '',
|
||||
pass: components.pass || '',
|
||||
host: components.host,
|
||||
port: components.port || '',
|
||||
path: components.path || '',
|
||||
projectId: components.projectId,
|
||||
};
|
||||
}
|
||||
|
||||
function validateDsn(dsn) {
|
||||
if (!(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__)) {
|
||||
return true;
|
||||
}
|
||||
|
||||
const { port, projectId, protocol } = dsn;
|
||||
|
||||
const requiredComponents = ['protocol', 'publicKey', 'host', 'projectId'];
|
||||
const hasMissingRequiredComponent = requiredComponents.find(component => {
|
||||
if (!dsn[component]) {
|
||||
logger.error(`Invalid Sentry Dsn: ${component} missing`);
|
||||
return true;
|
||||
}
|
||||
return false;
|
||||
});
|
||||
|
||||
if (hasMissingRequiredComponent) {
|
||||
return false;
|
||||
}
|
||||
|
||||
if (!projectId.match(/^\d+$/)) {
|
||||
logger.error(`Invalid Sentry Dsn: Invalid projectId ${projectId}`);
|
||||
return false;
|
||||
}
|
||||
|
||||
if (!isValidProtocol(protocol)) {
|
||||
logger.error(`Invalid Sentry Dsn: Invalid protocol ${protocol}`);
|
||||
return false;
|
||||
}
|
||||
|
||||
if (port && isNaN(parseInt(port, 10))) {
|
||||
logger.error(`Invalid Sentry Dsn: Invalid port ${port}`);
|
||||
return false;
|
||||
}
|
||||
|
||||
return true;
|
||||
}
|
||||
|
||||
/**
|
||||
* Creates a valid Sentry Dsn object, identifying a Sentry instance and project.
|
||||
* @returns a valid DsnComponents object or `undefined` if @param from is an invalid DSN source
|
||||
*/
|
||||
function makeDsn(from) {
|
||||
const components = typeof from === 'string' ? dsnFromString(from) : dsnFromComponents(from);
|
||||
if (!components || !validateDsn(components)) {
|
||||
return undefined;
|
||||
}
|
||||
return components;
|
||||
}
|
||||
|
||||
export { dsnFromString, dsnToString, makeDsn };
|
||||
//# sourceMappingURL=dsn.js.map
|
||||
34
shared/logger/node_modules/@sentry/utils/esm/env.js
generated
vendored
Normal file
34
shared/logger/node_modules/@sentry/utils/esm/env.js
generated
vendored
Normal file
@@ -0,0 +1,34 @@
|
||||
/*
|
||||
* This module exists for optimizations in the build process through rollup and terser. We define some global
|
||||
* constants, which can be overridden during build. By guarding certain pieces of code with functions that return these
|
||||
* constants, we can control whether or not they appear in the final bundle. (Any code guarded by a false condition will
|
||||
* never run, and will hence be dropped during treeshaking.) The two primary uses for this are stripping out calls to
|
||||
* `logger` and preventing node-related code from appearing in browser bundles.
|
||||
*
|
||||
* Attention:
|
||||
* This file should not be used to define constants/flags that are intended to be used for tree-shaking conducted by
|
||||
* users. These flags should live in their respective packages, as we identified user tooling (specifically webpack)
|
||||
* having issues tree-shaking these constants across package boundaries.
|
||||
* An example for this is the __SENTRY_DEBUG__ constant. It is declared in each package individually because we want
|
||||
* users to be able to shake away expressions that it guards.
|
||||
*/
|
||||
|
||||
/**
|
||||
* Figures out if we're building a browser bundle.
|
||||
*
|
||||
* @returns true if this is a browser bundle build.
|
||||
*/
|
||||
function isBrowserBundle() {
|
||||
return typeof __SENTRY_BROWSER_BUNDLE__ !== 'undefined' && !!__SENTRY_BROWSER_BUNDLE__;
|
||||
}
|
||||
|
||||
/**
|
||||
* Get source of SDK.
|
||||
*/
|
||||
function getSDKSource() {
|
||||
// @ts-ignore "npm" is injected by rollup during build process
|
||||
return "npm";
|
||||
}
|
||||
|
||||
export { getSDKSource, isBrowserBundle };
|
||||
//# sourceMappingURL=env.js.map
|
||||
232
shared/logger/node_modules/@sentry/utils/esm/envelope.js
generated
vendored
Normal file
232
shared/logger/node_modules/@sentry/utils/esm/envelope.js
generated
vendored
Normal file
@@ -0,0 +1,232 @@
|
||||
import { dsnToString } from './dsn.js';
|
||||
import { normalize } from './normalize.js';
|
||||
import { dropUndefinedKeys } from './object.js';
|
||||
|
||||
/**
|
||||
* Creates an envelope.
|
||||
* Make sure to always explicitly provide the generic to this function
|
||||
* so that the envelope types resolve correctly.
|
||||
*/
|
||||
function createEnvelope(headers, items = []) {
|
||||
return [headers, items] ;
|
||||
}
|
||||
|
||||
/**
|
||||
* Add an item to an envelope.
|
||||
* Make sure to always explicitly provide the generic to this function
|
||||
* so that the envelope types resolve correctly.
|
||||
*/
|
||||
function addItemToEnvelope(envelope, newItem) {
|
||||
const [headers, items] = envelope;
|
||||
return [headers, [...items, newItem]] ;
|
||||
}
|
||||
|
||||
/**
|
||||
* Convenience function to loop through the items and item types of an envelope.
|
||||
* (This function was mostly created because working with envelope types is painful at the moment)
|
||||
*
|
||||
* If the callback returns true, the rest of the items will be skipped.
|
||||
*/
|
||||
function forEachEnvelopeItem(
|
||||
envelope,
|
||||
callback,
|
||||
) {
|
||||
const envelopeItems = envelope[1];
|
||||
|
||||
for (const envelopeItem of envelopeItems) {
|
||||
const envelopeItemType = envelopeItem[0].type;
|
||||
const result = callback(envelopeItem, envelopeItemType);
|
||||
|
||||
if (result) {
|
||||
return true;
|
||||
}
|
||||
}
|
||||
|
||||
return false;
|
||||
}
|
||||
|
||||
/**
|
||||
* Returns true if the envelope contains any of the given envelope item types
|
||||
*/
|
||||
function envelopeContainsItemType(envelope, types) {
|
||||
return forEachEnvelopeItem(envelope, (_, type) => types.includes(type));
|
||||
}
|
||||
|
||||
/**
|
||||
* Encode a string to UTF8.
|
||||
*/
|
||||
function encodeUTF8(input, textEncoder) {
|
||||
const utf8 = textEncoder || new TextEncoder();
|
||||
return utf8.encode(input);
|
||||
}
|
||||
|
||||
/**
|
||||
* Serializes an envelope.
|
||||
*/
|
||||
function serializeEnvelope(envelope, textEncoder) {
|
||||
const [envHeaders, items] = envelope;
|
||||
|
||||
// Initially we construct our envelope as a string and only convert to binary chunks if we encounter binary data
|
||||
let parts = JSON.stringify(envHeaders);
|
||||
|
||||
function append(next) {
|
||||
if (typeof parts === 'string') {
|
||||
parts = typeof next === 'string' ? parts + next : [encodeUTF8(parts, textEncoder), next];
|
||||
} else {
|
||||
parts.push(typeof next === 'string' ? encodeUTF8(next, textEncoder) : next);
|
||||
}
|
||||
}
|
||||
|
||||
for (const item of items) {
|
||||
const [itemHeaders, payload] = item;
|
||||
|
||||
append(`\n${JSON.stringify(itemHeaders)}\n`);
|
||||
|
||||
if (typeof payload === 'string' || payload instanceof Uint8Array) {
|
||||
append(payload);
|
||||
} else {
|
||||
let stringifiedPayload;
|
||||
try {
|
||||
stringifiedPayload = JSON.stringify(payload);
|
||||
} catch (e) {
|
||||
// In case, despite all our efforts to keep `payload` circular-dependency-free, `JSON.strinify()` still
|
||||
// fails, we try again after normalizing it again with infinite normalization depth. This of course has a
|
||||
// performance impact but in this case a performance hit is better than throwing.
|
||||
stringifiedPayload = JSON.stringify(normalize(payload));
|
||||
}
|
||||
append(stringifiedPayload);
|
||||
}
|
||||
}
|
||||
|
||||
return typeof parts === 'string' ? parts : concatBuffers(parts);
|
||||
}
|
||||
|
||||
function concatBuffers(buffers) {
|
||||
const totalLength = buffers.reduce((acc, buf) => acc + buf.length, 0);
|
||||
|
||||
const merged = new Uint8Array(totalLength);
|
||||
let offset = 0;
|
||||
for (const buffer of buffers) {
|
||||
merged.set(buffer, offset);
|
||||
offset += buffer.length;
|
||||
}
|
||||
|
||||
return merged;
|
||||
}
|
||||
|
||||
/**
|
||||
* Parses an envelope
|
||||
*/
|
||||
function parseEnvelope(
|
||||
env,
|
||||
textEncoder,
|
||||
textDecoder,
|
||||
) {
|
||||
let buffer = typeof env === 'string' ? textEncoder.encode(env) : env;
|
||||
|
||||
function readBinary(length) {
|
||||
const bin = buffer.subarray(0, length);
|
||||
// Replace the buffer with the remaining data excluding trailing newline
|
||||
buffer = buffer.subarray(length + 1);
|
||||
return bin;
|
||||
}
|
||||
|
||||
function readJson() {
|
||||
let i = buffer.indexOf(0xa);
|
||||
// If we couldn't find a newline, we must have found the end of the buffer
|
||||
if (i < 0) {
|
||||
i = buffer.length;
|
||||
}
|
||||
|
||||
return JSON.parse(textDecoder.decode(readBinary(i))) ;
|
||||
}
|
||||
|
||||
const envelopeHeader = readJson();
|
||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any
|
||||
const items = [];
|
||||
|
||||
while (buffer.length) {
|
||||
const itemHeader = readJson();
|
||||
const binaryLength = typeof itemHeader.length === 'number' ? itemHeader.length : undefined;
|
||||
|
||||
items.push([itemHeader, binaryLength ? readBinary(binaryLength) : readJson()]);
|
||||
}
|
||||
|
||||
return [envelopeHeader, items];
|
||||
}
|
||||
|
||||
/**
|
||||
* Creates attachment envelope items
|
||||
*/
|
||||
function createAttachmentEnvelopeItem(
|
||||
attachment,
|
||||
textEncoder,
|
||||
) {
|
||||
const buffer = typeof attachment.data === 'string' ? encodeUTF8(attachment.data, textEncoder) : attachment.data;
|
||||
|
||||
return [
|
||||
dropUndefinedKeys({
|
||||
type: 'attachment',
|
||||
length: buffer.length,
|
||||
filename: attachment.filename,
|
||||
content_type: attachment.contentType,
|
||||
attachment_type: attachment.attachmentType,
|
||||
}),
|
||||
buffer,
|
||||
];
|
||||
}
|
||||
|
||||
const ITEM_TYPE_TO_DATA_CATEGORY_MAP = {
|
||||
session: 'session',
|
||||
sessions: 'session',
|
||||
attachment: 'attachment',
|
||||
transaction: 'transaction',
|
||||
event: 'error',
|
||||
client_report: 'internal',
|
||||
user_report: 'default',
|
||||
profile: 'profile',
|
||||
replay_event: 'replay',
|
||||
replay_recording: 'replay',
|
||||
check_in: 'monitor',
|
||||
};
|
||||
|
||||
/**
|
||||
* Maps the type of an envelope item to a data category.
|
||||
*/
|
||||
function envelopeItemTypeToDataCategory(type) {
|
||||
return ITEM_TYPE_TO_DATA_CATEGORY_MAP[type];
|
||||
}
|
||||
|
||||
/** Extracts the minimal SDK info from from the metadata or an events */
|
||||
function getSdkMetadataForEnvelopeHeader(metadataOrEvent) {
|
||||
if (!metadataOrEvent || !metadataOrEvent.sdk) {
|
||||
return;
|
||||
}
|
||||
const { name, version } = metadataOrEvent.sdk;
|
||||
return { name, version };
|
||||
}
|
||||
|
||||
/**
|
||||
* Creates event envelope headers, based on event, sdk info and tunnel
|
||||
* Note: This function was extracted from the core package to make it available in Replay
|
||||
*/
|
||||
function createEventEnvelopeHeaders(
|
||||
event,
|
||||
sdkInfo,
|
||||
tunnel,
|
||||
dsn,
|
||||
) {
|
||||
const dynamicSamplingContext = event.sdkProcessingMetadata && event.sdkProcessingMetadata.dynamicSamplingContext;
|
||||
return {
|
||||
event_id: event.event_id ,
|
||||
sent_at: new Date().toISOString(),
|
||||
...(sdkInfo && { sdk: sdkInfo }),
|
||||
...(!!tunnel && { dsn: dsnToString(dsn) }),
|
||||
...(dynamicSamplingContext && {
|
||||
trace: dropUndefinedKeys({ ...dynamicSamplingContext }),
|
||||
}),
|
||||
};
|
||||
}
|
||||
|
||||
export { addItemToEnvelope, createAttachmentEnvelopeItem, createEnvelope, createEventEnvelopeHeaders, envelopeContainsItemType, envelopeItemTypeToDataCategory, forEachEnvelopeItem, getSdkMetadataForEnvelopeHeader, parseEnvelope, serializeEnvelope };
|
||||
//# sourceMappingURL=envelope.js.map
|
||||
17
shared/logger/node_modules/@sentry/utils/esm/error.js
generated
vendored
Normal file
17
shared/logger/node_modules/@sentry/utils/esm/error.js
generated
vendored
Normal file
@@ -0,0 +1,17 @@
|
||||
/** An error emitted by Sentry SDKs and related utilities. */
|
||||
class SentryError extends Error {
|
||||
/** Display name of this error instance. */
|
||||
|
||||
constructor( message, logLevel = 'warn') {
|
||||
super(message);this.message = message;
|
||||
this.name = new.target.prototype.constructor.name;
|
||||
// This sets the prototype to be `Error`, not `SentryError`. It's unclear why we do this, but commenting this line
|
||||
// out causes various (seemingly totally unrelated) playwright tests consistently time out. FYI, this makes
|
||||
// instances of `SentryError` fail `obj instanceof SentryError` checks.
|
||||
Object.setPrototypeOf(this, new.target.prototype);
|
||||
this.logLevel = logLevel;
|
||||
}
|
||||
}
|
||||
|
||||
export { SentryError };
|
||||
//# sourceMappingURL=error.js.map
|
||||
631
shared/logger/node_modules/@sentry/utils/esm/instrument.js
generated
vendored
Normal file
631
shared/logger/node_modules/@sentry/utils/esm/instrument.js
generated
vendored
Normal file
@@ -0,0 +1,631 @@
|
||||
import { isString } from './is.js';
|
||||
import { logger, CONSOLE_LEVELS } from './logger.js';
|
||||
import { fill } from './object.js';
|
||||
import { getFunctionName } from './stacktrace.js';
|
||||
import { supportsNativeFetch } from './supports.js';
|
||||
import { getGlobalObject } from './worldwide.js';
|
||||
import { supportsHistory } from './vendor/supportsHistory.js';
|
||||
|
||||
// eslint-disable-next-line deprecation/deprecation
|
||||
const WINDOW = getGlobalObject();
|
||||
|
||||
const SENTRY_XHR_DATA_KEY = '__sentry_xhr_v2__';
|
||||
|
||||
/**
|
||||
* Instrument native APIs to call handlers that can be used to create breadcrumbs, APM spans etc.
|
||||
* - Console API
|
||||
* - Fetch API
|
||||
* - XHR API
|
||||
* - History API
|
||||
* - DOM API (click/typing)
|
||||
* - Error API
|
||||
* - UnhandledRejection API
|
||||
*/
|
||||
|
||||
const handlers = {};
|
||||
const instrumented = {};
|
||||
|
||||
/** Instruments given API */
|
||||
function instrument(type) {
|
||||
if (instrumented[type]) {
|
||||
return;
|
||||
}
|
||||
|
||||
instrumented[type] = true;
|
||||
|
||||
switch (type) {
|
||||
case 'console':
|
||||
instrumentConsole();
|
||||
break;
|
||||
case 'dom':
|
||||
instrumentDOM();
|
||||
break;
|
||||
case 'xhr':
|
||||
instrumentXHR();
|
||||
break;
|
||||
case 'fetch':
|
||||
instrumentFetch();
|
||||
break;
|
||||
case 'history':
|
||||
instrumentHistory();
|
||||
break;
|
||||
case 'error':
|
||||
instrumentError();
|
||||
break;
|
||||
case 'unhandledrejection':
|
||||
instrumentUnhandledRejection();
|
||||
break;
|
||||
default:
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) && logger.warn('unknown instrumentation type:', type);
|
||||
return;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Add handler that will be called when given type of instrumentation triggers.
|
||||
* Use at your own risk, this might break without changelog notice, only used internally.
|
||||
* @hidden
|
||||
*/
|
||||
function addInstrumentationHandler(type, callback) {
|
||||
handlers[type] = handlers[type] || [];
|
||||
(handlers[type] ).push(callback);
|
||||
instrument(type);
|
||||
}
|
||||
|
||||
/** JSDoc */
|
||||
function triggerHandlers(type, data) {
|
||||
if (!type || !handlers[type]) {
|
||||
return;
|
||||
}
|
||||
|
||||
for (const handler of handlers[type] || []) {
|
||||
try {
|
||||
handler(data);
|
||||
} catch (e) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) &&
|
||||
logger.error(
|
||||
`Error while triggering instrumentation handler.\nType: ${type}\nName: ${getFunctionName(handler)}\nError:`,
|
||||
e,
|
||||
);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/** JSDoc */
|
||||
function instrumentConsole() {
|
||||
if (!('console' in WINDOW)) {
|
||||
return;
|
||||
}
|
||||
|
||||
CONSOLE_LEVELS.forEach(function (level) {
|
||||
if (!(level in WINDOW.console)) {
|
||||
return;
|
||||
}
|
||||
|
||||
fill(WINDOW.console, level, function (originalConsoleMethod) {
|
||||
return function (...args) {
|
||||
triggerHandlers('console', { args, level });
|
||||
|
||||
// this fails for some browsers. :(
|
||||
if (originalConsoleMethod) {
|
||||
originalConsoleMethod.apply(WINDOW.console, args);
|
||||
}
|
||||
};
|
||||
});
|
||||
});
|
||||
}
|
||||
|
||||
/** JSDoc */
|
||||
function instrumentFetch() {
|
||||
if (!supportsNativeFetch()) {
|
||||
return;
|
||||
}
|
||||
|
||||
fill(WINDOW, 'fetch', function (originalFetch) {
|
||||
return function (...args) {
|
||||
const { method, url } = parseFetchArgs(args);
|
||||
|
||||
const handlerData = {
|
||||
args,
|
||||
fetchData: {
|
||||
method,
|
||||
url,
|
||||
},
|
||||
startTimestamp: Date.now(),
|
||||
};
|
||||
|
||||
triggerHandlers('fetch', {
|
||||
...handlerData,
|
||||
});
|
||||
|
||||
// eslint-disable-next-line @typescript-eslint/no-unsafe-member-access
|
||||
return originalFetch.apply(WINDOW, args).then(
|
||||
(response) => {
|
||||
triggerHandlers('fetch', {
|
||||
...handlerData,
|
||||
endTimestamp: Date.now(),
|
||||
response,
|
||||
});
|
||||
return response;
|
||||
},
|
||||
(error) => {
|
||||
triggerHandlers('fetch', {
|
||||
...handlerData,
|
||||
endTimestamp: Date.now(),
|
||||
error,
|
||||
});
|
||||
// NOTE: If you are a Sentry user, and you are seeing this stack frame,
|
||||
// it means the sentry.javascript SDK caught an error invoking your application code.
|
||||
// This is expected behavior and NOT indicative of a bug with sentry.javascript.
|
||||
throw error;
|
||||
},
|
||||
);
|
||||
};
|
||||
});
|
||||
}
|
||||
|
||||
function hasProp(obj, prop) {
|
||||
return !!obj && typeof obj === 'object' && !!(obj )[prop];
|
||||
}
|
||||
|
||||
function getUrlFromResource(resource) {
|
||||
if (typeof resource === 'string') {
|
||||
return resource;
|
||||
}
|
||||
|
||||
if (!resource) {
|
||||
return '';
|
||||
}
|
||||
|
||||
if (hasProp(resource, 'url')) {
|
||||
return resource.url;
|
||||
}
|
||||
|
||||
if (resource.toString) {
|
||||
return resource.toString();
|
||||
}
|
||||
|
||||
return '';
|
||||
}
|
||||
|
||||
/**
|
||||
* Parses the fetch arguments to find the used Http method and the url of the request
|
||||
*/
|
||||
function parseFetchArgs(fetchArgs) {
|
||||
if (fetchArgs.length === 0) {
|
||||
return { method: 'GET', url: '' };
|
||||
}
|
||||
|
||||
if (fetchArgs.length === 2) {
|
||||
const [url, options] = fetchArgs ;
|
||||
|
||||
return {
|
||||
url: getUrlFromResource(url),
|
||||
method: hasProp(options, 'method') ? String(options.method).toUpperCase() : 'GET',
|
||||
};
|
||||
}
|
||||
|
||||
const arg = fetchArgs[0];
|
||||
return {
|
||||
url: getUrlFromResource(arg ),
|
||||
method: hasProp(arg, 'method') ? String(arg.method).toUpperCase() : 'GET',
|
||||
};
|
||||
}
|
||||
|
||||
/** JSDoc */
|
||||
function instrumentXHR() {
|
||||
if (!('XMLHttpRequest' in WINDOW)) {
|
||||
return;
|
||||
}
|
||||
|
||||
const xhrproto = XMLHttpRequest.prototype;
|
||||
|
||||
fill(xhrproto, 'open', function (originalOpen) {
|
||||
return function ( ...args) {
|
||||
const url = args[1];
|
||||
const xhrInfo = (this[SENTRY_XHR_DATA_KEY] = {
|
||||
// eslint-disable-next-line @typescript-eslint/no-unsafe-member-access
|
||||
method: isString(args[0]) ? args[0].toUpperCase() : args[0],
|
||||
url: args[1],
|
||||
request_headers: {},
|
||||
});
|
||||
|
||||
// if Sentry key appears in URL, don't capture it as a request
|
||||
// eslint-disable-next-line @typescript-eslint/no-unsafe-member-access
|
||||
if (isString(url) && xhrInfo.method === 'POST' && url.match(/sentry_key/)) {
|
||||
this.__sentry_own_request__ = true;
|
||||
}
|
||||
|
||||
const onreadystatechangeHandler = () => {
|
||||
// For whatever reason, this is not the same instance here as from the outer method
|
||||
const xhrInfo = this[SENTRY_XHR_DATA_KEY];
|
||||
|
||||
if (!xhrInfo) {
|
||||
return;
|
||||
}
|
||||
|
||||
if (this.readyState === 4) {
|
||||
try {
|
||||
// touching statusCode in some platforms throws
|
||||
// an exception
|
||||
xhrInfo.status_code = this.status;
|
||||
} catch (e) {
|
||||
/* do nothing */
|
||||
}
|
||||
|
||||
triggerHandlers('xhr', {
|
||||
args: args ,
|
||||
endTimestamp: Date.now(),
|
||||
startTimestamp: Date.now(),
|
||||
xhr: this,
|
||||
} );
|
||||
}
|
||||
};
|
||||
|
||||
if ('onreadystatechange' in this && typeof this.onreadystatechange === 'function') {
|
||||
fill(this, 'onreadystatechange', function (original) {
|
||||
return function ( ...readyStateArgs) {
|
||||
onreadystatechangeHandler();
|
||||
return original.apply(this, readyStateArgs);
|
||||
};
|
||||
});
|
||||
} else {
|
||||
this.addEventListener('readystatechange', onreadystatechangeHandler);
|
||||
}
|
||||
|
||||
// Intercepting `setRequestHeader` to access the request headers of XHR instance.
|
||||
// This will only work for user/library defined headers, not for the default/browser-assigned headers.
|
||||
// Request cookies are also unavailable for XHR, as `Cookie` header can't be defined by `setRequestHeader`.
|
||||
fill(this, 'setRequestHeader', function (original) {
|
||||
return function ( ...setRequestHeaderArgs) {
|
||||
const [header, value] = setRequestHeaderArgs ;
|
||||
|
||||
const xhrInfo = this[SENTRY_XHR_DATA_KEY];
|
||||
|
||||
if (xhrInfo) {
|
||||
xhrInfo.request_headers[header.toLowerCase()] = value;
|
||||
}
|
||||
|
||||
return original.apply(this, setRequestHeaderArgs);
|
||||
};
|
||||
});
|
||||
|
||||
return originalOpen.apply(this, args);
|
||||
};
|
||||
});
|
||||
|
||||
fill(xhrproto, 'send', function (originalSend) {
|
||||
return function ( ...args) {
|
||||
const sentryXhrData = this[SENTRY_XHR_DATA_KEY];
|
||||
if (sentryXhrData && args[0] !== undefined) {
|
||||
sentryXhrData.body = args[0];
|
||||
}
|
||||
|
||||
triggerHandlers('xhr', {
|
||||
args,
|
||||
startTimestamp: Date.now(),
|
||||
xhr: this,
|
||||
});
|
||||
|
||||
return originalSend.apply(this, args);
|
||||
};
|
||||
});
|
||||
}
|
||||
|
||||
let lastHref;
|
||||
|
||||
/** JSDoc */
|
||||
function instrumentHistory() {
|
||||
if (!supportsHistory()) {
|
||||
return;
|
||||
}
|
||||
|
||||
const oldOnPopState = WINDOW.onpopstate;
|
||||
WINDOW.onpopstate = function ( ...args) {
|
||||
const to = WINDOW.location.href;
|
||||
// keep track of the current URL state, as we always receive only the updated state
|
||||
const from = lastHref;
|
||||
lastHref = to;
|
||||
triggerHandlers('history', {
|
||||
from,
|
||||
to,
|
||||
});
|
||||
if (oldOnPopState) {
|
||||
// Apparently this can throw in Firefox when incorrectly implemented plugin is installed.
|
||||
// https://github.com/getsentry/sentry-javascript/issues/3344
|
||||
// https://github.com/bugsnag/bugsnag-js/issues/469
|
||||
try {
|
||||
return oldOnPopState.apply(this, args);
|
||||
} catch (_oO) {
|
||||
// no-empty
|
||||
}
|
||||
}
|
||||
};
|
||||
|
||||
/** @hidden */
|
||||
function historyReplacementFunction(originalHistoryFunction) {
|
||||
return function ( ...args) {
|
||||
const url = args.length > 2 ? args[2] : undefined;
|
||||
if (url) {
|
||||
// coerce to string (this is what pushState does)
|
||||
const from = lastHref;
|
||||
const to = String(url);
|
||||
// keep track of the current URL state, as we always receive only the updated state
|
||||
lastHref = to;
|
||||
triggerHandlers('history', {
|
||||
from,
|
||||
to,
|
||||
});
|
||||
}
|
||||
return originalHistoryFunction.apply(this, args);
|
||||
};
|
||||
}
|
||||
|
||||
fill(WINDOW.history, 'pushState', historyReplacementFunction);
|
||||
fill(WINDOW.history, 'replaceState', historyReplacementFunction);
|
||||
}
|
||||
|
||||
const debounceDuration = 1000;
|
||||
let debounceTimerID;
|
||||
let lastCapturedEvent;
|
||||
|
||||
/**
|
||||
* Decide whether the current event should finish the debounce of previously captured one.
|
||||
* @param previous previously captured event
|
||||
* @param current event to be captured
|
||||
*/
|
||||
function shouldShortcircuitPreviousDebounce(previous, current) {
|
||||
// If there was no previous event, it should always be swapped for the new one.
|
||||
if (!previous) {
|
||||
return true;
|
||||
}
|
||||
|
||||
// If both events have different type, then user definitely performed two separate actions. e.g. click + keypress.
|
||||
if (previous.type !== current.type) {
|
||||
return true;
|
||||
}
|
||||
|
||||
try {
|
||||
// If both events have the same type, it's still possible that actions were performed on different targets.
|
||||
// e.g. 2 clicks on different buttons.
|
||||
if (previous.target !== current.target) {
|
||||
return true;
|
||||
}
|
||||
} catch (e) {
|
||||
// just accessing `target` property can throw an exception in some rare circumstances
|
||||
// see: https://github.com/getsentry/sentry-javascript/issues/838
|
||||
}
|
||||
|
||||
// If both events have the same type _and_ same `target` (an element which triggered an event, _not necessarily_
|
||||
// to which an event listener was attached), we treat them as the same action, as we want to capture
|
||||
// only one breadcrumb. e.g. multiple clicks on the same button, or typing inside a user input box.
|
||||
return false;
|
||||
}
|
||||
|
||||
/**
|
||||
* Decide whether an event should be captured.
|
||||
* @param event event to be captured
|
||||
*/
|
||||
function shouldSkipDOMEvent(event) {
|
||||
// We are only interested in filtering `keypress` events for now.
|
||||
if (event.type !== 'keypress') {
|
||||
return false;
|
||||
}
|
||||
|
||||
try {
|
||||
const target = event.target ;
|
||||
|
||||
if (!target || !target.tagName) {
|
||||
return true;
|
||||
}
|
||||
|
||||
// Only consider keypress events on actual input elements. This will disregard keypresses targeting body
|
||||
// e.g.tabbing through elements, hotkeys, etc.
|
||||
if (target.tagName === 'INPUT' || target.tagName === 'TEXTAREA' || target.isContentEditable) {
|
||||
return false;
|
||||
}
|
||||
} catch (e) {
|
||||
// just accessing `target` property can throw an exception in some rare circumstances
|
||||
// see: https://github.com/getsentry/sentry-javascript/issues/838
|
||||
}
|
||||
|
||||
return true;
|
||||
}
|
||||
|
||||
/**
|
||||
* Wraps addEventListener to capture UI breadcrumbs
|
||||
* @param handler function that will be triggered
|
||||
* @param globalListener indicates whether event was captured by the global event listener
|
||||
* @returns wrapped breadcrumb events handler
|
||||
* @hidden
|
||||
*/
|
||||
function makeDOMEventHandler(handler, globalListener = false) {
|
||||
return (event) => {
|
||||
// It's possible this handler might trigger multiple times for the same
|
||||
// event (e.g. event propagation through node ancestors).
|
||||
// Ignore if we've already captured that event.
|
||||
if (!event || lastCapturedEvent === event) {
|
||||
return;
|
||||
}
|
||||
|
||||
// We always want to skip _some_ events.
|
||||
if (shouldSkipDOMEvent(event)) {
|
||||
return;
|
||||
}
|
||||
|
||||
const name = event.type === 'keypress' ? 'input' : event.type;
|
||||
|
||||
// If there is no debounce timer, it means that we can safely capture the new event and store it for future comparisons.
|
||||
if (debounceTimerID === undefined) {
|
||||
handler({
|
||||
event: event,
|
||||
name,
|
||||
global: globalListener,
|
||||
});
|
||||
lastCapturedEvent = event;
|
||||
}
|
||||
// If there is a debounce awaiting, see if the new event is different enough to treat it as a unique one.
|
||||
// If that's the case, emit the previous event and store locally the newly-captured DOM event.
|
||||
else if (shouldShortcircuitPreviousDebounce(lastCapturedEvent, event)) {
|
||||
handler({
|
||||
event: event,
|
||||
name,
|
||||
global: globalListener,
|
||||
});
|
||||
lastCapturedEvent = event;
|
||||
}
|
||||
|
||||
// Start a new debounce timer that will prevent us from capturing multiple events that should be grouped together.
|
||||
clearTimeout(debounceTimerID);
|
||||
debounceTimerID = WINDOW.setTimeout(() => {
|
||||
debounceTimerID = undefined;
|
||||
}, debounceDuration);
|
||||
};
|
||||
}
|
||||
|
||||
/** JSDoc */
|
||||
function instrumentDOM() {
|
||||
if (!('document' in WINDOW)) {
|
||||
return;
|
||||
}
|
||||
|
||||
// Make it so that any click or keypress that is unhandled / bubbled up all the way to the document triggers our dom
|
||||
// handlers. (Normally we have only one, which captures a breadcrumb for each click or keypress.) Do this before
|
||||
// we instrument `addEventListener` so that we don't end up attaching this handler twice.
|
||||
const triggerDOMHandler = triggerHandlers.bind(null, 'dom');
|
||||
const globalDOMEventHandler = makeDOMEventHandler(triggerDOMHandler, true);
|
||||
WINDOW.document.addEventListener('click', globalDOMEventHandler, false);
|
||||
WINDOW.document.addEventListener('keypress', globalDOMEventHandler, false);
|
||||
|
||||
// After hooking into click and keypress events bubbled up to `document`, we also hook into user-handled
|
||||
// clicks & keypresses, by adding an event listener of our own to any element to which they add a listener. That
|
||||
// way, whenever one of their handlers is triggered, ours will be, too. (This is needed because their handler
|
||||
// could potentially prevent the event from bubbling up to our global listeners. This way, our handler are still
|
||||
// guaranteed to fire at least once.)
|
||||
['EventTarget', 'Node'].forEach((target) => {
|
||||
// eslint-disable-next-line @typescript-eslint/no-unsafe-member-access
|
||||
const proto = (WINDOW )[target] && (WINDOW )[target].prototype;
|
||||
// eslint-disable-next-line @typescript-eslint/no-unsafe-member-access, no-prototype-builtins
|
||||
if (!proto || !proto.hasOwnProperty || !proto.hasOwnProperty('addEventListener')) {
|
||||
return;
|
||||
}
|
||||
|
||||
fill(proto, 'addEventListener', function (originalAddEventListener) {
|
||||
return function (
|
||||
|
||||
type,
|
||||
listener,
|
||||
options,
|
||||
) {
|
||||
if (type === 'click' || type == 'keypress') {
|
||||
try {
|
||||
const el = this ;
|
||||
const handlers = (el.__sentry_instrumentation_handlers__ = el.__sentry_instrumentation_handlers__ || {});
|
||||
const handlerForType = (handlers[type] = handlers[type] || { refCount: 0 });
|
||||
|
||||
if (!handlerForType.handler) {
|
||||
const handler = makeDOMEventHandler(triggerDOMHandler);
|
||||
handlerForType.handler = handler;
|
||||
originalAddEventListener.call(this, type, handler, options);
|
||||
}
|
||||
|
||||
handlerForType.refCount++;
|
||||
} catch (e) {
|
||||
// Accessing dom properties is always fragile.
|
||||
// Also allows us to skip `addEventListenrs` calls with no proper `this` context.
|
||||
}
|
||||
}
|
||||
|
||||
return originalAddEventListener.call(this, type, listener, options);
|
||||
};
|
||||
});
|
||||
|
||||
fill(
|
||||
proto,
|
||||
'removeEventListener',
|
||||
function (originalRemoveEventListener) {
|
||||
return function (
|
||||
|
||||
type,
|
||||
listener,
|
||||
options,
|
||||
) {
|
||||
if (type === 'click' || type == 'keypress') {
|
||||
try {
|
||||
const el = this ;
|
||||
const handlers = el.__sentry_instrumentation_handlers__ || {};
|
||||
const handlerForType = handlers[type];
|
||||
|
||||
if (handlerForType) {
|
||||
handlerForType.refCount--;
|
||||
// If there are no longer any custom handlers of the current type on this element, we can remove ours, too.
|
||||
if (handlerForType.refCount <= 0) {
|
||||
originalRemoveEventListener.call(this, type, handlerForType.handler, options);
|
||||
handlerForType.handler = undefined;
|
||||
delete handlers[type]; // eslint-disable-line @typescript-eslint/no-dynamic-delete
|
||||
}
|
||||
|
||||
// If there are no longer any custom handlers of any type on this element, cleanup everything.
|
||||
if (Object.keys(handlers).length === 0) {
|
||||
delete el.__sentry_instrumentation_handlers__;
|
||||
}
|
||||
}
|
||||
} catch (e) {
|
||||
// Accessing dom properties is always fragile.
|
||||
// Also allows us to skip `addEventListenrs` calls with no proper `this` context.
|
||||
}
|
||||
}
|
||||
|
||||
return originalRemoveEventListener.call(this, type, listener, options);
|
||||
};
|
||||
},
|
||||
);
|
||||
});
|
||||
}
|
||||
|
||||
let _oldOnErrorHandler = null;
|
||||
/** JSDoc */
|
||||
function instrumentError() {
|
||||
_oldOnErrorHandler = WINDOW.onerror;
|
||||
|
||||
WINDOW.onerror = function (msg, url, line, column, error) {
|
||||
triggerHandlers('error', {
|
||||
column,
|
||||
error,
|
||||
line,
|
||||
msg,
|
||||
url,
|
||||
});
|
||||
|
||||
if (_oldOnErrorHandler && !_oldOnErrorHandler.__SENTRY_LOADER__) {
|
||||
// eslint-disable-next-line prefer-rest-params
|
||||
return _oldOnErrorHandler.apply(this, arguments);
|
||||
}
|
||||
|
||||
return false;
|
||||
};
|
||||
|
||||
WINDOW.onerror.__SENTRY_INSTRUMENTED__ = true;
|
||||
}
|
||||
|
||||
let _oldOnUnhandledRejectionHandler = null;
|
||||
/** JSDoc */
|
||||
function instrumentUnhandledRejection() {
|
||||
_oldOnUnhandledRejectionHandler = WINDOW.onunhandledrejection;
|
||||
|
||||
WINDOW.onunhandledrejection = function (e) {
|
||||
triggerHandlers('unhandledrejection', e);
|
||||
|
||||
if (_oldOnUnhandledRejectionHandler && !_oldOnUnhandledRejectionHandler.__SENTRY_LOADER__) {
|
||||
// eslint-disable-next-line prefer-rest-params
|
||||
return _oldOnUnhandledRejectionHandler.apply(this, arguments);
|
||||
}
|
||||
|
||||
return true;
|
||||
};
|
||||
|
||||
WINDOW.onunhandledrejection.__SENTRY_INSTRUMENTED__ = true;
|
||||
}
|
||||
|
||||
export { SENTRY_XHR_DATA_KEY, addInstrumentationHandler, parseFetchArgs };
|
||||
//# sourceMappingURL=instrument.js.map
|
||||
179
shared/logger/node_modules/@sentry/utils/esm/is.js
generated
vendored
Normal file
179
shared/logger/node_modules/@sentry/utils/esm/is.js
generated
vendored
Normal file
@@ -0,0 +1,179 @@
|
||||
// eslint-disable-next-line @typescript-eslint/unbound-method
|
||||
const objectToString = Object.prototype.toString;
|
||||
|
||||
/**
|
||||
* Checks whether given value's type is one of a few Error or Error-like
|
||||
* {@link isError}.
|
||||
*
|
||||
* @param wat A value to be checked.
|
||||
* @returns A boolean representing the result.
|
||||
*/
|
||||
function isError(wat) {
|
||||
switch (objectToString.call(wat)) {
|
||||
case '[object Error]':
|
||||
case '[object Exception]':
|
||||
case '[object DOMException]':
|
||||
return true;
|
||||
default:
|
||||
return isInstanceOf(wat, Error);
|
||||
}
|
||||
}
|
||||
/**
|
||||
* Checks whether given value is an instance of the given built-in class.
|
||||
*
|
||||
* @param wat The value to be checked
|
||||
* @param className
|
||||
* @returns A boolean representing the result.
|
||||
*/
|
||||
function isBuiltin(wat, className) {
|
||||
return objectToString.call(wat) === `[object ${className}]`;
|
||||
}
|
||||
|
||||
/**
|
||||
* Checks whether given value's type is ErrorEvent
|
||||
* {@link isErrorEvent}.
|
||||
*
|
||||
* @param wat A value to be checked.
|
||||
* @returns A boolean representing the result.
|
||||
*/
|
||||
function isErrorEvent(wat) {
|
||||
return isBuiltin(wat, 'ErrorEvent');
|
||||
}
|
||||
|
||||
/**
|
||||
* Checks whether given value's type is DOMError
|
||||
* {@link isDOMError}.
|
||||
*
|
||||
* @param wat A value to be checked.
|
||||
* @returns A boolean representing the result.
|
||||
*/
|
||||
function isDOMError(wat) {
|
||||
return isBuiltin(wat, 'DOMError');
|
||||
}
|
||||
|
||||
/**
|
||||
* Checks whether given value's type is DOMException
|
||||
* {@link isDOMException}.
|
||||
*
|
||||
* @param wat A value to be checked.
|
||||
* @returns A boolean representing the result.
|
||||
*/
|
||||
function isDOMException(wat) {
|
||||
return isBuiltin(wat, 'DOMException');
|
||||
}
|
||||
|
||||
/**
|
||||
* Checks whether given value's type is a string
|
||||
* {@link isString}.
|
||||
*
|
||||
* @param wat A value to be checked.
|
||||
* @returns A boolean representing the result.
|
||||
*/
|
||||
function isString(wat) {
|
||||
return isBuiltin(wat, 'String');
|
||||
}
|
||||
|
||||
/**
|
||||
* Checks whether given value is a primitive (undefined, null, number, boolean, string, bigint, symbol)
|
||||
* {@link isPrimitive}.
|
||||
*
|
||||
* @param wat A value to be checked.
|
||||
* @returns A boolean representing the result.
|
||||
*/
|
||||
function isPrimitive(wat) {
|
||||
return wat === null || (typeof wat !== 'object' && typeof wat !== 'function');
|
||||
}
|
||||
|
||||
/**
|
||||
* Checks whether given value's type is an object literal
|
||||
* {@link isPlainObject}.
|
||||
*
|
||||
* @param wat A value to be checked.
|
||||
* @returns A boolean representing the result.
|
||||
*/
|
||||
function isPlainObject(wat) {
|
||||
return isBuiltin(wat, 'Object');
|
||||
}
|
||||
|
||||
/**
|
||||
* Checks whether given value's type is an Event instance
|
||||
* {@link isEvent}.
|
||||
*
|
||||
* @param wat A value to be checked.
|
||||
* @returns A boolean representing the result.
|
||||
*/
|
||||
function isEvent(wat) {
|
||||
return typeof Event !== 'undefined' && isInstanceOf(wat, Event);
|
||||
}
|
||||
|
||||
/**
|
||||
* Checks whether given value's type is an Element instance
|
||||
* {@link isElement}.
|
||||
*
|
||||
* @param wat A value to be checked.
|
||||
* @returns A boolean representing the result.
|
||||
*/
|
||||
function isElement(wat) {
|
||||
return typeof Element !== 'undefined' && isInstanceOf(wat, Element);
|
||||
}
|
||||
|
||||
/**
|
||||
* Checks whether given value's type is an regexp
|
||||
* {@link isRegExp}.
|
||||
*
|
||||
* @param wat A value to be checked.
|
||||
* @returns A boolean representing the result.
|
||||
*/
|
||||
function isRegExp(wat) {
|
||||
return isBuiltin(wat, 'RegExp');
|
||||
}
|
||||
|
||||
/**
|
||||
* Checks whether given value has a then function.
|
||||
* @param wat A value to be checked.
|
||||
*/
|
||||
function isThenable(wat) {
|
||||
// eslint-disable-next-line @typescript-eslint/no-unsafe-member-access
|
||||
return Boolean(wat && wat.then && typeof wat.then === 'function');
|
||||
}
|
||||
|
||||
/**
|
||||
* Checks whether given value's type is a SyntheticEvent
|
||||
* {@link isSyntheticEvent}.
|
||||
*
|
||||
* @param wat A value to be checked.
|
||||
* @returns A boolean representing the result.
|
||||
*/
|
||||
function isSyntheticEvent(wat) {
|
||||
return isPlainObject(wat) && 'nativeEvent' in wat && 'preventDefault' in wat && 'stopPropagation' in wat;
|
||||
}
|
||||
|
||||
/**
|
||||
* Checks whether given value is NaN
|
||||
* {@link isNaN}.
|
||||
*
|
||||
* @param wat A value to be checked.
|
||||
* @returns A boolean representing the result.
|
||||
*/
|
||||
function isNaN(wat) {
|
||||
return typeof wat === 'number' && wat !== wat;
|
||||
}
|
||||
|
||||
/**
|
||||
* Checks whether given value's type is an instance of provided constructor.
|
||||
* {@link isInstanceOf}.
|
||||
*
|
||||
* @param wat A value to be checked.
|
||||
* @param base A constructor to be used in a check.
|
||||
* @returns A boolean representing the result.
|
||||
*/
|
||||
function isInstanceOf(wat, base) {
|
||||
try {
|
||||
return wat instanceof base;
|
||||
} catch (_e) {
|
||||
return false;
|
||||
}
|
||||
}
|
||||
|
||||
export { isDOMError, isDOMException, isElement, isError, isErrorEvent, isEvent, isInstanceOf, isNaN, isPlainObject, isPrimitive, isRegExp, isString, isSyntheticEvent, isThenable };
|
||||
//# sourceMappingURL=is.js.map
|
||||
83
shared/logger/node_modules/@sentry/utils/esm/logger.js
generated
vendored
Normal file
83
shared/logger/node_modules/@sentry/utils/esm/logger.js
generated
vendored
Normal file
@@ -0,0 +1,83 @@
|
||||
import { getGlobalSingleton, GLOBAL_OBJ } from './worldwide.js';
|
||||
|
||||
/** Prefix for logging strings */
|
||||
const PREFIX = 'Sentry Logger ';
|
||||
|
||||
const CONSOLE_LEVELS = ['debug', 'info', 'warn', 'error', 'log', 'assert', 'trace'] ;
|
||||
|
||||
/**
|
||||
* Temporarily disable sentry console instrumentations.
|
||||
*
|
||||
* @param callback The function to run against the original `console` messages
|
||||
* @returns The results of the callback
|
||||
*/
|
||||
function consoleSandbox(callback) {
|
||||
if (!('console' in GLOBAL_OBJ)) {
|
||||
return callback();
|
||||
}
|
||||
|
||||
const originalConsole = GLOBAL_OBJ.console ;
|
||||
const wrappedLevels = {};
|
||||
|
||||
// Restore all wrapped console methods
|
||||
CONSOLE_LEVELS.forEach(level => {
|
||||
// TODO(v7): Remove this check as it's only needed for Node 6
|
||||
const originalWrappedFunc =
|
||||
originalConsole[level] && (originalConsole[level] ).__sentry_original__;
|
||||
if (level in originalConsole && originalWrappedFunc) {
|
||||
wrappedLevels[level] = originalConsole[level] ;
|
||||
originalConsole[level] = originalWrappedFunc ;
|
||||
}
|
||||
});
|
||||
|
||||
try {
|
||||
return callback();
|
||||
} finally {
|
||||
// Revert restoration to wrapped state
|
||||
Object.keys(wrappedLevels).forEach(level => {
|
||||
originalConsole[level] = wrappedLevels[level ];
|
||||
});
|
||||
}
|
||||
}
|
||||
|
||||
function makeLogger() {
|
||||
let enabled = false;
|
||||
const logger = {
|
||||
enable: () => {
|
||||
enabled = true;
|
||||
},
|
||||
disable: () => {
|
||||
enabled = false;
|
||||
},
|
||||
};
|
||||
|
||||
if ((typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__)) {
|
||||
CONSOLE_LEVELS.forEach(name => {
|
||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any
|
||||
logger[name] = (...args) => {
|
||||
if (enabled) {
|
||||
consoleSandbox(() => {
|
||||
GLOBAL_OBJ.console[name](`${PREFIX}[${name}]:`, ...args);
|
||||
});
|
||||
}
|
||||
};
|
||||
});
|
||||
} else {
|
||||
CONSOLE_LEVELS.forEach(name => {
|
||||
logger[name] = () => undefined;
|
||||
});
|
||||
}
|
||||
|
||||
return logger ;
|
||||
}
|
||||
|
||||
// Ensure we only have a single logger instance, even if multiple versions of @sentry/utils are being used
|
||||
let logger;
|
||||
if ((typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__)) {
|
||||
logger = getGlobalSingleton('logger', makeLogger);
|
||||
} else {
|
||||
logger = makeLogger();
|
||||
}
|
||||
|
||||
export { CONSOLE_LEVELS, consoleSandbox, logger };
|
||||
//# sourceMappingURL=logger.js.map
|
||||
45
shared/logger/node_modules/@sentry/utils/esm/memo.js
generated
vendored
Normal file
45
shared/logger/node_modules/@sentry/utils/esm/memo.js
generated
vendored
Normal file
@@ -0,0 +1,45 @@
|
||||
/* eslint-disable @typescript-eslint/no-unsafe-member-access */
|
||||
/* eslint-disable @typescript-eslint/no-explicit-any */
|
||||
|
||||
/**
|
||||
* Helper to decycle json objects
|
||||
*/
|
||||
function memoBuilder() {
|
||||
const hasWeakSet = typeof WeakSet === 'function';
|
||||
const inner = hasWeakSet ? new WeakSet() : [];
|
||||
function memoize(obj) {
|
||||
if (hasWeakSet) {
|
||||
if (inner.has(obj)) {
|
||||
return true;
|
||||
}
|
||||
inner.add(obj);
|
||||
return false;
|
||||
}
|
||||
// eslint-disable-next-line @typescript-eslint/prefer-for-of
|
||||
for (let i = 0; i < inner.length; i++) {
|
||||
const value = inner[i];
|
||||
if (value === obj) {
|
||||
return true;
|
||||
}
|
||||
}
|
||||
inner.push(obj);
|
||||
return false;
|
||||
}
|
||||
|
||||
function unmemoize(obj) {
|
||||
if (hasWeakSet) {
|
||||
inner.delete(obj);
|
||||
} else {
|
||||
for (let i = 0; i < inner.length; i++) {
|
||||
if (inner[i] === obj) {
|
||||
inner.splice(i, 1);
|
||||
break;
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
return [memoize, unmemoize];
|
||||
}
|
||||
|
||||
export { memoBuilder };
|
||||
//# sourceMappingURL=memo.js.map
|
||||
197
shared/logger/node_modules/@sentry/utils/esm/misc.js
generated
vendored
Normal file
197
shared/logger/node_modules/@sentry/utils/esm/misc.js
generated
vendored
Normal file
@@ -0,0 +1,197 @@
|
||||
import { addNonEnumerableProperty } from './object.js';
|
||||
import { snipLine } from './string.js';
|
||||
import { GLOBAL_OBJ } from './worldwide.js';
|
||||
|
||||
/**
|
||||
* UUID4 generator
|
||||
*
|
||||
* @returns string Generated UUID4.
|
||||
*/
|
||||
function uuid4() {
|
||||
const gbl = GLOBAL_OBJ ;
|
||||
const crypto = gbl.crypto || gbl.msCrypto;
|
||||
|
||||
if (crypto && crypto.randomUUID) {
|
||||
return crypto.randomUUID().replace(/-/g, '');
|
||||
}
|
||||
|
||||
const getRandomByte =
|
||||
crypto && crypto.getRandomValues ? () => crypto.getRandomValues(new Uint8Array(1))[0] : () => Math.random() * 16;
|
||||
|
||||
// http://stackoverflow.com/questions/105034/how-to-create-a-guid-uuid-in-javascript/2117523#2117523
|
||||
// Concatenating the following numbers as strings results in '10000000100040008000100000000000'
|
||||
return (([1e7] ) + 1e3 + 4e3 + 8e3 + 1e11).replace(/[018]/g, c =>
|
||||
// eslint-disable-next-line no-bitwise
|
||||
((c ) ^ ((getRandomByte() & 15) >> ((c ) / 4))).toString(16),
|
||||
);
|
||||
}
|
||||
|
||||
function getFirstException(event) {
|
||||
return event.exception && event.exception.values ? event.exception.values[0] : undefined;
|
||||
}
|
||||
|
||||
/**
|
||||
* Extracts either message or type+value from an event that can be used for user-facing logs
|
||||
* @returns event's description
|
||||
*/
|
||||
function getEventDescription(event) {
|
||||
const { message, event_id: eventId } = event;
|
||||
if (message) {
|
||||
return message;
|
||||
}
|
||||
|
||||
const firstException = getFirstException(event);
|
||||
if (firstException) {
|
||||
if (firstException.type && firstException.value) {
|
||||
return `${firstException.type}: ${firstException.value}`;
|
||||
}
|
||||
return firstException.type || firstException.value || eventId || '<unknown>';
|
||||
}
|
||||
return eventId || '<unknown>';
|
||||
}
|
||||
|
||||
/**
|
||||
* Adds exception values, type and value to an synthetic Exception.
|
||||
* @param event The event to modify.
|
||||
* @param value Value of the exception.
|
||||
* @param type Type of the exception.
|
||||
* @hidden
|
||||
*/
|
||||
function addExceptionTypeValue(event, value, type) {
|
||||
const exception = (event.exception = event.exception || {});
|
||||
const values = (exception.values = exception.values || []);
|
||||
const firstException = (values[0] = values[0] || {});
|
||||
if (!firstException.value) {
|
||||
firstException.value = value || '';
|
||||
}
|
||||
if (!firstException.type) {
|
||||
firstException.type = type || 'Error';
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Adds exception mechanism data to a given event. Uses defaults if the second parameter is not passed.
|
||||
*
|
||||
* @param event The event to modify.
|
||||
* @param newMechanism Mechanism data to add to the event.
|
||||
* @hidden
|
||||
*/
|
||||
function addExceptionMechanism(event, newMechanism) {
|
||||
const firstException = getFirstException(event);
|
||||
if (!firstException) {
|
||||
return;
|
||||
}
|
||||
|
||||
const defaultMechanism = { type: 'generic', handled: true };
|
||||
const currentMechanism = firstException.mechanism;
|
||||
firstException.mechanism = { ...defaultMechanism, ...currentMechanism, ...newMechanism };
|
||||
|
||||
if (newMechanism && 'data' in newMechanism) {
|
||||
const mergedData = { ...(currentMechanism && currentMechanism.data), ...newMechanism.data };
|
||||
firstException.mechanism.data = mergedData;
|
||||
}
|
||||
}
|
||||
|
||||
// https://semver.org/#is-there-a-suggested-regular-expression-regex-to-check-a-semver-string
|
||||
const SEMVER_REGEXP =
|
||||
/^(0|[1-9]\d*)\.(0|[1-9]\d*)\.(0|[1-9]\d*)(?:-((?:0|[1-9]\d*|\d*[a-zA-Z-][0-9a-zA-Z-]*)(?:\.(?:0|[1-9]\d*|\d*[a-zA-Z-][0-9a-zA-Z-]*))*))?(?:\+([0-9a-zA-Z-]+(?:\.[0-9a-zA-Z-]+)*))?$/;
|
||||
|
||||
/**
|
||||
* Represents Semantic Versioning object
|
||||
*/
|
||||
|
||||
/**
|
||||
* Parses input into a SemVer interface
|
||||
* @param input string representation of a semver version
|
||||
*/
|
||||
function parseSemver(input) {
|
||||
const match = input.match(SEMVER_REGEXP) || [];
|
||||
const major = parseInt(match[1], 10);
|
||||
const minor = parseInt(match[2], 10);
|
||||
const patch = parseInt(match[3], 10);
|
||||
return {
|
||||
buildmetadata: match[5],
|
||||
major: isNaN(major) ? undefined : major,
|
||||
minor: isNaN(minor) ? undefined : minor,
|
||||
patch: isNaN(patch) ? undefined : patch,
|
||||
prerelease: match[4],
|
||||
};
|
||||
}
|
||||
|
||||
/**
|
||||
* This function adds context (pre/post/line) lines to the provided frame
|
||||
*
|
||||
* @param lines string[] containing all lines
|
||||
* @param frame StackFrame that will be mutated
|
||||
* @param linesOfContext number of context lines we want to add pre/post
|
||||
*/
|
||||
function addContextToFrame(lines, frame, linesOfContext = 5) {
|
||||
// When there is no line number in the frame, attaching context is nonsensical and will even break grouping
|
||||
if (frame.lineno === undefined) {
|
||||
return;
|
||||
}
|
||||
|
||||
const maxLines = lines.length;
|
||||
const sourceLine = Math.max(Math.min(maxLines, frame.lineno - 1), 0);
|
||||
|
||||
frame.pre_context = lines
|
||||
.slice(Math.max(0, sourceLine - linesOfContext), sourceLine)
|
||||
.map((line) => snipLine(line, 0));
|
||||
|
||||
frame.context_line = snipLine(lines[Math.min(maxLines - 1, sourceLine)], frame.colno || 0);
|
||||
|
||||
frame.post_context = lines
|
||||
.slice(Math.min(sourceLine + 1, maxLines), sourceLine + 1 + linesOfContext)
|
||||
.map((line) => snipLine(line, 0));
|
||||
}
|
||||
|
||||
/**
|
||||
* Checks whether or not we've already captured the given exception (note: not an identical exception - the very object
|
||||
* in question), and marks it captured if not.
|
||||
*
|
||||
* This is useful because it's possible for an error to get captured by more than one mechanism. After we intercept and
|
||||
* record an error, we rethrow it (assuming we've intercepted it before it's reached the top-level global handlers), so
|
||||
* that we don't interfere with whatever effects the error might have had were the SDK not there. At that point, because
|
||||
* the error has been rethrown, it's possible for it to bubble up to some other code we've instrumented. If it's not
|
||||
* caught after that, it will bubble all the way up to the global handlers (which of course we also instrument). This
|
||||
* function helps us ensure that even if we encounter the same error more than once, we only record it the first time we
|
||||
* see it.
|
||||
*
|
||||
* Note: It will ignore primitives (always return `false` and not mark them as seen), as properties can't be set on
|
||||
* them. {@link: Object.objectify} can be used on exceptions to convert any that are primitives into their equivalent
|
||||
* object wrapper forms so that this check will always work. However, because we need to flag the exact object which
|
||||
* will get rethrown, and because that rethrowing happens outside of the event processing pipeline, the objectification
|
||||
* must be done before the exception captured.
|
||||
*
|
||||
* @param A thrown exception to check or flag as having been seen
|
||||
* @returns `true` if the exception has already been captured, `false` if not (with the side effect of marking it seen)
|
||||
*/
|
||||
function checkOrSetAlreadyCaught(exception) {
|
||||
// eslint-disable-next-line @typescript-eslint/no-unsafe-member-access
|
||||
if (exception && (exception ).__sentry_captured__) {
|
||||
return true;
|
||||
}
|
||||
|
||||
try {
|
||||
// set it this way rather than by assignment so that it's not ennumerable and therefore isn't recorded by the
|
||||
// `ExtraErrorData` integration
|
||||
addNonEnumerableProperty(exception , '__sentry_captured__', true);
|
||||
} catch (err) {
|
||||
// `exception` is a primitive, so we can't mark it seen
|
||||
}
|
||||
|
||||
return false;
|
||||
}
|
||||
|
||||
/**
|
||||
* Checks whether the given input is already an array, and if it isn't, wraps it in one.
|
||||
*
|
||||
* @param maybeArray Input to turn into an array, if necessary
|
||||
* @returns The input, if already an array, or an array with the input as the only element, if not
|
||||
*/
|
||||
function arrayify(maybeArray) {
|
||||
return Array.isArray(maybeArray) ? maybeArray : [maybeArray];
|
||||
}
|
||||
|
||||
export { addContextToFrame, addExceptionMechanism, addExceptionTypeValue, arrayify, checkOrSetAlreadyCaught, getEventDescription, parseSemver, uuid4 };
|
||||
//# sourceMappingURL=misc.js.map
|
||||
66
shared/logger/node_modules/@sentry/utils/esm/node.js
generated
vendored
Normal file
66
shared/logger/node_modules/@sentry/utils/esm/node.js
generated
vendored
Normal file
@@ -0,0 +1,66 @@
|
||||
import { isBrowserBundle } from './env.js';
|
||||
|
||||
/**
|
||||
* NOTE: In order to avoid circular dependencies, if you add a function to this module and it needs to print something,
|
||||
* you must either a) use `console.log` rather than the logger, or b) put your function elsewhere.
|
||||
*/
|
||||
|
||||
/**
|
||||
* Checks whether we're in the Node.js or Browser environment
|
||||
*
|
||||
* @returns Answer to given question
|
||||
*/
|
||||
function isNodeEnv() {
|
||||
// explicitly check for browser bundles as those can be optimized statically
|
||||
// by terser/rollup.
|
||||
return (
|
||||
!isBrowserBundle() &&
|
||||
Object.prototype.toString.call(typeof process !== 'undefined' ? process : 0) === '[object process]'
|
||||
);
|
||||
}
|
||||
|
||||
/**
|
||||
* Requires a module which is protected against bundler minification.
|
||||
*
|
||||
* @param request The module path to resolve
|
||||
*/
|
||||
// eslint-disable-next-line @typescript-eslint/explicit-module-boundary-types, @typescript-eslint/no-explicit-any
|
||||
function dynamicRequire(mod, request) {
|
||||
// eslint-disable-next-line @typescript-eslint/no-unsafe-member-access
|
||||
return mod.require(request);
|
||||
}
|
||||
|
||||
/**
|
||||
* Helper for dynamically loading module that should work with linked dependencies.
|
||||
* The problem is that we _should_ be using `require(require.resolve(moduleName, { paths: [cwd()] }))`
|
||||
* However it's _not possible_ to do that with Webpack, as it has to know all the dependencies during
|
||||
* build time. `require.resolve` is also not available in any other way, so we cannot create,
|
||||
* a fake helper like we do with `dynamicRequire`.
|
||||
*
|
||||
* We always prefer to use local package, thus the value is not returned early from each `try/catch` block.
|
||||
* That is to mimic the behavior of `require.resolve` exactly.
|
||||
*
|
||||
* @param moduleName module name to require
|
||||
* @returns possibly required module
|
||||
*/
|
||||
function loadModule(moduleName) {
|
||||
let mod;
|
||||
|
||||
try {
|
||||
mod = dynamicRequire(module, moduleName);
|
||||
} catch (e) {
|
||||
// no-empty
|
||||
}
|
||||
|
||||
try {
|
||||
const { cwd } = dynamicRequire(module, 'process');
|
||||
mod = dynamicRequire(module, `${cwd()}/node_modules/${moduleName}`) ;
|
||||
} catch (e) {
|
||||
// no-empty
|
||||
}
|
||||
|
||||
return mod;
|
||||
}
|
||||
|
||||
export { dynamicRequire, isNodeEnv, loadModule };
|
||||
//# sourceMappingURL=node.js.map
|
||||
263
shared/logger/node_modules/@sentry/utils/esm/normalize.js
generated
vendored
Normal file
263
shared/logger/node_modules/@sentry/utils/esm/normalize.js
generated
vendored
Normal file
@@ -0,0 +1,263 @@
|
||||
import { isNaN, isSyntheticEvent } from './is.js';
|
||||
import { memoBuilder } from './memo.js';
|
||||
import { convertToPlainObject } from './object.js';
|
||||
import { getFunctionName } from './stacktrace.js';
|
||||
|
||||
/**
|
||||
* Recursively normalizes the given object.
|
||||
*
|
||||
* - Creates a copy to prevent original input mutation
|
||||
* - Skips non-enumerable properties
|
||||
* - When stringifying, calls `toJSON` if implemented
|
||||
* - Removes circular references
|
||||
* - Translates non-serializable values (`undefined`/`NaN`/functions) to serializable format
|
||||
* - Translates known global objects/classes to a string representations
|
||||
* - Takes care of `Error` object serialization
|
||||
* - Optionally limits depth of final output
|
||||
* - Optionally limits number of properties/elements included in any single object/array
|
||||
*
|
||||
* @param input The object to be normalized.
|
||||
* @param depth The max depth to which to normalize the object. (Anything deeper stringified whole.)
|
||||
* @param maxProperties The max number of elements or properties to be included in any single array or
|
||||
* object in the normallized output.
|
||||
* @returns A normalized version of the object, or `"**non-serializable**"` if any errors are thrown during normalization.
|
||||
*/
|
||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any
|
||||
function normalize(input, depth = 100, maxProperties = +Infinity) {
|
||||
try {
|
||||
// since we're at the outermost level, we don't provide a key
|
||||
return visit('', input, depth, maxProperties);
|
||||
} catch (err) {
|
||||
return { ERROR: `**non-serializable** (${err})` };
|
||||
}
|
||||
}
|
||||
|
||||
/** JSDoc */
|
||||
function normalizeToSize(
|
||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any
|
||||
object,
|
||||
// Default Node.js REPL depth
|
||||
depth = 3,
|
||||
// 100kB, as 200kB is max payload size, so half sounds reasonable
|
||||
maxSize = 100 * 1024,
|
||||
) {
|
||||
const normalized = normalize(object, depth);
|
||||
|
||||
if (jsonSize(normalized) > maxSize) {
|
||||
return normalizeToSize(object, depth - 1, maxSize);
|
||||
}
|
||||
|
||||
return normalized ;
|
||||
}
|
||||
|
||||
/**
|
||||
* Visits a node to perform normalization on it
|
||||
*
|
||||
* @param key The key corresponding to the given node
|
||||
* @param value The node to be visited
|
||||
* @param depth Optional number indicating the maximum recursion depth
|
||||
* @param maxProperties Optional maximum number of properties/elements included in any single object/array
|
||||
* @param memo Optional Memo class handling decycling
|
||||
*/
|
||||
function visit(
|
||||
key,
|
||||
value,
|
||||
depth = +Infinity,
|
||||
maxProperties = +Infinity,
|
||||
memo = memoBuilder(),
|
||||
) {
|
||||
const [memoize, unmemoize] = memo;
|
||||
|
||||
// Get the simple cases out of the way first
|
||||
if (
|
||||
value == null || // this matches null and undefined -> eqeq not eqeqeq
|
||||
(['number', 'boolean', 'string'].includes(typeof value) && !isNaN(value))
|
||||
) {
|
||||
return value ;
|
||||
}
|
||||
|
||||
const stringified = stringifyValue(key, value);
|
||||
|
||||
// Anything we could potentially dig into more (objects or arrays) will have come back as `"[object XXXX]"`.
|
||||
// Everything else will have already been serialized, so if we don't see that pattern, we're done.
|
||||
if (!stringified.startsWith('[object ')) {
|
||||
return stringified;
|
||||
}
|
||||
|
||||
// From here on, we can assert that `value` is either an object or an array.
|
||||
|
||||
// Do not normalize objects that we know have already been normalized. As a general rule, the
|
||||
// "__sentry_skip_normalization__" property should only be used sparingly and only should only be set on objects that
|
||||
// have already been normalized.
|
||||
if ((value )['__sentry_skip_normalization__']) {
|
||||
return value ;
|
||||
}
|
||||
|
||||
// We can set `__sentry_override_normalization_depth__` on an object to ensure that from there
|
||||
// We keep a certain amount of depth.
|
||||
// This should be used sparingly, e.g. we use it for the redux integration to ensure we get a certain amount of state.
|
||||
const remainingDepth =
|
||||
typeof (value )['__sentry_override_normalization_depth__'] === 'number'
|
||||
? ((value )['__sentry_override_normalization_depth__'] )
|
||||
: depth;
|
||||
|
||||
// We're also done if we've reached the max depth
|
||||
if (remainingDepth === 0) {
|
||||
// At this point we know `serialized` is a string of the form `"[object XXXX]"`. Clean it up so it's just `"[XXXX]"`.
|
||||
return stringified.replace('object ', '');
|
||||
}
|
||||
|
||||
// If we've already visited this branch, bail out, as it's circular reference. If not, note that we're seeing it now.
|
||||
if (memoize(value)) {
|
||||
return '[Circular ~]';
|
||||
}
|
||||
|
||||
// If the value has a `toJSON` method, we call it to extract more information
|
||||
const valueWithToJSON = value ;
|
||||
if (valueWithToJSON && typeof valueWithToJSON.toJSON === 'function') {
|
||||
try {
|
||||
const jsonValue = valueWithToJSON.toJSON();
|
||||
// We need to normalize the return value of `.toJSON()` in case it has circular references
|
||||
return visit('', jsonValue, remainingDepth - 1, maxProperties, memo);
|
||||
} catch (err) {
|
||||
// pass (The built-in `toJSON` failed, but we can still try to do it ourselves)
|
||||
}
|
||||
}
|
||||
|
||||
// At this point we know we either have an object or an array, we haven't seen it before, and we're going to recurse
|
||||
// because we haven't yet reached the max depth. Create an accumulator to hold the results of visiting each
|
||||
// property/entry, and keep track of the number of items we add to it.
|
||||
const normalized = (Array.isArray(value) ? [] : {}) ;
|
||||
let numAdded = 0;
|
||||
|
||||
// Before we begin, convert`Error` and`Event` instances into plain objects, since some of each of their relevant
|
||||
// properties are non-enumerable and otherwise would get missed.
|
||||
const visitable = convertToPlainObject(value );
|
||||
|
||||
for (const visitKey in visitable) {
|
||||
// Avoid iterating over fields in the prototype if they've somehow been exposed to enumeration.
|
||||
if (!Object.prototype.hasOwnProperty.call(visitable, visitKey)) {
|
||||
continue;
|
||||
}
|
||||
|
||||
if (numAdded >= maxProperties) {
|
||||
normalized[visitKey] = '[MaxProperties ~]';
|
||||
break;
|
||||
}
|
||||
|
||||
// Recursively visit all the child nodes
|
||||
const visitValue = visitable[visitKey];
|
||||
normalized[visitKey] = visit(visitKey, visitValue, remainingDepth - 1, maxProperties, memo);
|
||||
|
||||
numAdded++;
|
||||
}
|
||||
|
||||
// Once we've visited all the branches, remove the parent from memo storage
|
||||
unmemoize(value);
|
||||
|
||||
// Return accumulated values
|
||||
return normalized;
|
||||
}
|
||||
|
||||
/* eslint-disable complexity */
|
||||
/**
|
||||
* Stringify the given value. Handles various known special values and types.
|
||||
*
|
||||
* Not meant to be used on simple primitives which already have a string representation, as it will, for example, turn
|
||||
* the number 1231 into "[Object Number]", nor on `null`, as it will throw.
|
||||
*
|
||||
* @param value The value to stringify
|
||||
* @returns A stringified representation of the given value
|
||||
*/
|
||||
function stringifyValue(
|
||||
key,
|
||||
// this type is a tiny bit of a cheat, since this function does handle NaN (which is technically a number), but for
|
||||
// our internal use, it'll do
|
||||
value,
|
||||
) {
|
||||
try {
|
||||
if (key === 'domain' && value && typeof value === 'object' && (value )._events) {
|
||||
return '[Domain]';
|
||||
}
|
||||
|
||||
if (key === 'domainEmitter') {
|
||||
return '[DomainEmitter]';
|
||||
}
|
||||
|
||||
// It's safe to use `global`, `window`, and `document` here in this manner, as we are asserting using `typeof` first
|
||||
// which won't throw if they are not present.
|
||||
|
||||
if (typeof global !== 'undefined' && value === global) {
|
||||
return '[Global]';
|
||||
}
|
||||
|
||||
// eslint-disable-next-line no-restricted-globals
|
||||
if (typeof window !== 'undefined' && value === window) {
|
||||
return '[Window]';
|
||||
}
|
||||
|
||||
// eslint-disable-next-line no-restricted-globals
|
||||
if (typeof document !== 'undefined' && value === document) {
|
||||
return '[Document]';
|
||||
}
|
||||
|
||||
// React's SyntheticEvent thingy
|
||||
if (isSyntheticEvent(value)) {
|
||||
return '[SyntheticEvent]';
|
||||
}
|
||||
|
||||
if (typeof value === 'number' && value !== value) {
|
||||
return '[NaN]';
|
||||
}
|
||||
|
||||
if (typeof value === 'function') {
|
||||
return `[Function: ${getFunctionName(value)}]`;
|
||||
}
|
||||
|
||||
if (typeof value === 'symbol') {
|
||||
return `[${String(value)}]`;
|
||||
}
|
||||
|
||||
// stringified BigInts are indistinguishable from regular numbers, so we need to label them to avoid confusion
|
||||
if (typeof value === 'bigint') {
|
||||
return `[BigInt: ${String(value)}]`;
|
||||
}
|
||||
|
||||
// Now that we've knocked out all the special cases and the primitives, all we have left are objects. Simply casting
|
||||
// them to strings means that instances of classes which haven't defined their `toStringTag` will just come out as
|
||||
// `"[object Object]"`. If we instead look at the constructor's name (which is the same as the name of the class),
|
||||
// we can make sure that only plain objects come out that way.
|
||||
const objName = getConstructorName(value);
|
||||
|
||||
// Handle HTML Elements
|
||||
if (/^HTML(\w*)Element$/.test(objName)) {
|
||||
return `[HTMLElement: ${objName}]`;
|
||||
}
|
||||
|
||||
return `[object ${objName}]`;
|
||||
} catch (err) {
|
||||
return `**non-serializable** (${err})`;
|
||||
}
|
||||
}
|
||||
/* eslint-enable complexity */
|
||||
|
||||
function getConstructorName(value) {
|
||||
const prototype = Object.getPrototypeOf(value);
|
||||
|
||||
return prototype ? prototype.constructor.name : 'null prototype';
|
||||
}
|
||||
|
||||
/** Calculates bytes size of input string */
|
||||
function utf8Length(value) {
|
||||
// eslint-disable-next-line no-bitwise
|
||||
return ~-encodeURI(value).split(/%..|./).length;
|
||||
}
|
||||
|
||||
/** Calculates bytes size of input object */
|
||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any
|
||||
function jsonSize(value) {
|
||||
return utf8Length(JSON.stringify(value));
|
||||
}
|
||||
|
||||
export { normalize, normalizeToSize, visit as walk };
|
||||
//# sourceMappingURL=normalize.js.map
|
||||
279
shared/logger/node_modules/@sentry/utils/esm/object.js
generated
vendored
Normal file
279
shared/logger/node_modules/@sentry/utils/esm/object.js
generated
vendored
Normal file
@@ -0,0 +1,279 @@
|
||||
import { htmlTreeAsString } from './browser.js';
|
||||
import { isError, isEvent, isInstanceOf, isElement, isPlainObject, isPrimitive } from './is.js';
|
||||
import { truncate } from './string.js';
|
||||
|
||||
/**
|
||||
* Replace a method in an object with a wrapped version of itself.
|
||||
*
|
||||
* @param source An object that contains a method to be wrapped.
|
||||
* @param name The name of the method to be wrapped.
|
||||
* @param replacementFactory A higher-order function that takes the original version of the given method and returns a
|
||||
* wrapped version. Note: The function returned by `replacementFactory` needs to be a non-arrow function, in order to
|
||||
* preserve the correct value of `this`, and the original method must be called using `origMethod.call(this, <other
|
||||
* args>)` or `origMethod.apply(this, [<other args>])` (rather than being called directly), again to preserve `this`.
|
||||
* @returns void
|
||||
*/
|
||||
function fill(source, name, replacementFactory) {
|
||||
if (!(name in source)) {
|
||||
return;
|
||||
}
|
||||
|
||||
const original = source[name] ;
|
||||
const wrapped = replacementFactory(original) ;
|
||||
|
||||
// Make sure it's a function first, as we need to attach an empty prototype for `defineProperties` to work
|
||||
// otherwise it'll throw "TypeError: Object.defineProperties called on non-object"
|
||||
if (typeof wrapped === 'function') {
|
||||
try {
|
||||
markFunctionWrapped(wrapped, original);
|
||||
} catch (_Oo) {
|
||||
// This can throw if multiple fill happens on a global object like XMLHttpRequest
|
||||
// Fixes https://github.com/getsentry/sentry-javascript/issues/2043
|
||||
}
|
||||
}
|
||||
|
||||
source[name] = wrapped;
|
||||
}
|
||||
|
||||
/**
|
||||
* Defines a non-enumerable property on the given object.
|
||||
*
|
||||
* @param obj The object on which to set the property
|
||||
* @param name The name of the property to be set
|
||||
* @param value The value to which to set the property
|
||||
*/
|
||||
function addNonEnumerableProperty(obj, name, value) {
|
||||
Object.defineProperty(obj, name, {
|
||||
// enumerable: false, // the default, so we can save on bundle size by not explicitly setting it
|
||||
value: value,
|
||||
writable: true,
|
||||
configurable: true,
|
||||
});
|
||||
}
|
||||
|
||||
/**
|
||||
* Remembers the original function on the wrapped function and
|
||||
* patches up the prototype.
|
||||
*
|
||||
* @param wrapped the wrapper function
|
||||
* @param original the original function that gets wrapped
|
||||
*/
|
||||
function markFunctionWrapped(wrapped, original) {
|
||||
const proto = original.prototype || {};
|
||||
wrapped.prototype = original.prototype = proto;
|
||||
addNonEnumerableProperty(wrapped, '__sentry_original__', original);
|
||||
}
|
||||
|
||||
/**
|
||||
* This extracts the original function if available. See
|
||||
* `markFunctionWrapped` for more information.
|
||||
*
|
||||
* @param func the function to unwrap
|
||||
* @returns the unwrapped version of the function if available.
|
||||
*/
|
||||
function getOriginalFunction(func) {
|
||||
return func.__sentry_original__;
|
||||
}
|
||||
|
||||
/**
|
||||
* Encodes given object into url-friendly format
|
||||
*
|
||||
* @param object An object that contains serializable values
|
||||
* @returns string Encoded
|
||||
*/
|
||||
function urlEncode(object) {
|
||||
return Object.keys(object)
|
||||
.map(key => `${encodeURIComponent(key)}=${encodeURIComponent(object[key])}`)
|
||||
.join('&');
|
||||
}
|
||||
|
||||
/**
|
||||
* Transforms any `Error` or `Event` into a plain object with all of their enumerable properties, and some of their
|
||||
* non-enumerable properties attached.
|
||||
*
|
||||
* @param value Initial source that we have to transform in order for it to be usable by the serializer
|
||||
* @returns An Event or Error turned into an object - or the value argurment itself, when value is neither an Event nor
|
||||
* an Error.
|
||||
*/
|
||||
function convertToPlainObject(value)
|
||||
|
||||
{
|
||||
if (isError(value)) {
|
||||
return {
|
||||
message: value.message,
|
||||
name: value.name,
|
||||
stack: value.stack,
|
||||
...getOwnProperties(value),
|
||||
};
|
||||
} else if (isEvent(value)) {
|
||||
const newObj
|
||||
|
||||
= {
|
||||
type: value.type,
|
||||
target: serializeEventTarget(value.target),
|
||||
currentTarget: serializeEventTarget(value.currentTarget),
|
||||
...getOwnProperties(value),
|
||||
};
|
||||
|
||||
if (typeof CustomEvent !== 'undefined' && isInstanceOf(value, CustomEvent)) {
|
||||
newObj.detail = value.detail;
|
||||
}
|
||||
|
||||
return newObj;
|
||||
} else {
|
||||
return value;
|
||||
}
|
||||
}
|
||||
|
||||
/** Creates a string representation of the target of an `Event` object */
|
||||
function serializeEventTarget(target) {
|
||||
try {
|
||||
return isElement(target) ? htmlTreeAsString(target) : Object.prototype.toString.call(target);
|
||||
} catch (_oO) {
|
||||
return '<unknown>';
|
||||
}
|
||||
}
|
||||
|
||||
/** Filters out all but an object's own properties */
|
||||
function getOwnProperties(obj) {
|
||||
if (typeof obj === 'object' && obj !== null) {
|
||||
const extractedProps = {};
|
||||
for (const property in obj) {
|
||||
if (Object.prototype.hasOwnProperty.call(obj, property)) {
|
||||
extractedProps[property] = (obj )[property];
|
||||
}
|
||||
}
|
||||
return extractedProps;
|
||||
} else {
|
||||
return {};
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Given any captured exception, extract its keys and create a sorted
|
||||
* and truncated list that will be used inside the event message.
|
||||
* eg. `Non-error exception captured with keys: foo, bar, baz`
|
||||
*/
|
||||
function extractExceptionKeysForMessage(exception, maxLength = 40) {
|
||||
const keys = Object.keys(convertToPlainObject(exception));
|
||||
keys.sort();
|
||||
|
||||
if (!keys.length) {
|
||||
return '[object has no keys]';
|
||||
}
|
||||
|
||||
if (keys[0].length >= maxLength) {
|
||||
return truncate(keys[0], maxLength);
|
||||
}
|
||||
|
||||
for (let includedKeys = keys.length; includedKeys > 0; includedKeys--) {
|
||||
const serialized = keys.slice(0, includedKeys).join(', ');
|
||||
if (serialized.length > maxLength) {
|
||||
continue;
|
||||
}
|
||||
if (includedKeys === keys.length) {
|
||||
return serialized;
|
||||
}
|
||||
return truncate(serialized, maxLength);
|
||||
}
|
||||
|
||||
return '';
|
||||
}
|
||||
|
||||
/**
|
||||
* Given any object, return a new object having removed all fields whose value was `undefined`.
|
||||
* Works recursively on objects and arrays.
|
||||
*
|
||||
* Attention: This function keeps circular references in the returned object.
|
||||
*/
|
||||
function dropUndefinedKeys(inputValue) {
|
||||
// This map keeps track of what already visited nodes map to.
|
||||
// Our Set - based memoBuilder doesn't work here because we want to the output object to have the same circular
|
||||
// references as the input object.
|
||||
const memoizationMap = new Map();
|
||||
|
||||
// This function just proxies `_dropUndefinedKeys` to keep the `memoBuilder` out of this function's API
|
||||
return _dropUndefinedKeys(inputValue, memoizationMap);
|
||||
}
|
||||
|
||||
function _dropUndefinedKeys(inputValue, memoizationMap) {
|
||||
if (isPlainObject(inputValue)) {
|
||||
// If this node has already been visited due to a circular reference, return the object it was mapped to in the new object
|
||||
const memoVal = memoizationMap.get(inputValue);
|
||||
if (memoVal !== undefined) {
|
||||
return memoVal ;
|
||||
}
|
||||
|
||||
const returnValue = {};
|
||||
// Store the mapping of this value in case we visit it again, in case of circular data
|
||||
memoizationMap.set(inputValue, returnValue);
|
||||
|
||||
for (const key of Object.keys(inputValue)) {
|
||||
if (typeof inputValue[key] !== 'undefined') {
|
||||
returnValue[key] = _dropUndefinedKeys(inputValue[key], memoizationMap);
|
||||
}
|
||||
}
|
||||
|
||||
return returnValue ;
|
||||
}
|
||||
|
||||
if (Array.isArray(inputValue)) {
|
||||
// If this node has already been visited due to a circular reference, return the array it was mapped to in the new object
|
||||
const memoVal = memoizationMap.get(inputValue);
|
||||
if (memoVal !== undefined) {
|
||||
return memoVal ;
|
||||
}
|
||||
|
||||
const returnValue = [];
|
||||
// Store the mapping of this value in case we visit it again, in case of circular data
|
||||
memoizationMap.set(inputValue, returnValue);
|
||||
|
||||
inputValue.forEach((item) => {
|
||||
returnValue.push(_dropUndefinedKeys(item, memoizationMap));
|
||||
});
|
||||
|
||||
return returnValue ;
|
||||
}
|
||||
|
||||
return inputValue;
|
||||
}
|
||||
|
||||
/**
|
||||
* Ensure that something is an object.
|
||||
*
|
||||
* Turns `undefined` and `null` into `String`s and all other primitives into instances of their respective wrapper
|
||||
* classes (String, Boolean, Number, etc.). Acts as the identity function on non-primitives.
|
||||
*
|
||||
* @param wat The subject of the objectification
|
||||
* @returns A version of `wat` which can safely be used with `Object` class methods
|
||||
*/
|
||||
function objectify(wat) {
|
||||
let objectified;
|
||||
switch (true) {
|
||||
case wat === undefined || wat === null:
|
||||
objectified = new String(wat);
|
||||
break;
|
||||
|
||||
// Though symbols and bigints do have wrapper classes (`Symbol` and `BigInt`, respectively), for whatever reason
|
||||
// those classes don't have constructors which can be used with the `new` keyword. We therefore need to cast each as
|
||||
// an object in order to wrap it.
|
||||
case typeof wat === 'symbol' || typeof wat === 'bigint':
|
||||
objectified = Object(wat);
|
||||
break;
|
||||
|
||||
// this will catch the remaining primitives: `String`, `Number`, and `Boolean`
|
||||
case isPrimitive(wat):
|
||||
// eslint-disable-next-line @typescript-eslint/no-unsafe-member-access
|
||||
objectified = new (wat ).constructor(wat);
|
||||
break;
|
||||
|
||||
// by process of elimination, at this point we know that `wat` must already be an object
|
||||
default:
|
||||
objectified = wat;
|
||||
break;
|
||||
}
|
||||
return objectified;
|
||||
}
|
||||
|
||||
export { addNonEnumerableProperty, convertToPlainObject, dropUndefinedKeys, extractExceptionKeysForMessage, fill, getOriginalFunction, markFunctionWrapped, objectify, urlEncode };
|
||||
//# sourceMappingURL=object.js.map
|
||||
102
shared/logger/node_modules/@sentry/utils/esm/promisebuffer.js
generated
vendored
Normal file
102
shared/logger/node_modules/@sentry/utils/esm/promisebuffer.js
generated
vendored
Normal file
@@ -0,0 +1,102 @@
|
||||
import { SentryError } from './error.js';
|
||||
import { rejectedSyncPromise, SyncPromise, resolvedSyncPromise } from './syncpromise.js';
|
||||
|
||||
/**
|
||||
* Creates an new PromiseBuffer object with the specified limit
|
||||
* @param limit max number of promises that can be stored in the buffer
|
||||
*/
|
||||
function makePromiseBuffer(limit) {
|
||||
const buffer = [];
|
||||
|
||||
function isReady() {
|
||||
return limit === undefined || buffer.length < limit;
|
||||
}
|
||||
|
||||
/**
|
||||
* Remove a promise from the queue.
|
||||
*
|
||||
* @param task Can be any PromiseLike<T>
|
||||
* @returns Removed promise.
|
||||
*/
|
||||
function remove(task) {
|
||||
return buffer.splice(buffer.indexOf(task), 1)[0];
|
||||
}
|
||||
|
||||
/**
|
||||
* Add a promise (representing an in-flight action) to the queue, and set it to remove itself on fulfillment.
|
||||
*
|
||||
* @param taskProducer A function producing any PromiseLike<T>; In previous versions this used to be `task:
|
||||
* PromiseLike<T>`, but under that model, Promises were instantly created on the call-site and their executor
|
||||
* functions therefore ran immediately. Thus, even if the buffer was full, the action still happened. By
|
||||
* requiring the promise to be wrapped in a function, we can defer promise creation until after the buffer
|
||||
* limit check.
|
||||
* @returns The original promise.
|
||||
*/
|
||||
function add(taskProducer) {
|
||||
if (!isReady()) {
|
||||
return rejectedSyncPromise(new SentryError('Not adding Promise because buffer limit was reached.'));
|
||||
}
|
||||
|
||||
// start the task and add its promise to the queue
|
||||
const task = taskProducer();
|
||||
if (buffer.indexOf(task) === -1) {
|
||||
buffer.push(task);
|
||||
}
|
||||
void task
|
||||
.then(() => remove(task))
|
||||
// Use `then(null, rejectionHandler)` rather than `catch(rejectionHandler)` so that we can use `PromiseLike`
|
||||
// rather than `Promise`. `PromiseLike` doesn't have a `.catch` method, making its polyfill smaller. (ES5 didn't
|
||||
// have promises, so TS has to polyfill when down-compiling.)
|
||||
.then(null, () =>
|
||||
remove(task).then(null, () => {
|
||||
// We have to add another catch here because `remove()` starts a new promise chain.
|
||||
}),
|
||||
);
|
||||
return task;
|
||||
}
|
||||
|
||||
/**
|
||||
* Wait for all promises in the queue to resolve or for timeout to expire, whichever comes first.
|
||||
*
|
||||
* @param timeout The time, in ms, after which to resolve to `false` if the queue is still non-empty. Passing `0` (or
|
||||
* not passing anything) will make the promise wait as long as it takes for the queue to drain before resolving to
|
||||
* `true`.
|
||||
* @returns A promise which will resolve to `true` if the queue is already empty or drains before the timeout, and
|
||||
* `false` otherwise
|
||||
*/
|
||||
function drain(timeout) {
|
||||
return new SyncPromise((resolve, reject) => {
|
||||
let counter = buffer.length;
|
||||
|
||||
if (!counter) {
|
||||
return resolve(true);
|
||||
}
|
||||
|
||||
// wait for `timeout` ms and then resolve to `false` (if not cancelled first)
|
||||
const capturedSetTimeout = setTimeout(() => {
|
||||
if (timeout && timeout > 0) {
|
||||
resolve(false);
|
||||
}
|
||||
}, timeout);
|
||||
|
||||
// if all promises resolve in time, cancel the timer and resolve to `true`
|
||||
buffer.forEach(item => {
|
||||
void resolvedSyncPromise(item).then(() => {
|
||||
if (!--counter) {
|
||||
clearTimeout(capturedSetTimeout);
|
||||
resolve(true);
|
||||
}
|
||||
}, reject);
|
||||
});
|
||||
});
|
||||
}
|
||||
|
||||
return {
|
||||
$: buffer,
|
||||
add,
|
||||
drain,
|
||||
};
|
||||
}
|
||||
|
||||
export { makePromiseBuffer };
|
||||
//# sourceMappingURL=promisebuffer.js.map
|
||||
97
shared/logger/node_modules/@sentry/utils/esm/ratelimit.js
generated
vendored
Normal file
97
shared/logger/node_modules/@sentry/utils/esm/ratelimit.js
generated
vendored
Normal file
@@ -0,0 +1,97 @@
|
||||
// Intentionally keeping the key broad, as we don't know for sure what rate limit headers get returned from backend
|
||||
|
||||
const DEFAULT_RETRY_AFTER = 60 * 1000; // 60 seconds
|
||||
|
||||
/**
|
||||
* Extracts Retry-After value from the request header or returns default value
|
||||
* @param header string representation of 'Retry-After' header
|
||||
* @param now current unix timestamp
|
||||
*
|
||||
*/
|
||||
function parseRetryAfterHeader(header, now = Date.now()) {
|
||||
const headerDelay = parseInt(`${header}`, 10);
|
||||
if (!isNaN(headerDelay)) {
|
||||
return headerDelay * 1000;
|
||||
}
|
||||
|
||||
const headerDate = Date.parse(`${header}`);
|
||||
if (!isNaN(headerDate)) {
|
||||
return headerDate - now;
|
||||
}
|
||||
|
||||
return DEFAULT_RETRY_AFTER;
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets the time that the given category is disabled until for rate limiting.
|
||||
* In case no category-specific limit is set but a general rate limit across all categories is active,
|
||||
* that time is returned.
|
||||
*
|
||||
* @return the time in ms that the category is disabled until or 0 if there's no active rate limit.
|
||||
*/
|
||||
function disabledUntil(limits, category) {
|
||||
return limits[category] || limits.all || 0;
|
||||
}
|
||||
|
||||
/**
|
||||
* Checks if a category is rate limited
|
||||
*/
|
||||
function isRateLimited(limits, category, now = Date.now()) {
|
||||
return disabledUntil(limits, category) > now;
|
||||
}
|
||||
|
||||
/**
|
||||
* Update ratelimits from incoming headers.
|
||||
*
|
||||
* @return the updated RateLimits object.
|
||||
*/
|
||||
function updateRateLimits(
|
||||
limits,
|
||||
{ statusCode, headers },
|
||||
now = Date.now(),
|
||||
) {
|
||||
const updatedRateLimits = {
|
||||
...limits,
|
||||
};
|
||||
|
||||
// "The name is case-insensitive."
|
||||
// https://developer.mozilla.org/en-US/docs/Web/API/Headers/get
|
||||
const rateLimitHeader = headers && headers['x-sentry-rate-limits'];
|
||||
const retryAfterHeader = headers && headers['retry-after'];
|
||||
|
||||
if (rateLimitHeader) {
|
||||
/**
|
||||
* rate limit headers are of the form
|
||||
* <header>,<header>,..
|
||||
* where each <header> is of the form
|
||||
* <retry_after>: <categories>: <scope>: <reason_code>
|
||||
* where
|
||||
* <retry_after> is a delay in seconds
|
||||
* <categories> is the event type(s) (error, transaction, etc) being rate limited and is of the form
|
||||
* <category>;<category>;...
|
||||
* <scope> is what's being limited (org, project, or key) - ignored by SDK
|
||||
* <reason_code> is an arbitrary string like "org_quota" - ignored by SDK
|
||||
*/
|
||||
for (const limit of rateLimitHeader.trim().split(',')) {
|
||||
const [retryAfter, categories] = limit.split(':', 2);
|
||||
const headerDelay = parseInt(retryAfter, 10);
|
||||
const delay = (!isNaN(headerDelay) ? headerDelay : 60) * 1000; // 60sec default
|
||||
if (!categories) {
|
||||
updatedRateLimits.all = now + delay;
|
||||
} else {
|
||||
for (const category of categories.split(';')) {
|
||||
updatedRateLimits[category] = now + delay;
|
||||
}
|
||||
}
|
||||
}
|
||||
} else if (retryAfterHeader) {
|
||||
updatedRateLimits.all = now + parseRetryAfterHeader(retryAfterHeader, now);
|
||||
} else if (statusCode === 429) {
|
||||
updatedRateLimits.all = now + 60 * 1000;
|
||||
}
|
||||
|
||||
return updatedRateLimits;
|
||||
}
|
||||
|
||||
export { DEFAULT_RETRY_AFTER, disabledUntil, isRateLimited, parseRetryAfterHeader, updateRateLimits };
|
||||
//# sourceMappingURL=ratelimit.js.map
|
||||
36
shared/logger/node_modules/@sentry/utils/esm/severity.js
generated
vendored
Normal file
36
shared/logger/node_modules/@sentry/utils/esm/severity.js
generated
vendored
Normal file
@@ -0,0 +1,36 @@
|
||||
// Note: Ideally the `SeverityLevel` type would be derived from `validSeverityLevels`, but that would mean either
|
||||
//
|
||||
// a) moving `validSeverityLevels` to `@sentry/types`,
|
||||
// b) moving the`SeverityLevel` type here, or
|
||||
// c) importing `validSeverityLevels` from here into `@sentry/types`.
|
||||
//
|
||||
// Option A would make `@sentry/types` a runtime dependency of `@sentry/utils` (not good), and options B and C would
|
||||
// create a circular dependency between `@sentry/types` and `@sentry/utils` (also not good). So a TODO accompanying the
|
||||
// type, reminding anyone who changes it to change this list also, will have to do.
|
||||
|
||||
const validSeverityLevels = ['fatal', 'error', 'warning', 'log', 'info', 'debug'];
|
||||
|
||||
/**
|
||||
* Converts a string-based level into a member of the deprecated {@link Severity} enum.
|
||||
*
|
||||
* @deprecated `severityFromString` is deprecated. Please use `severityLevelFromString` instead.
|
||||
*
|
||||
* @param level String representation of Severity
|
||||
* @returns Severity
|
||||
*/
|
||||
function severityFromString(level) {
|
||||
return severityLevelFromString(level) ;
|
||||
}
|
||||
|
||||
/**
|
||||
* Converts a string-based level into a `SeverityLevel`, normalizing it along the way.
|
||||
*
|
||||
* @param level String representation of desired `SeverityLevel`.
|
||||
* @returns The `SeverityLevel` corresponding to the given string, or 'log' if the string isn't a valid level.
|
||||
*/
|
||||
function severityLevelFromString(level) {
|
||||
return (level === 'warn' ? 'warning' : validSeverityLevels.includes(level) ? level : 'log') ;
|
||||
}
|
||||
|
||||
export { severityFromString, severityLevelFromString, validSeverityLevels };
|
||||
//# sourceMappingURL=severity.js.map
|
||||
136
shared/logger/node_modules/@sentry/utils/esm/stacktrace.js
generated
vendored
Normal file
136
shared/logger/node_modules/@sentry/utils/esm/stacktrace.js
generated
vendored
Normal file
@@ -0,0 +1,136 @@
|
||||
import { node } from './node-stack-trace.js';
|
||||
|
||||
const STACKTRACE_FRAME_LIMIT = 50;
|
||||
// Used to sanitize webpack (error: *) wrapped stack errors
|
||||
const WEBPACK_ERROR_REGEXP = /\(error: (.*)\)/;
|
||||
|
||||
/**
|
||||
* Creates a stack parser with the supplied line parsers
|
||||
*
|
||||
* StackFrames are returned in the correct order for Sentry Exception
|
||||
* frames and with Sentry SDK internal frames removed from the top and bottom
|
||||
*
|
||||
*/
|
||||
function createStackParser(...parsers) {
|
||||
const sortedParsers = parsers.sort((a, b) => a[0] - b[0]).map(p => p[1]);
|
||||
|
||||
return (stack, skipFirst = 0) => {
|
||||
const frames = [];
|
||||
const lines = stack.split('\n');
|
||||
|
||||
for (let i = skipFirst; i < lines.length; i++) {
|
||||
const line = lines[i];
|
||||
// Ignore lines over 1kb as they are unlikely to be stack frames.
|
||||
// Many of the regular expressions use backtracking which results in run time that increases exponentially with
|
||||
// input size. Huge strings can result in hangs/Denial of Service:
|
||||
// https://github.com/getsentry/sentry-javascript/issues/2286
|
||||
if (line.length > 1024) {
|
||||
continue;
|
||||
}
|
||||
|
||||
// https://github.com/getsentry/sentry-javascript/issues/5459
|
||||
// Remove webpack (error: *) wrappers
|
||||
const cleanedLine = WEBPACK_ERROR_REGEXP.test(line) ? line.replace(WEBPACK_ERROR_REGEXP, '$1') : line;
|
||||
|
||||
// https://github.com/getsentry/sentry-javascript/issues/7813
|
||||
// Skip Error: lines
|
||||
if (cleanedLine.match(/\S*Error: /)) {
|
||||
continue;
|
||||
}
|
||||
|
||||
for (const parser of sortedParsers) {
|
||||
const frame = parser(cleanedLine);
|
||||
|
||||
if (frame) {
|
||||
frames.push(frame);
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
if (frames.length >= STACKTRACE_FRAME_LIMIT) {
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
return stripSentryFramesAndReverse(frames);
|
||||
};
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets a stack parser implementation from Options.stackParser
|
||||
* @see Options
|
||||
*
|
||||
* If options contains an array of line parsers, it is converted into a parser
|
||||
*/
|
||||
function stackParserFromStackParserOptions(stackParser) {
|
||||
if (Array.isArray(stackParser)) {
|
||||
return createStackParser(...stackParser);
|
||||
}
|
||||
return stackParser;
|
||||
}
|
||||
|
||||
/**
|
||||
* Removes Sentry frames from the top and bottom of the stack if present and enforces a limit of max number of frames.
|
||||
* Assumes stack input is ordered from top to bottom and returns the reverse representation so call site of the
|
||||
* function that caused the crash is the last frame in the array.
|
||||
* @hidden
|
||||
*/
|
||||
function stripSentryFramesAndReverse(stack) {
|
||||
if (!stack.length) {
|
||||
return [];
|
||||
}
|
||||
|
||||
const localStack = stack.slice(0, STACKTRACE_FRAME_LIMIT);
|
||||
|
||||
const lastFrameFunction = localStack[localStack.length - 1].function;
|
||||
// If stack starts with one of our API calls, remove it (starts, meaning it's the top of the stack - aka last call)
|
||||
if (lastFrameFunction && /sentryWrapped/.test(lastFrameFunction)) {
|
||||
localStack.pop();
|
||||
}
|
||||
|
||||
// Reversing in the middle of the procedure allows us to just pop the values off the stack
|
||||
localStack.reverse();
|
||||
|
||||
const firstFrameFunction = localStack[localStack.length - 1].function;
|
||||
// If stack ends with one of our internal API calls, remove it (ends, meaning it's the bottom of the stack - aka top-most call)
|
||||
if (firstFrameFunction && /captureMessage|captureException/.test(firstFrameFunction)) {
|
||||
localStack.pop();
|
||||
}
|
||||
|
||||
return localStack.map(frame => ({
|
||||
...frame,
|
||||
filename: frame.filename || localStack[localStack.length - 1].filename,
|
||||
function: frame.function || '?',
|
||||
}));
|
||||
}
|
||||
|
||||
const defaultFunctionName = '<anonymous>';
|
||||
|
||||
/**
|
||||
* Safely extract function name from itself
|
||||
*/
|
||||
function getFunctionName(fn) {
|
||||
try {
|
||||
if (!fn || typeof fn !== 'function') {
|
||||
return defaultFunctionName;
|
||||
}
|
||||
return fn.name || defaultFunctionName;
|
||||
} catch (e) {
|
||||
// Just accessing custom props in some Selenium environments
|
||||
// can cause a "Permission denied" exception (see raven-js#495).
|
||||
return defaultFunctionName;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Node.js stack line parser
|
||||
*
|
||||
* This is in @sentry/utils so it can be used from the Electron SDK in the browser for when `nodeIntegration == true`.
|
||||
* This allows it to be used without referencing or importing any node specific code which causes bundlers to complain
|
||||
*/
|
||||
function nodeStackLineParser(getModule) {
|
||||
return [90, node(getModule)];
|
||||
}
|
||||
|
||||
export { createStackParser, getFunctionName, nodeStackLineParser, stackParserFromStackParserOptions, stripSentryFramesAndReverse };
|
||||
//# sourceMappingURL=stacktrace.js.map
|
||||
132
shared/logger/node_modules/@sentry/utils/esm/string.js
generated
vendored
Normal file
132
shared/logger/node_modules/@sentry/utils/esm/string.js
generated
vendored
Normal file
@@ -0,0 +1,132 @@
|
||||
import { isString, isRegExp } from './is.js';
|
||||
|
||||
/**
|
||||
* Truncates given string to the maximum characters count
|
||||
*
|
||||
* @param str An object that contains serializable values
|
||||
* @param max Maximum number of characters in truncated string (0 = unlimited)
|
||||
* @returns string Encoded
|
||||
*/
|
||||
function truncate(str, max = 0) {
|
||||
if (typeof str !== 'string' || max === 0) {
|
||||
return str;
|
||||
}
|
||||
return str.length <= max ? str : `${str.slice(0, max)}...`;
|
||||
}
|
||||
|
||||
/**
|
||||
* This is basically just `trim_line` from
|
||||
* https://github.com/getsentry/sentry/blob/master/src/sentry/lang/javascript/processor.py#L67
|
||||
*
|
||||
* @param str An object that contains serializable values
|
||||
* @param max Maximum number of characters in truncated string
|
||||
* @returns string Encoded
|
||||
*/
|
||||
function snipLine(line, colno) {
|
||||
let newLine = line;
|
||||
const lineLength = newLine.length;
|
||||
if (lineLength <= 150) {
|
||||
return newLine;
|
||||
}
|
||||
if (colno > lineLength) {
|
||||
// eslint-disable-next-line no-param-reassign
|
||||
colno = lineLength;
|
||||
}
|
||||
|
||||
let start = Math.max(colno - 60, 0);
|
||||
if (start < 5) {
|
||||
start = 0;
|
||||
}
|
||||
|
||||
let end = Math.min(start + 140, lineLength);
|
||||
if (end > lineLength - 5) {
|
||||
end = lineLength;
|
||||
}
|
||||
if (end === lineLength) {
|
||||
start = Math.max(end - 140, 0);
|
||||
}
|
||||
|
||||
newLine = newLine.slice(start, end);
|
||||
if (start > 0) {
|
||||
newLine = `'{snip} ${newLine}`;
|
||||
}
|
||||
if (end < lineLength) {
|
||||
newLine += ' {snip}';
|
||||
}
|
||||
|
||||
return newLine;
|
||||
}
|
||||
|
||||
/**
|
||||
* Join values in array
|
||||
* @param input array of values to be joined together
|
||||
* @param delimiter string to be placed in-between values
|
||||
* @returns Joined values
|
||||
*/
|
||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any
|
||||
function safeJoin(input, delimiter) {
|
||||
if (!Array.isArray(input)) {
|
||||
return '';
|
||||
}
|
||||
|
||||
const output = [];
|
||||
// eslint-disable-next-line @typescript-eslint/prefer-for-of
|
||||
for (let i = 0; i < input.length; i++) {
|
||||
const value = input[i];
|
||||
try {
|
||||
output.push(String(value));
|
||||
} catch (e) {
|
||||
output.push('[value cannot be serialized]');
|
||||
}
|
||||
}
|
||||
|
||||
return output.join(delimiter);
|
||||
}
|
||||
|
||||
/**
|
||||
* Checks if the given value matches a regex or string
|
||||
*
|
||||
* @param value The string to test
|
||||
* @param pattern Either a regex or a string against which `value` will be matched
|
||||
* @param requireExactStringMatch If true, `value` must match `pattern` exactly. If false, `value` will match
|
||||
* `pattern` if it contains `pattern`. Only applies to string-type patterns.
|
||||
*/
|
||||
function isMatchingPattern(
|
||||
value,
|
||||
pattern,
|
||||
requireExactStringMatch = false,
|
||||
) {
|
||||
if (!isString(value)) {
|
||||
return false;
|
||||
}
|
||||
|
||||
if (isRegExp(pattern)) {
|
||||
return pattern.test(value);
|
||||
}
|
||||
if (isString(pattern)) {
|
||||
return requireExactStringMatch ? value === pattern : value.includes(pattern);
|
||||
}
|
||||
|
||||
return false;
|
||||
}
|
||||
|
||||
/**
|
||||
* Test the given string against an array of strings and regexes. By default, string matching is done on a
|
||||
* substring-inclusion basis rather than a strict equality basis
|
||||
*
|
||||
* @param testString The string to test
|
||||
* @param patterns The patterns against which to test the string
|
||||
* @param requireExactStringMatch If true, `testString` must match one of the given string patterns exactly in order to
|
||||
* count. If false, `testString` will match a string pattern if it contains that pattern.
|
||||
* @returns
|
||||
*/
|
||||
function stringMatchesSomePattern(
|
||||
testString,
|
||||
patterns = [],
|
||||
requireExactStringMatch = false,
|
||||
) {
|
||||
return patterns.some(pattern => isMatchingPattern(testString, pattern, requireExactStringMatch));
|
||||
}
|
||||
|
||||
export { isMatchingPattern, safeJoin, snipLine, stringMatchesSomePattern, truncate };
|
||||
//# sourceMappingURL=string.js.map
|
||||
161
shared/logger/node_modules/@sentry/utils/esm/supports.js
generated
vendored
Normal file
161
shared/logger/node_modules/@sentry/utils/esm/supports.js
generated
vendored
Normal file
@@ -0,0 +1,161 @@
|
||||
import { logger } from './logger.js';
|
||||
import { getGlobalObject } from './worldwide.js';
|
||||
|
||||
// eslint-disable-next-line deprecation/deprecation
|
||||
const WINDOW = getGlobalObject();
|
||||
|
||||
/**
|
||||
* Tells whether current environment supports ErrorEvent objects
|
||||
* {@link supportsErrorEvent}.
|
||||
*
|
||||
* @returns Answer to the given question.
|
||||
*/
|
||||
function supportsErrorEvent() {
|
||||
try {
|
||||
new ErrorEvent('');
|
||||
return true;
|
||||
} catch (e) {
|
||||
return false;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Tells whether current environment supports DOMError objects
|
||||
* {@link supportsDOMError}.
|
||||
*
|
||||
* @returns Answer to the given question.
|
||||
*/
|
||||
function supportsDOMError() {
|
||||
try {
|
||||
// Chrome: VM89:1 Uncaught TypeError: Failed to construct 'DOMError':
|
||||
// 1 argument required, but only 0 present.
|
||||
// @ts-ignore It really needs 1 argument, not 0.
|
||||
new DOMError('');
|
||||
return true;
|
||||
} catch (e) {
|
||||
return false;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Tells whether current environment supports DOMException objects
|
||||
* {@link supportsDOMException}.
|
||||
*
|
||||
* @returns Answer to the given question.
|
||||
*/
|
||||
function supportsDOMException() {
|
||||
try {
|
||||
new DOMException('');
|
||||
return true;
|
||||
} catch (e) {
|
||||
return false;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Tells whether current environment supports Fetch API
|
||||
* {@link supportsFetch}.
|
||||
*
|
||||
* @returns Answer to the given question.
|
||||
*/
|
||||
function supportsFetch() {
|
||||
if (!('fetch' in WINDOW)) {
|
||||
return false;
|
||||
}
|
||||
|
||||
try {
|
||||
new Headers();
|
||||
new Request('http://www.example.com');
|
||||
new Response();
|
||||
return true;
|
||||
} catch (e) {
|
||||
return false;
|
||||
}
|
||||
}
|
||||
/**
|
||||
* isNativeFetch checks if the given function is a native implementation of fetch()
|
||||
*/
|
||||
// eslint-disable-next-line @typescript-eslint/ban-types
|
||||
function isNativeFetch(func) {
|
||||
return func && /^function fetch\(\)\s+\{\s+\[native code\]\s+\}$/.test(func.toString());
|
||||
}
|
||||
|
||||
/**
|
||||
* Tells whether current environment supports Fetch API natively
|
||||
* {@link supportsNativeFetch}.
|
||||
*
|
||||
* @returns true if `window.fetch` is natively implemented, false otherwise
|
||||
*/
|
||||
function supportsNativeFetch() {
|
||||
if (!supportsFetch()) {
|
||||
return false;
|
||||
}
|
||||
|
||||
// Fast path to avoid DOM I/O
|
||||
// eslint-disable-next-line @typescript-eslint/unbound-method
|
||||
if (isNativeFetch(WINDOW.fetch)) {
|
||||
return true;
|
||||
}
|
||||
|
||||
// window.fetch is implemented, but is polyfilled or already wrapped (e.g: by a chrome extension)
|
||||
// so create a "pure" iframe to see if that has native fetch
|
||||
let result = false;
|
||||
const doc = WINDOW.document;
|
||||
// eslint-disable-next-line deprecation/deprecation
|
||||
if (doc && typeof (doc.createElement ) === 'function') {
|
||||
try {
|
||||
const sandbox = doc.createElement('iframe');
|
||||
sandbox.hidden = true;
|
||||
doc.head.appendChild(sandbox);
|
||||
if (sandbox.contentWindow && sandbox.contentWindow.fetch) {
|
||||
// eslint-disable-next-line @typescript-eslint/unbound-method
|
||||
result = isNativeFetch(sandbox.contentWindow.fetch);
|
||||
}
|
||||
doc.head.removeChild(sandbox);
|
||||
} catch (err) {
|
||||
(typeof __SENTRY_DEBUG__ === 'undefined' || __SENTRY_DEBUG__) &&
|
||||
logger.warn('Could not create sandbox iframe for pure fetch check, bailing to window.fetch: ', err);
|
||||
}
|
||||
}
|
||||
|
||||
return result;
|
||||
}
|
||||
|
||||
/**
|
||||
* Tells whether current environment supports ReportingObserver API
|
||||
* {@link supportsReportingObserver}.
|
||||
*
|
||||
* @returns Answer to the given question.
|
||||
*/
|
||||
function supportsReportingObserver() {
|
||||
return 'ReportingObserver' in WINDOW;
|
||||
}
|
||||
|
||||
/**
|
||||
* Tells whether current environment supports Referrer Policy API
|
||||
* {@link supportsReferrerPolicy}.
|
||||
*
|
||||
* @returns Answer to the given question.
|
||||
*/
|
||||
function supportsReferrerPolicy() {
|
||||
// Despite all stars in the sky saying that Edge supports old draft syntax, aka 'never', 'always', 'origin' and 'default'
|
||||
// (see https://caniuse.com/#feat=referrer-policy),
|
||||
// it doesn't. And it throws an exception instead of ignoring this parameter...
|
||||
// REF: https://github.com/getsentry/raven-js/issues/1233
|
||||
|
||||
if (!supportsFetch()) {
|
||||
return false;
|
||||
}
|
||||
|
||||
try {
|
||||
new Request('_', {
|
||||
referrerPolicy: 'origin' ,
|
||||
});
|
||||
return true;
|
||||
} catch (e) {
|
||||
return false;
|
||||
}
|
||||
}
|
||||
|
||||
export { isNativeFetch, supportsDOMError, supportsDOMException, supportsErrorEvent, supportsFetch, supportsNativeFetch, supportsReferrerPolicy, supportsReportingObserver };
|
||||
//# sourceMappingURL=supports.js.map
|
||||
191
shared/logger/node_modules/@sentry/utils/esm/syncpromise.js
generated
vendored
Normal file
191
shared/logger/node_modules/@sentry/utils/esm/syncpromise.js
generated
vendored
Normal file
@@ -0,0 +1,191 @@
|
||||
import { isThenable } from './is.js';
|
||||
|
||||
/* eslint-disable @typescript-eslint/explicit-function-return-type */
|
||||
|
||||
/** SyncPromise internal states */
|
||||
var States; (function (States) {
|
||||
/** Pending */
|
||||
const PENDING = 0; States[States["PENDING"] = PENDING] = "PENDING";
|
||||
/** Resolved / OK */
|
||||
const RESOLVED = 1; States[States["RESOLVED"] = RESOLVED] = "RESOLVED";
|
||||
/** Rejected / Error */
|
||||
const REJECTED = 2; States[States["REJECTED"] = REJECTED] = "REJECTED";
|
||||
})(States || (States = {}));
|
||||
|
||||
// Overloads so we can call resolvedSyncPromise without arguments and generic argument
|
||||
|
||||
/**
|
||||
* Creates a resolved sync promise.
|
||||
*
|
||||
* @param value the value to resolve the promise with
|
||||
* @returns the resolved sync promise
|
||||
*/
|
||||
function resolvedSyncPromise(value) {
|
||||
return new SyncPromise(resolve => {
|
||||
resolve(value);
|
||||
});
|
||||
}
|
||||
|
||||
/**
|
||||
* Creates a rejected sync promise.
|
||||
*
|
||||
* @param value the value to reject the promise with
|
||||
* @returns the rejected sync promise
|
||||
*/
|
||||
function rejectedSyncPromise(reason) {
|
||||
return new SyncPromise((_, reject) => {
|
||||
reject(reason);
|
||||
});
|
||||
}
|
||||
|
||||
/**
|
||||
* Thenable class that behaves like a Promise and follows it's interface
|
||||
* but is not async internally
|
||||
*/
|
||||
class SyncPromise {
|
||||
__init() {this._state = States.PENDING;}
|
||||
__init2() {this._handlers = [];}
|
||||
|
||||
constructor(
|
||||
executor,
|
||||
) {SyncPromise.prototype.__init.call(this);SyncPromise.prototype.__init2.call(this);SyncPromise.prototype.__init3.call(this);SyncPromise.prototype.__init4.call(this);SyncPromise.prototype.__init5.call(this);SyncPromise.prototype.__init6.call(this);
|
||||
try {
|
||||
executor(this._resolve, this._reject);
|
||||
} catch (e) {
|
||||
this._reject(e);
|
||||
}
|
||||
}
|
||||
|
||||
/** JSDoc */
|
||||
then(
|
||||
onfulfilled,
|
||||
onrejected,
|
||||
) {
|
||||
return new SyncPromise((resolve, reject) => {
|
||||
this._handlers.push([
|
||||
false,
|
||||
result => {
|
||||
if (!onfulfilled) {
|
||||
// TODO: ¯\_(ツ)_/¯
|
||||
// TODO: FIXME
|
||||
resolve(result );
|
||||
} else {
|
||||
try {
|
||||
resolve(onfulfilled(result));
|
||||
} catch (e) {
|
||||
reject(e);
|
||||
}
|
||||
}
|
||||
},
|
||||
reason => {
|
||||
if (!onrejected) {
|
||||
reject(reason);
|
||||
} else {
|
||||
try {
|
||||
resolve(onrejected(reason));
|
||||
} catch (e) {
|
||||
reject(e);
|
||||
}
|
||||
}
|
||||
},
|
||||
]);
|
||||
this._executeHandlers();
|
||||
});
|
||||
}
|
||||
|
||||
/** JSDoc */
|
||||
catch(
|
||||
onrejected,
|
||||
) {
|
||||
return this.then(val => val, onrejected);
|
||||
}
|
||||
|
||||
/** JSDoc */
|
||||
finally(onfinally) {
|
||||
return new SyncPromise((resolve, reject) => {
|
||||
let val;
|
||||
let isRejected;
|
||||
|
||||
return this.then(
|
||||
value => {
|
||||
isRejected = false;
|
||||
val = value;
|
||||
if (onfinally) {
|
||||
onfinally();
|
||||
}
|
||||
},
|
||||
reason => {
|
||||
isRejected = true;
|
||||
val = reason;
|
||||
if (onfinally) {
|
||||
onfinally();
|
||||
}
|
||||
},
|
||||
).then(() => {
|
||||
if (isRejected) {
|
||||
reject(val);
|
||||
return;
|
||||
}
|
||||
|
||||
resolve(val );
|
||||
});
|
||||
});
|
||||
}
|
||||
|
||||
/** JSDoc */
|
||||
__init3() {this._resolve = (value) => {
|
||||
this._setResult(States.RESOLVED, value);
|
||||
};}
|
||||
|
||||
/** JSDoc */
|
||||
__init4() {this._reject = (reason) => {
|
||||
this._setResult(States.REJECTED, reason);
|
||||
};}
|
||||
|
||||
/** JSDoc */
|
||||
__init5() {this._setResult = (state, value) => {
|
||||
if (this._state !== States.PENDING) {
|
||||
return;
|
||||
}
|
||||
|
||||
if (isThenable(value)) {
|
||||
void (value ).then(this._resolve, this._reject);
|
||||
return;
|
||||
}
|
||||
|
||||
this._state = state;
|
||||
this._value = value;
|
||||
|
||||
this._executeHandlers();
|
||||
};}
|
||||
|
||||
/** JSDoc */
|
||||
__init6() {this._executeHandlers = () => {
|
||||
if (this._state === States.PENDING) {
|
||||
return;
|
||||
}
|
||||
|
||||
const cachedHandlers = this._handlers.slice();
|
||||
this._handlers = [];
|
||||
|
||||
cachedHandlers.forEach(handler => {
|
||||
if (handler[0]) {
|
||||
return;
|
||||
}
|
||||
|
||||
if (this._state === States.RESOLVED) {
|
||||
// eslint-disable-next-line @typescript-eslint/no-floating-promises
|
||||
handler[1](this._value );
|
||||
}
|
||||
|
||||
if (this._state === States.REJECTED) {
|
||||
handler[2](this._value);
|
||||
}
|
||||
|
||||
handler[0] = true;
|
||||
});
|
||||
};}
|
||||
}
|
||||
|
||||
export { SyncPromise, rejectedSyncPromise, resolvedSyncPromise };
|
||||
//# sourceMappingURL=syncpromise.js.map
|
||||
183
shared/logger/node_modules/@sentry/utils/esm/time.js
generated
vendored
Normal file
183
shared/logger/node_modules/@sentry/utils/esm/time.js
generated
vendored
Normal file
@@ -0,0 +1,183 @@
|
||||
import { isNodeEnv, dynamicRequire } from './node.js';
|
||||
import { getGlobalObject } from './worldwide.js';
|
||||
|
||||
// eslint-disable-next-line deprecation/deprecation
|
||||
const WINDOW = getGlobalObject();
|
||||
|
||||
/**
|
||||
* An object that can return the current timestamp in seconds since the UNIX epoch.
|
||||
*/
|
||||
|
||||
/**
|
||||
* A TimestampSource implementation for environments that do not support the Performance Web API natively.
|
||||
*
|
||||
* Note that this TimestampSource does not use a monotonic clock. A call to `nowSeconds` may return a timestamp earlier
|
||||
* than a previously returned value. We do not try to emulate a monotonic behavior in order to facilitate debugging. It
|
||||
* is more obvious to explain "why does my span have negative duration" than "why my spans have zero duration".
|
||||
*/
|
||||
const dateTimestampSource = {
|
||||
nowSeconds: () => Date.now() / 1000,
|
||||
};
|
||||
|
||||
/**
|
||||
* A partial definition of the [Performance Web API]{@link https://developer.mozilla.org/en-US/docs/Web/API/Performance}
|
||||
* for accessing a high-resolution monotonic clock.
|
||||
*/
|
||||
|
||||
/**
|
||||
* Returns a wrapper around the native Performance API browser implementation, or undefined for browsers that do not
|
||||
* support the API.
|
||||
*
|
||||
* Wrapping the native API works around differences in behavior from different browsers.
|
||||
*/
|
||||
function getBrowserPerformance() {
|
||||
const { performance } = WINDOW;
|
||||
if (!performance || !performance.now) {
|
||||
return undefined;
|
||||
}
|
||||
|
||||
// Replace performance.timeOrigin with our own timeOrigin based on Date.now().
|
||||
//
|
||||
// This is a partial workaround for browsers reporting performance.timeOrigin such that performance.timeOrigin +
|
||||
// performance.now() gives a date arbitrarily in the past.
|
||||
//
|
||||
// Additionally, computing timeOrigin in this way fills the gap for browsers where performance.timeOrigin is
|
||||
// undefined.
|
||||
//
|
||||
// The assumption that performance.timeOrigin + performance.now() ~= Date.now() is flawed, but we depend on it to
|
||||
// interact with data coming out of performance entries.
|
||||
//
|
||||
// Note that despite recommendations against it in the spec, browsers implement the Performance API with a clock that
|
||||
// might stop when the computer is asleep (and perhaps under other circumstances). Such behavior causes
|
||||
// performance.timeOrigin + performance.now() to have an arbitrary skew over Date.now(). In laptop computers, we have
|
||||
// observed skews that can be as long as days, weeks or months.
|
||||
//
|
||||
// See https://github.com/getsentry/sentry-javascript/issues/2590.
|
||||
//
|
||||
// BUG: despite our best intentions, this workaround has its limitations. It mostly addresses timings of pageload
|
||||
// transactions, but ignores the skew built up over time that can aversely affect timestamps of navigation
|
||||
// transactions of long-lived web pages.
|
||||
const timeOrigin = Date.now() - performance.now();
|
||||
|
||||
return {
|
||||
now: () => performance.now(),
|
||||
timeOrigin,
|
||||
};
|
||||
}
|
||||
|
||||
/**
|
||||
* Returns the native Performance API implementation from Node.js. Returns undefined in old Node.js versions that don't
|
||||
* implement the API.
|
||||
*/
|
||||
function getNodePerformance() {
|
||||
try {
|
||||
const perfHooks = dynamicRequire(module, 'perf_hooks') ;
|
||||
return perfHooks.performance;
|
||||
} catch (_) {
|
||||
return undefined;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* The Performance API implementation for the current platform, if available.
|
||||
*/
|
||||
const platformPerformance = isNodeEnv() ? getNodePerformance() : getBrowserPerformance();
|
||||
|
||||
const timestampSource =
|
||||
platformPerformance === undefined
|
||||
? dateTimestampSource
|
||||
: {
|
||||
nowSeconds: () => (platformPerformance.timeOrigin + platformPerformance.now()) / 1000,
|
||||
};
|
||||
|
||||
/**
|
||||
* Returns a timestamp in seconds since the UNIX epoch using the Date API.
|
||||
*/
|
||||
const dateTimestampInSeconds = dateTimestampSource.nowSeconds.bind(dateTimestampSource);
|
||||
|
||||
/**
|
||||
* Returns a timestamp in seconds since the UNIX epoch using either the Performance or Date APIs, depending on the
|
||||
* availability of the Performance API.
|
||||
*
|
||||
* See `usingPerformanceAPI` to test whether the Performance API is used.
|
||||
*
|
||||
* BUG: Note that because of how browsers implement the Performance API, the clock might stop when the computer is
|
||||
* asleep. This creates a skew between `dateTimestampInSeconds` and `timestampInSeconds`. The
|
||||
* skew can grow to arbitrary amounts like days, weeks or months.
|
||||
* See https://github.com/getsentry/sentry-javascript/issues/2590.
|
||||
*/
|
||||
const timestampInSeconds = timestampSource.nowSeconds.bind(timestampSource);
|
||||
|
||||
/**
|
||||
* Re-exported with an old name for backwards-compatibility.
|
||||
* TODO (v8): Remove this
|
||||
*
|
||||
* @deprecated Use `timestampInSeconds` instead.
|
||||
*/
|
||||
const timestampWithMs = timestampInSeconds;
|
||||
|
||||
/**
|
||||
* A boolean that is true when timestampInSeconds uses the Performance API to produce monotonic timestamps.
|
||||
*/
|
||||
const usingPerformanceAPI = platformPerformance !== undefined;
|
||||
|
||||
/**
|
||||
* Internal helper to store what is the source of browserPerformanceTimeOrigin below. For debugging only.
|
||||
*/
|
||||
let _browserPerformanceTimeOriginMode;
|
||||
|
||||
/**
|
||||
* The number of milliseconds since the UNIX epoch. This value is only usable in a browser, and only when the
|
||||
* performance API is available.
|
||||
*/
|
||||
const browserPerformanceTimeOrigin = (() => {
|
||||
// Unfortunately browsers may report an inaccurate time origin data, through either performance.timeOrigin or
|
||||
// performance.timing.navigationStart, which results in poor results in performance data. We only treat time origin
|
||||
// data as reliable if they are within a reasonable threshold of the current time.
|
||||
|
||||
const { performance } = WINDOW;
|
||||
if (!performance || !performance.now) {
|
||||
_browserPerformanceTimeOriginMode = 'none';
|
||||
return undefined;
|
||||
}
|
||||
|
||||
const threshold = 3600 * 1000;
|
||||
const performanceNow = performance.now();
|
||||
const dateNow = Date.now();
|
||||
|
||||
// if timeOrigin isn't available set delta to threshold so it isn't used
|
||||
const timeOriginDelta = performance.timeOrigin
|
||||
? Math.abs(performance.timeOrigin + performanceNow - dateNow)
|
||||
: threshold;
|
||||
const timeOriginIsReliable = timeOriginDelta < threshold;
|
||||
|
||||
// While performance.timing.navigationStart is deprecated in favor of performance.timeOrigin, performance.timeOrigin
|
||||
// is not as widely supported. Namely, performance.timeOrigin is undefined in Safari as of writing.
|
||||
// Also as of writing, performance.timing is not available in Web Workers in mainstream browsers, so it is not always
|
||||
// a valid fallback. In the absence of an initial time provided by the browser, fallback to the current time from the
|
||||
// Date API.
|
||||
// eslint-disable-next-line deprecation/deprecation
|
||||
const navigationStart = performance.timing && performance.timing.navigationStart;
|
||||
const hasNavigationStart = typeof navigationStart === 'number';
|
||||
// if navigationStart isn't available set delta to threshold so it isn't used
|
||||
const navigationStartDelta = hasNavigationStart ? Math.abs(navigationStart + performanceNow - dateNow) : threshold;
|
||||
const navigationStartIsReliable = navigationStartDelta < threshold;
|
||||
|
||||
if (timeOriginIsReliable || navigationStartIsReliable) {
|
||||
// Use the more reliable time origin
|
||||
if (timeOriginDelta <= navigationStartDelta) {
|
||||
_browserPerformanceTimeOriginMode = 'timeOrigin';
|
||||
return performance.timeOrigin;
|
||||
} else {
|
||||
_browserPerformanceTimeOriginMode = 'navigationStart';
|
||||
return navigationStart;
|
||||
}
|
||||
}
|
||||
|
||||
// Either both timeOrigin and navigationStart are skewed or neither is available, fallback to Date.
|
||||
_browserPerformanceTimeOriginMode = 'dateNow';
|
||||
return dateNow;
|
||||
})();
|
||||
|
||||
export { _browserPerformanceTimeOriginMode, browserPerformanceTimeOrigin, dateTimestampInSeconds, timestampInSeconds, timestampWithMs, usingPerformanceAPI };
|
||||
//# sourceMappingURL=time.js.map
|
||||
39
shared/logger/node_modules/@sentry/utils/esm/tracing.js
generated
vendored
Normal file
39
shared/logger/node_modules/@sentry/utils/esm/tracing.js
generated
vendored
Normal file
@@ -0,0 +1,39 @@
|
||||
const TRACEPARENT_REGEXP = new RegExp(
|
||||
'^[ \\t]*' + // whitespace
|
||||
'([0-9a-f]{32})?' + // trace_id
|
||||
'-?([0-9a-f]{16})?' + // span_id
|
||||
'-?([01])?' + // sampled
|
||||
'[ \\t]*$', // whitespace
|
||||
);
|
||||
|
||||
/**
|
||||
* Extract transaction context data from a `sentry-trace` header.
|
||||
*
|
||||
* @param traceparent Traceparent string
|
||||
*
|
||||
* @returns Object containing data from the header, or undefined if traceparent string is malformed
|
||||
*/
|
||||
function extractTraceparentData(traceparent) {
|
||||
const matches = traceparent.match(TRACEPARENT_REGEXP);
|
||||
|
||||
if (!traceparent || !matches) {
|
||||
// empty string or no matches is invalid traceparent data
|
||||
return undefined;
|
||||
}
|
||||
|
||||
let parentSampled;
|
||||
if (matches[3] === '1') {
|
||||
parentSampled = true;
|
||||
} else if (matches[3] === '0') {
|
||||
parentSampled = false;
|
||||
}
|
||||
|
||||
return {
|
||||
traceId: matches[1],
|
||||
parentSampled,
|
||||
parentSpanId: matches[2],
|
||||
};
|
||||
}
|
||||
|
||||
export { TRACEPARENT_REGEXP, extractTraceparentData };
|
||||
//# sourceMappingURL=tracing.js.map
|
||||
72
shared/logger/node_modules/@sentry/utils/esm/url.js
generated
vendored
Normal file
72
shared/logger/node_modules/@sentry/utils/esm/url.js
generated
vendored
Normal file
@@ -0,0 +1,72 @@
|
||||
/**
|
||||
* Parses string form of URL into an object
|
||||
* // borrowed from https://tools.ietf.org/html/rfc3986#appendix-B
|
||||
* // intentionally using regex and not <a/> href parsing trick because React Native and other
|
||||
* // environments where DOM might not be available
|
||||
* @returns parsed URL object
|
||||
*/
|
||||
function parseUrl(url) {
|
||||
if (!url) {
|
||||
return {};
|
||||
}
|
||||
|
||||
const match = url.match(/^(([^:/?#]+):)?(\/\/([^/?#]*))?([^?#]*)(\?([^#]*))?(#(.*))?$/);
|
||||
|
||||
if (!match) {
|
||||
return {};
|
||||
}
|
||||
|
||||
// coerce to undefined values to empty string so we don't get 'undefined'
|
||||
const query = match[6] || '';
|
||||
const fragment = match[8] || '';
|
||||
return {
|
||||
host: match[4],
|
||||
path: match[5],
|
||||
protocol: match[2],
|
||||
search: query,
|
||||
hash: fragment,
|
||||
relative: match[5] + query + fragment, // everything minus origin
|
||||
};
|
||||
}
|
||||
|
||||
/**
|
||||
* Strip the query string and fragment off of a given URL or path (if present)
|
||||
*
|
||||
* @param urlPath Full URL or path, including possible query string and/or fragment
|
||||
* @returns URL or path without query string or fragment
|
||||
*/
|
||||
function stripUrlQueryAndFragment(urlPath) {
|
||||
// eslint-disable-next-line no-useless-escape
|
||||
return urlPath.split(/[\?#]/, 1)[0];
|
||||
}
|
||||
|
||||
/**
|
||||
* Returns number of URL segments of a passed string URL.
|
||||
*/
|
||||
function getNumberOfUrlSegments(url) {
|
||||
// split at '/' or at '\/' to split regex urls correctly
|
||||
return url.split(/\\?\//).filter(s => s.length > 0 && s !== ',').length;
|
||||
}
|
||||
|
||||
/**
|
||||
* Takes a URL object and returns a sanitized string which is safe to use as span description
|
||||
* see: https://develop.sentry.dev/sdk/data-handling/#structuring-data
|
||||
*/
|
||||
function getSanitizedUrlString(url) {
|
||||
const { protocol, host, path } = url;
|
||||
|
||||
const filteredHost =
|
||||
(host &&
|
||||
host
|
||||
// Always filter out authority
|
||||
.replace(/^.*@/, '[filtered]:[filtered]@')
|
||||
// Don't show standard :80 (http) and :443 (https) ports to reduce the noise
|
||||
.replace(':80', '')
|
||||
.replace(':443', '')) ||
|
||||
'';
|
||||
|
||||
return `${protocol ? `${protocol}://` : ''}${filteredHost}${path}`;
|
||||
}
|
||||
|
||||
export { getNumberOfUrlSegments, getSanitizedUrlString, parseUrl, stripUrlQueryAndFragment };
|
||||
//# sourceMappingURL=url.js.map
|
||||
29
shared/logger/node_modules/@sentry/utils/esm/vendor/supportsHistory.js
generated
vendored
Normal file
29
shared/logger/node_modules/@sentry/utils/esm/vendor/supportsHistory.js
generated
vendored
Normal file
@@ -0,0 +1,29 @@
|
||||
import { getGlobalObject } from '../worldwide.js';
|
||||
|
||||
// Based on https://github.com/angular/angular.js/pull/13945/files
|
||||
|
||||
// eslint-disable-next-line deprecation/deprecation
|
||||
const WINDOW = getGlobalObject();
|
||||
|
||||
/**
|
||||
* Tells whether current environment supports History API
|
||||
* {@link supportsHistory}.
|
||||
*
|
||||
* @returns Answer to the given question.
|
||||
*/
|
||||
function supportsHistory() {
|
||||
// NOTE: in Chrome App environment, touching history.pushState, *even inside
|
||||
// a try/catch block*, will cause Chrome to output an error to console.error
|
||||
// borrowed from: https://github.com/angular/angular.js/pull/13945/files
|
||||
/* eslint-disable @typescript-eslint/no-unsafe-member-access */
|
||||
// eslint-disable-next-line @typescript-eslint/no-explicit-any
|
||||
const chrome = (WINDOW ).chrome;
|
||||
const isChromePackagedApp = chrome && chrome.app && chrome.app.runtime;
|
||||
/* eslint-enable @typescript-eslint/no-unsafe-member-access */
|
||||
const hasHistoryApi = 'history' in WINDOW && !!WINDOW.history.pushState && !!WINDOW.history.replaceState;
|
||||
|
||||
return !isChromePackagedApp && hasHistoryApi;
|
||||
}
|
||||
|
||||
export { supportsHistory };
|
||||
//# sourceMappingURL=supportsHistory.js.map
|
||||
70
shared/logger/node_modules/@sentry/utils/esm/worldwide.js
generated
vendored
Normal file
70
shared/logger/node_modules/@sentry/utils/esm/worldwide.js
generated
vendored
Normal file
@@ -0,0 +1,70 @@
|
||||
/** Internal global with common properties and Sentry extensions */
|
||||
|
||||
// The code below for 'isGlobalObj' and 'GLOBAL_OBJ' was copied from core-js before modification
|
||||
// https://github.com/zloirock/core-js/blob/1b944df55282cdc99c90db5f49eb0b6eda2cc0a3/packages/core-js/internals/global.js
|
||||
// core-js has the following licence:
|
||||
//
|
||||
// Copyright (c) 2014-2022 Denis Pushkarev
|
||||
//
|
||||
// Permission is hereby granted, free of charge, to any person obtaining a copy
|
||||
// of this software and associated documentation files (the "Software"), to deal
|
||||
// in the Software without restriction, including without limitation the rights
|
||||
// to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
|
||||
// copies of the Software, and to permit persons to whom the Software is
|
||||
// furnished to do so, subject to the following conditions:
|
||||
//
|
||||
// The above copyright notice and this permission notice shall be included in
|
||||
// all copies or substantial portions of the Software.
|
||||
//
|
||||
// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
|
||||
// IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
|
||||
// FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
|
||||
// AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
|
||||
// LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
|
||||
// OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
|
||||
// THE SOFTWARE.
|
||||
|
||||
/** Returns 'obj' if it's the global object, otherwise returns undefined */
|
||||
function isGlobalObj(obj) {
|
||||
return obj && obj.Math == Math ? obj : undefined;
|
||||
}
|
||||
|
||||
/** Get's the global object for the current JavaScript runtime */
|
||||
const GLOBAL_OBJ =
|
||||
(typeof globalThis == 'object' && isGlobalObj(globalThis)) ||
|
||||
// eslint-disable-next-line no-restricted-globals
|
||||
(typeof window == 'object' && isGlobalObj(window)) ||
|
||||
(typeof self == 'object' && isGlobalObj(self)) ||
|
||||
(typeof global == 'object' && isGlobalObj(global)) ||
|
||||
(function () {
|
||||
return this;
|
||||
})() ||
|
||||
{};
|
||||
|
||||
/**
|
||||
* @deprecated Use GLOBAL_OBJ instead or WINDOW from @sentry/browser. This will be removed in v8
|
||||
*/
|
||||
function getGlobalObject() {
|
||||
return GLOBAL_OBJ ;
|
||||
}
|
||||
|
||||
/**
|
||||
* Returns a global singleton contained in the global `__SENTRY__` object.
|
||||
*
|
||||
* If the singleton doesn't already exist in `__SENTRY__`, it will be created using the given factory
|
||||
* function and added to the `__SENTRY__` object.
|
||||
*
|
||||
* @param name name of the global singleton on __SENTRY__
|
||||
* @param creator creator Factory function to create the singleton if it doesn't already exist on `__SENTRY__`
|
||||
* @param obj (Optional) The global object on which to look for `__SENTRY__`, if not `GLOBAL_OBJ`'s return value
|
||||
* @returns the singleton
|
||||
*/
|
||||
function getGlobalSingleton(name, creator, obj) {
|
||||
const gbl = (obj || GLOBAL_OBJ) ;
|
||||
const __SENTRY__ = (gbl.__SENTRY__ = gbl.__SENTRY__ || {});
|
||||
const singleton = __SENTRY__[name] || (__SENTRY__[name] = creator());
|
||||
return singleton;
|
||||
}
|
||||
|
||||
export { GLOBAL_OBJ, getGlobalObject, getGlobalSingleton };
|
||||
//# sourceMappingURL=worldwide.js.map
|
||||
Reference in New Issue
Block a user